diff --git a/.prettierignore b/.prettierignore index bff7847..fbe09a4 100644 --- a/.prettierignore +++ b/.prettierignore @@ -6,4 +6,5 @@ .env* sentry* package.json -node_modules \ No newline at end of file +node_modules +/public/docs diff --git a/build_docs_gh_workflow.sh b/build_docs_gh_workflow.sh index 7706be1..ec22321 100644 --- a/build_docs_gh_workflow.sh +++ b/build_docs_gh_workflow.sh @@ -1,8 +1,8 @@ #!/bin/bash cd ./docs/ npm install -g vitepress - bunx vitepress build - cd .. - cp -R ./docs/.vitepress/dist/ ./public/docs/ - echo "Done :)" - exit 1 +bunx vitepress build +cd .. +cp -R ./docs/.vitepress/dist/ ./public/docs/ +echo "Done :)" +exit 1 diff --git a/public/docs/404.html b/public/docs/404.html index ec9f352..c654053 100644 --- a/public/docs/404.html +++ b/public/docs/404.html @@ -1,22 +1,50 @@ - + - - + + 404 | News Analzye Docs - - - - - + + + + + - - - + + +
- - + - \ No newline at end of file + diff --git a/public/docs/api-examples.html b/public/docs/api-examples.html index 9bf36ee..efdf83f 100644 --- a/public/docs/api-examples.html +++ b/public/docs/api-examples.html @@ -1,24 +1,446 @@ - + - - + + Runtime API Examples | News Analzye Docs - - - - - + + + + + - - - - - - + + + + + + -
News Analzye Docs

Appearance

Runtime API Examples ​

This page demonstrates usage of some of the runtime APIs provided by VitePress.

The main useData() API can be used to access site, theme, and page data for the current page. It works in both .md and .vue files:

md
<script setup>
+    

+      

+        
+        

+          

+            

+              

+                

+                  

+                    News Analzye Docs
+                  

+                

+                

+                  

+                    
+                    

+                      
+                    

+                    
+                    
+                    

+                      
+                    

+                    
+                    

+                      
+                      

+                        

+                          
+                          

+                            

+                              
Appearance

+                              

+                                
+                              

+                            

+                          

+                          

+                            
+                          

+                          
+                        

+                      

+                    

+                    
+                  

+                

+              

+            

+            

+              

+            

+          

+          
+        

+        

+          

+            
+            

+              
+            

+          

+        

+        
+        

+          

+            
+            

+              

+                

+                

+                  

+                    

+                      
+                      
+                      
+                      

+                      
+                    

+                  

+                

+              

+              

+                

+                  
+                  

+                    

+                      

+                        

+                          Runtime API Examples
+                          ​
+                        

+                        

+                          This page demonstrates usage of some of the runtime
+                          APIs provided by VitePress.
+                        

+                        

+                          The main useData() API can be used to
+                          access site, theme, and page data for the current
+                          page. It works in both .md and
+                          .vue files:
+                        

+                        

+                          md
+                          
<script setup>
 import { useData } from 'vitepress'
 
 const { theme, page, frontmatter } = useData()
@@ -33,7 +455,28 @@
 <pre>{{ page }}</pre>
 
 ### Page Frontmatter
-<pre>{{ frontmatter }}</pre>
Results ​
Theme Data ​
{
+<pre>{{ frontmatter }}</pre>

+                        

+                        

+                          Results
+                          ​
+                        

+                        

+                          Theme Data
+                          ​
+                        

+                        
+{
   "nav": [
     {
       "text": "Home",
@@ -65,7 +508,19 @@
       "link": "https://github.com/vuejs/vitepress"
     }
   ]
-}
Page Data ​
{
+}

+                        

+                          Page Data
+                          ​
+                        

+                        
+{
   "title": "Runtime API Examples",
   "description": "",
   "frontmatter": {
@@ -74,10 +529,88 @@
   "headers": [],
   "relativePath": "api-examples.md",
   "filePath": "api-examples.md"
-}
Page Frontmatter ​
{
+}

+                        

+                          Page Frontmatter
+                          ​
+                        

+                        
+{
   "outline": "deep"
-}
More ​
Check out the documentation for the full list of runtime APIs.
- - +} +

+ More + ​ +

+

+ Check out the documentation for the + full list of runtime APIs. +

+ + + + + + + + + + + + + + + - \ No newline at end of file + diff --git a/public/docs/assets/api-examples.md.B5cbNgMl.js b/public/docs/assets/api-examples.md.B5cbNgMl.js index ae1fe82..83a83da 100644 --- a/public/docs/assets/api-examples.md.B5cbNgMl.js +++ b/public/docs/assets/api-examples.md.B5cbNgMl.js @@ -1,4 +1,26 @@ -import{u as p,c as h,o,ae as d,j as a,t,k as i,a as s}from"./chunks/framework.WowTybjF.js";const f=JSON.parse('{"title":"Runtime API Examples","description":"","frontmatter":{"outline":"deep"},"headers":[],"relativePath":"api-examples.md","filePath":"api-examples.md"}'),m={name:"api-examples.md"},E=Object.assign(m,{setup(k){const{site:g,theme:n,page:l,frontmatter:r}=p();return(c,e)=>(o(),h("div",null,[e[0]||(e[0]=d(`

Runtime API Examples ​

This page demonstrates usage of some of the runtime APIs provided by VitePress.

The main useData() API can be used to access site, theme, and page data for the current page. It works in both .md and .vue files:

md
<script setup>
+import {
+  u as p,
+  c as h,
+  o,
+  ae as d,
+  j as a,
+  t,
+  k as i,
+  a as s,
+} from "./chunks/framework.WowTybjF.js";
+const f = JSON.parse(
+    '{"title":"Runtime API Examples","description":"","frontmatter":{"outline":"deep"},"headers":[],"relativePath":"api-examples.md","filePath":"api-examples.md"}',
+  ),
+  m = { name: "api-examples.md" },
+  E = Object.assign(m, {
+    setup(k) {
+      const { site: g, theme: n, page: l, frontmatter: r } = p();
+      return (c, e) => (
+        o(),
+        h("div", null, [
+          e[0] ||
+            (e[0] = d(
+              `
Runtime API Examples ​
This page demonstrates usage of some of the runtime APIs provided by VitePress.
The main useData() API can be used to access site, theme, and page data for the current page. It works in both .md and .vue files:
md
<script setup>
 import { useData } from 'vitepress'
 
 const { theme, page, frontmatter } = useData()
@@ -13,4 +35,87 @@ import{u as p,c as h,o,ae as d,j as a,t,k as i,a as s}from"./chunks/framework.Wo
 <pre>{{ page }}</pre>
 
 ### Page Frontmatter
-<pre>{{ frontmatter }}</pre>
Results ​
Theme Data ​
`,6)),a("pre",null,t(i(n)),1),e[1]||(e[1]=a("h3",{id:"page-data",tabindex:"-1"},[s("Page Data "),a("a",{class:"header-anchor",href:"#page-data","aria-label":'Permalink to "Page Data"'},"​")],-1)),a("pre",null,t(i(l)),1),e[2]||(e[2]=a("h3",{id:"page-frontmatter",tabindex:"-1"},[s("Page Frontmatter "),a("a",{class:"header-anchor",href:"#page-frontmatter","aria-label":'Permalink to "Page Frontmatter"'},"​")],-1)),a("pre",null,t(i(r)),1),e[3]||(e[3]=a("h2",{id:"more",tabindex:"-1"},[s("More "),a("a",{class:"header-anchor",href:"#more","aria-label":'Permalink to "More"'},"​")],-1)),e[4]||(e[4]=a("p",null,[s("Check out the documentation for the "),a("a",{href:"https://vitepress.dev/reference/runtime-api#usedata",target:"_blank",rel:"noreferrer"},"full list of runtime APIs"),s(".")],-1))]))}});export{f as __pageData,E as default};
+<pre>{{ frontmatter }}</pre>

Results ​

Theme Data ​

`, + 6, + )), + a("pre", null, t(i(n)), 1), + e[1] || + (e[1] = a( + "h3", + { id: "page-data", tabindex: "-1" }, + [ + s("Page Data "), + a( + "a", + { + class: "header-anchor", + href: "#page-data", + "aria-label": 'Permalink to "Page Data"', + }, + "​", + ), + ], + -1, + )), + a("pre", null, t(i(l)), 1), + e[2] || + (e[2] = a( + "h3", + { id: "page-frontmatter", tabindex: "-1" }, + [ + s("Page Frontmatter "), + a( + "a", + { + class: "header-anchor", + href: "#page-frontmatter", + "aria-label": 'Permalink to "Page Frontmatter"', + }, + "​", + ), + ], + -1, + )), + a("pre", null, t(i(r)), 1), + e[3] || + (e[3] = a( + "h2", + { id: "more", tabindex: "-1" }, + [ + s("More "), + a( + "a", + { + class: "header-anchor", + href: "#more", + "aria-label": 'Permalink to "More"', + }, + "​", + ), + ], + -1, + )), + e[4] || + (e[4] = a( + "p", + null, + [ + s("Check out the documentation for the "), + a( + "a", + { + href: "https://vitepress.dev/reference/runtime-api#usedata", + target: "_blank", + rel: "noreferrer", + }, + "full list of runtime APIs", + ), + s("."), + ], + -1, + )), + ]) + ); + }, + }); +export { f as __pageData, E as default }; diff --git a/public/docs/assets/api-examples.md.B5cbNgMl.lean.js b/public/docs/assets/api-examples.md.B5cbNgMl.lean.js index f6e5f2e..776f252 100644 --- a/public/docs/assets/api-examples.md.B5cbNgMl.lean.js +++ b/public/docs/assets/api-examples.md.B5cbNgMl.lean.js @@ -1 +1,102 @@ -import{u as p,c as h,o,ae as d,j as a,t,k as i,a as s}from"./chunks/framework.WowTybjF.js";const f=JSON.parse('{"title":"Runtime API Examples","description":"","frontmatter":{"outline":"deep"},"headers":[],"relativePath":"api-examples.md","filePath":"api-examples.md"}'),m={name:"api-examples.md"},E=Object.assign(m,{setup(k){const{site:g,theme:n,page:l,frontmatter:r}=p();return(c,e)=>(o(),h("div",null,[e[0]||(e[0]=d("",6)),a("pre",null,t(i(n)),1),e[1]||(e[1]=a("h3",{id:"page-data",tabindex:"-1"},[s("Page Data "),a("a",{class:"header-anchor",href:"#page-data","aria-label":'Permalink to "Page Data"'},"​")],-1)),a("pre",null,t(i(l)),1),e[2]||(e[2]=a("h3",{id:"page-frontmatter",tabindex:"-1"},[s("Page Frontmatter "),a("a",{class:"header-anchor",href:"#page-frontmatter","aria-label":'Permalink to "Page Frontmatter"'},"​")],-1)),a("pre",null,t(i(r)),1),e[3]||(e[3]=a("h2",{id:"more",tabindex:"-1"},[s("More "),a("a",{class:"header-anchor",href:"#more","aria-label":'Permalink to "More"'},"​")],-1)),e[4]||(e[4]=a("p",null,[s("Check out the documentation for the "),a("a",{href:"https://vitepress.dev/reference/runtime-api#usedata",target:"_blank",rel:"noreferrer"},"full list of runtime APIs"),s(".")],-1))]))}});export{f as __pageData,E as default}; +import { + u as p, + c as h, + o, + ae as d, + j as a, + t, + k as i, + a as s, +} from "./chunks/framework.WowTybjF.js"; +const f = JSON.parse( + '{"title":"Runtime API Examples","description":"","frontmatter":{"outline":"deep"},"headers":[],"relativePath":"api-examples.md","filePath":"api-examples.md"}', + ), + m = { name: "api-examples.md" }, + E = Object.assign(m, { + setup(k) { + const { site: g, theme: n, page: l, frontmatter: r } = p(); + return (c, e) => ( + o(), + h("div", null, [ + e[0] || (e[0] = d("", 6)), + a("pre", null, t(i(n)), 1), + e[1] || + (e[1] = a( + "h3", + { id: "page-data", tabindex: "-1" }, + [ + s("Page Data "), + a( + "a", + { + class: "header-anchor", + href: "#page-data", + "aria-label": 'Permalink to "Page Data"', + }, + "​", + ), + ], + -1, + )), + a("pre", null, t(i(l)), 1), + e[2] || + (e[2] = a( + "h3", + { id: "page-frontmatter", tabindex: "-1" }, + [ + s("Page Frontmatter "), + a( + "a", + { + class: "header-anchor", + href: "#page-frontmatter", + "aria-label": 'Permalink to "Page Frontmatter"', + }, + "​", + ), + ], + -1, + )), + a("pre", null, t(i(r)), 1), + e[3] || + (e[3] = a( + "h2", + { id: "more", tabindex: "-1" }, + [ + s("More "), + a( + "a", + { + class: "header-anchor", + href: "#more", + "aria-label": 'Permalink to "More"', + }, + "​", + ), + ], + -1, + )), + e[4] || + (e[4] = a( + "p", + null, + [ + s("Check out the documentation for the "), + a( + "a", + { + href: "https://vitepress.dev/reference/runtime-api#usedata", + target: "_blank", + rel: "noreferrer", + }, + "full list of runtime APIs", + ), + s("."), + ], + -1, + )), + ]) + ); + }, + }); +export { f as __pageData, E as default }; diff --git a/public/docs/assets/app.Da36Cfp3.js b/public/docs/assets/app.Da36Cfp3.js index 8cdaf01..4988e0f 100644 --- a/public/docs/assets/app.Da36Cfp3.js +++ b/public/docs/assets/app.Da36Cfp3.js @@ -1 +1,104 @@ -import{t as p}from"./chunks/theme.u6X5xXdX.js";import{R as s,a0 as i,a1 as u,a2 as c,a3 as l,a4 as f,a5 as d,a6 as m,a7 as h,a8 as g,a9 as A,d as v,u as y,v as C,s as P,aa as b,ab as w,ac as R,ad as E}from"./chunks/framework.WowTybjF.js";function r(e){if(e.extends){const a=r(e.extends);return{...a,...e,async enhanceApp(t){a.enhanceApp&&await a.enhanceApp(t),e.enhanceApp&&await e.enhanceApp(t)}}}return e}const n=r(p),S=v({name:"VitePressApp",setup(){const{site:e,lang:a,dir:t}=y();return C(()=>{P(()=>{document.documentElement.lang=a.value,document.documentElement.dir=t.value})}),e.value.router.prefetchLinks&&b(),w(),R(),n.setup&&n.setup(),()=>E(n.Layout)}});async function T(){globalThis.__VITEPRESS__=!0;const e=_(),a=D();a.provide(u,e);const t=c(e.route);return a.provide(l,t),a.component("Content",f),a.component("ClientOnly",d),Object.defineProperties(a.config.globalProperties,{$frontmatter:{get(){return t.frontmatter.value}},$params:{get(){return t.page.value.params}}}),n.enhanceApp&&await n.enhanceApp({app:a,router:e,siteData:m}),{app:a,router:e,data:t}}function D(){return A(S)}function _(){let e=s;return h(a=>{let t=g(a),o=null;return t&&(e&&(t=t.replace(/\.js$/,".lean.js")),o=import(t)),s&&(e=!1),o},n.NotFound)}s&&T().then(({app:e,router:a,data:t})=>{a.go().then(()=>{i(a.route,t.site),e.mount("#app")})});export{T as createApp}; +import { t as p } from "./chunks/theme.u6X5xXdX.js"; +import { + R as s, + a0 as i, + a1 as u, + a2 as c, + a3 as l, + a4 as f, + a5 as d, + a6 as m, + a7 as h, + a8 as g, + a9 as A, + d as v, + u as y, + v as C, + s as P, + aa as b, + ab as w, + ac as R, + ad as E, +} from "./chunks/framework.WowTybjF.js"; +function r(e) { + if (e.extends) { + const a = r(e.extends); + return { + ...a, + ...e, + async enhanceApp(t) { + a.enhanceApp && (await a.enhanceApp(t)), + e.enhanceApp && (await e.enhanceApp(t)); + }, + }; + } + return e; +} +const n = r(p), + S = v({ + name: "VitePressApp", + setup() { + const { site: e, lang: a, dir: t } = y(); + return ( + C(() => { + P(() => { + (document.documentElement.lang = a.value), + (document.documentElement.dir = t.value); + }); + }), + e.value.router.prefetchLinks && b(), + w(), + R(), + n.setup && n.setup(), + () => E(n.Layout) + ); + }, + }); +async function T() { + globalThis.__VITEPRESS__ = !0; + const e = _(), + a = D(); + a.provide(u, e); + const t = c(e.route); + return ( + a.provide(l, t), + a.component("Content", f), + a.component("ClientOnly", d), + Object.defineProperties(a.config.globalProperties, { + $frontmatter: { + get() { + return t.frontmatter.value; + }, + }, + $params: { + get() { + return t.page.value.params; + }, + }, + }), + n.enhanceApp && (await n.enhanceApp({ app: a, router: e, siteData: m })), + { app: a, router: e, data: t } + ); +} +function D() { + return A(S); +} +function _() { + let e = s; + return h((a) => { + let t = g(a), + o = null; + return ( + t && (e && (t = t.replace(/\.js$/, ".lean.js")), (o = import(t))), + s && (e = !1), + o + ); + }, n.NotFound); +} +s && + T().then(({ app: e, router: a, data: t }) => { + a.go().then(() => { + i(a.route, t.site), e.mount("#app"); + }); + }); +export { T as createApp }; diff --git a/public/docs/assets/chunks/framework.WowTybjF.js b/public/docs/assets/chunks/framework.WowTybjF.js index 23747ff..d81326f 100644 --- a/public/docs/assets/chunks/framework.WowTybjF.js +++ b/public/docs/assets/chunks/framework.WowTybjF.js @@ -1,18 +1,6254 @@ /** -* @vue/shared v3.5.14 -* (c) 2018-present Yuxi (Evan) You and Vue contributors -* @license MIT -**//*! #__NO_SIDE_EFFECTS__ */function Os(e){const t=Object.create(null);for(const n of e.split(","))t[n]=1;return n=>n in t}const ne={},At=[],ke=()=>{},Ao=()=>!1,Qt=e=>e.charCodeAt(0)===111&&e.charCodeAt(1)===110&&(e.charCodeAt(2)>122||e.charCodeAt(2)<97),Ms=e=>e.startsWith("onUpdate:"),ue=Object.assign,Is=(e,t)=>{const n=e.indexOf(t);n>-1&&e.splice(n,1)},Ro=Object.prototype.hasOwnProperty,Q=(e,t)=>Ro.call(e,t),B=Array.isArray,Rt=e=>On(e)==="[object Map]",Kr=e=>On(e)==="[object Set]",G=e=>typeof e=="function",oe=e=>typeof e=="string",Je=e=>typeof e=="symbol",se=e=>e!==null&&typeof e=="object",qr=e=>(se(e)||G(e))&&G(e.then)&&G(e.catch),Gr=Object.prototype.toString,On=e=>Gr.call(e),Oo=e=>On(e).slice(8,-1),Xr=e=>On(e)==="[object Object]",Ps=e=>oe(e)&&e!=="NaN"&&e[0]!=="-"&&""+parseInt(e,10)===e,Ot=Os(",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted"),Mn=e=>{const t=Object.create(null);return n=>t[n]||(t[n]=e(n))},Mo=/-(\w)/g,Ne=Mn(e=>e.replace(Mo,(t,n)=>n?n.toUpperCase():"")),Io=/\B([A-Z])/g,lt=Mn(e=>e.replace(Io,"-$1").toLowerCase()),In=Mn(e=>e.charAt(0).toUpperCase()+e.slice(1)),mn=Mn(e=>e?`on${In(e)}`:""),rt=(e,t)=>!Object.is(e,t),Gn=(e,...t)=>{for(let n=0;n{Object.defineProperty(e,t,{configurable:!0,enumerable:!1,writable:s,value:n})},Po=e=>{const t=parseFloat(e);return isNaN(t)?e:t},Lo=e=>{const t=oe(e)?Number(e):NaN;return isNaN(t)?e:t};let er;const Pn=()=>er||(er=typeof globalThis<"u"?globalThis:typeof self<"u"?self:typeof window<"u"?window:typeof global<"u"?global:{});function Ls(e){if(B(e)){const t={};for(let n=0;n{if(n){const s=n.split(Fo);s.length>1&&(t[s[0].trim()]=s[1].trim())}}),t}function Ns(e){let t="";if(oe(e))t=e;else if(B(e))for(let n=0;n!!(e&&e.__v_isRef===!0),Vo=e=>oe(e)?e:e==null?"":B(e)||se(e)&&(e.toString===Gr||!G(e.toString))?Jr(e)?Vo(e.value):JSON.stringify(e,Qr,2):String(e),Qr=(e,t)=>Jr(t)?Qr(e,t.value):Rt(t)?{[`Map(${t.size})`]:[...t.entries()].reduce((n,[s,r],i)=>(n[Xn(s,i)+" =>"]=r,n),{})}:Kr(t)?{[`Set(${t.size})`]:[...t.values()].map(n=>Xn(n))}:Je(t)?Xn(t):se(t)&&!B(t)&&!Xr(t)?String(t):t,Xn=(e,t="")=>{var n;return Je(e)?`Symbol(${(n=e.description)!=null?n:t})`:e};/** -* @vue/reactivity v3.5.14 -* (c) 2018-present Yuxi (Evan) You and Vue contributors -* @license MIT -**/let ve;class Wo{constructor(t=!1){this.detached=t,this._active=!0,this._on=0,this.effects=[],this.cleanups=[],this._isPaused=!1,this.parent=ve,!t&&ve&&(this.index=(ve.scopes||(ve.scopes=[])).push(this)-1)}get active(){return this._active}pause(){if(this._active){this._isPaused=!0;let t,n;if(this.scopes)for(t=0,n=this.scopes.length;t0&&--this._on===0&&(ve=this.prevScope,this.prevScope=void 0)}stop(t){if(this._active){this._active=!1;let n,s;for(n=0,s=this.effects.length;n0)return;if(jt){let t=jt;for(jt=void 0;t;){const n=t.next;t.next=void 0,t.flags&=-9,t=n}}let e;for(;$t;){let t=$t;for($t=void 0;t;){const n=t.next;if(t.next=void 0,t.flags&=-9,t.flags&1)try{t.trigger()}catch(s){e||(e=s)}t=n}}if(e)throw e}function si(e){for(let t=e.deps;t;t=t.nextDep)t.version=-1,t.prevActiveLink=t.dep.activeLink,t.dep.activeLink=t}function ri(e){let t,n=e.depsTail,s=n;for(;s;){const r=s.prevDep;s.version===-1?(s===n&&(n=r),Ds(s),Uo(s)):t=s,s.dep.activeLink=s.prevActiveLink,s.prevActiveLink=void 0,s=r}e.deps=t,e.depsTail=n}function ms(e){for(let t=e.deps;t;t=t.nextDep)if(t.dep.version!==t.version||t.dep.computed&&(ii(t.dep.computed)||t.dep.version!==t.version))return!0;return!!e._dirty}function ii(e){if(e.flags&4&&!(e.flags&16)||(e.flags&=-17,e.globalVersion===Ut)||(e.globalVersion=Ut,!e.isSSR&&e.flags&128&&(!e.deps&&!e._dirty||!ms(e))))return;e.flags|=2;const t=e.dep,n=te,s=He;te=e,He=!0;try{si(e);const r=e.fn(e._value);(t.version===0||rt(r,e._value))&&(e.flags|=128,e._value=r,t.version++)}catch(r){throw t.version++,r}finally{te=n,He=s,ri(e),e.flags&=-3}}function Ds(e,t=!1){const{dep:n,prevSub:s,nextSub:r}=e;if(s&&(s.nextSub=r,e.prevSub=void 0),r&&(r.prevSub=s,e.nextSub=void 0),n.subs===e&&(n.subs=s,!s&&n.computed)){n.computed.flags&=-5;for(let i=n.computed.deps;i;i=i.nextDep)Ds(i,!0)}!t&&!--n.sc&&n.map&&n.map.delete(n.key)}function Uo(e){const{prevDep:t,nextDep:n}=e;t&&(t.nextDep=n,e.prevDep=void 0),n&&(n.prevDep=t,e.nextDep=void 0)}let He=!0;const oi=[];function Ge(){oi.push(He),He=!1}function Xe(){const e=oi.pop();He=e===void 0?!0:e}function tr(e){const{cleanup:t}=e;if(e.cleanup=void 0,t){const n=te;te=void 0;try{t()}finally{te=n}}}let Ut=0;class Bo{constructor(t,n){this.sub=t,this.dep=n,this.version=n.version,this.nextDep=this.prevDep=this.nextSub=this.prevSub=this.prevActiveLink=void 0}}class Ln{constructor(t){this.computed=t,this.version=0,this.activeLink=void 0,this.subs=void 0,this.map=void 0,this.key=void 0,this.sc=0}track(t){if(!te||!He||te===this.computed)return;let n=this.activeLink;if(n===void 0||n.sub!==te)n=this.activeLink=new Bo(te,this),te.deps?(n.prevDep=te.depsTail,te.depsTail.nextDep=n,te.depsTail=n):te.deps=te.depsTail=n,li(n);else if(n.version===-1&&(n.version=this.version,n.nextDep)){const s=n.nextDep;s.prevDep=n.prevDep,n.prevDep&&(n.prevDep.nextDep=s),n.prevDep=te.depsTail,n.nextDep=void 0,te.depsTail.nextDep=n,te.depsTail=n,te.deps===n&&(te.deps=s)}return n}trigger(t){this.version++,Ut++,this.notify(t)}notify(t){Fs();try{for(let n=this.subs;n;n=n.prevSub)n.sub.notify()&&n.sub.dep.notify()}finally{Hs()}}}function li(e){if(e.dep.sc++,e.sub.flags&4){const t=e.dep.computed;if(t&&!e.dep.subs){t.flags|=20;for(let s=t.deps;s;s=s.nextDep)li(s)}const n=e.dep.subs;n!==e&&(e.prevSub=n,n&&(n.nextSub=e)),e.dep.subs=e}}const wn=new WeakMap,pt=Symbol(""),vs=Symbol(""),Bt=Symbol("");function be(e,t,n){if(He&&te){let s=wn.get(e);s||wn.set(e,s=new Map);let r=s.get(n);r||(s.set(n,r=new Ln),r.map=s,r.key=n),r.track()}}function qe(e,t,n,s,r,i){const o=wn.get(e);if(!o){Ut++;return}const l=c=>{c&&c.trigger()};if(Fs(),t==="clear")o.forEach(l);else{const c=B(e),u=c&&Ps(n);if(c&&n==="length"){const a=Number(s);o.forEach((h,v)=>{(v==="length"||v===Bt||!Je(v)&&v>=a)&&l(h)})}else switch((n!==void 0||o.has(void 0))&&l(o.get(n)),u&&l(o.get(Bt)),t){case"add":c?u&&l(o.get("length")):(l(o.get(pt)),Rt(e)&&l(o.get(vs)));break;case"delete":c||(l(o.get(pt)),Rt(e)&&l(o.get(vs)));break;case"set":Rt(e)&&l(o.get(pt));break}}Hs()}function Ko(e,t){const n=wn.get(e);return n&&n.get(t)}function Tt(e){const t=J(e);return t===e?t:(be(t,"iterate",Bt),Ie(e)?t:t.map(de))}function Nn(e){return be(e=J(e),"iterate",Bt),e}const qo={__proto__:null,[Symbol.iterator](){return zn(this,Symbol.iterator,de)},concat(...e){return Tt(this).concat(...e.map(t=>B(t)?Tt(t):t))},entries(){return zn(this,"entries",e=>(e[1]=de(e[1]),e))},every(e,t){return Ue(this,"every",e,t,void 0,arguments)},filter(e,t){return Ue(this,"filter",e,t,n=>n.map(de),arguments)},find(e,t){return Ue(this,"find",e,t,de,arguments)},findIndex(e,t){return Ue(this,"findIndex",e,t,void 0,arguments)},findLast(e,t){return Ue(this,"findLast",e,t,de,arguments)},findLastIndex(e,t){return Ue(this,"findLastIndex",e,t,void 0,arguments)},forEach(e,t){return Ue(this,"forEach",e,t,void 0,arguments)},includes(...e){return Jn(this,"includes",e)},indexOf(...e){return Jn(this,"indexOf",e)},join(e){return Tt(this).join(e)},lastIndexOf(...e){return Jn(this,"lastIndexOf",e)},map(e,t){return Ue(this,"map",e,t,void 0,arguments)},pop(){return Ft(this,"pop")},push(...e){return Ft(this,"push",e)},reduce(e,...t){return nr(this,"reduce",e,t)},reduceRight(e,...t){return nr(this,"reduceRight",e,t)},shift(){return Ft(this,"shift")},some(e,t){return Ue(this,"some",e,t,void 0,arguments)},splice(...e){return Ft(this,"splice",e)},toReversed(){return Tt(this).toReversed()},toSorted(e){return Tt(this).toSorted(e)},toSpliced(...e){return Tt(this).toSpliced(...e)},unshift(...e){return Ft(this,"unshift",e)},values(){return zn(this,"values",de)}};function zn(e,t,n){const s=Nn(e),r=s[t]();return s!==e&&!Ie(e)&&(r._next=r.next,r.next=()=>{const i=r._next();return i.value&&(i.value=n(i.value)),i}),r}const Go=Array.prototype;function Ue(e,t,n,s,r,i){const o=Nn(e),l=o!==e&&!Ie(e),c=o[t];if(c!==Go[t]){const h=c.apply(e,i);return l?de(h):h}let u=n;o!==e&&(l?u=function(h,v){return n.call(this,de(h),v,e)}:n.length>2&&(u=function(h,v){return n.call(this,h,v,e)}));const a=c.call(o,u,s);return l&&r?r(a):a}function nr(e,t,n,s){const r=Nn(e);let i=n;return r!==e&&(Ie(e)?n.length>3&&(i=function(o,l,c){return n.call(this,o,l,c,e)}):i=function(o,l,c){return n.call(this,o,de(l),c,e)}),r[t](i,...s)}function Jn(e,t,n){const s=J(e);be(s,"iterate",Bt);const r=s[t](...n);return(r===-1||r===!1)&&Vs(n[0])?(n[0]=J(n[0]),s[t](...n)):r}function Ft(e,t,n=[]){Ge(),Fs();const s=J(e)[t].apply(e,n);return Hs(),Xe(),s}const Xo=Os("__proto__,__v_isRef,__isVue"),ci=new Set(Object.getOwnPropertyNames(Symbol).filter(e=>e!=="arguments"&&e!=="caller").map(e=>Symbol[e]).filter(Je));function Yo(e){Je(e)||(e=String(e));const t=J(this);return be(t,"has",e),t.hasOwnProperty(e)}class ai{constructor(t=!1,n=!1){this._isReadonly=t,this._isShallow=n}get(t,n,s){if(n==="__v_skip")return t.__v_skip;const r=this._isReadonly,i=this._isShallow;if(n==="__v_isReactive")return!r;if(n==="__v_isReadonly")return r;if(n==="__v_isShallow")return i;if(n==="__v_raw")return s===(r?i?il:hi:i?di:ui).get(t)||Object.getPrototypeOf(t)===Object.getPrototypeOf(s)?t:void 0;const o=B(t);if(!r){let c;if(o&&(c=qo[n]))return c;if(n==="hasOwnProperty")return Yo}const l=Reflect.get(t,n,ae(t)?t:s);return(Je(n)?ci.has(n):Xo(n))||(r||be(t,"get",n),i)?l:ae(l)?o&&Ps(n)?l:l.value:se(l)?r?Fn(l):It(l):l}}class fi extends ai{constructor(t=!1){super(!1,t)}set(t,n,s,r){let i=t[n];if(!this._isShallow){const c=it(i);if(!Ie(s)&&!it(s)&&(i=J(i),s=J(s)),!B(t)&&ae(i)&&!ae(s))return c?!1:(i.value=s,!0)}const o=B(t)&&Ps(n)?Number(n)e,rn=e=>Reflect.getPrototypeOf(e);function el(e,t,n){return function(...s){const r=this.__v_raw,i=J(r),o=Rt(i),l=e==="entries"||e===Symbol.iterator&&o,c=e==="keys"&&o,u=r[e](...s),a=n?ys:t?Sn:de;return!t&&be(i,"iterate",c?vs:pt),{next(){const{value:h,done:v}=u.next();return v?{value:h,done:v}:{value:l?[a(h[0]),a(h[1])]:a(h),done:v}},[Symbol.iterator](){return this}}}}function on(e){return function(...t){return e==="delete"?!1:e==="clear"?void 0:this}}function tl(e,t){const n={get(r){const i=this.__v_raw,o=J(i),l=J(r);e||(rt(r,l)&&be(o,"get",r),be(o,"get",l));const{has:c}=rn(o),u=t?ys:e?Sn:de;if(c.call(o,r))return u(i.get(r));if(c.call(o,l))return u(i.get(l));i!==o&&i.get(r)},get size(){const r=this.__v_raw;return!e&&be(J(r),"iterate",pt),Reflect.get(r,"size",r)},has(r){const i=this.__v_raw,o=J(i),l=J(r);return e||(rt(r,l)&&be(o,"has",r),be(o,"has",l)),r===l?i.has(r):i.has(r)||i.has(l)},forEach(r,i){const o=this,l=o.__v_raw,c=J(l),u=t?ys:e?Sn:de;return!e&&be(c,"iterate",pt),l.forEach((a,h)=>r.call(i,u(a),u(h),o))}};return ue(n,e?{add:on("add"),set:on("set"),delete:on("delete"),clear:on("clear")}:{add(r){!t&&!Ie(r)&&!it(r)&&(r=J(r));const i=J(this);return rn(i).has.call(i,r)||(i.add(r),qe(i,"add",r,r)),this},set(r,i){!t&&!Ie(i)&&!it(i)&&(i=J(i));const o=J(this),{has:l,get:c}=rn(o);let u=l.call(o,r);u||(r=J(r),u=l.call(o,r));const a=c.call(o,r);return o.set(r,i),u?rt(i,a)&&qe(o,"set",r,i):qe(o,"add",r,i),this},delete(r){const i=J(this),{has:o,get:l}=rn(i);let c=o.call(i,r);c||(r=J(r),c=o.call(i,r)),l&&l.call(i,r);const u=i.delete(r);return c&&qe(i,"delete",r,void 0),u},clear(){const r=J(this),i=r.size!==0,o=r.clear();return i&&qe(r,"clear",void 0,void 0),o}}),["keys","values","entries",Symbol.iterator].forEach(r=>{n[r]=el(r,e,t)}),n}function $s(e,t){const n=tl(e,t);return(s,r,i)=>r==="__v_isReactive"?!e:r==="__v_isReadonly"?e:r==="__v_raw"?s:Reflect.get(Q(n,r)&&r in s?n:s,r,i)}const nl={get:$s(!1,!1)},sl={get:$s(!1,!0)},rl={get:$s(!0,!1)};const ui=new WeakMap,di=new WeakMap,hi=new WeakMap,il=new WeakMap;function ol(e){switch(e){case"Object":case"Array":return 1;case"Map":case"Set":case"WeakMap":case"WeakSet":return 2;default:return 0}}function ll(e){return e.__v_skip||!Object.isExtensible(e)?0:ol(Oo(e))}function It(e){return it(e)?e:js(e,!1,Jo,nl,ui)}function cl(e){return js(e,!1,Zo,sl,di)}function Fn(e){return js(e,!0,Qo,rl,hi)}function js(e,t,n,s,r){if(!se(e)||e.__v_raw&&!(t&&e.__v_isReactive))return e;const i=ll(e);if(i===0)return e;const o=r.get(e);if(o)return o;const l=new Proxy(e,i===2?s:n);return r.set(e,l),l}function gt(e){return it(e)?gt(e.__v_raw):!!(e&&e.__v_isReactive)}function it(e){return!!(e&&e.__v_isReadonly)}function Ie(e){return!!(e&&e.__v_isShallow)}function Vs(e){return e?!!e.__v_raw:!1}function J(e){const t=e&&e.__v_raw;return t?J(t):e}function vn(e){return!Q(e,"__v_skip")&&Object.isExtensible(e)&&Yr(e,"__v_skip",!0),e}const de=e=>se(e)?It(e):e,Sn=e=>se(e)?Fn(e):e;function ae(e){return e?e.__v_isRef===!0:!1}function mt(e){return pi(e,!1)}function Pe(e){return pi(e,!0)}function pi(e,t){return ae(e)?e:new al(e,t)}class al{constructor(t,n){this.dep=new Ln,this.__v_isRef=!0,this.__v_isShallow=!1,this._rawValue=n?t:J(t),this._value=n?t:de(t),this.__v_isShallow=n}get value(){return this.dep.track(),this._value}set value(t){const n=this._rawValue,s=this.__v_isShallow||Ie(t)||it(t);t=s?t:J(t),rt(t,n)&&(this._rawValue=t,this._value=s?t:de(t),this.dep.trigger())}}function Ws(e){return ae(e)?e.value:e}function le(e){return G(e)?e():Ws(e)}const fl={get:(e,t,n)=>t==="__v_raw"?e:Ws(Reflect.get(e,t,n)),set:(e,t,n,s)=>{const r=e[t];return ae(r)&&!ae(n)?(r.value=n,!0):Reflect.set(e,t,n,s)}};function gi(e){return gt(e)?e:new Proxy(e,fl)}class ul{constructor(t){this.__v_isRef=!0,this._value=void 0;const n=this.dep=new Ln,{get:s,set:r}=t(n.track.bind(n),n.trigger.bind(n));this._get=s,this._set=r}get value(){return this._value=this._get()}set value(t){this._set(t)}}function dl(e){return new ul(e)}class hl{constructor(t,n,s){this._object=t,this._key=n,this._defaultValue=s,this.__v_isRef=!0,this._value=void 0}get value(){const t=this._object[this._key];return this._value=t===void 0?this._defaultValue:t}set value(t){this._object[this._key]=t}get dep(){return Ko(J(this._object),this._key)}}class pl{constructor(t){this._getter=t,this.__v_isRef=!0,this.__v_isReadonly=!0,this._value=void 0}get value(){return this._value=this._getter()}}function gl(e,t,n){return ae(e)?e:G(e)?new pl(e):se(e)&&arguments.length>1?ml(e,t,n):mt(e)}function ml(e,t,n){const s=e[t];return ae(s)?s:new hl(e,t,n)}class vl{constructor(t,n,s){this.fn=t,this.setter=n,this._value=void 0,this.dep=new Ln(this),this.__v_isRef=!0,this.deps=void 0,this.depsTail=void 0,this.flags=16,this.globalVersion=Ut-1,this.next=void 0,this.effect=this,this.__v_isReadonly=!n,this.isSSR=s}notify(){if(this.flags|=16,!(this.flags&8)&&te!==this)return ni(this,!0),!0}get value(){const t=this.dep.track();return ii(this),t&&(t.version=this.dep.version),this._value}set value(t){this.setter&&this.setter(t)}}function yl(e,t,n=!1){let s,r;return G(e)?s=e:(s=e.get,r=e.set),new vl(s,r,n)}const ln={},xn=new WeakMap;let dt;function bl(e,t=!1,n=dt){if(n){let s=xn.get(n);s||xn.set(n,s=[]),s.push(e)}}function _l(e,t,n=ne){const{immediate:s,deep:r,once:i,scheduler:o,augmentJob:l,call:c}=n,u=g=>r?g:Ie(g)||r===!1||r===0?st(g,1):st(g);let a,h,v,y,A=!1,P=!1;if(ae(e)?(h=()=>e.value,A=Ie(e)):gt(e)?(h=()=>u(e),A=!0):B(e)?(P=!0,A=e.some(g=>gt(g)||Ie(g)),h=()=>e.map(g=>{if(ae(g))return g.value;if(gt(g))return u(g);if(G(g))return c?c(g,2):g()})):G(e)?t?h=c?()=>c(e,2):e:h=()=>{if(v){Ge();try{v()}finally{Xe()}}const g=dt;dt=a;try{return c?c(e,3,[y]):e(y)}finally{dt=g}}:h=ke,t&&r){const g=h,M=r===!0?1/0:r;h=()=>st(g(),M)}const K=Zr(),H=()=>{a.stop(),K&&K.active&&Is(K.effects,a)};if(i&&t){const g=t;t=(...M)=>{g(...M),H()}}let k=P?new Array(e.length).fill(ln):ln;const p=g=>{if(!(!(a.flags&1)||!a.dirty&&!g))if(t){const M=a.run();if(r||A||(P?M.some((V,R)=>rt(V,k[R])):rt(M,k))){v&&v();const V=dt;dt=a;try{const R=[M,k===ln?void 0:P&&k[0]===ln?[]:k,y];c?c(t,3,R):t(...R),k=M}finally{dt=V}}}else a.run()};return l&&l(p),a=new ei(h),a.scheduler=o?()=>o(p,!1):p,y=g=>bl(g,!1,a),v=a.onStop=()=>{const g=xn.get(a);if(g){if(c)c(g,4);else for(const M of g)M();xn.delete(a)}},t?s?p(!0):k=a.run():o?o(p.bind(null,!0),!0):a.run(),H.pause=a.pause.bind(a),H.resume=a.resume.bind(a),H.stop=H,H}function st(e,t=1/0,n){if(t<=0||!se(e)||e.__v_skip||(n=n||new Set,n.has(e)))return e;if(n.add(e),t--,ae(e))st(e.value,t,n);else if(B(e))for(let s=0;s{st(s,t,n)});else if(Xr(e)){for(const s in e)st(e[s],t,n);for(const s of Object.getOwnPropertySymbols(e))Object.prototype.propertyIsEnumerable.call(e,s)&&st(e[s],t,n)}return e}/** -* @vue/runtime-core v3.5.14 -* (c) 2018-present Yuxi (Evan) You and Vue contributors -* @license MIT -**/function Zt(e,t,n,s){try{return s?e(...s):e()}catch(r){Hn(r,t,n)}}function De(e,t,n,s){if(G(e)){const r=Zt(e,t,n,s);return r&&qr(r)&&r.catch(i=>{Hn(i,t,n)}),r}if(B(e)){const r=[];for(let i=0;i>>1,r=we[s],i=Kt(r);i=Kt(n)?we.push(e):we.splice(Sl(t),0,e),e.flags|=1,vi()}}function vi(){Tn||(Tn=mi.then(yi))}function xl(e){B(e)?Mt.push(...e):et&&e.id===-1?et.splice(Ct+1,0,e):e.flags&1||(Mt.push(e),e.flags|=1),vi()}function sr(e,t,n=Ve+1){for(;nKt(n)-Kt(s));if(Mt.length=0,et){et.push(...t);return}for(et=t,Ct=0;Cte.id==null?e.flags&2?-1:1/0:e.id;function yi(e){try{for(Ve=0;Ve{s._d&&gr(-1);const i=Cn(t);let o;try{o=e(...r)}finally{Cn(i),s._d&&gr(1)}return o};return s._n=!0,s._c=!0,s._d=!0,s}function We(e,t,n,s){const r=e.dirs,i=t&&t.dirs;for(let o=0;oe.__isTeleport,tt=Symbol("_leaveCb"),cn=Symbol("_enterCb");function Cl(){const e={isMounted:!1,isLeaving:!1,isUnmounting:!1,leavingVNodes:new Map};return Pt(()=>{e.isMounted=!0}),Oi(()=>{e.isUnmounting=!0}),e}const Re=[Function,Array],wi={mode:String,appear:Boolean,persisted:Boolean,onBeforeEnter:Re,onEnter:Re,onAfterEnter:Re,onEnterCancelled:Re,onBeforeLeave:Re,onLeave:Re,onAfterLeave:Re,onLeaveCancelled:Re,onBeforeAppear:Re,onAppear:Re,onAfterAppear:Re,onAppearCancelled:Re},Si=e=>{const t=e.subTree;return t.component?Si(t.component):t},Al={name:"BaseTransition",props:wi,setup(e,{slots:t}){const n=en(),s=Cl();return()=>{const r=t.default&&Ei(t.default(),!0);if(!r||!r.length)return;const i=xi(r),o=J(e),{mode:l}=o;if(s.isLeaving)return Qn(i);const c=rr(i);if(!c)return Qn(i);let u=bs(c,o,s,n,h=>u=h);c.type!==he&&qt(c,u);let a=n.subTree&&rr(n.subTree);if(a&&a.type!==he&&!ht(c,a)&&Si(n).type!==he){let h=bs(a,o,s,n);if(qt(a,h),l==="out-in"&&c.type!==he)return s.isLeaving=!0,h.afterLeave=()=>{s.isLeaving=!1,n.job.flags&8||n.update(),delete h.afterLeave,a=void 0},Qn(i);l==="in-out"&&c.type!==he?h.delayLeave=(v,y,A)=>{const P=Ti(s,a);P[String(a.key)]=a,v[tt]=()=>{y(),v[tt]=void 0,delete u.delayedLeave,a=void 0},u.delayedLeave=()=>{A(),delete u.delayedLeave,a=void 0}}:a=void 0}else a&&(a=void 0);return i}}};function xi(e){let t=e[0];if(e.length>1){for(const n of e)if(n.type!==he){t=n;break}}return t}const Rl=Al;function Ti(e,t){const{leavingVNodes:n}=e;let s=n.get(t.type);return s||(s=Object.create(null),n.set(t.type,s)),s}function bs(e,t,n,s,r){const{appear:i,mode:o,persisted:l=!1,onBeforeEnter:c,onEnter:u,onAfterEnter:a,onEnterCancelled:h,onBeforeLeave:v,onLeave:y,onAfterLeave:A,onLeaveCancelled:P,onBeforeAppear:K,onAppear:H,onAfterAppear:k,onAppearCancelled:p}=t,g=String(e.key),M=Ti(n,e),V=(T,I)=>{T&&De(T,s,9,I)},R=(T,I)=>{const E=I[1];V(T,I),B(T)?T.every(b=>b.length<=1)&&E():T.length<=1&&E()},U={mode:o,persisted:l,beforeEnter(T){let I=c;if(!n.isMounted)if(i)I=K||c;else return;T[tt]&&T[tt](!0);const E=M[g];E&&ht(e,E)&&E.el[tt]&&E.el[tt](),V(I,[T])},enter(T){let I=u,E=a,b=h;if(!n.isMounted)if(i)I=H||u,E=k||a,b=p||h;else return;let N=!1;const Y=T[cn]=re=>{N||(N=!0,re?V(b,[T]):V(E,[T]),U.delayedLeave&&U.delayedLeave(),T[cn]=void 0)};I?R(I,[T,Y]):Y()},leave(T,I){const E=String(e.key);if(T[cn]&&T[cn](!0),n.isUnmounting)return I();V(v,[T]);let b=!1;const N=T[tt]=Y=>{b||(b=!0,I(),Y?V(P,[T]):V(A,[T]),T[tt]=void 0,M[E]===e&&delete M[E])};M[E]=e,y?R(y,[T,N]):N()},clone(T){const I=bs(T,t,n,s,r);return r&&r(I),I}};return U}function Qn(e){if($n(e))return e=ot(e),e.children=null,e}function rr(e){if(!$n(e))return _i(e.type)&&e.children?xi(e.children):e;if(e.component)return e.component.subTree;const{shapeFlag:t,children:n}=e;if(n){if(t&16)return n[0];if(t&32&&G(n.default))return n.default()}}function qt(e,t){e.shapeFlag&6&&e.component?(e.transition=t,qt(e.component.subTree,t)):e.shapeFlag&128?(e.ssContent.transition=t.clone(e.ssContent),e.ssFallback.transition=t.clone(e.ssFallback)):e.transition=t}function Ei(e,t=!1,n){let s=[],r=0;for(let i=0;i1)for(let i=0;iGt(A,t&&(B(t)?t[P]:t),n,s,r));return}if(vt(s)&&!r){s.shapeFlag&512&&s.type.__asyncResolved&&s.component.subTree.component&&Gt(e,t,n,s.component.subTree);return}const i=s.shapeFlag&4?qs(s.component):s.el,o=r?null:i,{i:l,r:c}=e,u=t&&t.r,a=l.refs===ne?l.refs={}:l.refs,h=l.setupState,v=J(h),y=h===ne?()=>!1:A=>Q(v,A);if(u!=null&&u!==c&&(oe(u)?(a[u]=null,y(u)&&(h[u]=null)):ae(u)&&(u.value=null)),G(c))Zt(c,l,12,[o,a]);else{const A=oe(c),P=ae(c);if(A||P){const K=()=>{if(e.f){const H=A?y(c)?h[c]:a[c]:c.value;r?B(H)&&Is(H,i):B(H)?H.includes(i)||H.push(i):A?(a[c]=[i],y(c)&&(h[c]=a[c])):(c.value=[i],e.k&&(a[e.k]=c.value))}else A?(a[c]=o,y(c)&&(h[c]=o)):P&&(c.value=o,e.k&&(a[e.k]=o))};o?(K.id=-1,Ce(K,n)):K()}}}let ir=!1;const Et=()=>{ir||(console.error("Hydration completed but contains mismatches."),ir=!0)},Ol=e=>e.namespaceURI.includes("svg")&&e.tagName!=="foreignObject",Ml=e=>e.namespaceURI.includes("MathML"),an=e=>{if(e.nodeType===1){if(Ol(e))return"svg";if(Ml(e))return"mathml"}},fn=e=>e.nodeType===8;function Il(e){const{mt:t,p:n,o:{patchProp:s,createText:r,nextSibling:i,parentNode:o,remove:l,insert:c,createComment:u}}=e,a=(p,g)=>{if(!g.hasChildNodes()){n(null,p,g),En(),g._vnode=p;return}h(g.firstChild,p,null,null,null),En(),g._vnode=p},h=(p,g,M,V,R,U=!1)=>{U=U||!!g.dynamicChildren;const T=fn(p)&&p.data==="[",I=()=>P(p,g,M,V,R,T),{type:E,ref:b,shapeFlag:N,patchFlag:Y}=g;let re=p.nodeType;g.el=p,Y===-2&&(U=!1,g.dynamicChildren=null);let j=null;switch(E){case _t:re!==3?g.children===""?(c(g.el=r(""),o(p),p),j=p):j=I():(p.data!==g.children&&(Et(),p.data=g.children),j=i(p));break;case he:k(p)?(j=i(p),H(g.el=p.content.firstChild,p,M)):re!==8||T?j=I():j=i(p);break;case Wt:if(T&&(p=i(p),re=p.nodeType),re===1||re===3){j=p;const X=!g.children.length;for(let D=0;D{U=U||!!g.dynamicChildren;const{type:T,props:I,patchFlag:E,shapeFlag:b,dirs:N,transition:Y}=g,re=T==="input"||T==="option";if(re||E!==-1){N&&We(g,null,M,"created");let j=!1;if(k(p)){j=qi(null,Y)&&M&&M.vnode.props&&M.vnode.props.appear;const D=p.content.firstChild;j&&Y.beforeEnter(D),H(D,p,M),g.el=p=D}if(b&16&&!(I&&(I.innerHTML||I.textContent))){let D=y(p.firstChild,g,p,M,V,R,U);for(;D;){un(p,1)||Et();const ce=D;D=D.nextSibling,l(ce)}}else if(b&8){let D=g.children;D[0]===` -`&&(p.tagName==="PRE"||p.tagName==="TEXTAREA")&&(D=D.slice(1)),p.textContent!==D&&(un(p,0)||Et(),p.textContent=g.children)}if(I){if(re||!U||E&48){const D=p.tagName.includes("-");for(const ce in I)(re&&(ce.endsWith("value")||ce==="indeterminate")||Qt(ce)&&!Ot(ce)||ce[0]==="."||D)&&s(p,ce,null,I[ce],void 0,M)}else if(I.onClick)s(p,"onClick",null,I.onClick,void 0,M);else if(E&4&>(I.style))for(const D in I.style)I.style[D]}let X;(X=I&&I.onVnodeBeforeMount)&&Oe(X,M,g),N&&We(g,null,M,"beforeMount"),((X=I&&I.onVnodeMounted)||N||j)&&eo(()=>{X&&Oe(X,M,g),j&&Y.enter(p),N&&We(g,null,M,"mounted")},V)}return p.nextSibling},y=(p,g,M,V,R,U,T)=>{T=T||!!g.dynamicChildren;const I=g.children,E=I.length;for(let b=0;b{const{slotScopeIds:T}=g;T&&(R=R?R.concat(T):T);const I=o(p),E=y(i(p),g,I,M,V,R,U);return E&&fn(E)&&E.data==="]"?i(g.anchor=E):(Et(),c(g.anchor=u("]"),I,E),E)},P=(p,g,M,V,R,U)=>{if(un(p.parentElement,1)||Et(),g.el=null,U){const E=K(p);for(;;){const b=i(p);if(b&&b!==E)l(b);else break}}const T=i(p),I=o(p);return l(p),n(null,g,I,T,M,V,an(I),R),M&&(M.vnode.el=g.el,Qi(M,g.el)),T},K=(p,g="[",M="]")=>{let V=0;for(;p;)if(p=i(p),p&&fn(p)&&(p.data===g&&V++,p.data===M)){if(V===0)return i(p);V--}return p},H=(p,g,M)=>{const V=g.parentNode;V&&V.replaceChild(p,g);let R=M;for(;R;)R.vnode.el===g&&(R.vnode.el=R.subTree.el=p),R=R.parent},k=p=>p.nodeType===1&&p.tagName==="TEMPLATE";return[a,h]}const or="data-allow-mismatch",Pl={0:"text",1:"children",2:"class",3:"style",4:"attribute"};function un(e,t){if(t===0||t===1)for(;e&&!e.hasAttribute(or);)e=e.parentElement;const n=e&&e.getAttribute(or);if(n==null)return!1;if(n==="")return!0;{const s=n.split(",");return t===0&&s.includes("children")?!0:n.split(",").includes(Pl[t])}}Pn().requestIdleCallback;Pn().cancelIdleCallback;const vt=e=>!!e.type.__asyncLoader,$n=e=>e.type.__isKeepAlive;function Ll(e,t){Ri(e,"a",t)}function Nl(e,t){Ri(e,"da",t)}function Ri(e,t,n=fe){const s=e.__wdc||(e.__wdc=()=>{let r=n;for(;r;){if(r.isDeactivated)return;r=r.parent}return e()});if(jn(t,s,n),n){let r=n.parent;for(;r&&r.parent;)$n(r.parent.vnode)&&Fl(s,t,n,r),r=r.parent}}function Fl(e,t,n,s){const r=jn(t,e,s,!0);Vn(()=>{Is(s[t],r)},n)}function jn(e,t,n=fe,s=!1){if(n){const r=n[e]||(n[e]=[]),i=t.__weh||(t.__weh=(...o)=>{Ge();const l=tn(n),c=De(t,n,e,o);return l(),Xe(),c});return s?r.unshift(i):r.push(i),i}}const Qe=e=>(t,n=fe)=>{(!zt||e==="sp")&&jn(e,(...s)=>t(...s),n)},Hl=Qe("bm"),Pt=Qe("m"),Dl=Qe("bu"),$l=Qe("u"),Oi=Qe("bum"),Vn=Qe("um"),jl=Qe("sp"),Vl=Qe("rtg"),Wl=Qe("rtc");function kl(e,t=fe){jn("ec",e,t)}const Mi="components";function ff(e,t){return Pi(Mi,e,!0,t)||e}const Ii=Symbol.for("v-ndc");function uf(e){return oe(e)?Pi(Mi,e,!1)||e:e||Ii}function Pi(e,t,n=!0,s=!1){const r=pe||fe;if(r){const i=r.type;{const l=Cc(i,!1);if(l&&(l===t||l===Ne(t)||l===In(Ne(t))))return i}const o=lr(r[e]||i[e],t)||lr(r.appContext[e],t);return!o&&s?i:o}}function lr(e,t){return e&&(e[t]||e[Ne(t)]||e[In(Ne(t))])}function df(e,t,n,s){let r;const i=n,o=B(e);if(o||oe(e)){const l=o&>(e);let c=!1,u=!1;l&&(c=!Ie(e),u=it(e),e=Nn(e)),r=new Array(e.length);for(let a=0,h=e.length;at(l,c,void 0,i));else{const l=Object.keys(e);r=new Array(l.length);for(let c=0,u=l.length;cYt(t)?!(t.type===he||t.type===Se&&!Li(t.children)):!0)?e:null}function pf(e,t){const n={};for(const s in e)n[/[A-Z]/.test(s)?`on:${s}`:mn(s)]=e[s];return n}const _s=e=>e?io(e)?qs(e):_s(e.parent):null,Vt=ue(Object.create(null),{$:e=>e,$el:e=>e.vnode.el,$data:e=>e.data,$props:e=>e.props,$attrs:e=>e.attrs,$slots:e=>e.slots,$refs:e=>e.refs,$parent:e=>_s(e.parent),$root:e=>_s(e.root),$host:e=>e.ce,$emit:e=>e.emit,$options:e=>Fi(e),$forceUpdate:e=>e.f||(e.f=()=>{ks(e.update)}),$nextTick:e=>e.n||(e.n=Dn.bind(e.proxy)),$watch:e=>fc.bind(e)}),Zn=(e,t)=>e!==ne&&!e.__isScriptSetup&&Q(e,t),Ul={get({_:e},t){if(t==="__v_skip")return!0;const{ctx:n,setupState:s,data:r,props:i,accessCache:o,type:l,appContext:c}=e;let u;if(t[0]!=="$"){const y=o[t];if(y!==void 0)switch(y){case 1:return s[t];case 2:return r[t];case 4:return n[t];case 3:return i[t]}else{if(Zn(s,t))return o[t]=1,s[t];if(r!==ne&&Q(r,t))return o[t]=2,r[t];if((u=e.propsOptions[0])&&Q(u,t))return o[t]=3,i[t];if(n!==ne&&Q(n,t))return o[t]=4,n[t];ws&&(o[t]=0)}}const a=Vt[t];let h,v;if(a)return t==="$attrs"&&be(e.attrs,"get",""),a(e);if((h=l.__cssModules)&&(h=h[t]))return h;if(n!==ne&&Q(n,t))return o[t]=4,n[t];if(v=c.config.globalProperties,Q(v,t))return v[t]},set({_:e},t,n){const{data:s,setupState:r,ctx:i}=e;return Zn(r,t)?(r[t]=n,!0):s!==ne&&Q(s,t)?(s[t]=n,!0):Q(e.props,t)||t[0]==="$"&&t.slice(1)in e?!1:(i[t]=n,!0)},has({_:{data:e,setupState:t,accessCache:n,ctx:s,appContext:r,propsOptions:i}},o){let l;return!!n[o]||e!==ne&&Q(e,o)||Zn(t,o)||(l=i[0])&&Q(l,o)||Q(s,o)||Q(Vt,o)||Q(r.config.globalProperties,o)},defineProperty(e,t,n){return n.get!=null?e._.accessCache[t]=0:Q(n,"value")&&this.set(e,t,n.value,null),Reflect.defineProperty(e,t,n)}};function gf(){return Bl().slots}function Bl(){const e=en();return e.setupContext||(e.setupContext=lo(e))}function cr(e){return B(e)?e.reduce((t,n)=>(t[n]=null,t),{}):e}let ws=!0;function Kl(e){const t=Fi(e),n=e.proxy,s=e.ctx;ws=!1,t.beforeCreate&&ar(t.beforeCreate,e,"bc");const{data:r,computed:i,methods:o,watch:l,provide:c,inject:u,created:a,beforeMount:h,mounted:v,beforeUpdate:y,updated:A,activated:P,deactivated:K,beforeDestroy:H,beforeUnmount:k,destroyed:p,unmounted:g,render:M,renderTracked:V,renderTriggered:R,errorCaptured:U,serverPrefetch:T,expose:I,inheritAttrs:E,components:b,directives:N,filters:Y}=t;if(u&&ql(u,s,null),o)for(const X in o){const D=o[X];G(D)&&(s[X]=D.bind(n))}if(r){const X=r.call(n,n);se(X)&&(e.data=It(X))}if(ws=!0,i)for(const X in i){const D=i[X],ce=G(D)?D.bind(n,n):G(D.get)?D.get.bind(n,n):ke,nn=!G(D)&&G(D.set)?D.set.bind(n):ke,ct=ie({get:ce,set:nn});Object.defineProperty(s,X,{enumerable:!0,configurable:!0,get:()=>ct.value,set:$e=>ct.value=$e})}if(l)for(const X in l)Ni(l[X],s,n,X);if(c){const X=G(c)?c.call(n):c;Reflect.ownKeys(X).forEach(D=>{Ql(D,X[D])})}a&&ar(a,e,"c");function j(X,D){B(D)?D.forEach(ce=>X(ce.bind(n))):D&&X(D.bind(n))}if(j(Hl,h),j(Pt,v),j(Dl,y),j($l,A),j(Ll,P),j(Nl,K),j(kl,U),j(Wl,V),j(Vl,R),j(Oi,k),j(Vn,g),j(jl,T),B(I))if(I.length){const X=e.exposed||(e.exposed={});I.forEach(D=>{Object.defineProperty(X,D,{get:()=>n[D],set:ce=>n[D]=ce})})}else e.exposed||(e.exposed={});M&&e.render===ke&&(e.render=M),E!=null&&(e.inheritAttrs=E),b&&(e.components=b),N&&(e.directives=N),T&&Ai(e)}function ql(e,t,n=ke){B(e)&&(e=Ss(e));for(const s in e){const r=e[s];let i;se(r)?"default"in r?i=bt(r.from||s,r.default,!0):i=bt(r.from||s):i=bt(r),ae(i)?Object.defineProperty(t,s,{enumerable:!0,configurable:!0,get:()=>i.value,set:o=>i.value=o}):t[s]=i}}function ar(e,t,n){De(B(e)?e.map(s=>s.bind(t.proxy)):e.bind(t.proxy),t,n)}function Ni(e,t,n,s){let r=s.includes(".")?zi(n,s):()=>n[s];if(oe(e)){const i=t[e];G(i)&&Le(r,i)}else if(G(e))Le(r,e.bind(n));else if(se(e))if(B(e))e.forEach(i=>Ni(i,t,n,s));else{const i=G(e.handler)?e.handler.bind(n):t[e.handler];G(i)&&Le(r,i,e)}}function Fi(e){const t=e.type,{mixins:n,extends:s}=t,{mixins:r,optionsCache:i,config:{optionMergeStrategies:o}}=e.appContext,l=i.get(t);let c;return l?c=l:!r.length&&!n&&!s?c=t:(c={},r.length&&r.forEach(u=>An(c,u,o,!0)),An(c,t,o)),se(t)&&i.set(t,c),c}function An(e,t,n,s=!1){const{mixins:r,extends:i}=t;i&&An(e,i,n,!0),r&&r.forEach(o=>An(e,o,n,!0));for(const o in t)if(!(s&&o==="expose")){const l=Gl[o]||n&&n[o];e[o]=l?l(e[o],t[o]):t[o]}return e}const Gl={data:fr,props:ur,emits:ur,methods:Dt,computed:Dt,beforeCreate:_e,created:_e,beforeMount:_e,mounted:_e,beforeUpdate:_e,updated:_e,beforeDestroy:_e,beforeUnmount:_e,destroyed:_e,unmounted:_e,activated:_e,deactivated:_e,errorCaptured:_e,serverPrefetch:_e,components:Dt,directives:Dt,watch:Yl,provide:fr,inject:Xl};function fr(e,t){return t?e?function(){return ue(G(e)?e.call(this,this):e,G(t)?t.call(this,this):t)}:t:e}function Xl(e,t){return Dt(Ss(e),Ss(t))}function Ss(e){if(B(e)){const t={};for(let n=0;n1)return n&&G(t)?t.call(s&&s.proxy):t}}function Di(){return!!(fe||pe||yt)}const $i={},ji=()=>Object.create($i),Vi=e=>Object.getPrototypeOf(e)===$i;function Zl(e,t,n,s=!1){const r={},i=ji();e.propsDefaults=Object.create(null),Wi(e,t,r,i);for(const o in e.propsOptions[0])o in r||(r[o]=void 0);n?e.props=s?r:cl(r):e.type.props?e.props=r:e.props=i,e.attrs=i}function ec(e,t,n,s){const{props:r,attrs:i,vnode:{patchFlag:o}}=e,l=J(r),[c]=e.propsOptions;let u=!1;if((s||o>0)&&!(o&16)){if(o&8){const a=e.vnode.dynamicProps;for(let h=0;h{c=!0;const[v,y]=ki(h,t,!0);ue(o,v),y&&l.push(...y)};!n&&t.mixins.length&&t.mixins.forEach(a),e.extends&&a(e.extends),e.mixins&&e.mixins.forEach(a)}if(!i&&!c)return se(e)&&s.set(e,At),At;if(B(i))for(let a=0;ae[0]==="_"||e==="$stable",Bs=e=>B(e)?e.map(Me):[Me(e)],nc=(e,t,n)=>{if(t._n)return t;const s=Tl((...r)=>Bs(t(...r)),n);return s._c=!1,s},Ui=(e,t,n)=>{const s=e._ctx;for(const r in e){if(Us(r))continue;const i=e[r];if(G(i))t[r]=nc(r,i,s);else if(i!=null){const o=Bs(i);t[r]=()=>o}}},Bi=(e,t)=>{const n=Bs(t);e.slots.default=()=>n},Ki=(e,t,n)=>{for(const s in t)(n||!Us(s))&&(e[s]=t[s])},sc=(e,t,n)=>{const s=e.slots=ji();if(e.vnode.shapeFlag&32){const r=t._;r?(Ki(s,t,n),n&&Yr(s,"_",r,!0)):Ui(t,s)}else t&&Bi(e,t)},rc=(e,t,n)=>{const{vnode:s,slots:r}=e;let i=!0,o=ne;if(s.shapeFlag&32){const l=t._;l?n&&l===1?i=!1:Ki(r,t,n):(i=!t.$stable,Ui(t,r)),o=t}else t&&(Bi(e,t),o={default:1});if(i)for(const l in r)!Us(l)&&o[l]==null&&delete r[l]},Ce=eo;function ic(e){return oc(e,Il)}function oc(e,t){const n=Pn();n.__VUE__=!0;const{insert:s,remove:r,patchProp:i,createElement:o,createText:l,createComment:c,setText:u,setElementText:a,parentNode:h,nextSibling:v,setScopeId:y=ke,insertStaticContent:A}=e,P=(f,d,m,S=null,_=null,w=null,L=void 0,O=null,C=!!d.dynamicChildren)=>{if(f===d)return;f&&!ht(f,d)&&(S=sn(f),$e(f,_,w,!0),f=null),d.patchFlag===-2&&(C=!1,d.dynamicChildren=null);const{type:x,ref:W,shapeFlag:F}=d;switch(x){case _t:K(f,d,m,S);break;case he:H(f,d,m,S);break;case Wt:f==null&&k(d,m,S,L);break;case Se:b(f,d,m,S,_,w,L,O,C);break;default:F&1?M(f,d,m,S,_,w,L,O,C):F&6?N(f,d,m,S,_,w,L,O,C):(F&64||F&128)&&x.process(f,d,m,S,_,w,L,O,C,xt)}W!=null&&_&&Gt(W,f&&f.ref,w,d||f,!d)},K=(f,d,m,S)=>{if(f==null)s(d.el=l(d.children),m,S);else{const _=d.el=f.el;d.children!==f.children&&u(_,d.children)}},H=(f,d,m,S)=>{f==null?s(d.el=c(d.children||""),m,S):d.el=f.el},k=(f,d,m,S)=>{[f.el,f.anchor]=A(f.children,d,m,S,f.el,f.anchor)},p=({el:f,anchor:d},m,S)=>{let _;for(;f&&f!==d;)_=v(f),s(f,m,S),f=_;s(d,m,S)},g=({el:f,anchor:d})=>{let m;for(;f&&f!==d;)m=v(f),r(f),f=m;r(d)},M=(f,d,m,S,_,w,L,O,C)=>{d.type==="svg"?L="svg":d.type==="math"&&(L="mathml"),f==null?V(d,m,S,_,w,L,O,C):T(f,d,_,w,L,O,C)},V=(f,d,m,S,_,w,L,O)=>{let C,x;const{props:W,shapeFlag:F,transition:$,dirs:q}=f;if(C=f.el=o(f.type,w,W&&W.is,W),F&8?a(C,f.children):F&16&&U(f.children,C,null,S,_,es(f,w),L,O),q&&We(f,null,S,"created"),R(C,f,f.scopeId,L,S),W){for(const ee in W)ee!=="value"&&!Ot(ee)&&i(C,ee,null,W[ee],w,S);"value"in W&&i(C,"value",null,W.value,w),(x=W.onVnodeBeforeMount)&&Oe(x,S,f)}q&&We(f,null,S,"beforeMount");const z=qi(_,$);z&&$.beforeEnter(C),s(C,d,m),((x=W&&W.onVnodeMounted)||z||q)&&Ce(()=>{x&&Oe(x,S,f),z&&$.enter(C),q&&We(f,null,S,"mounted")},_)},R=(f,d,m,S,_)=>{if(m&&y(f,m),S)for(let w=0;w{for(let x=C;x{const O=d.el=f.el;let{patchFlag:C,dynamicChildren:x,dirs:W}=d;C|=f.patchFlag&16;const F=f.props||ne,$=d.props||ne;let q;if(m&&at(m,!1),(q=$.onVnodeBeforeUpdate)&&Oe(q,m,d,f),W&&We(d,f,m,"beforeUpdate"),m&&at(m,!0),(F.innerHTML&&$.innerHTML==null||F.textContent&&$.textContent==null)&&a(O,""),x?I(f.dynamicChildren,x,O,m,S,es(d,_),w):L||D(f,d,O,null,m,S,es(d,_),w,!1),C>0){if(C&16)E(O,F,$,m,_);else if(C&2&&F.class!==$.class&&i(O,"class",null,$.class,_),C&4&&i(O,"style",F.style,$.style,_),C&8){const z=d.dynamicProps;for(let ee=0;ee{q&&Oe(q,m,d,f),W&&We(d,f,m,"updated")},S)},I=(f,d,m,S,_,w,L)=>{for(let O=0;O{if(d!==m){if(d!==ne)for(const w in d)!Ot(w)&&!(w in m)&&i(f,w,d[w],null,_,S);for(const w in m){if(Ot(w))continue;const L=m[w],O=d[w];L!==O&&w!=="value"&&i(f,w,O,L,_,S)}"value"in m&&i(f,"value",d.value,m.value,_)}},b=(f,d,m,S,_,w,L,O,C)=>{const x=d.el=f?f.el:l(""),W=d.anchor=f?f.anchor:l("");let{patchFlag:F,dynamicChildren:$,slotScopeIds:q}=d;q&&(O=O?O.concat(q):q),f==null?(s(x,m,S),s(W,m,S),U(d.children||[],m,W,_,w,L,O,C)):F>0&&F&64&&$&&f.dynamicChildren?(I(f.dynamicChildren,$,m,_,w,L,O),(d.key!=null||_&&d===_.subTree)&&Gi(f,d,!0)):D(f,d,m,W,_,w,L,O,C)},N=(f,d,m,S,_,w,L,O,C)=>{d.slotScopeIds=O,f==null?d.shapeFlag&512?_.ctx.activate(d,m,S,L,C):Y(d,m,S,_,w,L,C):re(f,d,C)},Y=(f,d,m,S,_,w,L)=>{const O=f.component=Sc(f,S,_);if($n(f)&&(O.ctx.renderer=xt),xc(O,!1,L),O.asyncDep){if(_&&_.registerDep(O,j,L),!f.el){const C=O.subTree=ge(he);H(null,C,d,m)}}else j(O,f,d,m,_,w,L)},re=(f,d,m)=>{const S=d.component=f.component;if(gc(f,d,m))if(S.asyncDep&&!S.asyncResolved){X(S,d,m);return}else S.next=d,S.update();else d.el=f.el,S.vnode=d},j=(f,d,m,S,_,w,L)=>{const O=()=>{if(f.isMounted){let{next:F,bu:$,u:q,parent:z,vnode:ee}=f;{const Te=Xi(f);if(Te){F&&(F.el=ee.el,X(f,F,L)),Te.asyncDep.then(()=>{f.isUnmounted||O()});return}}let Z=F,xe;at(f,!1),F?(F.el=ee.el,X(f,F,L)):F=ee,$&&Gn($),(xe=F.props&&F.props.onVnodeBeforeUpdate)&&Oe(xe,z,F,ee),at(f,!0);const me=ts(f),Fe=f.subTree;f.subTree=me,P(Fe,me,h(Fe.el),sn(Fe),f,_,w),F.el=me.el,Z===null&&Qi(f,me.el),q&&Ce(q,_),(xe=F.props&&F.props.onVnodeUpdated)&&Ce(()=>Oe(xe,z,F,ee),_)}else{let F;const{el:$,props:q}=d,{bm:z,m:ee,parent:Z,root:xe,type:me}=f,Fe=vt(d);if(at(f,!1),z&&Gn(z),!Fe&&(F=q&&q.onVnodeBeforeMount)&&Oe(F,Z,d),at(f,!0),$&&qn){const Te=()=>{f.subTree=ts(f),qn($,f.subTree,f,_,null)};Fe&&me.__asyncHydrate?me.__asyncHydrate($,f,Te):Te()}else{xe.ce&&xe.ce._injectChildStyle(me);const Te=f.subTree=ts(f);P(null,Te,m,S,f,_,w),d.el=Te.el}if(ee&&Ce(ee,_),!Fe&&(F=q&&q.onVnodeMounted)){const Te=d;Ce(()=>Oe(F,Z,Te),_)}(d.shapeFlag&256||Z&&vt(Z.vnode)&&Z.vnode.shapeFlag&256)&&f.a&&Ce(f.a,_),f.isMounted=!0,d=m=S=null}};f.scope.on();const C=f.effect=new ei(O);f.scope.off();const x=f.update=C.run.bind(C),W=f.job=C.runIfDirty.bind(C);W.i=f,W.id=f.uid,C.scheduler=()=>ks(W),at(f,!0),x()},X=(f,d,m)=>{d.component=f;const S=f.vnode.props;f.vnode=d,f.next=null,ec(f,d.props,S,m),rc(f,d.children,m),Ge(),sr(f),Xe()},D=(f,d,m,S,_,w,L,O,C=!1)=>{const x=f&&f.children,W=f?f.shapeFlag:0,F=d.children,{patchFlag:$,shapeFlag:q}=d;if($>0){if($&128){nn(x,F,m,S,_,w,L,O,C);return}else if($&256){ce(x,F,m,S,_,w,L,O,C);return}}q&8?(W&16&&Lt(x,_,w),F!==x&&a(m,F)):W&16?q&16?nn(x,F,m,S,_,w,L,O,C):Lt(x,_,w,!0):(W&8&&a(m,""),q&16&&U(F,m,S,_,w,L,O,C))},ce=(f,d,m,S,_,w,L,O,C)=>{f=f||At,d=d||At;const x=f.length,W=d.length,F=Math.min(x,W);let $;for($=0;$W?Lt(f,_,w,!0,!1,F):U(d,m,S,_,w,L,O,C,F)},nn=(f,d,m,S,_,w,L,O,C)=>{let x=0;const W=d.length;let F=f.length-1,$=W-1;for(;x<=F&&x<=$;){const q=f[x],z=d[x]=C?nt(d[x]):Me(d[x]);if(ht(q,z))P(q,z,m,null,_,w,L,O,C);else break;x++}for(;x<=F&&x<=$;){const q=f[F],z=d[$]=C?nt(d[$]):Me(d[$]);if(ht(q,z))P(q,z,m,null,_,w,L,O,C);else break;F--,$--}if(x>F){if(x<=$){const q=$+1,z=q$)for(;x<=F;)$e(f[x],_,w,!0),x++;else{const q=x,z=x,ee=new Map;for(x=z;x<=$;x++){const Ee=d[x]=C?nt(d[x]):Me(d[x]);Ee.key!=null&&ee.set(Ee.key,x)}let Z,xe=0;const me=$-z+1;let Fe=!1,Te=0;const Nt=new Array(me);for(x=0;x=me){$e(Ee,_,w,!0);continue}let je;if(Ee.key!=null)je=ee.get(Ee.key);else for(Z=z;Z<=$;Z++)if(Nt[Z-z]===0&&ht(Ee,d[Z])){je=Z;break}je===void 0?$e(Ee,_,w,!0):(Nt[je-z]=x+1,je>=Te?Te=je:Fe=!0,P(Ee,d[je],m,null,_,w,L,O,C),xe++)}const Qs=Fe?lc(Nt):At;for(Z=Qs.length-1,x=me-1;x>=0;x--){const Ee=z+x,je=d[Ee],Zs=Ee+1{const{el:w,type:L,transition:O,children:C,shapeFlag:x}=f;if(x&6){ct(f.component.subTree,d,m,S);return}if(x&128){f.suspense.move(d,m,S);return}if(x&64){L.move(f,d,m,xt);return}if(L===Se){s(w,d,m);for(let F=0;FO.enter(w),_);else{const{leave:F,delayLeave:$,afterLeave:q}=O,z=()=>{f.ctx.isUnmounted?r(w):s(w,d,m)},ee=()=>{F(w,()=>{z(),q&&q()})};$?$(w,z,ee):ee()}else s(w,d,m)},$e=(f,d,m,S=!1,_=!1)=>{const{type:w,props:L,ref:O,children:C,dynamicChildren:x,shapeFlag:W,patchFlag:F,dirs:$,cacheIndex:q}=f;if(F===-2&&(_=!1),O!=null&&(Ge(),Gt(O,null,m,f,!0),Xe()),q!=null&&(d.renderCache[q]=void 0),W&256){d.ctx.deactivate(f);return}const z=W&1&&$,ee=!vt(f);let Z;if(ee&&(Z=L&&L.onVnodeBeforeUnmount)&&Oe(Z,d,f),W&6)Co(f.component,m,S);else{if(W&128){f.suspense.unmount(m,S);return}z&&We(f,null,d,"beforeUnmount"),W&64?f.type.remove(f,d,m,xt,S):x&&!x.hasOnce&&(w!==Se||F>0&&F&64)?Lt(x,d,m,!1,!0):(w===Se&&F&384||!_&&W&16)&&Lt(C,d,m),S&&zs(f)}(ee&&(Z=L&&L.onVnodeUnmounted)||z)&&Ce(()=>{Z&&Oe(Z,d,f),z&&We(f,null,d,"unmounted")},m)},zs=f=>{const{type:d,el:m,anchor:S,transition:_}=f;if(d===Se){Eo(m,S);return}if(d===Wt){g(f);return}const w=()=>{r(m),_&&!_.persisted&&_.afterLeave&&_.afterLeave()};if(f.shapeFlag&1&&_&&!_.persisted){const{leave:L,delayLeave:O}=_,C=()=>L(m,w);O?O(f.el,w,C):C()}else w()},Eo=(f,d)=>{let m;for(;f!==d;)m=v(f),r(f),f=m;r(d)},Co=(f,d,m)=>{const{bum:S,scope:_,job:w,subTree:L,um:O,m:C,a:x,parent:W,slots:{__:F}}=f;hr(C),hr(x),S&&Gn(S),W&&B(F)&&F.forEach($=>{W.renderCache[$]=void 0}),_.stop(),w&&(w.flags|=8,$e(L,f,d,m)),O&&Ce(O,d),Ce(()=>{f.isUnmounted=!0},d),d&&d.pendingBranch&&!d.isUnmounted&&f.asyncDep&&!f.asyncResolved&&f.suspenseId===d.pendingId&&(d.deps--,d.deps===0&&d.resolve())},Lt=(f,d,m,S=!1,_=!1,w=0)=>{for(let L=w;L{if(f.shapeFlag&6)return sn(f.component.subTree);if(f.shapeFlag&128)return f.suspense.next();const d=v(f.anchor||f.el),m=d&&d[El];return m?v(m):d};let Bn=!1;const Js=(f,d,m)=>{f==null?d._vnode&&$e(d._vnode,null,null,!0):P(d._vnode||null,f,d,null,null,null,m),d._vnode=f,Bn||(Bn=!0,sr(),En(),Bn=!1)},xt={p:P,um:$e,m:ct,r:zs,mt:Y,mc:U,pc:D,pbc:I,n:sn,o:e};let Kn,qn;return t&&([Kn,qn]=t(xt)),{render:Js,hydrate:Kn,createApp:Jl(Js,Kn)}}function es({type:e,props:t},n){return n==="svg"&&e==="foreignObject"||n==="mathml"&&e==="annotation-xml"&&t&&t.encoding&&t.encoding.includes("html")?void 0:n}function at({effect:e,job:t},n){n?(e.flags|=32,t.flags|=4):(e.flags&=-33,t.flags&=-5)}function qi(e,t){return(!e||e&&!e.pendingBranch)&&t&&!t.persisted}function Gi(e,t,n=!1){const s=e.children,r=t.children;if(B(s)&&B(r))for(let i=0;i>1,e[n[l]]0&&(t[s]=n[i-1]),n[i]=s)}}for(i=n.length,o=n[i-1];i-- >0;)n[i]=o,o=t[o];return n}function Xi(e){const t=e.subTree.component;if(t)return t.asyncDep&&!t.asyncResolved?t:Xi(t)}function hr(e){if(e)for(let t=0;tbt(cc);function Yi(e,t){return Wn(e,null,t)}function mf(e,t){return Wn(e,null,{flush:"post"})}function Le(e,t,n){return Wn(e,t,n)}function Wn(e,t,n=ne){const{immediate:s,deep:r,flush:i,once:o}=n,l=ue({},n),c=t&&s||!t&&i!=="post";let u;if(zt){if(i==="sync"){const y=ac();u=y.__watcherHandles||(y.__watcherHandles=[])}else if(!c){const y=()=>{};return y.stop=ke,y.resume=ke,y.pause=ke,y}}const a=fe;l.call=(y,A,P)=>De(y,a,A,P);let h=!1;i==="post"?l.scheduler=y=>{Ce(y,a&&a.suspense)}:i!=="sync"&&(h=!0,l.scheduler=(y,A)=>{A?y():ks(y)}),l.augmentJob=y=>{t&&(y.flags|=4),h&&(y.flags|=2,a&&(y.id=a.uid,y.i=a))};const v=_l(e,t,l);return zt&&(u?u.push(v):c&&v()),v}function fc(e,t,n){const s=this.proxy,r=oe(e)?e.includes(".")?zi(s,e):()=>s[e]:e.bind(s,s);let i;G(t)?i=t:(i=t.handler,n=t);const o=tn(this),l=Wn(r,i.bind(s),n);return o(),l}function zi(e,t){const n=t.split(".");return()=>{let s=e;for(let r=0;rt==="modelValue"||t==="model-value"?e.modelModifiers:e[`${t}Modifiers`]||e[`${Ne(t)}Modifiers`]||e[`${lt(t)}Modifiers`];function dc(e,t,...n){if(e.isUnmounted)return;const s=e.vnode.props||ne;let r=n;const i=t.startsWith("update:"),o=i&&uc(s,t.slice(7));o&&(o.trim&&(r=n.map(a=>oe(a)?a.trim():a)),o.number&&(r=n.map(Po)));let l,c=s[l=mn(t)]||s[l=mn(Ne(t))];!c&&i&&(c=s[l=mn(lt(t))]),c&&De(c,e,6,r);const u=s[l+"Once"];if(u){if(!e.emitted)e.emitted={};else if(e.emitted[l])return;e.emitted[l]=!0,De(u,e,6,r)}}function Ji(e,t,n=!1){const s=t.emitsCache,r=s.get(e);if(r!==void 0)return r;const i=e.emits;let o={},l=!1;if(!G(e)){const c=u=>{const a=Ji(u,t,!0);a&&(l=!0,ue(o,a))};!n&&t.mixins.length&&t.mixins.forEach(c),e.extends&&c(e.extends),e.mixins&&e.mixins.forEach(c)}return!i&&!l?(se(e)&&s.set(e,null),null):(B(i)?i.forEach(c=>o[c]=null):ue(o,i),se(e)&&s.set(e,o),o)}function kn(e,t){return!e||!Qt(t)?!1:(t=t.slice(2).replace(/Once$/,""),Q(e,t[0].toLowerCase()+t.slice(1))||Q(e,lt(t))||Q(e,t))}function ts(e){const{type:t,vnode:n,proxy:s,withProxy:r,propsOptions:[i],slots:o,attrs:l,emit:c,render:u,renderCache:a,props:h,data:v,setupState:y,ctx:A,inheritAttrs:P}=e,K=Cn(e);let H,k;try{if(n.shapeFlag&4){const g=r||s,M=g;H=Me(u.call(M,g,a,h,y,v,A)),k=l}else{const g=t;H=Me(g.length>1?g(h,{attrs:l,slots:o,emit:c}):g(h,null)),k=t.props?l:hc(l)}}catch(g){kt.length=0,Hn(g,e,1),H=ge(he)}let p=H;if(k&&P!==!1){const g=Object.keys(k),{shapeFlag:M}=p;g.length&&M&7&&(i&&g.some(Ms)&&(k=pc(k,i)),p=ot(p,k,!1,!0))}return n.dirs&&(p=ot(p,null,!1,!0),p.dirs=p.dirs?p.dirs.concat(n.dirs):n.dirs),n.transition&&qt(p,n.transition),H=p,Cn(K),H}const hc=e=>{let t;for(const n in e)(n==="class"||n==="style"||Qt(n))&&((t||(t={}))[n]=e[n]);return t},pc=(e,t)=>{const n={};for(const s in e)(!Ms(s)||!(s.slice(9)in t))&&(n[s]=e[s]);return n};function gc(e,t,n){const{props:s,children:r,component:i}=e,{props:o,children:l,patchFlag:c}=t,u=i.emitsOptions;if(t.dirs||t.transition)return!0;if(n&&c>=0){if(c&1024)return!0;if(c&16)return s?pr(s,o,u):!!o;if(c&8){const a=t.dynamicProps;for(let h=0;he.__isSuspense;function eo(e,t){t&&t.pendingBranch?B(e)?t.effects.push(...e):t.effects.push(e):xl(e)}const Se=Symbol.for("v-fgt"),_t=Symbol.for("v-txt"),he=Symbol.for("v-cmt"),Wt=Symbol.for("v-stc"),kt=[];let Ae=null;function Ts(e=!1){kt.push(Ae=e?null:[])}function mc(){kt.pop(),Ae=kt[kt.length-1]||null}let Xt=1;function gr(e,t=!1){Xt+=e,e<0&&Ae&&t&&(Ae.hasOnce=!0)}function to(e){return e.dynamicChildren=Xt>0?Ae||At:null,mc(),Xt>0&&Ae&&Ae.push(e),e}function vf(e,t,n,s,r,i){return to(so(e,t,n,s,r,i,!0))}function Es(e,t,n,s,r){return to(ge(e,t,n,s,r,!0))}function Yt(e){return e?e.__v_isVNode===!0:!1}function ht(e,t){return e.type===t.type&&e.key===t.key}const no=({key:e})=>e??null,yn=({ref:e,ref_key:t,ref_for:n})=>(typeof e=="number"&&(e=""+e),e!=null?oe(e)||ae(e)||G(e)?{i:pe,r:e,k:t,f:!!n}:e:null);function so(e,t=null,n=null,s=0,r=null,i=e===Se?0:1,o=!1,l=!1){const c={__v_isVNode:!0,__v_skip:!0,type:e,props:t,key:t&&no(t),ref:t&&yn(t),scopeId:bi,slotScopeIds:null,children:n,component:null,suspense:null,ssContent:null,ssFallback:null,dirs:null,transition:null,el:null,anchor:null,target:null,targetStart:null,targetAnchor:null,staticCount:0,shapeFlag:i,patchFlag:s,dynamicProps:r,dynamicChildren:null,appContext:null,ctx:pe};return l?(Ks(c,n),i&128&&e.normalize(c)):n&&(c.shapeFlag|=oe(n)?8:16),Xt>0&&!o&&Ae&&(c.patchFlag>0||i&6)&&c.patchFlag!==32&&Ae.push(c),c}const ge=vc;function vc(e,t=null,n=null,s=0,r=null,i=!1){if((!e||e===Ii)&&(e=he),Yt(e)){const l=ot(e,t,!0);return n&&Ks(l,n),Xt>0&&!i&&Ae&&(l.shapeFlag&6?Ae[Ae.indexOf(e)]=l:Ae.push(l)),l.patchFlag=-2,l}if(Ac(e)&&(e=e.__vccOpts),t){t=yc(t);let{class:l,style:c}=t;l&&!oe(l)&&(t.class=Ns(l)),se(c)&&(Vs(c)&&!B(c)&&(c=ue({},c)),t.style=Ls(c))}const o=oe(e)?1:Zi(e)?128:_i(e)?64:se(e)?4:G(e)?2:0;return so(e,t,n,s,r,o,i,!0)}function yc(e){return e?Vs(e)||Vi(e)?ue({},e):e:null}function ot(e,t,n=!1,s=!1){const{props:r,ref:i,patchFlag:o,children:l,transition:c}=e,u=t?bc(r||{},t):r,a={__v_isVNode:!0,__v_skip:!0,type:e.type,props:u,key:u&&no(u),ref:t&&t.ref?n&&i?B(i)?i.concat(yn(t)):[i,yn(t)]:yn(t):i,scopeId:e.scopeId,slotScopeIds:e.slotScopeIds,children:l,target:e.target,targetStart:e.targetStart,targetAnchor:e.targetAnchor,staticCount:e.staticCount,shapeFlag:e.shapeFlag,patchFlag:t&&e.type!==Se?o===-1?16:o|16:o,dynamicProps:e.dynamicProps,dynamicChildren:e.dynamicChildren,appContext:e.appContext,dirs:e.dirs,transition:c,component:e.component,suspense:e.suspense,ssContent:e.ssContent&&ot(e.ssContent),ssFallback:e.ssFallback&&ot(e.ssFallback),el:e.el,anchor:e.anchor,ctx:e.ctx,ce:e.ce};return c&&s&&qt(a,c.clone(a)),a}function ro(e=" ",t=0){return ge(_t,null,e,t)}function yf(e,t){const n=ge(Wt,null,e);return n.staticCount=t,n}function bf(e="",t=!1){return t?(Ts(),Es(he,null,e)):ge(he,null,e)}function Me(e){return e==null||typeof e=="boolean"?ge(he):B(e)?ge(Se,null,e.slice()):Yt(e)?nt(e):ge(_t,null,String(e))}function nt(e){return e.el===null&&e.patchFlag!==-1||e.memo?e:ot(e)}function Ks(e,t){let n=0;const{shapeFlag:s}=e;if(t==null)t=null;else if(B(t))n=16;else if(typeof t=="object")if(s&65){const r=t.default;r&&(r._c&&(r._d=!1),Ks(e,r()),r._c&&(r._d=!0));return}else{n=32;const r=t._;!r&&!Vi(t)?t._ctx=pe:r===3&&pe&&(pe.slots._===1?t._=1:(t._=2,e.patchFlag|=1024))}else G(t)?(t={default:t,_ctx:pe},n=32):(t=String(t),s&64?(n=16,t=[ro(t)]):n=8);e.children=t,e.shapeFlag|=n}function bc(...e){const t={};for(let n=0;nfe||pe;let Rn,Cs;{const e=Pn(),t=(n,s)=>{let r;return(r=e[n])||(r=e[n]=[]),r.push(s),i=>{r.length>1?r.forEach(o=>o(i)):r[0](i)}};Rn=t("__VUE_INSTANCE_SETTERS__",n=>fe=n),Cs=t("__VUE_SSR_SETTERS__",n=>zt=n)}const tn=e=>{const t=fe;return Rn(e),e.scope.on(),()=>{e.scope.off(),Rn(t)}},mr=()=>{fe&&fe.scope.off(),Rn(null)};function io(e){return e.vnode.shapeFlag&4}let zt=!1;function xc(e,t=!1,n=!1){t&&Cs(t);const{props:s,children:r}=e.vnode,i=io(e);Zl(e,s,i,t),sc(e,r,n||t);const o=i?Tc(e,t):void 0;return t&&Cs(!1),o}function Tc(e,t){const n=e.type;e.accessCache=Object.create(null),e.proxy=new Proxy(e.ctx,Ul);const{setup:s}=n;if(s){Ge();const r=e.setupContext=s.length>1?lo(e):null,i=tn(e),o=Zt(s,e,0,[e.props,r]),l=qr(o);if(Xe(),i(),(l||e.sp)&&!vt(e)&&Ai(e),l){if(o.then(mr,mr),t)return o.then(c=>{vr(e,c)}).catch(c=>{Hn(c,e,0)});e.asyncDep=o}else vr(e,o)}else oo(e)}function vr(e,t,n){G(t)?e.type.__ssrInlineRender?e.ssrRender=t:e.render=t:se(t)&&(e.setupState=gi(t)),oo(e)}function oo(e,t,n){const s=e.type;e.render||(e.render=s.render||ke);{const r=tn(e);Ge();try{Kl(e)}finally{Xe(),r()}}}const Ec={get(e,t){return be(e,"get",""),e[t]}};function lo(e){const t=n=>{e.exposed=n||{}};return{attrs:new Proxy(e.attrs,Ec),slots:e.slots,emit:e.emit,expose:t}}function qs(e){return e.exposed?e.exposeProxy||(e.exposeProxy=new Proxy(gi(vn(e.exposed)),{get(t,n){if(n in t)return t[n];if(n in Vt)return Vt[n](e)},has(t,n){return n in t||n in Vt}})):e.proxy}function Cc(e,t=!0){return G(e)?e.displayName||e.name:e.name||t&&e.__name}function Ac(e){return G(e)&&"__vccOpts"in e}const ie=(e,t)=>yl(e,t,zt);function As(e,t,n){const s=arguments.length;return s===2?se(t)&&!B(t)?Yt(t)?ge(e,null,[t]):ge(e,t):ge(e,null,t):(s>3?n=Array.prototype.slice.call(arguments,2):s===3&&Yt(n)&&(n=[n]),ge(e,t,n))}const Rc="3.5.14";/** -* @vue/runtime-dom v3.5.14 -* (c) 2018-present Yuxi (Evan) You and Vue contributors -* @license MIT -**/let Rs;const yr=typeof window<"u"&&window.trustedTypes;if(yr)try{Rs=yr.createPolicy("vue",{createHTML:e=>e})}catch{}const co=Rs?e=>Rs.createHTML(e):e=>e,Oc="http://www.w3.org/2000/svg",Mc="http://www.w3.org/1998/Math/MathML",Ke=typeof document<"u"?document:null,br=Ke&&Ke.createElement("template"),Ic={insert:(e,t,n)=>{t.insertBefore(e,n||null)},remove:e=>{const t=e.parentNode;t&&t.removeChild(e)},createElement:(e,t,n,s)=>{const r=t==="svg"?Ke.createElementNS(Oc,e):t==="mathml"?Ke.createElementNS(Mc,e):n?Ke.createElement(e,{is:n}):Ke.createElement(e);return e==="select"&&s&&s.multiple!=null&&r.setAttribute("multiple",s.multiple),r},createText:e=>Ke.createTextNode(e),createComment:e=>Ke.createComment(e),setText:(e,t)=>{e.nodeValue=t},setElementText:(e,t)=>{e.textContent=t},parentNode:e=>e.parentNode,nextSibling:e=>e.nextSibling,querySelector:e=>Ke.querySelector(e),setScopeId(e,t){e.setAttribute(t,"")},insertStaticContent(e,t,n,s,r,i){const o=n?n.previousSibling:t.lastChild;if(r&&(r===i||r.nextSibling))for(;t.insertBefore(r.cloneNode(!0),n),!(r===i||!(r=r.nextSibling)););else{br.innerHTML=co(s==="svg"?`${e}`:s==="mathml"?`${e}`:e);const l=br.content;if(s==="svg"||s==="mathml"){const c=l.firstChild;for(;c.firstChild;)l.appendChild(c.firstChild);l.removeChild(c)}t.insertBefore(l,n)}return[o?o.nextSibling:t.firstChild,n?n.previousSibling:t.lastChild]}},Ze="transition",Ht="animation",Jt=Symbol("_vtc"),ao={name:String,type:String,css:{type:Boolean,default:!0},duration:[String,Number,Object],enterFromClass:String,enterActiveClass:String,enterToClass:String,appearFromClass:String,appearActiveClass:String,appearToClass:String,leaveFromClass:String,leaveActiveClass:String,leaveToClass:String},Pc=ue({},wi,ao),Lc=e=>(e.displayName="Transition",e.props=Pc,e),_f=Lc((e,{slots:t})=>As(Rl,Nc(e),t)),ft=(e,t=[])=>{B(e)?e.forEach(n=>n(...t)):e&&e(...t)},_r=e=>e?B(e)?e.some(t=>t.length>1):e.length>1:!1;function Nc(e){const t={};for(const b in e)b in ao||(t[b]=e[b]);if(e.css===!1)return t;const{name:n="v",type:s,duration:r,enterFromClass:i=`${n}-enter-from`,enterActiveClass:o=`${n}-enter-active`,enterToClass:l=`${n}-enter-to`,appearFromClass:c=i,appearActiveClass:u=o,appearToClass:a=l,leaveFromClass:h=`${n}-leave-from`,leaveActiveClass:v=`${n}-leave-active`,leaveToClass:y=`${n}-leave-to`}=e,A=Fc(r),P=A&&A[0],K=A&&A[1],{onBeforeEnter:H,onEnter:k,onEnterCancelled:p,onLeave:g,onLeaveCancelled:M,onBeforeAppear:V=H,onAppear:R=k,onAppearCancelled:U=p}=t,T=(b,N,Y,re)=>{b._enterCancelled=re,ut(b,N?a:l),ut(b,N?u:o),Y&&Y()},I=(b,N)=>{b._isLeaving=!1,ut(b,h),ut(b,y),ut(b,v),N&&N()},E=b=>(N,Y)=>{const re=b?R:k,j=()=>T(N,b,Y);ft(re,[N,j]),wr(()=>{ut(N,b?c:i),Be(N,b?a:l),_r(re)||Sr(N,s,P,j)})};return ue(t,{onBeforeEnter(b){ft(H,[b]),Be(b,i),Be(b,o)},onBeforeAppear(b){ft(V,[b]),Be(b,c),Be(b,u)},onEnter:E(!1),onAppear:E(!0),onLeave(b,N){b._isLeaving=!0;const Y=()=>I(b,N);Be(b,h),b._enterCancelled?(Be(b,v),Er()):(Er(),Be(b,v)),wr(()=>{b._isLeaving&&(ut(b,h),Be(b,y),_r(g)||Sr(b,s,K,Y))}),ft(g,[b,Y])},onEnterCancelled(b){T(b,!1,void 0,!0),ft(p,[b])},onAppearCancelled(b){T(b,!0,void 0,!0),ft(U,[b])},onLeaveCancelled(b){I(b),ft(M,[b])}})}function Fc(e){if(e==null)return null;if(se(e))return[ns(e.enter),ns(e.leave)];{const t=ns(e);return[t,t]}}function ns(e){return Lo(e)}function Be(e,t){t.split(/\s+/).forEach(n=>n&&e.classList.add(n)),(e[Jt]||(e[Jt]=new Set)).add(t)}function ut(e,t){t.split(/\s+/).forEach(s=>s&&e.classList.remove(s));const n=e[Jt];n&&(n.delete(t),n.size||(e[Jt]=void 0))}function wr(e){requestAnimationFrame(()=>{requestAnimationFrame(e)})}let Hc=0;function Sr(e,t,n,s){const r=e._endId=++Hc,i=()=>{r===e._endId&&s()};if(n!=null)return setTimeout(i,n);const{type:o,timeout:l,propCount:c}=Dc(e,t);if(!o)return s();const u=o+"end";let a=0;const h=()=>{e.removeEventListener(u,v),i()},v=y=>{y.target===e&&++a>=c&&h()};setTimeout(()=>{a(n[A]||"").split(", "),r=s(`${Ze}Delay`),i=s(`${Ze}Duration`),o=xr(r,i),l=s(`${Ht}Delay`),c=s(`${Ht}Duration`),u=xr(l,c);let a=null,h=0,v=0;t===Ze?o>0&&(a=Ze,h=o,v=i.length):t===Ht?u>0&&(a=Ht,h=u,v=c.length):(h=Math.max(o,u),a=h>0?o>u?Ze:Ht:null,v=a?a===Ze?i.length:c.length:0);const y=a===Ze&&/\b(transform|all)(,|$)/.test(s(`${Ze}Property`).toString());return{type:a,timeout:h,propCount:v,hasTransform:y}}function xr(e,t){for(;e.lengthTr(n)+Tr(e[s])))}function Tr(e){return e==="auto"?0:Number(e.slice(0,-1).replace(",","."))*1e3}function Er(){return document.body.offsetHeight}function $c(e,t,n){const s=e[Jt];s&&(t=(t?[t,...s]:[...s]).join(" ")),t==null?e.removeAttribute("class"):n?e.setAttribute("class",t):e.className=t}const Cr=Symbol("_vod"),jc=Symbol("_vsh"),Vc=Symbol(""),Wc=/(^|;)\s*display\s*:/;function kc(e,t,n){const s=e.style,r=oe(n);let i=!1;if(n&&!r){if(t)if(oe(t))for(const o of t.split(";")){const l=o.slice(0,o.indexOf(":")).trim();n[l]==null&&bn(s,l,"")}else for(const o in t)n[o]==null&&bn(s,o,"");for(const o in n)o==="display"&&(i=!0),bn(s,o,n[o])}else if(r){if(t!==n){const o=s[Vc];o&&(n+=";"+o),s.cssText=n,i=Wc.test(n)}}else t&&e.removeAttribute("style");Cr in e&&(e[Cr]=i?s.display:"",e[jc]&&(s.display="none"))}const Ar=/\s*!important$/;function bn(e,t,n){if(B(n))n.forEach(s=>bn(e,t,s));else if(n==null&&(n=""),t.startsWith("--"))e.setProperty(t,n);else{const s=Uc(e,t);Ar.test(n)?e.setProperty(lt(s),n.replace(Ar,""),"important"):e[s]=n}}const Rr=["Webkit","Moz","ms"],ss={};function Uc(e,t){const n=ss[t];if(n)return n;let s=Ne(t);if(s!=="filter"&&s in e)return ss[t]=s;s=In(s);for(let r=0;rrs||(Xc.then(()=>rs=0),rs=Date.now());function zc(e,t){const n=s=>{if(!s._vts)s._vts=Date.now();else if(s._vts<=n.attached)return;De(Jc(s,n.value),t,5,[s])};return n.value=e,n.attached=Yc(),n}function Jc(e,t){if(B(t)){const n=e.stopImmediatePropagation;return e.stopImmediatePropagation=()=>{n.call(e),e._stopped=!0},t.map(s=>r=>!r._stopped&&s&&s(r))}else return t}const Nr=e=>e.charCodeAt(0)===111&&e.charCodeAt(1)===110&&e.charCodeAt(2)>96&&e.charCodeAt(2)<123,Qc=(e,t,n,s,r,i)=>{const o=r==="svg";t==="class"?$c(e,s,o):t==="style"?kc(e,n,s):Qt(t)?Ms(t)||qc(e,t,n,s,i):(t[0]==="."?(t=t.slice(1),!0):t[0]==="^"?(t=t.slice(1),!1):Zc(e,t,s,o))?(Ir(e,t,s),!e.tagName.includes("-")&&(t==="value"||t==="checked"||t==="selected")&&Mr(e,t,s,o,i,t!=="value")):e._isVueCE&&(/[A-Z]/.test(t)||!oe(s))?Ir(e,Ne(t),s,i,t):(t==="true-value"?e._trueValue=s:t==="false-value"&&(e._falseValue=s),Mr(e,t,s,o))};function Zc(e,t,n,s){if(s)return!!(t==="innerHTML"||t==="textContent"||t in e&&Nr(t)&&G(n));if(t==="spellcheck"||t==="draggable"||t==="translate"||t==="autocorrect"||t==="form"||t==="list"&&e.tagName==="INPUT"||t==="type"&&e.tagName==="TEXTAREA")return!1;if(t==="width"||t==="height"){const r=e.tagName;if(r==="IMG"||r==="VIDEO"||r==="CANVAS"||r==="SOURCE")return!1}return Nr(t)&&oe(n)?!1:t in e}const ea=["ctrl","shift","alt","meta"],ta={stop:e=>e.stopPropagation(),prevent:e=>e.preventDefault(),self:e=>e.target!==e.currentTarget,ctrl:e=>!e.ctrlKey,shift:e=>!e.shiftKey,alt:e=>!e.altKey,meta:e=>!e.metaKey,left:e=>"button"in e&&e.button!==0,middle:e=>"button"in e&&e.button!==1,right:e=>"button"in e&&e.button!==2,exact:(e,t)=>ea.some(n=>e[`${n}Key`]&&!t.includes(n))},wf=(e,t)=>{const n=e._withMods||(e._withMods={}),s=t.join(".");return n[s]||(n[s]=(r,...i)=>{for(let o=0;o{const n=e._withKeys||(e._withKeys={}),s=t.join(".");return n[s]||(n[s]=r=>{if(!("key"in r))return;const i=lt(r.key);if(t.some(o=>o===i||na[o]===i))return e(r)})},sa=ue({patchProp:Qc},Ic);let is,Fr=!1;function ra(){return is=Fr?is:ic(sa),Fr=!0,is}const xf=(...e)=>{const t=ra().createApp(...e),{mount:n}=t;return t.mount=s=>{const r=oa(s);if(r)return n(r,!0,ia(r))},t};function ia(e){if(e instanceof SVGElement)return"svg";if(typeof MathMLElement=="function"&&e instanceof MathMLElement)return"mathml"}function oa(e){return oe(e)?document.querySelector(e):e}const la=window.__VP_SITE_DATA__;function fo(e){return Zr()?(ko(e),!0):!1}const os=new WeakMap,ca=(...e)=>{var t;const n=e[0],s=(t=en())==null?void 0:t.proxy;if(s==null&&!Di())throw new Error("injectLocal must be called in setup");return s&&os.has(s)&&n in os.get(s)?os.get(s)[n]:bt(...e)},uo=typeof window<"u"&&typeof document<"u";typeof WorkerGlobalScope<"u"&&globalThis instanceof WorkerGlobalScope;const aa=Object.prototype.toString,fa=e=>aa.call(e)==="[object Object]",St=()=>{},Hr=ua();function ua(){var e,t;return uo&&((e=window==null?void 0:window.navigator)==null?void 0:e.userAgent)&&(/iP(?:ad|hone|od)/.test(window.navigator.userAgent)||((t=window==null?void 0:window.navigator)==null?void 0:t.maxTouchPoints)>2&&/iPad|Macintosh/.test(window==null?void 0:window.navigator.userAgent))}function Gs(e,t){function n(...s){return new Promise((r,i)=>{Promise.resolve(e(()=>t.apply(this,s),{fn:t,thisArg:this,args:s})).then(r).catch(i)})}return n}const ho=e=>e();function da(e,t={}){let n,s,r=St;const i=c=>{clearTimeout(c),r(),r=St};let o;return c=>{const u=le(e),a=le(t.maxWait);return n&&i(n),u<=0||a!==void 0&&a<=0?(s&&(i(s),s=null),Promise.resolve(c())):new Promise((h,v)=>{r=t.rejectOnCancel?v:h,o=c,a&&!s&&(s=setTimeout(()=>{n&&i(n),s=null,h(o())},a)),n=setTimeout(()=>{s&&i(s),s=null,h(c())},u)})}}function ha(...e){let t=0,n,s=!0,r=St,i,o,l,c,u;!ae(e[0])&&typeof e[0]=="object"?{delay:o,trailing:l=!0,leading:c=!0,rejectOnCancel:u=!1}=e[0]:[o,l=!0,c=!0,u=!1]=e;const a=()=>{n&&(clearTimeout(n),n=void 0,r(),r=St)};return v=>{const y=le(o),A=Date.now()-t,P=()=>i=v();return a(),y<=0?(t=Date.now(),P()):(A>y&&(c||!s)?(t=Date.now(),P()):l&&(i=new Promise((K,H)=>{r=u?H:K,n=setTimeout(()=>{t=Date.now(),s=!0,K(P()),a()},Math.max(0,y-A))})),!c&&!n&&(n=setTimeout(()=>s=!0,y)),s=!1,i)}}function pa(e=ho,t={}){const{initialState:n="active"}=t,s=Xs(n==="active");function r(){s.value=!1}function i(){s.value=!0}const o=(...l)=>{s.value&&e(...l)};return{isActive:Fn(s),pause:r,resume:i,eventFilter:o}}function Dr(e){return e.endsWith("rem")?Number.parseFloat(e)*16:Number.parseFloat(e)}function ga(e){return en()}function ls(e){return Array.isArray(e)?e:[e]}function Xs(...e){if(e.length!==1)return gl(...e);const t=e[0];return typeof t=="function"?Fn(dl(()=>({get:t,set:St}))):mt(t)}function ma(e,t=200,n={}){return Gs(da(t,n),e)}function va(e,t=200,n=!1,s=!0,r=!1){return Gs(ha(t,n,s,r),e)}function ya(e,t,n={}){const{eventFilter:s=ho,...r}=n;return Le(e,Gs(s,t),r)}function ba(e,t,n={}){const{eventFilter:s,initialState:r="active",...i}=n,{eventFilter:o,pause:l,resume:c,isActive:u}=pa(s,{initialState:r});return{stop:ya(e,t,{...i,eventFilter:o}),pause:l,resume:c,isActive:u}}function Un(e,t=!0,n){ga()?Pt(e,n):t?e():Dn(e)}function _a(e,t,n){return Le(e,t,{...n,immediate:!0})}const Ye=uo?window:void 0;function Ys(e){var t;const n=le(e);return(t=n==null?void 0:n.$el)!=null?t:n}function ze(...e){const t=[],n=()=>{t.forEach(l=>l()),t.length=0},s=(l,c,u,a)=>(l.addEventListener(c,u,a),()=>l.removeEventListener(c,u,a)),r=ie(()=>{const l=ls(le(e[0])).filter(c=>c!=null);return l.every(c=>typeof c!="string")?l:void 0}),i=_a(()=>{var l,c;return[(c=(l=r.value)==null?void 0:l.map(u=>Ys(u)))!=null?c:[Ye].filter(u=>u!=null),ls(le(r.value?e[1]:e[0])),ls(Ws(r.value?e[2]:e[1])),le(r.value?e[3]:e[2])]},([l,c,u,a])=>{if(n(),!(l!=null&&l.length)||!(c!=null&&c.length)||!(u!=null&&u.length))return;const h=fa(a)?{...a}:a;t.push(...l.flatMap(v=>c.flatMap(y=>u.map(A=>s(v,y,A,h)))))},{flush:"post"}),o=()=>{i(),n()};return fo(n),o}function wa(){const e=Pe(!1),t=en();return t&&Pt(()=>{e.value=!0},t),e}function Sa(e){const t=wa();return ie(()=>(t.value,!!e()))}function xa(e){return typeof e=="function"?e:typeof e=="string"?t=>t.key===e:Array.isArray(e)?t=>e.includes(t.key):()=>!0}function Tf(...e){let t,n,s={};e.length===3?(t=e[0],n=e[1],s=e[2]):e.length===2?typeof e[1]=="object"?(t=!0,n=e[0],s=e[1]):(t=e[0],n=e[1]):(t=!0,n=e[0]);const{target:r=Ye,eventName:i="keydown",passive:o=!1,dedupe:l=!1}=s,c=xa(t);return ze(r,i,a=>{a.repeat&&le(l)||c(a)&&n(a)},o)}const Ta=Symbol("vueuse-ssr-width");function Ea(){const e=Di()?ca(Ta,null):null;return typeof e=="number"?e:void 0}function po(e,t={}){const{window:n=Ye,ssrWidth:s=Ea()}=t,r=Sa(()=>n&&"matchMedia"in n&&typeof n.matchMedia=="function"),i=Pe(typeof s=="number"),o=Pe(),l=Pe(!1),c=u=>{l.value=u.matches};return Yi(()=>{if(i.value){i.value=!r.value;const u=le(e).split(",");l.value=u.some(a=>{const h=a.includes("not all"),v=a.match(/\(\s*min-width:\s*(-?\d+(?:\.\d*)?[a-z]+\s*)\)/),y=a.match(/\(\s*max-width:\s*(-?\d+(?:\.\d*)?[a-z]+\s*)\)/);let A=!!(v||y);return v&&A&&(A=s>=Dr(v[1])),y&&A&&(A=s<=Dr(y[1])),h?!A:A});return}r.value&&(o.value=n.matchMedia(le(e)),l.value=o.value.matches)}),ze(o,"change",c,{passive:!0}),ie(()=>l.value)}const dn=typeof globalThis<"u"?globalThis:typeof window<"u"?window:typeof global<"u"?global:typeof self<"u"?self:{},hn="__vueuse_ssr_handlers__",Ca=Aa();function Aa(){return hn in dn||(dn[hn]=dn[hn]||{}),dn[hn]}function go(e,t){return Ca[e]||t}function mo(e){return po("(prefers-color-scheme: dark)",e)}function Ra(e){return e==null?"any":e instanceof Set?"set":e instanceof Map?"map":e instanceof Date?"date":typeof e=="boolean"?"boolean":typeof e=="string"?"string":typeof e=="object"?"object":Number.isNaN(e)?"any":"number"}const Oa={boolean:{read:e=>e==="true",write:e=>String(e)},object:{read:e=>JSON.parse(e),write:e=>JSON.stringify(e)},number:{read:e=>Number.parseFloat(e),write:e=>String(e)},any:{read:e=>e,write:e=>String(e)},string:{read:e=>e,write:e=>String(e)},map:{read:e=>new Map(JSON.parse(e)),write:e=>JSON.stringify(Array.from(e.entries()))},set:{read:e=>new Set(JSON.parse(e)),write:e=>JSON.stringify(Array.from(e))},date:{read:e=>new Date(e),write:e=>e.toISOString()}},$r="vueuse-storage";function Ma(e,t,n,s={}){var r;const{flush:i="pre",deep:o=!0,listenToStorageChanges:l=!0,writeDefaults:c=!0,mergeDefaults:u=!1,shallow:a,window:h=Ye,eventFilter:v,onError:y=E=>{console.error(E)},initOnMounted:A}=s,P=(a?Pe:mt)(typeof t=="function"?t():t),K=ie(()=>le(e));if(!n)try{n=go("getDefaultStorage",()=>{var E;return(E=Ye)==null?void 0:E.localStorage})()}catch(E){y(E)}if(!n)return P;const H=le(t),k=Ra(H),p=(r=s.serializer)!=null?r:Oa[k],{pause:g,resume:M}=ba(P,()=>R(P.value),{flush:i,deep:o,eventFilter:v});Le(K,()=>T(),{flush:i}),h&&l&&Un(()=>{n instanceof Storage?ze(h,"storage",T,{passive:!0}):ze(h,$r,I),A&&T()}),A||T();function V(E,b){if(h){const N={key:K.value,oldValue:E,newValue:b,storageArea:n};h.dispatchEvent(n instanceof Storage?new StorageEvent("storage",N):new CustomEvent($r,{detail:N}))}}function R(E){try{const b=n.getItem(K.value);if(E==null)V(b,null),n.removeItem(K.value);else{const N=p.write(E);b!==N&&(n.setItem(K.value,N),V(b,N))}}catch(b){y(b)}}function U(E){const b=E?E.newValue:n.getItem(K.value);if(b==null)return c&&H!=null&&n.setItem(K.value,p.write(H)),H;if(!E&&u){const N=p.read(b);return typeof u=="function"?u(N,H):k==="object"&&!Array.isArray(N)?{...H,...N}:N}else return typeof b!="string"?b:p.read(b)}function T(E){if(!(E&&E.storageArea!==n)){if(E&&E.key==null){P.value=H;return}if(!(E&&E.key!==K.value)){g();try{(E==null?void 0:E.newValue)!==p.write(P.value)&&(P.value=U(E))}catch(b){y(b)}finally{E?Dn(M):M()}}}}function I(E){T(E.detail)}return P}const Ia="*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}";function Pa(e={}){const{selector:t="html",attribute:n="class",initialValue:s="auto",window:r=Ye,storage:i,storageKey:o="vueuse-color-scheme",listenToStorageChanges:l=!0,storageRef:c,emitAuto:u,disableTransition:a=!0}=e,h={auto:"",light:"light",dark:"dark",...e.modes||{}},v=mo({window:r}),y=ie(()=>v.value?"dark":"light"),A=c||(o==null?Xs(s):Ma(o,s,i,{window:r,listenToStorageChanges:l})),P=ie(()=>A.value==="auto"?y.value:A.value),K=go("updateHTMLAttrs",(g,M,V)=>{const R=typeof g=="string"?r==null?void 0:r.document.querySelector(g):Ys(g);if(!R)return;const U=new Set,T=new Set;let I=null;if(M==="class"){const b=V.split(/\s/g);Object.values(h).flatMap(N=>(N||"").split(/\s/g)).filter(Boolean).forEach(N=>{b.includes(N)?U.add(N):T.add(N)})}else I={key:M,value:V};if(U.size===0&&T.size===0&&I===null)return;let E;a&&(E=r.document.createElement("style"),E.appendChild(document.createTextNode(Ia)),r.document.head.appendChild(E));for(const b of U)R.classList.add(b);for(const b of T)R.classList.remove(b);I&&R.setAttribute(I.key,I.value),a&&(r.getComputedStyle(E).opacity,document.head.removeChild(E))});function H(g){var M;K(t,n,(M=h[g])!=null?M:g)}function k(g){e.onChanged?e.onChanged(g,H):H(g)}Le(P,k,{flush:"post",immediate:!0}),Un(()=>k(P.value));const p=ie({get(){return u?A.value:P.value},set(g){A.value=g}});return Object.assign(p,{store:A,system:y,state:P})}function La(e={}){const{valueDark:t="dark",valueLight:n=""}=e,s=Pa({...e,onChanged:(o,l)=>{var c;e.onChanged?(c=e.onChanged)==null||c.call(e,o==="dark",l,o):l(o)},modes:{dark:t,light:n}}),r=ie(()=>s.system.value);return ie({get(){return s.value==="dark"},set(o){const l=o?"dark":"light";r.value===l?s.value="auto":s.value=l}})}function cs(e){return typeof Window<"u"&&e instanceof Window?e.document.documentElement:typeof Document<"u"&&e instanceof Document?e.documentElement:e}const jr=1;function Na(e,t={}){const{throttle:n=0,idle:s=200,onStop:r=St,onScroll:i=St,offset:o={left:0,right:0,top:0,bottom:0},eventListenerOptions:l={capture:!1,passive:!0},behavior:c="auto",window:u=Ye,onError:a=R=>{console.error(R)}}=t,h=Pe(0),v=Pe(0),y=ie({get(){return h.value},set(R){P(R,void 0)}}),A=ie({get(){return v.value},set(R){P(void 0,R)}});function P(R,U){var T,I,E,b;if(!u)return;const N=le(e);if(!N)return;(E=N instanceof Document?u.document.body:N)==null||E.scrollTo({top:(T=le(U))!=null?T:A.value,left:(I=le(R))!=null?I:y.value,behavior:le(c)});const Y=((b=N==null?void 0:N.document)==null?void 0:b.documentElement)||(N==null?void 0:N.documentElement)||N;y!=null&&(h.value=Y.scrollLeft),A!=null&&(v.value=Y.scrollTop)}const K=Pe(!1),H=It({left:!0,right:!1,top:!0,bottom:!1}),k=It({left:!1,right:!1,top:!1,bottom:!1}),p=R=>{K.value&&(K.value=!1,k.left=!1,k.right=!1,k.top=!1,k.bottom=!1,r(R))},g=ma(p,n+s),M=R=>{var U;if(!u)return;const T=((U=R==null?void 0:R.document)==null?void 0:U.documentElement)||(R==null?void 0:R.documentElement)||Ys(R),{display:I,flexDirection:E,direction:b}=getComputedStyle(T),N=b==="rtl"?-1:1,Y=T.scrollLeft;k.left=Yh.value;const re=Math.abs(Y*N)<=(o.left||0),j=Math.abs(Y*N)+T.clientWidth>=T.scrollWidth-(o.right||0)-jr;I==="flex"&&E==="row-reverse"?(H.left=j,H.right=re):(H.left=re,H.right=j),h.value=Y;let X=T.scrollTop;R===u.document&&!X&&(X=u.document.body.scrollTop),k.top=Xv.value;const D=Math.abs(X)<=(o.top||0),ce=Math.abs(X)+T.clientHeight>=T.scrollHeight-(o.bottom||0)-jr;I==="flex"&&E==="column-reverse"?(H.top=ce,H.bottom=D):(H.top=D,H.bottom=ce),v.value=X},V=R=>{var U;if(!u)return;const T=(U=R.target.documentElement)!=null?U:R.target;M(T),K.value=!0,g(R),i(R)};return ze(e,"scroll",n?va(V,n,!0,!1):V,l),Un(()=>{try{const R=le(e);if(!R)return;M(R)}catch(R){a(R)}}),ze(e,"scrollend",p,l),{x:y,y:A,isScrolling:K,arrivedState:H,directions:k,measure(){const R=le(e);u&&R&&M(R)}}}function vo(e){const t=window.getComputedStyle(e);if(t.overflowX==="scroll"||t.overflowY==="scroll"||t.overflowX==="auto"&&e.clientWidth1?!0:(t.preventDefault&&t.preventDefault(),!1)}const as=new WeakMap;function Ef(e,t=!1){const n=Pe(t);let s=null,r="";Le(Xs(e),l=>{const c=cs(le(l));if(c){const u=c;if(as.get(u)||as.set(u,u.style.overflow),u.style.overflow!=="hidden"&&(r=u.style.overflow),u.style.overflow==="hidden")return n.value=!0;if(n.value)return u.style.overflow="hidden"}},{immediate:!0});const i=()=>{const l=cs(le(e));!l||n.value||(Hr&&(s=ze(l,"touchmove",c=>{Fa(c)},{passive:!1})),l.style.overflow="hidden",n.value=!0)},o=()=>{const l=cs(le(e));!l||!n.value||(Hr&&(s==null||s()),l.style.overflow=r,as.delete(l),n.value=!1)};return fo(o),ie({get(){return n.value},set(l){l?i():o()}})}function Cf(e={}){const{window:t=Ye,...n}=e;return Na(t,n)}function Af(e={}){const{window:t=Ye,initialWidth:n=Number.POSITIVE_INFINITY,initialHeight:s=Number.POSITIVE_INFINITY,listenOrientation:r=!0,includeScrollbar:i=!0,type:o="inner"}=e,l=Pe(n),c=Pe(s),u=()=>{if(t)if(o==="outer")l.value=t.outerWidth,c.value=t.outerHeight;else if(o==="visual"&&t.visualViewport){const{width:h,height:v,scale:y}=t.visualViewport;l.value=Math.round(h*y),c.value=Math.round(v*y)}else i?(l.value=t.innerWidth,c.value=t.innerHeight):(l.value=t.document.documentElement.clientWidth,c.value=t.document.documentElement.clientHeight)};u(),Un(u);const a={passive:!0};if(ze("resize",u,a),t&&o==="visual"&&t.visualViewport&&ze(t.visualViewport,"resize",u,a),r){const h=po("(orientation: portrait)");Le(h,()=>u())}return{width:l,height:c}}const fs={};var us={};const yo=/^(?:[a-z]+:|\/\/)/i,Ha="vitepress-theme-appearance",Da=/#.*$/,$a=/[?#].*$/,ja=/(?:(^|\/)index)?\.(?:md|html)$/,ye=typeof document<"u",bo={relativePath:"404.md",filePath:"",title:"404",description:"Not Found",headers:[],frontmatter:{sidebar:!1,layout:"page"},lastUpdated:0,isNotFound:!0};function Va(e,t,n=!1){if(t===void 0)return!1;if(e=Vr(`/${e}`),n)return new RegExp(t).test(e);if(Vr(t)!==e)return!1;const s=t.match(Da);return s?(ye?location.hash:"")===s[0]:!0}function Vr(e){return decodeURI(e).replace($a,"").replace(ja,"$1")}function Wa(e){return yo.test(e)}function ka(e,t){return Object.keys((e==null?void 0:e.locales)||{}).find(n=>n!=="root"&&!Wa(n)&&Va(t,`/${n}/`,!0))||"root"}function Ua(e,t){var s,r,i,o,l,c,u;const n=ka(e,t);return Object.assign({},e,{localeIndex:n,lang:((s=e.locales[n])==null?void 0:s.lang)??e.lang,dir:((r=e.locales[n])==null?void 0:r.dir)??e.dir,title:((i=e.locales[n])==null?void 0:i.title)??e.title,titleTemplate:((o=e.locales[n])==null?void 0:o.titleTemplate)??e.titleTemplate,description:((l=e.locales[n])==null?void 0:l.description)??e.description,head:wo(e.head,((c=e.locales[n])==null?void 0:c.head)??[]),themeConfig:{...e.themeConfig,...(u=e.locales[n])==null?void 0:u.themeConfig}})}function _o(e,t){const n=t.title||e.title,s=t.titleTemplate??e.titleTemplate;if(typeof s=="string"&&s.includes(":title"))return s.replace(/:title/g,n);const r=Ba(e.title,s);return n===r.slice(3)?n:`${n}${r}`}function Ba(e,t){return t===!1?"":t===!0||t===void 0?` | ${e}`:e===t?"":` | ${t}`}function Ka(e,t){const[n,s]=t;if(n!=="meta")return!1;const r=Object.entries(s)[0];return r==null?!1:e.some(([i,o])=>i===n&&o[r[0]]===r[1])}function wo(e,t){return[...e.filter(n=>!Ka(t,n)),...t]}const qa=/[\u0000-\u001F"#$&*+,:;<=>?[\]^`{|}\u007F]/g,Ga=/^[a-z]:/i;function Wr(e){const t=Ga.exec(e),n=t?t[0]:"";return n+e.slice(n.length).replace(qa,"_").replace(/(^|\/)_+(?=[^/]*$)/,"$1")}const ds=new Set;function Xa(e){if(ds.size===0){const n=typeof process=="object"&&(us==null?void 0:us.VITE_EXTRA_EXTENSIONS)||(fs==null?void 0:fs.VITE_EXTRA_EXTENSIONS)||"";("3g2,3gp,aac,ai,apng,au,avif,bin,bmp,cer,class,conf,crl,css,csv,dll,doc,eps,epub,exe,gif,gz,ics,ief,jar,jpe,jpeg,jpg,js,json,jsonld,m4a,man,mid,midi,mjs,mov,mp2,mp3,mp4,mpe,mpeg,mpg,mpp,oga,ogg,ogv,ogx,opus,otf,p10,p7c,p7m,p7s,pdf,png,ps,qt,roff,rtf,rtx,ser,svg,t,tif,tiff,tr,ts,tsv,ttf,txt,vtt,wav,weba,webm,webp,woff,woff2,xhtml,xml,yaml,yml,zip"+(n&&typeof n=="string"?","+n:"")).split(",").forEach(s=>ds.add(s))}const t=e.split(".").pop();return t==null||!ds.has(t.toLowerCase())}const Ya=Symbol(),wt=Pe(la);function Rf(e){const t=ie(()=>Ua(wt.value,e.data.relativePath)),n=t.value.appearance,s=n==="force-dark"?mt(!0):n==="force-auto"?mo():n?La({storageKey:Ha,initialValue:()=>n==="dark"?"dark":"auto",...typeof n=="object"?n:{}}):mt(!1),r=mt(ye?location.hash:"");return ye&&window.addEventListener("hashchange",()=>{r.value=location.hash}),Le(()=>e.data,()=>{r.value=ye?location.hash:""}),{site:t,theme:ie(()=>t.value.themeConfig),page:ie(()=>e.data),frontmatter:ie(()=>e.data.frontmatter),params:ie(()=>e.data.params),lang:ie(()=>t.value.lang),dir:ie(()=>e.data.frontmatter.dir||t.value.dir),localeIndex:ie(()=>t.value.localeIndex||"root"),title:ie(()=>_o(t.value,e.data)),description:ie(()=>e.data.description||t.value.description),isDark:s,hash:ie(()=>r.value)}}function za(){const e=bt(Ya);if(!e)throw new Error("vitepress data not properly injected in app");return e}function Ja(e,t){return`${e}${t}`.replace(/\/+/g,"/")}function kr(e){return yo.test(e)||!e.startsWith("/")?e:Ja(wt.value.base,e)}function Qa(e){let t=e.replace(/\.html$/,"");if(t=decodeURIComponent(t),t=t.replace(/\/$/,"/index"),ye){const n="/docs/";t=Wr(t.slice(n.length).replace(/\//g,"_")||"index")+".md";let s=__VP_HASH_MAP__[t.toLowerCase()];if(s||(t=t.endsWith("_index.md")?t.slice(0,-9)+".md":t.slice(0,-3)+"_index.md",s=__VP_HASH_MAP__[t.toLowerCase()]),!s)return null;t=`${n}assets/${t}.${s}.js`}else t=`./${Wr(t.slice(1).replace(/\//g,"_"))}.md.js`;return t}let _n=[];function Of(e){_n.push(e),Vn(()=>{_n=_n.filter(t=>t!==e)})}function Za(){let e=wt.value.scrollOffset,t=0,n=24;if(typeof e=="object"&&"padding"in e&&(n=e.padding,e=e.selector),typeof e=="number")t=e;else if(typeof e=="string")t=Ur(e,n);else if(Array.isArray(e))for(const s of e){const r=Ur(s,n);if(r){t=r;break}}return t}function Ur(e,t){const n=document.querySelector(e);if(!n)return 0;const s=n.getBoundingClientRect().bottom;return s<0?0:s+t}const ef=Symbol(),So="http://a.com",tf=()=>({path:"/",component:null,data:bo});function Mf(e,t){const n=It(tf()),s={route:n,go:r};async function r(l=ye?location.href:"/"){var c,u;l=hs(l),await((c=s.onBeforeRouteChange)==null?void 0:c.call(s,l))!==!1&&(ye&&l!==hs(location.href)&&(history.replaceState({scrollPosition:window.scrollY},""),history.pushState({},"",l)),await o(l),await((u=s.onAfterRouteChange??s.onAfterRouteChanged)==null?void 0:u(l)))}let i=null;async function o(l,c=0,u=!1){var v,y;if(await((v=s.onBeforePageLoad)==null?void 0:v.call(s,l))===!1)return;const a=new URL(l,So),h=i=a.pathname;try{let A=await e(h);if(!A)throw new Error(`Page not found: ${h}`);if(i===h){i=null;const{default:P,__pageData:K}=A;if(!P)throw new Error(`Invalid route component: ${P}`);await((y=s.onAfterPageLoad)==null?void 0:y.call(s,l)),n.path=ye?h:kr(h),n.component=vn(P),n.data=vn(K),ye&&Dn(()=>{let H=wt.value.base+K.relativePath.replace(/(?:(^|\/)index)?\.md$/,"$1");if(!wt.value.cleanUrls&&!H.endsWith("/")&&(H+=".html"),H!==a.pathname&&(a.pathname=H,l=H+a.search+a.hash,history.replaceState({},"",l)),a.hash&&!c){let k=null;try{k=document.getElementById(decodeURIComponent(a.hash).slice(1))}catch(p){console.warn(p)}if(k){Br(k,a.hash);return}}window.scrollTo(0,c)})}}catch(A){if(!/fetch|Page not found/.test(A.message)&&!/^\/404(\.html|\/)?$/.test(l)&&console.error(A),!u)try{const P=await fetch(wt.value.base+"hashmap.json");window.__VP_HASH_MAP__=await P.json(),await o(l,c,!0);return}catch{}if(i===h){i=null,n.path=ye?h:kr(h),n.component=t?vn(t):null;const P=ye?h.replace(/(^|\/)$/,"$1index").replace(/(\.html)?$/,".md").replace(/^\//,""):"404.md";n.data={...bo,relativePath:P}}}}return ye&&(history.state===null&&history.replaceState({},""),window.addEventListener("click",l=>{if(l.defaultPrevented||!(l.target instanceof Element)||l.target.closest("button")||l.button!==0||l.ctrlKey||l.shiftKey||l.altKey||l.metaKey)return;const c=l.target.closest("a");if(!c||c.closest(".vp-raw")||c.hasAttribute("download")||c.hasAttribute("target"))return;const u=c.getAttribute("href")??(c instanceof SVGAElement?c.getAttribute("xlink:href"):null);if(u==null)return;const{href:a,origin:h,pathname:v,hash:y,search:A}=new URL(u,c.baseURI),P=new URL(location.href);h===P.origin&&Xa(v)&&(l.preventDefault(),v===P.pathname&&A===P.search?(y!==P.hash&&(history.pushState({},"",a),window.dispatchEvent(new HashChangeEvent("hashchange",{oldURL:P.href,newURL:a}))),y?Br(c,y,c.classList.contains("header-anchor")):window.scrollTo(0,0)):r(a))},{capture:!0}),window.addEventListener("popstate",async l=>{var u;if(l.state===null)return;const c=hs(location.href);await o(c,l.state&&l.state.scrollPosition||0),await((u=s.onAfterRouteChange??s.onAfterRouteChanged)==null?void 0:u(c))}),window.addEventListener("hashchange",l=>{l.preventDefault()})),s}function nf(){const e=bt(ef);if(!e)throw new Error("useRouter() is called without provider.");return e}function xo(){return nf().route}function Br(e,t,n=!1){let s=null;try{s=e.classList.contains("header-anchor")?e:document.getElementById(decodeURIComponent(t).slice(1))}catch(r){console.warn(r)}if(s){let r=function(){!n||Math.abs(o-window.scrollY)>window.innerHeight?window.scrollTo(0,o):window.scrollTo({left:0,top:o,behavior:"smooth"})};const i=parseInt(window.getComputedStyle(s).paddingTop,10),o=window.scrollY+s.getBoundingClientRect().top-Za()+i;requestAnimationFrame(r)}}function hs(e){const t=new URL(e,So);return t.pathname=t.pathname.replace(/(^|\/)index(\.html)?$/,"$1"),wt.value.cleanUrls?t.pathname=t.pathname.replace(/\.html$/,""):!t.pathname.endsWith("/")&&!t.pathname.endsWith(".html")&&(t.pathname+=".html"),t.pathname+t.search+t.hash}const pn=()=>_n.forEach(e=>e()),If=Ci({name:"VitePressContent",props:{as:{type:[Object,String],default:"div"}},setup(e){const t=xo(),{frontmatter:n,site:s}=za();return Le(n,pn,{deep:!0,flush:"post"}),()=>As(e.as,s.value.contentProps??{style:{position:"relative"}},[t.component?As(t.component,{onVnodeMounted:pn,onVnodeUpdated:pn,onVnodeUnmounted:pn}):"404 Page Not Found"])}}),Pf=(e,t)=>{const n=e.__vccOpts||e;for(const[s,r]of t)n[s]=r;return n},Lf=Ci({setup(e,{slots:t}){const n=mt(!1);return Pt(()=>{n.value=!0}),()=>n.value&&t.default?t.default():null}});function Nf(){ye&&window.addEventListener("click",e=>{var n;const t=e.target;if(t.matches(".vp-code-group input")){const s=(n=t.parentElement)==null?void 0:n.parentElement;if(!s)return;const r=Array.from(s.querySelectorAll("input")).indexOf(t);if(r<0)return;const i=s.querySelector(".blocks");if(!i)return;const o=Array.from(i.children).find(u=>u.classList.contains("active"));if(!o)return;const l=i.children[r];if(!l||o===l)return;o.classList.remove("active"),l.classList.add("active");const c=s==null?void 0:s.querySelector(`label[for="${t.id}"]`);c==null||c.scrollIntoView({block:"nearest"})}})}function Ff(){if(ye){const e=new WeakMap;window.addEventListener("click",t=>{var s;const n=t.target;if(n.matches('div[class*="language-"] > button.copy')){const r=n.parentElement,i=(s=n.nextElementSibling)==null?void 0:s.nextElementSibling;if(!r||!i)return;const o=/language-(shellscript|shell|bash|sh|zsh)/.test(r.className),l=[".vp-copy-ignore",".diff.remove"],c=i.cloneNode(!0);c.querySelectorAll(l.join(",")).forEach(a=>a.remove());let u=c.textContent||"";o&&(u=u.replace(/^ *(\$|>) /gm,"").trim()),sf(u).then(()=>{n.classList.add("copied"),clearTimeout(e.get(n));const a=setTimeout(()=>{n.classList.remove("copied"),n.blur(),e.delete(n)},2e3);e.set(n,a)})}})}}async function sf(e){try{return navigator.clipboard.writeText(e)}catch{const t=document.createElement("textarea"),n=document.activeElement;t.value=e,t.setAttribute("readonly",""),t.style.contain="strict",t.style.position="absolute",t.style.left="-9999px",t.style.fontSize="12pt";const s=document.getSelection(),r=s?s.rangeCount>0&&s.getRangeAt(0):null;document.body.appendChild(t),t.select(),t.selectionStart=0,t.selectionEnd=e.length,document.execCommand("copy"),document.body.removeChild(t),r&&(s.removeAllRanges(),s.addRange(r)),n&&n.focus()}}function Hf(e,t){let n=!0,s=[];const r=i=>{if(n){n=!1,i.forEach(l=>{const c=ps(l);for(const u of document.head.children)if(u.isEqualNode(c)){s.push(u);return}});return}const o=i.map(ps);s.forEach((l,c)=>{const u=o.findIndex(a=>a==null?void 0:a.isEqualNode(l??null));u!==-1?delete o[u]:(l==null||l.remove(),delete s[c])}),o.forEach(l=>l&&document.head.appendChild(l)),s=[...s,...o].filter(Boolean)};Yi(()=>{const i=e.data,o=t.value,l=i&&i.description,c=i&&i.frontmatter.head||[],u=_o(o,i);u!==document.title&&(document.title=u);const a=l||o.description;let h=document.querySelector("meta[name=description]");h?h.getAttribute("content")!==a&&h.setAttribute("content",a):ps(["meta",{name:"description",content:a}]),r(wo(o.head,of(c)))})}function ps([e,t,n]){const s=document.createElement(e);for(const r in t)s.setAttribute(r,t[r]);return n&&(s.innerHTML=n),e==="script"&&t.async==null&&(s.async=!1),s}function rf(e){return e[0]==="meta"&&e[1]&&e[1].name==="description"}function of(e){return e.filter(t=>!rf(t))}const gs=new Set,To=()=>document.createElement("link"),lf=e=>{const t=To();t.rel="prefetch",t.href=e,document.head.appendChild(t)},cf=e=>{const t=new XMLHttpRequest;t.open("GET",e,t.withCredentials=!0),t.send()};let gn;const af=ye&&(gn=To())&&gn.relList&&gn.relList.supports&&gn.relList.supports("prefetch")?lf:cf;function Df(){if(!ye||!window.IntersectionObserver)return;let e;if((e=navigator.connection)&&(e.saveData||/2g/.test(e.effectiveType)))return;const t=window.requestIdleCallback||setTimeout;let n=null;const s=()=>{n&&n.disconnect(),n=new IntersectionObserver(i=>{i.forEach(o=>{if(o.isIntersecting){const l=o.target;n.unobserve(l);const{pathname:c}=l;if(!gs.has(c)){gs.add(c);const u=Qa(c);u&&af(u)}}})}),t(()=>{document.querySelectorAll("#app a").forEach(i=>{const{hostname:o,pathname:l}=new URL(i.href instanceof SVGAnimatedString?i.href.animVal:i.href,i.baseURI),c=l.match(/\.\w+$/);c&&c[0]!==".html"||i.target!=="_blank"&&o===location.hostname&&(l!==location.pathname?n.observe(i):gs.add(l))})})};Pt(s);const r=xo();Le(()=>r.path,s),Vn(()=>{n&&n.disconnect()})}export{gf as $,Za as A,df as B,ff as C,Pe as D,Of as E,Se as F,ge as G,uf as H,yo as I,xo as J,bc as K,bt as L,Af as M,Ls as N,Tf as O,Dn as P,Cf as Q,ye as R,Fn as S,_f as T,Ef as U,Ql as V,pf as W,Sf as X,Oi as Y,wf as Z,Pf as _,ro as a,Hf as a0,ef as a1,Rf as a2,Ya as a3,If as a4,Lf as a5,wt as a6,Mf as a7,Qa as a8,xf as a9,Df as aa,Ff as ab,Nf as ac,As as ad,yf as ae,Es as b,vf as c,Ci as d,bf as e,Xa as f,kr as g,ie as h,Wa as i,so as j,Ws as k,Va as l,po as m,Ns as n,Ts as o,mt as p,Le as q,hf as r,Yi as s,Vo as t,za as u,Pt as v,Tl as w,Vn as x,mf as y,$l as z}; + * @vue/shared v3.5.14 + * (c) 2018-present Yuxi (Evan) You and Vue contributors + * @license MIT + **/ /*! #__NO_SIDE_EFFECTS__ */ function Os(e) { + const t = Object.create(null); + for (const n of e.split(",")) t[n] = 1; + return (n) => n in t; +} +const ne = {}, + At = [], + ke = () => {}, + Ao = () => !1, + Qt = (e) => + e.charCodeAt(0) === 111 && + e.charCodeAt(1) === 110 && + (e.charCodeAt(2) > 122 || e.charCodeAt(2) < 97), + Ms = (e) => e.startsWith("onUpdate:"), + ue = Object.assign, + Is = (e, t) => { + const n = e.indexOf(t); + n > -1 && e.splice(n, 1); + }, + Ro = Object.prototype.hasOwnProperty, + Q = (e, t) => Ro.call(e, t), + B = Array.isArray, + Rt = (e) => On(e) === "[object Map]", + Kr = (e) => On(e) === "[object Set]", + G = (e) => typeof e == "function", + oe = (e) => typeof e == "string", + Je = (e) => typeof e == "symbol", + se = (e) => e !== null && typeof e == "object", + qr = (e) => (se(e) || G(e)) && G(e.then) && G(e.catch), + Gr = Object.prototype.toString, + On = (e) => Gr.call(e), + Oo = (e) => On(e).slice(8, -1), + Xr = (e) => On(e) === "[object Object]", + Ps = (e) => + oe(e) && e !== "NaN" && e[0] !== "-" && "" + parseInt(e, 10) === e, + Ot = Os( + ",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted", + ), + Mn = (e) => { + const t = Object.create(null); + return (n) => t[n] || (t[n] = e(n)); + }, + Mo = /-(\w)/g, + Ne = Mn((e) => e.replace(Mo, (t, n) => (n ? n.toUpperCase() : ""))), + Io = /\B([A-Z])/g, + lt = Mn((e) => e.replace(Io, "-$1").toLowerCase()), + In = Mn((e) => e.charAt(0).toUpperCase() + e.slice(1)), + mn = Mn((e) => (e ? `on${In(e)}` : "")), + rt = (e, t) => !Object.is(e, t), + Gn = (e, ...t) => { + for (let n = 0; n < e.length; n++) e[n](...t); + }, + Yr = (e, t, n, s = !1) => { + Object.defineProperty(e, t, { + configurable: !0, + enumerable: !1, + writable: s, + value: n, + }); + }, + Po = (e) => { + const t = parseFloat(e); + return isNaN(t) ? e : t; + }, + Lo = (e) => { + const t = oe(e) ? Number(e) : NaN; + return isNaN(t) ? e : t; + }; +let er; +const Pn = () => + er || + (er = + typeof globalThis < "u" + ? globalThis + : typeof self < "u" + ? self + : typeof window < "u" + ? window + : typeof global < "u" + ? global + : {}); +function Ls(e) { + if (B(e)) { + const t = {}; + for (let n = 0; n < e.length; n++) { + const s = e[n], + r = oe(s) ? Do(s) : Ls(s); + if (r) for (const i in r) t[i] = r[i]; + } + return t; + } else if (oe(e) || se(e)) return e; +} +const No = /;(?![^(]*\))/g, + Fo = /:([^]+)/, + Ho = /\/\*[^]*?\*\//g; +function Do(e) { + const t = {}; + return ( + e + .replace(Ho, "") + .split(No) + .forEach((n) => { + if (n) { + const s = n.split(Fo); + s.length > 1 && (t[s[0].trim()] = s[1].trim()); + } + }), + t + ); +} +function Ns(e) { + let t = ""; + if (oe(e)) t = e; + else if (B(e)) + for (let n = 0; n < e.length; n++) { + const s = Ns(e[n]); + s && (t += s + " "); + } + else if (se(e)) for (const n in e) e[n] && (t += n + " "); + return t.trim(); +} +const $o = + "itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly", + jo = Os($o); +function zr(e) { + return !!e || e === ""; +} +const Jr = (e) => !!(e && e.__v_isRef === !0), + Vo = (e) => + oe(e) + ? e + : e == null + ? "" + : B(e) || (se(e) && (e.toString === Gr || !G(e.toString))) + ? Jr(e) + ? Vo(e.value) + : JSON.stringify(e, Qr, 2) + : String(e), + Qr = (e, t) => + Jr(t) + ? Qr(e, t.value) + : Rt(t) + ? { + [`Map(${t.size})`]: [...t.entries()].reduce( + (n, [s, r], i) => ((n[Xn(s, i) + " =>"] = r), n), + {}, + ), + } + : Kr(t) + ? { [`Set(${t.size})`]: [...t.values()].map((n) => Xn(n)) } + : Je(t) + ? Xn(t) + : se(t) && !B(t) && !Xr(t) + ? String(t) + : t, + Xn = (e, t = "") => { + var n; + return Je(e) ? `Symbol(${(n = e.description) != null ? n : t})` : e; + }; +/** + * @vue/reactivity v3.5.14 + * (c) 2018-present Yuxi (Evan) You and Vue contributors + * @license MIT + **/ let ve; +class Wo { + constructor(t = !1) { + (this.detached = t), + (this._active = !0), + (this._on = 0), + (this.effects = []), + (this.cleanups = []), + (this._isPaused = !1), + (this.parent = ve), + !t && ve && (this.index = (ve.scopes || (ve.scopes = [])).push(this) - 1); + } + get active() { + return this._active; + } + pause() { + if (this._active) { + this._isPaused = !0; + let t, n; + if (this.scopes) + for (t = 0, n = this.scopes.length; t < n; t++) this.scopes[t].pause(); + for (t = 0, n = this.effects.length; t < n; t++) this.effects[t].pause(); + } + } + resume() { + if (this._active && this._isPaused) { + this._isPaused = !1; + let t, n; + if (this.scopes) + for (t = 0, n = this.scopes.length; t < n; t++) this.scopes[t].resume(); + for (t = 0, n = this.effects.length; t < n; t++) this.effects[t].resume(); + } + } + run(t) { + if (this._active) { + const n = ve; + try { + return (ve = this), t(); + } finally { + ve = n; + } + } + } + on() { + ++this._on === 1 && ((this.prevScope = ve), (ve = this)); + } + off() { + this._on > 0 && + --this._on === 0 && + ((ve = this.prevScope), (this.prevScope = void 0)); + } + stop(t) { + if (this._active) { + this._active = !1; + let n, s; + for (n = 0, s = this.effects.length; n < s; n++) this.effects[n].stop(); + for (this.effects.length = 0, n = 0, s = this.cleanups.length; n < s; n++) + this.cleanups[n](); + if (((this.cleanups.length = 0), this.scopes)) { + for (n = 0, s = this.scopes.length; n < s; n++) this.scopes[n].stop(!0); + this.scopes.length = 0; + } + if (!this.detached && this.parent && !t) { + const r = this.parent.scopes.pop(); + r && + r !== this && + ((this.parent.scopes[this.index] = r), (r.index = this.index)); + } + this.parent = void 0; + } + } +} +function Zr() { + return ve; +} +function ko(e, t = !1) { + ve && ve.cleanups.push(e); +} +let te; +const Yn = new WeakSet(); +class ei { + constructor(t) { + (this.fn = t), + (this.deps = void 0), + (this.depsTail = void 0), + (this.flags = 5), + (this.next = void 0), + (this.cleanup = void 0), + (this.scheduler = void 0), + ve && ve.active && ve.effects.push(this); + } + pause() { + this.flags |= 64; + } + resume() { + this.flags & 64 && + ((this.flags &= -65), Yn.has(this) && (Yn.delete(this), this.trigger())); + } + notify() { + (this.flags & 2 && !(this.flags & 32)) || this.flags & 8 || ni(this); + } + run() { + if (!(this.flags & 1)) return this.fn(); + (this.flags |= 2), tr(this), si(this); + const t = te, + n = He; + (te = this), (He = !0); + try { + return this.fn(); + } finally { + ri(this), (te = t), (He = n), (this.flags &= -3); + } + } + stop() { + if (this.flags & 1) { + for (let t = this.deps; t; t = t.nextDep) Ds(t); + (this.deps = this.depsTail = void 0), + tr(this), + this.onStop && this.onStop(), + (this.flags &= -2); + } + } + trigger() { + this.flags & 64 + ? Yn.add(this) + : this.scheduler + ? this.scheduler() + : this.runIfDirty(); + } + runIfDirty() { + ms(this) && this.run(); + } + get dirty() { + return ms(this); + } +} +let ti = 0, + $t, + jt; +function ni(e, t = !1) { + if (((e.flags |= 8), t)) { + (e.next = jt), (jt = e); + return; + } + (e.next = $t), ($t = e); +} +function Fs() { + ti++; +} +function Hs() { + if (--ti > 0) return; + if (jt) { + let t = jt; + for (jt = void 0; t; ) { + const n = t.next; + (t.next = void 0), (t.flags &= -9), (t = n); + } + } + let e; + for (; $t; ) { + let t = $t; + for ($t = void 0; t; ) { + const n = t.next; + if (((t.next = void 0), (t.flags &= -9), t.flags & 1)) + try { + t.trigger(); + } catch (s) { + e || (e = s); + } + t = n; + } + } + if (e) throw e; +} +function si(e) { + for (let t = e.deps; t; t = t.nextDep) + (t.version = -1), + (t.prevActiveLink = t.dep.activeLink), + (t.dep.activeLink = t); +} +function ri(e) { + let t, + n = e.depsTail, + s = n; + for (; s; ) { + const r = s.prevDep; + s.version === -1 ? (s === n && (n = r), Ds(s), Uo(s)) : (t = s), + (s.dep.activeLink = s.prevActiveLink), + (s.prevActiveLink = void 0), + (s = r); + } + (e.deps = t), (e.depsTail = n); +} +function ms(e) { + for (let t = e.deps; t; t = t.nextDep) + if ( + t.dep.version !== t.version || + (t.dep.computed && (ii(t.dep.computed) || t.dep.version !== t.version)) + ) + return !0; + return !!e._dirty; +} +function ii(e) { + if ( + (e.flags & 4 && !(e.flags & 16)) || + ((e.flags &= -17), e.globalVersion === Ut) || + ((e.globalVersion = Ut), + !e.isSSR && e.flags & 128 && ((!e.deps && !e._dirty) || !ms(e))) + ) + return; + e.flags |= 2; + const t = e.dep, + n = te, + s = He; + (te = e), (He = !0); + try { + si(e); + const r = e.fn(e._value); + (t.version === 0 || rt(r, e._value)) && + ((e.flags |= 128), (e._value = r), t.version++); + } catch (r) { + throw (t.version++, r); + } finally { + (te = n), (He = s), ri(e), (e.flags &= -3); + } +} +function Ds(e, t = !1) { + const { dep: n, prevSub: s, nextSub: r } = e; + if ( + (s && ((s.nextSub = r), (e.prevSub = void 0)), + r && ((r.prevSub = s), (e.nextSub = void 0)), + n.subs === e && ((n.subs = s), !s && n.computed)) + ) { + n.computed.flags &= -5; + for (let i = n.computed.deps; i; i = i.nextDep) Ds(i, !0); + } + !t && !--n.sc && n.map && n.map.delete(n.key); +} +function Uo(e) { + const { prevDep: t, nextDep: n } = e; + t && ((t.nextDep = n), (e.prevDep = void 0)), + n && ((n.prevDep = t), (e.nextDep = void 0)); +} +let He = !0; +const oi = []; +function Ge() { + oi.push(He), (He = !1); +} +function Xe() { + const e = oi.pop(); + He = e === void 0 ? !0 : e; +} +function tr(e) { + const { cleanup: t } = e; + if (((e.cleanup = void 0), t)) { + const n = te; + te = void 0; + try { + t(); + } finally { + te = n; + } + } +} +let Ut = 0; +class Bo { + constructor(t, n) { + (this.sub = t), + (this.dep = n), + (this.version = n.version), + (this.nextDep = + this.prevDep = + this.nextSub = + this.prevSub = + this.prevActiveLink = + void 0); + } +} +class Ln { + constructor(t) { + (this.computed = t), + (this.version = 0), + (this.activeLink = void 0), + (this.subs = void 0), + (this.map = void 0), + (this.key = void 0), + (this.sc = 0); + } + track(t) { + if (!te || !He || te === this.computed) return; + let n = this.activeLink; + if (n === void 0 || n.sub !== te) + (n = this.activeLink = new Bo(te, this)), + te.deps + ? ((n.prevDep = te.depsTail), + (te.depsTail.nextDep = n), + (te.depsTail = n)) + : (te.deps = te.depsTail = n), + li(n); + else if (n.version === -1 && ((n.version = this.version), n.nextDep)) { + const s = n.nextDep; + (s.prevDep = n.prevDep), + n.prevDep && (n.prevDep.nextDep = s), + (n.prevDep = te.depsTail), + (n.nextDep = void 0), + (te.depsTail.nextDep = n), + (te.depsTail = n), + te.deps === n && (te.deps = s); + } + return n; + } + trigger(t) { + this.version++, Ut++, this.notify(t); + } + notify(t) { + Fs(); + try { + for (let n = this.subs; n; n = n.prevSub) + n.sub.notify() && n.sub.dep.notify(); + } finally { + Hs(); + } + } +} +function li(e) { + if ((e.dep.sc++, e.sub.flags & 4)) { + const t = e.dep.computed; + if (t && !e.dep.subs) { + t.flags |= 20; + for (let s = t.deps; s; s = s.nextDep) li(s); + } + const n = e.dep.subs; + n !== e && ((e.prevSub = n), n && (n.nextSub = e)), (e.dep.subs = e); + } +} +const wn = new WeakMap(), + pt = Symbol(""), + vs = Symbol(""), + Bt = Symbol(""); +function be(e, t, n) { + if (He && te) { + let s = wn.get(e); + s || wn.set(e, (s = new Map())); + let r = s.get(n); + r || (s.set(n, (r = new Ln())), (r.map = s), (r.key = n)), r.track(); + } +} +function qe(e, t, n, s, r, i) { + const o = wn.get(e); + if (!o) { + Ut++; + return; + } + const l = (c) => { + c && c.trigger(); + }; + if ((Fs(), t === "clear")) o.forEach(l); + else { + const c = B(e), + u = c && Ps(n); + if (c && n === "length") { + const a = Number(s); + o.forEach((h, v) => { + (v === "length" || v === Bt || (!Je(v) && v >= a)) && l(h); + }); + } else + switch ( + ((n !== void 0 || o.has(void 0)) && l(o.get(n)), u && l(o.get(Bt)), t) + ) { + case "add": + c ? u && l(o.get("length")) : (l(o.get(pt)), Rt(e) && l(o.get(vs))); + break; + case "delete": + c || (l(o.get(pt)), Rt(e) && l(o.get(vs))); + break; + case "set": + Rt(e) && l(o.get(pt)); + break; + } + } + Hs(); +} +function Ko(e, t) { + const n = wn.get(e); + return n && n.get(t); +} +function Tt(e) { + const t = J(e); + return t === e ? t : (be(t, "iterate", Bt), Ie(e) ? t : t.map(de)); +} +function Nn(e) { + return be((e = J(e)), "iterate", Bt), e; +} +const qo = { + __proto__: null, + [Symbol.iterator]() { + return zn(this, Symbol.iterator, de); + }, + concat(...e) { + return Tt(this).concat(...e.map((t) => (B(t) ? Tt(t) : t))); + }, + entries() { + return zn(this, "entries", (e) => ((e[1] = de(e[1])), e)); + }, + every(e, t) { + return Ue(this, "every", e, t, void 0, arguments); + }, + filter(e, t) { + return Ue(this, "filter", e, t, (n) => n.map(de), arguments); + }, + find(e, t) { + return Ue(this, "find", e, t, de, arguments); + }, + findIndex(e, t) { + return Ue(this, "findIndex", e, t, void 0, arguments); + }, + findLast(e, t) { + return Ue(this, "findLast", e, t, de, arguments); + }, + findLastIndex(e, t) { + return Ue(this, "findLastIndex", e, t, void 0, arguments); + }, + forEach(e, t) { + return Ue(this, "forEach", e, t, void 0, arguments); + }, + includes(...e) { + return Jn(this, "includes", e); + }, + indexOf(...e) { + return Jn(this, "indexOf", e); + }, + join(e) { + return Tt(this).join(e); + }, + lastIndexOf(...e) { + return Jn(this, "lastIndexOf", e); + }, + map(e, t) { + return Ue(this, "map", e, t, void 0, arguments); + }, + pop() { + return Ft(this, "pop"); + }, + push(...e) { + return Ft(this, "push", e); + }, + reduce(e, ...t) { + return nr(this, "reduce", e, t); + }, + reduceRight(e, ...t) { + return nr(this, "reduceRight", e, t); + }, + shift() { + return Ft(this, "shift"); + }, + some(e, t) { + return Ue(this, "some", e, t, void 0, arguments); + }, + splice(...e) { + return Ft(this, "splice", e); + }, + toReversed() { + return Tt(this).toReversed(); + }, + toSorted(e) { + return Tt(this).toSorted(e); + }, + toSpliced(...e) { + return Tt(this).toSpliced(...e); + }, + unshift(...e) { + return Ft(this, "unshift", e); + }, + values() { + return zn(this, "values", de); + }, +}; +function zn(e, t, n) { + const s = Nn(e), + r = s[t](); + return ( + s !== e && + !Ie(e) && + ((r._next = r.next), + (r.next = () => { + const i = r._next(); + return i.value && (i.value = n(i.value)), i; + })), + r + ); +} +const Go = Array.prototype; +function Ue(e, t, n, s, r, i) { + const o = Nn(e), + l = o !== e && !Ie(e), + c = o[t]; + if (c !== Go[t]) { + const h = c.apply(e, i); + return l ? de(h) : h; + } + let u = n; + o !== e && + (l + ? (u = function (h, v) { + return n.call(this, de(h), v, e); + }) + : n.length > 2 && + (u = function (h, v) { + return n.call(this, h, v, e); + })); + const a = c.call(o, u, s); + return l && r ? r(a) : a; +} +function nr(e, t, n, s) { + const r = Nn(e); + let i = n; + return ( + r !== e && + (Ie(e) + ? n.length > 3 && + (i = function (o, l, c) { + return n.call(this, o, l, c, e); + }) + : (i = function (o, l, c) { + return n.call(this, o, de(l), c, e); + })), + r[t](i, ...s) + ); +} +function Jn(e, t, n) { + const s = J(e); + be(s, "iterate", Bt); + const r = s[t](...n); + return (r === -1 || r === !1) && Vs(n[0]) + ? ((n[0] = J(n[0])), s[t](...n)) + : r; +} +function Ft(e, t, n = []) { + Ge(), Fs(); + const s = J(e)[t].apply(e, n); + return Hs(), Xe(), s; +} +const Xo = Os("__proto__,__v_isRef,__isVue"), + ci = new Set( + Object.getOwnPropertyNames(Symbol) + .filter((e) => e !== "arguments" && e !== "caller") + .map((e) => Symbol[e]) + .filter(Je), + ); +function Yo(e) { + Je(e) || (e = String(e)); + const t = J(this); + return be(t, "has", e), t.hasOwnProperty(e); +} +class ai { + constructor(t = !1, n = !1) { + (this._isReadonly = t), (this._isShallow = n); + } + get(t, n, s) { + if (n === "__v_skip") return t.__v_skip; + const r = this._isReadonly, + i = this._isShallow; + if (n === "__v_isReactive") return !r; + if (n === "__v_isReadonly") return r; + if (n === "__v_isShallow") return i; + if (n === "__v_raw") + return s === (r ? (i ? il : hi) : i ? di : ui).get(t) || + Object.getPrototypeOf(t) === Object.getPrototypeOf(s) + ? t + : void 0; + const o = B(t); + if (!r) { + let c; + if (o && (c = qo[n])) return c; + if (n === "hasOwnProperty") return Yo; + } + const l = Reflect.get(t, n, ae(t) ? t : s); + return (Je(n) ? ci.has(n) : Xo(n)) || (r || be(t, "get", n), i) + ? l + : ae(l) + ? o && Ps(n) + ? l + : l.value + : se(l) + ? r + ? Fn(l) + : It(l) + : l; + } +} +class fi extends ai { + constructor(t = !1) { + super(!1, t); + } + set(t, n, s, r) { + let i = t[n]; + if (!this._isShallow) { + const c = it(i); + if ( + (!Ie(s) && !it(s) && ((i = J(i)), (s = J(s))), !B(t) && ae(i) && !ae(s)) + ) + return c ? !1 : ((i.value = s), !0); + } + const o = B(t) && Ps(n) ? Number(n) < t.length : Q(t, n), + l = Reflect.set(t, n, s, ae(t) ? t : r); + return ( + t === J(r) && (o ? rt(s, i) && qe(t, "set", n, s) : qe(t, "add", n, s)), l + ); + } + deleteProperty(t, n) { + const s = Q(t, n); + t[n]; + const r = Reflect.deleteProperty(t, n); + return r && s && qe(t, "delete", n, void 0), r; + } + has(t, n) { + const s = Reflect.has(t, n); + return (!Je(n) || !ci.has(n)) && be(t, "has", n), s; + } + ownKeys(t) { + return be(t, "iterate", B(t) ? "length" : pt), Reflect.ownKeys(t); + } +} +class zo extends ai { + constructor(t = !1) { + super(!0, t); + } + set(t, n) { + return !0; + } + deleteProperty(t, n) { + return !0; + } +} +const Jo = new fi(), + Qo = new zo(), + Zo = new fi(!0); +const ys = (e) => e, + rn = (e) => Reflect.getPrototypeOf(e); +function el(e, t, n) { + return function (...s) { + const r = this.__v_raw, + i = J(r), + o = Rt(i), + l = e === "entries" || (e === Symbol.iterator && o), + c = e === "keys" && o, + u = r[e](...s), + a = n ? ys : t ? Sn : de; + return ( + !t && be(i, "iterate", c ? vs : pt), + { + next() { + const { value: h, done: v } = u.next(); + return v + ? { value: h, done: v } + : { value: l ? [a(h[0]), a(h[1])] : a(h), done: v }; + }, + [Symbol.iterator]() { + return this; + }, + } + ); + }; +} +function on(e) { + return function (...t) { + return e === "delete" ? !1 : e === "clear" ? void 0 : this; + }; +} +function tl(e, t) { + const n = { + get(r) { + const i = this.__v_raw, + o = J(i), + l = J(r); + e || (rt(r, l) && be(o, "get", r), be(o, "get", l)); + const { has: c } = rn(o), + u = t ? ys : e ? Sn : de; + if (c.call(o, r)) return u(i.get(r)); + if (c.call(o, l)) return u(i.get(l)); + i !== o && i.get(r); + }, + get size() { + const r = this.__v_raw; + return !e && be(J(r), "iterate", pt), Reflect.get(r, "size", r); + }, + has(r) { + const i = this.__v_raw, + o = J(i), + l = J(r); + return ( + e || (rt(r, l) && be(o, "has", r), be(o, "has", l)), + r === l ? i.has(r) : i.has(r) || i.has(l) + ); + }, + forEach(r, i) { + const o = this, + l = o.__v_raw, + c = J(l), + u = t ? ys : e ? Sn : de; + return ( + !e && be(c, "iterate", pt), + l.forEach((a, h) => r.call(i, u(a), u(h), o)) + ); + }, + }; + return ( + ue( + n, + e + ? { + add: on("add"), + set: on("set"), + delete: on("delete"), + clear: on("clear"), + } + : { + add(r) { + !t && !Ie(r) && !it(r) && (r = J(r)); + const i = J(this); + return ( + rn(i).has.call(i, r) || (i.add(r), qe(i, "add", r, r)), this + ); + }, + set(r, i) { + !t && !Ie(i) && !it(i) && (i = J(i)); + const o = J(this), + { has: l, get: c } = rn(o); + let u = l.call(o, r); + u || ((r = J(r)), (u = l.call(o, r))); + const a = c.call(o, r); + return ( + o.set(r, i), + u ? rt(i, a) && qe(o, "set", r, i) : qe(o, "add", r, i), + this + ); + }, + delete(r) { + const i = J(this), + { has: o, get: l } = rn(i); + let c = o.call(i, r); + c || ((r = J(r)), (c = o.call(i, r))), l && l.call(i, r); + const u = i.delete(r); + return c && qe(i, "delete", r, void 0), u; + }, + clear() { + const r = J(this), + i = r.size !== 0, + o = r.clear(); + return i && qe(r, "clear", void 0, void 0), o; + }, + }, + ), + ["keys", "values", "entries", Symbol.iterator].forEach((r) => { + n[r] = el(r, e, t); + }), + n + ); +} +function $s(e, t) { + const n = tl(e, t); + return (s, r, i) => + r === "__v_isReactive" + ? !e + : r === "__v_isReadonly" + ? e + : r === "__v_raw" + ? s + : Reflect.get(Q(n, r) && r in s ? n : s, r, i); +} +const nl = { get: $s(!1, !1) }, + sl = { get: $s(!1, !0) }, + rl = { get: $s(!0, !1) }; +const ui = new WeakMap(), + di = new WeakMap(), + hi = new WeakMap(), + il = new WeakMap(); +function ol(e) { + switch (e) { + case "Object": + case "Array": + return 1; + case "Map": + case "Set": + case "WeakMap": + case "WeakSet": + return 2; + default: + return 0; + } +} +function ll(e) { + return e.__v_skip || !Object.isExtensible(e) ? 0 : ol(Oo(e)); +} +function It(e) { + return it(e) ? e : js(e, !1, Jo, nl, ui); +} +function cl(e) { + return js(e, !1, Zo, sl, di); +} +function Fn(e) { + return js(e, !0, Qo, rl, hi); +} +function js(e, t, n, s, r) { + if (!se(e) || (e.__v_raw && !(t && e.__v_isReactive))) return e; + const i = ll(e); + if (i === 0) return e; + const o = r.get(e); + if (o) return o; + const l = new Proxy(e, i === 2 ? s : n); + return r.set(e, l), l; +} +function gt(e) { + return it(e) ? gt(e.__v_raw) : !!(e && e.__v_isReactive); +} +function it(e) { + return !!(e && e.__v_isReadonly); +} +function Ie(e) { + return !!(e && e.__v_isShallow); +} +function Vs(e) { + return e ? !!e.__v_raw : !1; +} +function J(e) { + const t = e && e.__v_raw; + return t ? J(t) : e; +} +function vn(e) { + return ( + !Q(e, "__v_skip") && Object.isExtensible(e) && Yr(e, "__v_skip", !0), e + ); +} +const de = (e) => (se(e) ? It(e) : e), + Sn = (e) => (se(e) ? Fn(e) : e); +function ae(e) { + return e ? e.__v_isRef === !0 : !1; +} +function mt(e) { + return pi(e, !1); +} +function Pe(e) { + return pi(e, !0); +} +function pi(e, t) { + return ae(e) ? e : new al(e, t); +} +class al { + constructor(t, n) { + (this.dep = new Ln()), + (this.__v_isRef = !0), + (this.__v_isShallow = !1), + (this._rawValue = n ? t : J(t)), + (this._value = n ? t : de(t)), + (this.__v_isShallow = n); + } + get value() { + return this.dep.track(), this._value; + } + set value(t) { + const n = this._rawValue, + s = this.__v_isShallow || Ie(t) || it(t); + (t = s ? t : J(t)), + rt(t, n) && + ((this._rawValue = t), + (this._value = s ? t : de(t)), + this.dep.trigger()); + } +} +function Ws(e) { + return ae(e) ? e.value : e; +} +function le(e) { + return G(e) ? e() : Ws(e); +} +const fl = { + get: (e, t, n) => (t === "__v_raw" ? e : Ws(Reflect.get(e, t, n))), + set: (e, t, n, s) => { + const r = e[t]; + return ae(r) && !ae(n) ? ((r.value = n), !0) : Reflect.set(e, t, n, s); + }, +}; +function gi(e) { + return gt(e) ? e : new Proxy(e, fl); +} +class ul { + constructor(t) { + (this.__v_isRef = !0), (this._value = void 0); + const n = (this.dep = new Ln()), + { get: s, set: r } = t(n.track.bind(n), n.trigger.bind(n)); + (this._get = s), (this._set = r); + } + get value() { + return (this._value = this._get()); + } + set value(t) { + this._set(t); + } +} +function dl(e) { + return new ul(e); +} +class hl { + constructor(t, n, s) { + (this._object = t), + (this._key = n), + (this._defaultValue = s), + (this.__v_isRef = !0), + (this._value = void 0); + } + get value() { + const t = this._object[this._key]; + return (this._value = t === void 0 ? this._defaultValue : t); + } + set value(t) { + this._object[this._key] = t; + } + get dep() { + return Ko(J(this._object), this._key); + } +} +class pl { + constructor(t) { + (this._getter = t), + (this.__v_isRef = !0), + (this.__v_isReadonly = !0), + (this._value = void 0); + } + get value() { + return (this._value = this._getter()); + } +} +function gl(e, t, n) { + return ae(e) + ? e + : G(e) + ? new pl(e) + : se(e) && arguments.length > 1 + ? ml(e, t, n) + : mt(e); +} +function ml(e, t, n) { + const s = e[t]; + return ae(s) ? s : new hl(e, t, n); +} +class vl { + constructor(t, n, s) { + (this.fn = t), + (this.setter = n), + (this._value = void 0), + (this.dep = new Ln(this)), + (this.__v_isRef = !0), + (this.deps = void 0), + (this.depsTail = void 0), + (this.flags = 16), + (this.globalVersion = Ut - 1), + (this.next = void 0), + (this.effect = this), + (this.__v_isReadonly = !n), + (this.isSSR = s); + } + notify() { + if (((this.flags |= 16), !(this.flags & 8) && te !== this)) + return ni(this, !0), !0; + } + get value() { + const t = this.dep.track(); + return ii(this), t && (t.version = this.dep.version), this._value; + } + set value(t) { + this.setter && this.setter(t); + } +} +function yl(e, t, n = !1) { + let s, r; + return G(e) ? (s = e) : ((s = e.get), (r = e.set)), new vl(s, r, n); +} +const ln = {}, + xn = new WeakMap(); +let dt; +function bl(e, t = !1, n = dt) { + if (n) { + let s = xn.get(n); + s || xn.set(n, (s = [])), s.push(e); + } +} +function _l(e, t, n = ne) { + const { + immediate: s, + deep: r, + once: i, + scheduler: o, + augmentJob: l, + call: c, + } = n, + u = (g) => (r ? g : Ie(g) || r === !1 || r === 0 ? st(g, 1) : st(g)); + let a, + h, + v, + y, + A = !1, + P = !1; + if ( + (ae(e) + ? ((h = () => e.value), (A = Ie(e))) + : gt(e) + ? ((h = () => u(e)), (A = !0)) + : B(e) + ? ((P = !0), + (A = e.some((g) => gt(g) || Ie(g))), + (h = () => + e.map((g) => { + if (ae(g)) return g.value; + if (gt(g)) return u(g); + if (G(g)) return c ? c(g, 2) : g(); + }))) + : G(e) + ? t + ? (h = c ? () => c(e, 2) : e) + : (h = () => { + if (v) { + Ge(); + try { + v(); + } finally { + Xe(); + } + } + const g = dt; + dt = a; + try { + return c ? c(e, 3, [y]) : e(y); + } finally { + dt = g; + } + }) + : (h = ke), + t && r) + ) { + const g = h, + M = r === !0 ? 1 / 0 : r; + h = () => st(g(), M); + } + const K = Zr(), + H = () => { + a.stop(), K && K.active && Is(K.effects, a); + }; + if (i && t) { + const g = t; + t = (...M) => { + g(...M), H(); + }; + } + let k = P ? new Array(e.length).fill(ln) : ln; + const p = (g) => { + if (!(!(a.flags & 1) || (!a.dirty && !g))) + if (t) { + const M = a.run(); + if (r || A || (P ? M.some((V, R) => rt(V, k[R])) : rt(M, k))) { + v && v(); + const V = dt; + dt = a; + try { + const R = [M, k === ln ? void 0 : P && k[0] === ln ? [] : k, y]; + c ? c(t, 3, R) : t(...R), (k = M); + } finally { + dt = V; + } + } + } else a.run(); + }; + return ( + l && l(p), + (a = new ei(h)), + (a.scheduler = o ? () => o(p, !1) : p), + (y = (g) => bl(g, !1, a)), + (v = a.onStop = + () => { + const g = xn.get(a); + if (g) { + if (c) c(g, 4); + else for (const M of g) M(); + xn.delete(a); + } + }), + t ? (s ? p(!0) : (k = a.run())) : o ? o(p.bind(null, !0), !0) : a.run(), + (H.pause = a.pause.bind(a)), + (H.resume = a.resume.bind(a)), + (H.stop = H), + H + ); +} +function st(e, t = 1 / 0, n) { + if (t <= 0 || !se(e) || e.__v_skip || ((n = n || new Set()), n.has(e))) + return e; + if ((n.add(e), t--, ae(e))) st(e.value, t, n); + else if (B(e)) for (let s = 0; s < e.length; s++) st(e[s], t, n); + else if (Kr(e) || Rt(e)) + e.forEach((s) => { + st(s, t, n); + }); + else if (Xr(e)) { + for (const s in e) st(e[s], t, n); + for (const s of Object.getOwnPropertySymbols(e)) + Object.prototype.propertyIsEnumerable.call(e, s) && st(e[s], t, n); + } + return e; +} +/** + * @vue/runtime-core v3.5.14 + * (c) 2018-present Yuxi (Evan) You and Vue contributors + * @license MIT + **/ function Zt(e, t, n, s) { + try { + return s ? e(...s) : e(); + } catch (r) { + Hn(r, t, n); + } +} +function De(e, t, n, s) { + if (G(e)) { + const r = Zt(e, t, n, s); + return ( + r && + qr(r) && + r.catch((i) => { + Hn(i, t, n); + }), + r + ); + } + if (B(e)) { + const r = []; + for (let i = 0; i < e.length; i++) r.push(De(e[i], t, n, s)); + return r; + } +} +function Hn(e, t, n, s = !0) { + const r = t ? t.vnode : null, + { errorHandler: i, throwUnhandledErrorInProduction: o } = + (t && t.appContext.config) || ne; + if (t) { + let l = t.parent; + const c = t.proxy, + u = `https://vuejs.org/error-reference/#runtime-${n}`; + for (; l; ) { + const a = l.ec; + if (a) { + for (let h = 0; h < a.length; h++) if (a[h](e, c, u) === !1) return; + } + l = l.parent; + } + if (i) { + Ge(), Zt(i, null, 10, [e, c, u]), Xe(); + return; + } + } + wl(e, n, r, s, o); +} +function wl(e, t, n, s = !0, r = !1) { + if (r) throw e; + console.error(e); +} +const we = []; +let Ve = -1; +const Mt = []; +let et = null, + Ct = 0; +const mi = Promise.resolve(); +let Tn = null; +function Dn(e) { + const t = Tn || mi; + return e ? t.then(this ? e.bind(this) : e) : t; +} +function Sl(e) { + let t = Ve + 1, + n = we.length; + for (; t < n; ) { + const s = (t + n) >>> 1, + r = we[s], + i = Kt(r); + i < e || (i === e && r.flags & 2) ? (t = s + 1) : (n = s); + } + return t; +} +function ks(e) { + if (!(e.flags & 1)) { + const t = Kt(e), + n = we[we.length - 1]; + !n || (!(e.flags & 2) && t >= Kt(n)) ? we.push(e) : we.splice(Sl(t), 0, e), + (e.flags |= 1), + vi(); + } +} +function vi() { + Tn || (Tn = mi.then(yi)); +} +function xl(e) { + B(e) + ? Mt.push(...e) + : et && e.id === -1 + ? et.splice(Ct + 1, 0, e) + : e.flags & 1 || (Mt.push(e), (e.flags |= 1)), + vi(); +} +function sr(e, t, n = Ve + 1) { + for (; n < we.length; n++) { + const s = we[n]; + if (s && s.flags & 2) { + if (e && s.id !== e.uid) continue; + we.splice(n, 1), + n--, + s.flags & 4 && (s.flags &= -2), + s(), + s.flags & 4 || (s.flags &= -2); + } + } +} +function En(e) { + if (Mt.length) { + const t = [...new Set(Mt)].sort((n, s) => Kt(n) - Kt(s)); + if (((Mt.length = 0), et)) { + et.push(...t); + return; + } + for (et = t, Ct = 0; Ct < et.length; Ct++) { + const n = et[Ct]; + n.flags & 4 && (n.flags &= -2), n.flags & 8 || n(), (n.flags &= -2); + } + (et = null), (Ct = 0); + } +} +const Kt = (e) => (e.id == null ? (e.flags & 2 ? -1 : 1 / 0) : e.id); +function yi(e) { + try { + for (Ve = 0; Ve < we.length; Ve++) { + const t = we[Ve]; + t && + !(t.flags & 8) && + (t.flags & 4 && (t.flags &= -2), + Zt(t, t.i, t.i ? 15 : 14), + t.flags & 4 || (t.flags &= -2)); + } + } finally { + for (; Ve < we.length; Ve++) { + const t = we[Ve]; + t && (t.flags &= -2); + } + (Ve = -1), + (we.length = 0), + En(), + (Tn = null), + (we.length || Mt.length) && yi(); + } +} +let pe = null, + bi = null; +function Cn(e) { + const t = pe; + return (pe = e), (bi = (e && e.type.__scopeId) || null), t; +} +function Tl(e, t = pe, n) { + if (!t || e._n) return e; + const s = (...r) => { + s._d && gr(-1); + const i = Cn(t); + let o; + try { + o = e(...r); + } finally { + Cn(i), s._d && gr(1); + } + return o; + }; + return (s._n = !0), (s._c = !0), (s._d = !0), s; +} +function We(e, t, n, s) { + const r = e.dirs, + i = t && t.dirs; + for (let o = 0; o < r.length; o++) { + const l = r[o]; + i && (l.oldValue = i[o].value); + let c = l.dir[s]; + c && (Ge(), De(c, n, 8, [e.el, l, e, t]), Xe()); + } +} +const El = Symbol("_vte"), + _i = (e) => e.__isTeleport, + tt = Symbol("_leaveCb"), + cn = Symbol("_enterCb"); +function Cl() { + const e = { + isMounted: !1, + isLeaving: !1, + isUnmounting: !1, + leavingVNodes: new Map(), + }; + return ( + Pt(() => { + e.isMounted = !0; + }), + Oi(() => { + e.isUnmounting = !0; + }), + e + ); +} +const Re = [Function, Array], + wi = { + mode: String, + appear: Boolean, + persisted: Boolean, + onBeforeEnter: Re, + onEnter: Re, + onAfterEnter: Re, + onEnterCancelled: Re, + onBeforeLeave: Re, + onLeave: Re, + onAfterLeave: Re, + onLeaveCancelled: Re, + onBeforeAppear: Re, + onAppear: Re, + onAfterAppear: Re, + onAppearCancelled: Re, + }, + Si = (e) => { + const t = e.subTree; + return t.component ? Si(t.component) : t; + }, + Al = { + name: "BaseTransition", + props: wi, + setup(e, { slots: t }) { + const n = en(), + s = Cl(); + return () => { + const r = t.default && Ei(t.default(), !0); + if (!r || !r.length) return; + const i = xi(r), + o = J(e), + { mode: l } = o; + if (s.isLeaving) return Qn(i); + const c = rr(i); + if (!c) return Qn(i); + let u = bs(c, o, s, n, (h) => (u = h)); + c.type !== he && qt(c, u); + let a = n.subTree && rr(n.subTree); + if (a && a.type !== he && !ht(c, a) && Si(n).type !== he) { + let h = bs(a, o, s, n); + if ((qt(a, h), l === "out-in" && c.type !== he)) + return ( + (s.isLeaving = !0), + (h.afterLeave = () => { + (s.isLeaving = !1), + n.job.flags & 8 || n.update(), + delete h.afterLeave, + (a = void 0); + }), + Qn(i) + ); + l === "in-out" && c.type !== he + ? (h.delayLeave = (v, y, A) => { + const P = Ti(s, a); + (P[String(a.key)] = a), + (v[tt] = () => { + y(), (v[tt] = void 0), delete u.delayedLeave, (a = void 0); + }), + (u.delayedLeave = () => { + A(), delete u.delayedLeave, (a = void 0); + }); + }) + : (a = void 0); + } else a && (a = void 0); + return i; + }; + }, + }; +function xi(e) { + let t = e[0]; + if (e.length > 1) { + for (const n of e) + if (n.type !== he) { + t = n; + break; + } + } + return t; +} +const Rl = Al; +function Ti(e, t) { + const { leavingVNodes: n } = e; + let s = n.get(t.type); + return s || ((s = Object.create(null)), n.set(t.type, s)), s; +} +function bs(e, t, n, s, r) { + const { + appear: i, + mode: o, + persisted: l = !1, + onBeforeEnter: c, + onEnter: u, + onAfterEnter: a, + onEnterCancelled: h, + onBeforeLeave: v, + onLeave: y, + onAfterLeave: A, + onLeaveCancelled: P, + onBeforeAppear: K, + onAppear: H, + onAfterAppear: k, + onAppearCancelled: p, + } = t, + g = String(e.key), + M = Ti(n, e), + V = (T, I) => { + T && De(T, s, 9, I); + }, + R = (T, I) => { + const E = I[1]; + V(T, I), + B(T) ? T.every((b) => b.length <= 1) && E() : T.length <= 1 && E(); + }, + U = { + mode: o, + persisted: l, + beforeEnter(T) { + let I = c; + if (!n.isMounted) + if (i) I = K || c; + else return; + T[tt] && T[tt](!0); + const E = M[g]; + E && ht(e, E) && E.el[tt] && E.el[tt](), V(I, [T]); + }, + enter(T) { + let I = u, + E = a, + b = h; + if (!n.isMounted) + if (i) (I = H || u), (E = k || a), (b = p || h); + else return; + let N = !1; + const Y = (T[cn] = (re) => { + N || + ((N = !0), + re ? V(b, [T]) : V(E, [T]), + U.delayedLeave && U.delayedLeave(), + (T[cn] = void 0)); + }); + I ? R(I, [T, Y]) : Y(); + }, + leave(T, I) { + const E = String(e.key); + if ((T[cn] && T[cn](!0), n.isUnmounting)) return I(); + V(v, [T]); + let b = !1; + const N = (T[tt] = (Y) => { + b || + ((b = !0), + I(), + Y ? V(P, [T]) : V(A, [T]), + (T[tt] = void 0), + M[E] === e && delete M[E]); + }); + (M[E] = e), y ? R(y, [T, N]) : N(); + }, + clone(T) { + const I = bs(T, t, n, s, r); + return r && r(I), I; + }, + }; + return U; +} +function Qn(e) { + if ($n(e)) return (e = ot(e)), (e.children = null), e; +} +function rr(e) { + if (!$n(e)) return _i(e.type) && e.children ? xi(e.children) : e; + if (e.component) return e.component.subTree; + const { shapeFlag: t, children: n } = e; + if (n) { + if (t & 16) return n[0]; + if (t & 32 && G(n.default)) return n.default(); + } +} +function qt(e, t) { + e.shapeFlag & 6 && e.component + ? ((e.transition = t), qt(e.component.subTree, t)) + : e.shapeFlag & 128 + ? ((e.ssContent.transition = t.clone(e.ssContent)), + (e.ssFallback.transition = t.clone(e.ssFallback))) + : (e.transition = t); +} +function Ei(e, t = !1, n) { + let s = [], + r = 0; + for (let i = 0; i < e.length; i++) { + let o = e[i]; + const l = n == null ? o.key : String(n) + String(o.key != null ? o.key : i); + o.type === Se + ? (o.patchFlag & 128 && r++, (s = s.concat(Ei(o.children, t, l)))) + : (t || o.type !== he) && s.push(l != null ? ot(o, { key: l }) : o); + } + if (r > 1) for (let i = 0; i < s.length; i++) s[i].patchFlag = -2; + return s; +} +/*! #__NO_SIDE_EFFECTS__ */ function Ci(e, t) { + return G(e) ? ue({ name: e.name }, t, { setup: e }) : e; +} +function Ai(e) { + e.ids = [e.ids[0] + e.ids[2]++ + "-", 0, 0]; +} +function Gt(e, t, n, s, r = !1) { + if (B(e)) { + e.forEach((A, P) => Gt(A, t && (B(t) ? t[P] : t), n, s, r)); + return; + } + if (vt(s) && !r) { + s.shapeFlag & 512 && + s.type.__asyncResolved && + s.component.subTree.component && + Gt(e, t, n, s.component.subTree); + return; + } + const i = s.shapeFlag & 4 ? qs(s.component) : s.el, + o = r ? null : i, + { i: l, r: c } = e, + u = t && t.r, + a = l.refs === ne ? (l.refs = {}) : l.refs, + h = l.setupState, + v = J(h), + y = h === ne ? () => !1 : (A) => Q(v, A); + if ( + (u != null && + u !== c && + (oe(u) + ? ((a[u] = null), y(u) && (h[u] = null)) + : ae(u) && (u.value = null)), + G(c)) + ) + Zt(c, l, 12, [o, a]); + else { + const A = oe(c), + P = ae(c); + if (A || P) { + const K = () => { + if (e.f) { + const H = A ? (y(c) ? h[c] : a[c]) : c.value; + r + ? B(H) && Is(H, i) + : B(H) + ? H.includes(i) || H.push(i) + : A + ? ((a[c] = [i]), y(c) && (h[c] = a[c])) + : ((c.value = [i]), e.k && (a[e.k] = c.value)); + } else + A + ? ((a[c] = o), y(c) && (h[c] = o)) + : P && ((c.value = o), e.k && (a[e.k] = o)); + }; + o ? ((K.id = -1), Ce(K, n)) : K(); + } + } +} +let ir = !1; +const Et = () => { + ir || + (console.error("Hydration completed but contains mismatches."), + (ir = !0)); + }, + Ol = (e) => e.namespaceURI.includes("svg") && e.tagName !== "foreignObject", + Ml = (e) => e.namespaceURI.includes("MathML"), + an = (e) => { + if (e.nodeType === 1) { + if (Ol(e)) return "svg"; + if (Ml(e)) return "mathml"; + } + }, + fn = (e) => e.nodeType === 8; +function Il(e) { + const { + mt: t, + p: n, + o: { + patchProp: s, + createText: r, + nextSibling: i, + parentNode: o, + remove: l, + insert: c, + createComment: u, + }, + } = e, + a = (p, g) => { + if (!g.hasChildNodes()) { + n(null, p, g), En(), (g._vnode = p); + return; + } + h(g.firstChild, p, null, null, null), En(), (g._vnode = p); + }, + h = (p, g, M, V, R, U = !1) => { + U = U || !!g.dynamicChildren; + const T = fn(p) && p.data === "[", + I = () => P(p, g, M, V, R, T), + { type: E, ref: b, shapeFlag: N, patchFlag: Y } = g; + let re = p.nodeType; + (g.el = p), Y === -2 && ((U = !1), (g.dynamicChildren = null)); + let j = null; + switch (E) { + case _t: + re !== 3 + ? g.children === "" + ? (c((g.el = r("")), o(p), p), (j = p)) + : (j = I()) + : (p.data !== g.children && (Et(), (p.data = g.children)), + (j = i(p))); + break; + case he: + k(p) + ? ((j = i(p)), H((g.el = p.content.firstChild), p, M)) + : re !== 8 || T + ? (j = I()) + : (j = i(p)); + break; + case Wt: + if ((T && ((p = i(p)), (re = p.nodeType)), re === 1 || re === 3)) { + j = p; + const X = !g.children.length; + for (let D = 0; D < g.staticCount; D++) + X && (g.children += j.nodeType === 1 ? j.outerHTML : j.data), + D === g.staticCount - 1 && (g.anchor = j), + (j = i(j)); + return T ? i(j) : j; + } else I(); + break; + case Se: + T ? (j = A(p, g, M, V, R, U)) : (j = I()); + break; + default: + if (N & 1) + (re !== 1 || g.type.toLowerCase() !== p.tagName.toLowerCase()) && + !k(p) + ? (j = I()) + : (j = v(p, g, M, V, R, U)); + else if (N & 6) { + g.slotScopeIds = R; + const X = o(p); + if ( + (T + ? (j = K(p)) + : fn(p) && p.data === "teleport start" + ? (j = K(p, p.data, "teleport end")) + : (j = i(p)), + t(g, X, null, M, V, an(X), U), + vt(g) && !g.type.__asyncResolved) + ) { + let D; + T + ? ((D = ge(Se)), + (D.anchor = j ? j.previousSibling : X.lastChild)) + : (D = p.nodeType === 3 ? ro("") : ge("div")), + (D.el = p), + (g.component.subTree = D); + } + } else + N & 64 + ? re !== 8 + ? (j = I()) + : (j = g.type.hydrate(p, g, M, V, R, U, e, y)) + : N & 128 && + (j = g.type.hydrate(p, g, M, V, an(o(p)), R, U, e, h)); + } + return b != null && Gt(b, null, V, g), j; + }, + v = (p, g, M, V, R, U) => { + U = U || !!g.dynamicChildren; + const { + type: T, + props: I, + patchFlag: E, + shapeFlag: b, + dirs: N, + transition: Y, + } = g, + re = T === "input" || T === "option"; + if (re || E !== -1) { + N && We(g, null, M, "created"); + let j = !1; + if (k(p)) { + j = qi(null, Y) && M && M.vnode.props && M.vnode.props.appear; + const D = p.content.firstChild; + j && Y.beforeEnter(D), H(D, p, M), (g.el = p = D); + } + if (b & 16 && !(I && (I.innerHTML || I.textContent))) { + let D = y(p.firstChild, g, p, M, V, R, U); + for (; D; ) { + un(p, 1) || Et(); + const ce = D; + (D = D.nextSibling), l(ce); + } + } else if (b & 8) { + let D = g.children; + D[0] === + ` +` && + (p.tagName === "PRE" || p.tagName === "TEXTAREA") && + (D = D.slice(1)), + p.textContent !== D && + (un(p, 0) || Et(), (p.textContent = g.children)); + } + if (I) { + if (re || !U || E & 48) { + const D = p.tagName.includes("-"); + for (const ce in I) + ((re && (ce.endsWith("value") || ce === "indeterminate")) || + (Qt(ce) && !Ot(ce)) || + ce[0] === "." || + D) && + s(p, ce, null, I[ce], void 0, M); + } else if (I.onClick) s(p, "onClick", null, I.onClick, void 0, M); + else if (E & 4 && gt(I.style)) for (const D in I.style) I.style[D]; + } + let X; + (X = I && I.onVnodeBeforeMount) && Oe(X, M, g), + N && We(g, null, M, "beforeMount"), + ((X = I && I.onVnodeMounted) || N || j) && + eo(() => { + X && Oe(X, M, g), j && Y.enter(p), N && We(g, null, M, "mounted"); + }, V); + } + return p.nextSibling; + }, + y = (p, g, M, V, R, U, T) => { + T = T || !!g.dynamicChildren; + const I = g.children, + E = I.length; + for (let b = 0; b < E; b++) { + const N = T ? I[b] : (I[b] = Me(I[b])), + Y = N.type === _t; + p + ? (Y && + !T && + b + 1 < E && + Me(I[b + 1]).type === _t && + (c(r(p.data.slice(N.children.length)), M, i(p)), + (p.data = N.children)), + (p = h(p, N, V, R, U, T))) + : Y && !N.children + ? c((N.el = r("")), M) + : (un(M, 1) || Et(), n(null, N, M, null, V, R, an(M), U)); + } + return p; + }, + A = (p, g, M, V, R, U) => { + const { slotScopeIds: T } = g; + T && (R = R ? R.concat(T) : T); + const I = o(p), + E = y(i(p), g, I, M, V, R, U); + return E && fn(E) && E.data === "]" + ? i((g.anchor = E)) + : (Et(), c((g.anchor = u("]")), I, E), E); + }, + P = (p, g, M, V, R, U) => { + if ((un(p.parentElement, 1) || Et(), (g.el = null), U)) { + const E = K(p); + for (;;) { + const b = i(p); + if (b && b !== E) l(b); + else break; + } + } + const T = i(p), + I = o(p); + return ( + l(p), + n(null, g, I, T, M, V, an(I), R), + M && ((M.vnode.el = g.el), Qi(M, g.el)), + T + ); + }, + K = (p, g = "[", M = "]") => { + let V = 0; + for (; p; ) + if (((p = i(p)), p && fn(p) && (p.data === g && V++, p.data === M))) { + if (V === 0) return i(p); + V--; + } + return p; + }, + H = (p, g, M) => { + const V = g.parentNode; + V && V.replaceChild(p, g); + let R = M; + for (; R; ) + R.vnode.el === g && (R.vnode.el = R.subTree.el = p), (R = R.parent); + }, + k = (p) => p.nodeType === 1 && p.tagName === "TEMPLATE"; + return [a, h]; +} +const or = "data-allow-mismatch", + Pl = { 0: "text", 1: "children", 2: "class", 3: "style", 4: "attribute" }; +function un(e, t) { + if (t === 0 || t === 1) + for (; e && !e.hasAttribute(or); ) e = e.parentElement; + const n = e && e.getAttribute(or); + if (n == null) return !1; + if (n === "") return !0; + { + const s = n.split(","); + return t === 0 && s.includes("children") + ? !0 + : n.split(",").includes(Pl[t]); + } +} +Pn().requestIdleCallback; +Pn().cancelIdleCallback; +const vt = (e) => !!e.type.__asyncLoader, + $n = (e) => e.type.__isKeepAlive; +function Ll(e, t) { + Ri(e, "a", t); +} +function Nl(e, t) { + Ri(e, "da", t); +} +function Ri(e, t, n = fe) { + const s = + e.__wdc || + (e.__wdc = () => { + let r = n; + for (; r; ) { + if (r.isDeactivated) return; + r = r.parent; + } + return e(); + }); + if ((jn(t, s, n), n)) { + let r = n.parent; + for (; r && r.parent; ) + $n(r.parent.vnode) && Fl(s, t, n, r), (r = r.parent); + } +} +function Fl(e, t, n, s) { + const r = jn(t, e, s, !0); + Vn(() => { + Is(s[t], r); + }, n); +} +function jn(e, t, n = fe, s = !1) { + if (n) { + const r = n[e] || (n[e] = []), + i = + t.__weh || + (t.__weh = (...o) => { + Ge(); + const l = tn(n), + c = De(t, n, e, o); + return l(), Xe(), c; + }); + return s ? r.unshift(i) : r.push(i), i; + } +} +const Qe = + (e) => + (t, n = fe) => { + (!zt || e === "sp") && jn(e, (...s) => t(...s), n); + }, + Hl = Qe("bm"), + Pt = Qe("m"), + Dl = Qe("bu"), + $l = Qe("u"), + Oi = Qe("bum"), + Vn = Qe("um"), + jl = Qe("sp"), + Vl = Qe("rtg"), + Wl = Qe("rtc"); +function kl(e, t = fe) { + jn("ec", e, t); +} +const Mi = "components"; +function ff(e, t) { + return Pi(Mi, e, !0, t) || e; +} +const Ii = Symbol.for("v-ndc"); +function uf(e) { + return oe(e) ? Pi(Mi, e, !1) || e : e || Ii; +} +function Pi(e, t, n = !0, s = !1) { + const r = pe || fe; + if (r) { + const i = r.type; + { + const l = Cc(i, !1); + if (l && (l === t || l === Ne(t) || l === In(Ne(t)))) return i; + } + const o = lr(r[e] || i[e], t) || lr(r.appContext[e], t); + return !o && s ? i : o; + } +} +function lr(e, t) { + return e && (e[t] || e[Ne(t)] || e[In(Ne(t))]); +} +function df(e, t, n, s) { + let r; + const i = n, + o = B(e); + if (o || oe(e)) { + const l = o && gt(e); + let c = !1, + u = !1; + l && ((c = !Ie(e)), (u = it(e)), (e = Nn(e))), (r = new Array(e.length)); + for (let a = 0, h = e.length; a < h; a++) + r[a] = t(c ? (u ? Sn(de(e[a])) : de(e[a])) : e[a], a, void 0, i); + } else if (typeof e == "number") { + r = new Array(e); + for (let l = 0; l < e; l++) r[l] = t(l + 1, l, void 0, i); + } else if (se(e)) + if (e[Symbol.iterator]) r = Array.from(e, (l, c) => t(l, c, void 0, i)); + else { + const l = Object.keys(e); + r = new Array(l.length); + for (let c = 0, u = l.length; c < u; c++) { + const a = l[c]; + r[c] = t(e[a], a, c, i); + } + } + else r = []; + return r; +} +function hf(e, t, n = {}, s, r) { + if (pe.ce || (pe.parent && vt(pe.parent) && pe.parent.ce)) + return ( + t !== "default" && (n.name = t), + Ts(), + Es(Se, null, [ge("slot", n, s && s())], 64) + ); + let i = e[t]; + i && i._c && (i._d = !1), Ts(); + const o = i && Li(i(n)), + l = n.key || (o && o.key), + c = Es( + Se, + { key: (l && !Je(l) ? l : `_${t}`) + (!o && s ? "_fb" : "") }, + o || (s ? s() : []), + o && e._ === 1 ? 64 : -2, + ); + return ( + !r && c.scopeId && (c.slotScopeIds = [c.scopeId + "-s"]), + i && i._c && (i._d = !0), + c + ); +} +function Li(e) { + return e.some((t) => + Yt(t) ? !(t.type === he || (t.type === Se && !Li(t.children))) : !0, + ) + ? e + : null; +} +function pf(e, t) { + const n = {}; + for (const s in e) n[/[A-Z]/.test(s) ? `on:${s}` : mn(s)] = e[s]; + return n; +} +const _s = (e) => (e ? (io(e) ? qs(e) : _s(e.parent)) : null), + Vt = ue(Object.create(null), { + $: (e) => e, + $el: (e) => e.vnode.el, + $data: (e) => e.data, + $props: (e) => e.props, + $attrs: (e) => e.attrs, + $slots: (e) => e.slots, + $refs: (e) => e.refs, + $parent: (e) => _s(e.parent), + $root: (e) => _s(e.root), + $host: (e) => e.ce, + $emit: (e) => e.emit, + $options: (e) => Fi(e), + $forceUpdate: (e) => + e.f || + (e.f = () => { + ks(e.update); + }), + $nextTick: (e) => e.n || (e.n = Dn.bind(e.proxy)), + $watch: (e) => fc.bind(e), + }), + Zn = (e, t) => e !== ne && !e.__isScriptSetup && Q(e, t), + Ul = { + get({ _: e }, t) { + if (t === "__v_skip") return !0; + const { + ctx: n, + setupState: s, + data: r, + props: i, + accessCache: o, + type: l, + appContext: c, + } = e; + let u; + if (t[0] !== "$") { + const y = o[t]; + if (y !== void 0) + switch (y) { + case 1: + return s[t]; + case 2: + return r[t]; + case 4: + return n[t]; + case 3: + return i[t]; + } + else { + if (Zn(s, t)) return (o[t] = 1), s[t]; + if (r !== ne && Q(r, t)) return (o[t] = 2), r[t]; + if ((u = e.propsOptions[0]) && Q(u, t)) return (o[t] = 3), i[t]; + if (n !== ne && Q(n, t)) return (o[t] = 4), n[t]; + ws && (o[t] = 0); + } + } + const a = Vt[t]; + let h, v; + if (a) return t === "$attrs" && be(e.attrs, "get", ""), a(e); + if ((h = l.__cssModules) && (h = h[t])) return h; + if (n !== ne && Q(n, t)) return (o[t] = 4), n[t]; + if (((v = c.config.globalProperties), Q(v, t))) return v[t]; + }, + set({ _: e }, t, n) { + const { data: s, setupState: r, ctx: i } = e; + return Zn(r, t) + ? ((r[t] = n), !0) + : s !== ne && Q(s, t) + ? ((s[t] = n), !0) + : Q(e.props, t) || (t[0] === "$" && t.slice(1) in e) + ? !1 + : ((i[t] = n), !0); + }, + has( + { + _: { + data: e, + setupState: t, + accessCache: n, + ctx: s, + appContext: r, + propsOptions: i, + }, + }, + o, + ) { + let l; + return ( + !!n[o] || + (e !== ne && Q(e, o)) || + Zn(t, o) || + ((l = i[0]) && Q(l, o)) || + Q(s, o) || + Q(Vt, o) || + Q(r.config.globalProperties, o) + ); + }, + defineProperty(e, t, n) { + return ( + n.get != null + ? (e._.accessCache[t] = 0) + : Q(n, "value") && this.set(e, t, n.value, null), + Reflect.defineProperty(e, t, n) + ); + }, + }; +function gf() { + return Bl().slots; +} +function Bl() { + const e = en(); + return e.setupContext || (e.setupContext = lo(e)); +} +function cr(e) { + return B(e) ? e.reduce((t, n) => ((t[n] = null), t), {}) : e; +} +let ws = !0; +function Kl(e) { + const t = Fi(e), + n = e.proxy, + s = e.ctx; + (ws = !1), t.beforeCreate && ar(t.beforeCreate, e, "bc"); + const { + data: r, + computed: i, + methods: o, + watch: l, + provide: c, + inject: u, + created: a, + beforeMount: h, + mounted: v, + beforeUpdate: y, + updated: A, + activated: P, + deactivated: K, + beforeDestroy: H, + beforeUnmount: k, + destroyed: p, + unmounted: g, + render: M, + renderTracked: V, + renderTriggered: R, + errorCaptured: U, + serverPrefetch: T, + expose: I, + inheritAttrs: E, + components: b, + directives: N, + filters: Y, + } = t; + if ((u && ql(u, s, null), o)) + for (const X in o) { + const D = o[X]; + G(D) && (s[X] = D.bind(n)); + } + if (r) { + const X = r.call(n, n); + se(X) && (e.data = It(X)); + } + if (((ws = !0), i)) + for (const X in i) { + const D = i[X], + ce = G(D) ? D.bind(n, n) : G(D.get) ? D.get.bind(n, n) : ke, + nn = !G(D) && G(D.set) ? D.set.bind(n) : ke, + ct = ie({ get: ce, set: nn }); + Object.defineProperty(s, X, { + enumerable: !0, + configurable: !0, + get: () => ct.value, + set: ($e) => (ct.value = $e), + }); + } + if (l) for (const X in l) Ni(l[X], s, n, X); + if (c) { + const X = G(c) ? c.call(n) : c; + Reflect.ownKeys(X).forEach((D) => { + Ql(D, X[D]); + }); + } + a && ar(a, e, "c"); + function j(X, D) { + B(D) ? D.forEach((ce) => X(ce.bind(n))) : D && X(D.bind(n)); + } + if ( + (j(Hl, h), + j(Pt, v), + j(Dl, y), + j($l, A), + j(Ll, P), + j(Nl, K), + j(kl, U), + j(Wl, V), + j(Vl, R), + j(Oi, k), + j(Vn, g), + j(jl, T), + B(I)) + ) + if (I.length) { + const X = e.exposed || (e.exposed = {}); + I.forEach((D) => { + Object.defineProperty(X, D, { + get: () => n[D], + set: (ce) => (n[D] = ce), + }); + }); + } else e.exposed || (e.exposed = {}); + M && e.render === ke && (e.render = M), + E != null && (e.inheritAttrs = E), + b && (e.components = b), + N && (e.directives = N), + T && Ai(e); +} +function ql(e, t, n = ke) { + B(e) && (e = Ss(e)); + for (const s in e) { + const r = e[s]; + let i; + se(r) + ? "default" in r + ? (i = bt(r.from || s, r.default, !0)) + : (i = bt(r.from || s)) + : (i = bt(r)), + ae(i) + ? Object.defineProperty(t, s, { + enumerable: !0, + configurable: !0, + get: () => i.value, + set: (o) => (i.value = o), + }) + : (t[s] = i); + } +} +function ar(e, t, n) { + De(B(e) ? e.map((s) => s.bind(t.proxy)) : e.bind(t.proxy), t, n); +} +function Ni(e, t, n, s) { + let r = s.includes(".") ? zi(n, s) : () => n[s]; + if (oe(e)) { + const i = t[e]; + G(i) && Le(r, i); + } else if (G(e)) Le(r, e.bind(n)); + else if (se(e)) + if (B(e)) e.forEach((i) => Ni(i, t, n, s)); + else { + const i = G(e.handler) ? e.handler.bind(n) : t[e.handler]; + G(i) && Le(r, i, e); + } +} +function Fi(e) { + const t = e.type, + { mixins: n, extends: s } = t, + { + mixins: r, + optionsCache: i, + config: { optionMergeStrategies: o }, + } = e.appContext, + l = i.get(t); + let c; + return ( + l + ? (c = l) + : !r.length && !n && !s + ? (c = t) + : ((c = {}), + r.length && r.forEach((u) => An(c, u, o, !0)), + An(c, t, o)), + se(t) && i.set(t, c), + c + ); +} +function An(e, t, n, s = !1) { + const { mixins: r, extends: i } = t; + i && An(e, i, n, !0), r && r.forEach((o) => An(e, o, n, !0)); + for (const o in t) + if (!(s && o === "expose")) { + const l = Gl[o] || (n && n[o]); + e[o] = l ? l(e[o], t[o]) : t[o]; + } + return e; +} +const Gl = { + data: fr, + props: ur, + emits: ur, + methods: Dt, + computed: Dt, + beforeCreate: _e, + created: _e, + beforeMount: _e, + mounted: _e, + beforeUpdate: _e, + updated: _e, + beforeDestroy: _e, + beforeUnmount: _e, + destroyed: _e, + unmounted: _e, + activated: _e, + deactivated: _e, + errorCaptured: _e, + serverPrefetch: _e, + components: Dt, + directives: Dt, + watch: Yl, + provide: fr, + inject: Xl, +}; +function fr(e, t) { + return t + ? e + ? function () { + return ue( + G(e) ? e.call(this, this) : e, + G(t) ? t.call(this, this) : t, + ); + } + : t + : e; +} +function Xl(e, t) { + return Dt(Ss(e), Ss(t)); +} +function Ss(e) { + if (B(e)) { + const t = {}; + for (let n = 0; n < e.length; n++) t[e[n]] = e[n]; + return t; + } + return e; +} +function _e(e, t) { + return e ? [...new Set([].concat(e, t))] : t; +} +function Dt(e, t) { + return e ? ue(Object.create(null), e, t) : t; +} +function ur(e, t) { + return e + ? B(e) && B(t) + ? [...new Set([...e, ...t])] + : ue(Object.create(null), cr(e), cr(t ?? {})) + : t; +} +function Yl(e, t) { + if (!e) return t; + if (!t) return e; + const n = ue(Object.create(null), e); + for (const s in t) n[s] = _e(e[s], t[s]); + return n; +} +function Hi() { + return { + app: null, + config: { + isNativeTag: Ao, + performance: !1, + globalProperties: {}, + optionMergeStrategies: {}, + errorHandler: void 0, + warnHandler: void 0, + compilerOptions: {}, + }, + mixins: [], + components: {}, + directives: {}, + provides: Object.create(null), + optionsCache: new WeakMap(), + propsCache: new WeakMap(), + emitsCache: new WeakMap(), + }; +} +let zl = 0; +function Jl(e, t) { + return function (s, r = null) { + G(s) || (s = ue({}, s)), r != null && !se(r) && (r = null); + const i = Hi(), + o = new WeakSet(), + l = []; + let c = !1; + const u = (i.app = { + _uid: zl++, + _component: s, + _props: r, + _container: null, + _context: i, + _instance: null, + version: Rc, + get config() { + return i.config; + }, + set config(a) {}, + use(a, ...h) { + return ( + o.has(a) || + (a && G(a.install) + ? (o.add(a), a.install(u, ...h)) + : G(a) && (o.add(a), a(u, ...h))), + u + ); + }, + mixin(a) { + return i.mixins.includes(a) || i.mixins.push(a), u; + }, + component(a, h) { + return h ? ((i.components[a] = h), u) : i.components[a]; + }, + directive(a, h) { + return h ? ((i.directives[a] = h), u) : i.directives[a]; + }, + mount(a, h, v) { + if (!c) { + const y = u._ceVNode || ge(s, r); + return ( + (y.appContext = i), + v === !0 ? (v = "svg") : v === !1 && (v = void 0), + h && t ? t(y, a) : e(y, a, v), + (c = !0), + (u._container = a), + (a.__vue_app__ = u), + qs(y.component) + ); + } + }, + onUnmount(a) { + l.push(a); + }, + unmount() { + c && + (De(l, u._instance, 16), + e(null, u._container), + delete u._container.__vue_app__); + }, + provide(a, h) { + return (i.provides[a] = h), u; + }, + runWithContext(a) { + const h = yt; + yt = u; + try { + return a(); + } finally { + yt = h; + } + }, + }); + return u; + }; +} +let yt = null; +function Ql(e, t) { + if (fe) { + let n = fe.provides; + const s = fe.parent && fe.parent.provides; + s === n && (n = fe.provides = Object.create(s)), (n[e] = t); + } +} +function bt(e, t, n = !1) { + const s = fe || pe; + if (s || yt) { + const r = yt + ? yt._context.provides + : s + ? s.parent == null + ? s.vnode.appContext && s.vnode.appContext.provides + : s.parent.provides + : void 0; + if (r && e in r) return r[e]; + if (arguments.length > 1) return n && G(t) ? t.call(s && s.proxy) : t; + } +} +function Di() { + return !!(fe || pe || yt); +} +const $i = {}, + ji = () => Object.create($i), + Vi = (e) => Object.getPrototypeOf(e) === $i; +function Zl(e, t, n, s = !1) { + const r = {}, + i = ji(); + (e.propsDefaults = Object.create(null)), Wi(e, t, r, i); + for (const o in e.propsOptions[0]) o in r || (r[o] = void 0); + n ? (e.props = s ? r : cl(r)) : e.type.props ? (e.props = r) : (e.props = i), + (e.attrs = i); +} +function ec(e, t, n, s) { + const { + props: r, + attrs: i, + vnode: { patchFlag: o }, + } = e, + l = J(r), + [c] = e.propsOptions; + let u = !1; + if ((s || o > 0) && !(o & 16)) { + if (o & 8) { + const a = e.vnode.dynamicProps; + for (let h = 0; h < a.length; h++) { + let v = a[h]; + if (kn(e.emitsOptions, v)) continue; + const y = t[v]; + if (c) + if (Q(i, v)) y !== i[v] && ((i[v] = y), (u = !0)); + else { + const A = Ne(v); + r[A] = xs(c, l, A, y, e, !1); + } + else y !== i[v] && ((i[v] = y), (u = !0)); + } + } + } else { + Wi(e, t, r, i) && (u = !0); + let a; + for (const h in l) + (!t || (!Q(t, h) && ((a = lt(h)) === h || !Q(t, a)))) && + (c + ? n && + (n[h] !== void 0 || n[a] !== void 0) && + (r[h] = xs(c, l, h, void 0, e, !0)) + : delete r[h]); + if (i !== l) for (const h in i) (!t || !Q(t, h)) && (delete i[h], (u = !0)); + } + u && qe(e.attrs, "set", ""); +} +function Wi(e, t, n, s) { + const [r, i] = e.propsOptions; + let o = !1, + l; + if (t) + for (let c in t) { + if (Ot(c)) continue; + const u = t[c]; + let a; + r && Q(r, (a = Ne(c))) + ? !i || !i.includes(a) + ? (n[a] = u) + : ((l || (l = {}))[a] = u) + : kn(e.emitsOptions, c) || + ((!(c in s) || u !== s[c]) && ((s[c] = u), (o = !0))); + } + if (i) { + const c = J(n), + u = l || ne; + for (let a = 0; a < i.length; a++) { + const h = i[a]; + n[h] = xs(r, c, h, u[h], e, !Q(u, h)); + } + } + return o; +} +function xs(e, t, n, s, r, i) { + const o = e[n]; + if (o != null) { + const l = Q(o, "default"); + if (l && s === void 0) { + const c = o.default; + if (o.type !== Function && !o.skipFactory && G(c)) { + const { propsDefaults: u } = r; + if (n in u) s = u[n]; + else { + const a = tn(r); + (s = u[n] = c.call(null, t)), a(); + } + } else s = c; + r.ce && r.ce._setProp(n, s); + } + o[0] && + (i && !l ? (s = !1) : o[1] && (s === "" || s === lt(n)) && (s = !0)); + } + return s; +} +const tc = new WeakMap(); +function ki(e, t, n = !1) { + const s = n ? tc : t.propsCache, + r = s.get(e); + if (r) return r; + const i = e.props, + o = {}, + l = []; + let c = !1; + if (!G(e)) { + const a = (h) => { + c = !0; + const [v, y] = ki(h, t, !0); + ue(o, v), y && l.push(...y); + }; + !n && t.mixins.length && t.mixins.forEach(a), + e.extends && a(e.extends), + e.mixins && e.mixins.forEach(a); + } + if (!i && !c) return se(e) && s.set(e, At), At; + if (B(i)) + for (let a = 0; a < i.length; a++) { + const h = Ne(i[a]); + dr(h) && (o[h] = ne); + } + else if (i) + for (const a in i) { + const h = Ne(a); + if (dr(h)) { + const v = i[a], + y = (o[h] = B(v) || G(v) ? { type: v } : ue({}, v)), + A = y.type; + let P = !1, + K = !0; + if (B(A)) + for (let H = 0; H < A.length; ++H) { + const k = A[H], + p = G(k) && k.name; + if (p === "Boolean") { + P = !0; + break; + } else p === "String" && (K = !1); + } + else P = G(A) && A.name === "Boolean"; + (y[0] = P), (y[1] = K), (P || Q(y, "default")) && l.push(h); + } + } + const u = [o, l]; + return se(e) && s.set(e, u), u; +} +function dr(e) { + return e[0] !== "$" && !Ot(e); +} +const Us = (e) => e[0] === "_" || e === "$stable", + Bs = (e) => (B(e) ? e.map(Me) : [Me(e)]), + nc = (e, t, n) => { + if (t._n) return t; + const s = Tl((...r) => Bs(t(...r)), n); + return (s._c = !1), s; + }, + Ui = (e, t, n) => { + const s = e._ctx; + for (const r in e) { + if (Us(r)) continue; + const i = e[r]; + if (G(i)) t[r] = nc(r, i, s); + else if (i != null) { + const o = Bs(i); + t[r] = () => o; + } + } + }, + Bi = (e, t) => { + const n = Bs(t); + e.slots.default = () => n; + }, + Ki = (e, t, n) => { + for (const s in t) (n || !Us(s)) && (e[s] = t[s]); + }, + sc = (e, t, n) => { + const s = (e.slots = ji()); + if (e.vnode.shapeFlag & 32) { + const r = t._; + r ? (Ki(s, t, n), n && Yr(s, "_", r, !0)) : Ui(t, s); + } else t && Bi(e, t); + }, + rc = (e, t, n) => { + const { vnode: s, slots: r } = e; + let i = !0, + o = ne; + if (s.shapeFlag & 32) { + const l = t._; + l + ? n && l === 1 + ? (i = !1) + : Ki(r, t, n) + : ((i = !t.$stable), Ui(t, r)), + (o = t); + } else t && (Bi(e, t), (o = { default: 1 })); + if (i) for (const l in r) !Us(l) && o[l] == null && delete r[l]; + }, + Ce = eo; +function ic(e) { + return oc(e, Il); +} +function oc(e, t) { + const n = Pn(); + n.__VUE__ = !0; + const { + insert: s, + remove: r, + patchProp: i, + createElement: o, + createText: l, + createComment: c, + setText: u, + setElementText: a, + parentNode: h, + nextSibling: v, + setScopeId: y = ke, + insertStaticContent: A, + } = e, + P = ( + f, + d, + m, + S = null, + _ = null, + w = null, + L = void 0, + O = null, + C = !!d.dynamicChildren, + ) => { + if (f === d) return; + f && !ht(f, d) && ((S = sn(f)), $e(f, _, w, !0), (f = null)), + d.patchFlag === -2 && ((C = !1), (d.dynamicChildren = null)); + const { type: x, ref: W, shapeFlag: F } = d; + switch (x) { + case _t: + K(f, d, m, S); + break; + case he: + H(f, d, m, S); + break; + case Wt: + f == null && k(d, m, S, L); + break; + case Se: + b(f, d, m, S, _, w, L, O, C); + break; + default: + F & 1 + ? M(f, d, m, S, _, w, L, O, C) + : F & 6 + ? N(f, d, m, S, _, w, L, O, C) + : (F & 64 || F & 128) && x.process(f, d, m, S, _, w, L, O, C, xt); + } + W != null && _ && Gt(W, f && f.ref, w, d || f, !d); + }, + K = (f, d, m, S) => { + if (f == null) s((d.el = l(d.children)), m, S); + else { + const _ = (d.el = f.el); + d.children !== f.children && u(_, d.children); + } + }, + H = (f, d, m, S) => { + f == null ? s((d.el = c(d.children || "")), m, S) : (d.el = f.el); + }, + k = (f, d, m, S) => { + [f.el, f.anchor] = A(f.children, d, m, S, f.el, f.anchor); + }, + p = ({ el: f, anchor: d }, m, S) => { + let _; + for (; f && f !== d; ) (_ = v(f)), s(f, m, S), (f = _); + s(d, m, S); + }, + g = ({ el: f, anchor: d }) => { + let m; + for (; f && f !== d; ) (m = v(f)), r(f), (f = m); + r(d); + }, + M = (f, d, m, S, _, w, L, O, C) => { + d.type === "svg" ? (L = "svg") : d.type === "math" && (L = "mathml"), + f == null ? V(d, m, S, _, w, L, O, C) : T(f, d, _, w, L, O, C); + }, + V = (f, d, m, S, _, w, L, O) => { + let C, x; + const { props: W, shapeFlag: F, transition: $, dirs: q } = f; + if ( + ((C = f.el = o(f.type, w, W && W.is, W)), + F & 8 + ? a(C, f.children) + : F & 16 && U(f.children, C, null, S, _, es(f, w), L, O), + q && We(f, null, S, "created"), + R(C, f, f.scopeId, L, S), + W) + ) { + for (const ee in W) + ee !== "value" && !Ot(ee) && i(C, ee, null, W[ee], w, S); + "value" in W && i(C, "value", null, W.value, w), + (x = W.onVnodeBeforeMount) && Oe(x, S, f); + } + q && We(f, null, S, "beforeMount"); + const z = qi(_, $); + z && $.beforeEnter(C), + s(C, d, m), + ((x = W && W.onVnodeMounted) || z || q) && + Ce(() => { + x && Oe(x, S, f), z && $.enter(C), q && We(f, null, S, "mounted"); + }, _); + }, + R = (f, d, m, S, _) => { + if ((m && y(f, m), S)) for (let w = 0; w < S.length; w++) y(f, S[w]); + if (_) { + let w = _.subTree; + if ( + d === w || + (Zi(w.type) && (w.ssContent === d || w.ssFallback === d)) + ) { + const L = _.vnode; + R(f, L, L.scopeId, L.slotScopeIds, _.parent); + } + } + }, + U = (f, d, m, S, _, w, L, O, C = 0) => { + for (let x = C; x < f.length; x++) { + const W = (f[x] = O ? nt(f[x]) : Me(f[x])); + P(null, W, d, m, S, _, w, L, O); + } + }, + T = (f, d, m, S, _, w, L) => { + const O = (d.el = f.el); + let { patchFlag: C, dynamicChildren: x, dirs: W } = d; + C |= f.patchFlag & 16; + const F = f.props || ne, + $ = d.props || ne; + let q; + if ( + (m && at(m, !1), + (q = $.onVnodeBeforeUpdate) && Oe(q, m, d, f), + W && We(d, f, m, "beforeUpdate"), + m && at(m, !0), + ((F.innerHTML && $.innerHTML == null) || + (F.textContent && $.textContent == null)) && + a(O, ""), + x + ? I(f.dynamicChildren, x, O, m, S, es(d, _), w) + : L || D(f, d, O, null, m, S, es(d, _), w, !1), + C > 0) + ) { + if (C & 16) E(O, F, $, m, _); + else if ( + (C & 2 && F.class !== $.class && i(O, "class", null, $.class, _), + C & 4 && i(O, "style", F.style, $.style, _), + C & 8) + ) { + const z = d.dynamicProps; + for (let ee = 0; ee < z.length; ee++) { + const Z = z[ee], + xe = F[Z], + me = $[Z]; + (me !== xe || Z === "value") && i(O, Z, xe, me, _, m); + } + } + C & 1 && f.children !== d.children && a(O, d.children); + } else !L && x == null && E(O, F, $, m, _); + ((q = $.onVnodeUpdated) || W) && + Ce(() => { + q && Oe(q, m, d, f), W && We(d, f, m, "updated"); + }, S); + }, + I = (f, d, m, S, _, w, L) => { + for (let O = 0; O < d.length; O++) { + const C = f[O], + x = d[O], + W = + C.el && (C.type === Se || !ht(C, x) || C.shapeFlag & 70) + ? h(C.el) + : m; + P(C, x, W, null, S, _, w, L, !0); + } + }, + E = (f, d, m, S, _) => { + if (d !== m) { + if (d !== ne) + for (const w in d) !Ot(w) && !(w in m) && i(f, w, d[w], null, _, S); + for (const w in m) { + if (Ot(w)) continue; + const L = m[w], + O = d[w]; + L !== O && w !== "value" && i(f, w, O, L, _, S); + } + "value" in m && i(f, "value", d.value, m.value, _); + } + }, + b = (f, d, m, S, _, w, L, O, C) => { + const x = (d.el = f ? f.el : l("")), + W = (d.anchor = f ? f.anchor : l("")); + let { patchFlag: F, dynamicChildren: $, slotScopeIds: q } = d; + q && (O = O ? O.concat(q) : q), + f == null + ? (s(x, m, S), s(W, m, S), U(d.children || [], m, W, _, w, L, O, C)) + : F > 0 && F & 64 && $ && f.dynamicChildren + ? (I(f.dynamicChildren, $, m, _, w, L, O), + (d.key != null || (_ && d === _.subTree)) && Gi(f, d, !0)) + : D(f, d, m, W, _, w, L, O, C); + }, + N = (f, d, m, S, _, w, L, O, C) => { + (d.slotScopeIds = O), + f == null + ? d.shapeFlag & 512 + ? _.ctx.activate(d, m, S, L, C) + : Y(d, m, S, _, w, L, C) + : re(f, d, C); + }, + Y = (f, d, m, S, _, w, L) => { + const O = (f.component = Sc(f, S, _)); + if (($n(f) && (O.ctx.renderer = xt), xc(O, !1, L), O.asyncDep)) { + if ((_ && _.registerDep(O, j, L), !f.el)) { + const C = (O.subTree = ge(he)); + H(null, C, d, m); + } + } else j(O, f, d, m, _, w, L); + }, + re = (f, d, m) => { + const S = (d.component = f.component); + if (gc(f, d, m)) + if (S.asyncDep && !S.asyncResolved) { + X(S, d, m); + return; + } else (S.next = d), S.update(); + else (d.el = f.el), (S.vnode = d); + }, + j = (f, d, m, S, _, w, L) => { + const O = () => { + if (f.isMounted) { + let { next: F, bu: $, u: q, parent: z, vnode: ee } = f; + { + const Te = Xi(f); + if (Te) { + F && ((F.el = ee.el), X(f, F, L)), + Te.asyncDep.then(() => { + f.isUnmounted || O(); + }); + return; + } + } + let Z = F, + xe; + at(f, !1), + F ? ((F.el = ee.el), X(f, F, L)) : (F = ee), + $ && Gn($), + (xe = F.props && F.props.onVnodeBeforeUpdate) && Oe(xe, z, F, ee), + at(f, !0); + const me = ts(f), + Fe = f.subTree; + (f.subTree = me), + P(Fe, me, h(Fe.el), sn(Fe), f, _, w), + (F.el = me.el), + Z === null && Qi(f, me.el), + q && Ce(q, _), + (xe = F.props && F.props.onVnodeUpdated) && + Ce(() => Oe(xe, z, F, ee), _); + } else { + let F; + const { el: $, props: q } = d, + { bm: z, m: ee, parent: Z, root: xe, type: me } = f, + Fe = vt(d); + if ( + (at(f, !1), + z && Gn(z), + !Fe && (F = q && q.onVnodeBeforeMount) && Oe(F, Z, d), + at(f, !0), + $ && qn) + ) { + const Te = () => { + (f.subTree = ts(f)), qn($, f.subTree, f, _, null); + }; + Fe && me.__asyncHydrate ? me.__asyncHydrate($, f, Te) : Te(); + } else { + xe.ce && xe.ce._injectChildStyle(me); + const Te = (f.subTree = ts(f)); + P(null, Te, m, S, f, _, w), (d.el = Te.el); + } + if ((ee && Ce(ee, _), !Fe && (F = q && q.onVnodeMounted))) { + const Te = d; + Ce(() => Oe(F, Z, Te), _); + } + (d.shapeFlag & 256 || + (Z && vt(Z.vnode) && Z.vnode.shapeFlag & 256)) && + f.a && + Ce(f.a, _), + (f.isMounted = !0), + (d = m = S = null); + } + }; + f.scope.on(); + const C = (f.effect = new ei(O)); + f.scope.off(); + const x = (f.update = C.run.bind(C)), + W = (f.job = C.runIfDirty.bind(C)); + (W.i = f), (W.id = f.uid), (C.scheduler = () => ks(W)), at(f, !0), x(); + }, + X = (f, d, m) => { + d.component = f; + const S = f.vnode.props; + (f.vnode = d), + (f.next = null), + ec(f, d.props, S, m), + rc(f, d.children, m), + Ge(), + sr(f), + Xe(); + }, + D = (f, d, m, S, _, w, L, O, C = !1) => { + const x = f && f.children, + W = f ? f.shapeFlag : 0, + F = d.children, + { patchFlag: $, shapeFlag: q } = d; + if ($ > 0) { + if ($ & 128) { + nn(x, F, m, S, _, w, L, O, C); + return; + } else if ($ & 256) { + ce(x, F, m, S, _, w, L, O, C); + return; + } + } + q & 8 + ? (W & 16 && Lt(x, _, w), F !== x && a(m, F)) + : W & 16 + ? q & 16 + ? nn(x, F, m, S, _, w, L, O, C) + : Lt(x, _, w, !0) + : (W & 8 && a(m, ""), q & 16 && U(F, m, S, _, w, L, O, C)); + }, + ce = (f, d, m, S, _, w, L, O, C) => { + (f = f || At), (d = d || At); + const x = f.length, + W = d.length, + F = Math.min(x, W); + let $; + for ($ = 0; $ < F; $++) { + const q = (d[$] = C ? nt(d[$]) : Me(d[$])); + P(f[$], q, m, null, _, w, L, O, C); + } + x > W ? Lt(f, _, w, !0, !1, F) : U(d, m, S, _, w, L, O, C, F); + }, + nn = (f, d, m, S, _, w, L, O, C) => { + let x = 0; + const W = d.length; + let F = f.length - 1, + $ = W - 1; + for (; x <= F && x <= $; ) { + const q = f[x], + z = (d[x] = C ? nt(d[x]) : Me(d[x])); + if (ht(q, z)) P(q, z, m, null, _, w, L, O, C); + else break; + x++; + } + for (; x <= F && x <= $; ) { + const q = f[F], + z = (d[$] = C ? nt(d[$]) : Me(d[$])); + if (ht(q, z)) P(q, z, m, null, _, w, L, O, C); + else break; + F--, $--; + } + if (x > F) { + if (x <= $) { + const q = $ + 1, + z = q < W ? d[q].el : S; + for (; x <= $; ) + P(null, (d[x] = C ? nt(d[x]) : Me(d[x])), m, z, _, w, L, O, C), x++; + } + } else if (x > $) for (; x <= F; ) $e(f[x], _, w, !0), x++; + else { + const q = x, + z = x, + ee = new Map(); + for (x = z; x <= $; x++) { + const Ee = (d[x] = C ? nt(d[x]) : Me(d[x])); + Ee.key != null && ee.set(Ee.key, x); + } + let Z, + xe = 0; + const me = $ - z + 1; + let Fe = !1, + Te = 0; + const Nt = new Array(me); + for (x = 0; x < me; x++) Nt[x] = 0; + for (x = q; x <= F; x++) { + const Ee = f[x]; + if (xe >= me) { + $e(Ee, _, w, !0); + continue; + } + let je; + if (Ee.key != null) je = ee.get(Ee.key); + else + for (Z = z; Z <= $; Z++) + if (Nt[Z - z] === 0 && ht(Ee, d[Z])) { + je = Z; + break; + } + je === void 0 + ? $e(Ee, _, w, !0) + : ((Nt[je - z] = x + 1), + je >= Te ? (Te = je) : (Fe = !0), + P(Ee, d[je], m, null, _, w, L, O, C), + xe++); + } + const Qs = Fe ? lc(Nt) : At; + for (Z = Qs.length - 1, x = me - 1; x >= 0; x--) { + const Ee = z + x, + je = d[Ee], + Zs = Ee + 1 < W ? d[Ee + 1].el : S; + Nt[x] === 0 + ? P(null, je, m, Zs, _, w, L, O, C) + : Fe && (Z < 0 || x !== Qs[Z] ? ct(je, m, Zs, 2) : Z--); + } + } + }, + ct = (f, d, m, S, _ = null) => { + const { el: w, type: L, transition: O, children: C, shapeFlag: x } = f; + if (x & 6) { + ct(f.component.subTree, d, m, S); + return; + } + if (x & 128) { + f.suspense.move(d, m, S); + return; + } + if (x & 64) { + L.move(f, d, m, xt); + return; + } + if (L === Se) { + s(w, d, m); + for (let F = 0; F < C.length; F++) ct(C[F], d, m, S); + s(f.anchor, d, m); + return; + } + if (L === Wt) { + p(f, d, m); + return; + } + if (S !== 2 && x & 1 && O) + if (S === 0) O.beforeEnter(w), s(w, d, m), Ce(() => O.enter(w), _); + else { + const { leave: F, delayLeave: $, afterLeave: q } = O, + z = () => { + f.ctx.isUnmounted ? r(w) : s(w, d, m); + }, + ee = () => { + F(w, () => { + z(), q && q(); + }); + }; + $ ? $(w, z, ee) : ee(); + } + else s(w, d, m); + }, + $e = (f, d, m, S = !1, _ = !1) => { + const { + type: w, + props: L, + ref: O, + children: C, + dynamicChildren: x, + shapeFlag: W, + patchFlag: F, + dirs: $, + cacheIndex: q, + } = f; + if ( + (F === -2 && (_ = !1), + O != null && (Ge(), Gt(O, null, m, f, !0), Xe()), + q != null && (d.renderCache[q] = void 0), + W & 256) + ) { + d.ctx.deactivate(f); + return; + } + const z = W & 1 && $, + ee = !vt(f); + let Z; + if ((ee && (Z = L && L.onVnodeBeforeUnmount) && Oe(Z, d, f), W & 6)) + Co(f.component, m, S); + else { + if (W & 128) { + f.suspense.unmount(m, S); + return; + } + z && We(f, null, d, "beforeUnmount"), + W & 64 + ? f.type.remove(f, d, m, xt, S) + : x && !x.hasOnce && (w !== Se || (F > 0 && F & 64)) + ? Lt(x, d, m, !1, !0) + : ((w === Se && F & 384) || (!_ && W & 16)) && Lt(C, d, m), + S && zs(f); + } + ((ee && (Z = L && L.onVnodeUnmounted)) || z) && + Ce(() => { + Z && Oe(Z, d, f), z && We(f, null, d, "unmounted"); + }, m); + }, + zs = (f) => { + const { type: d, el: m, anchor: S, transition: _ } = f; + if (d === Se) { + Eo(m, S); + return; + } + if (d === Wt) { + g(f); + return; + } + const w = () => { + r(m), _ && !_.persisted && _.afterLeave && _.afterLeave(); + }; + if (f.shapeFlag & 1 && _ && !_.persisted) { + const { leave: L, delayLeave: O } = _, + C = () => L(m, w); + O ? O(f.el, w, C) : C(); + } else w(); + }, + Eo = (f, d) => { + let m; + for (; f !== d; ) (m = v(f)), r(f), (f = m); + r(d); + }, + Co = (f, d, m) => { + const { + bum: S, + scope: _, + job: w, + subTree: L, + um: O, + m: C, + a: x, + parent: W, + slots: { __: F }, + } = f; + hr(C), + hr(x), + S && Gn(S), + W && + B(F) && + F.forEach(($) => { + W.renderCache[$] = void 0; + }), + _.stop(), + w && ((w.flags |= 8), $e(L, f, d, m)), + O && Ce(O, d), + Ce(() => { + f.isUnmounted = !0; + }, d), + d && + d.pendingBranch && + !d.isUnmounted && + f.asyncDep && + !f.asyncResolved && + f.suspenseId === d.pendingId && + (d.deps--, d.deps === 0 && d.resolve()); + }, + Lt = (f, d, m, S = !1, _ = !1, w = 0) => { + for (let L = w; L < f.length; L++) $e(f[L], d, m, S, _); + }, + sn = (f) => { + if (f.shapeFlag & 6) return sn(f.component.subTree); + if (f.shapeFlag & 128) return f.suspense.next(); + const d = v(f.anchor || f.el), + m = d && d[El]; + return m ? v(m) : d; + }; + let Bn = !1; + const Js = (f, d, m) => { + f == null + ? d._vnode && $e(d._vnode, null, null, !0) + : P(d._vnode || null, f, d, null, null, null, m), + (d._vnode = f), + Bn || ((Bn = !0), sr(), En(), (Bn = !1)); + }, + xt = { + p: P, + um: $e, + m: ct, + r: zs, + mt: Y, + mc: U, + pc: D, + pbc: I, + n: sn, + o: e, + }; + let Kn, qn; + return ( + t && ([Kn, qn] = t(xt)), { render: Js, hydrate: Kn, createApp: Jl(Js, Kn) } + ); +} +function es({ type: e, props: t }, n) { + return (n === "svg" && e === "foreignObject") || + (n === "mathml" && + e === "annotation-xml" && + t && + t.encoding && + t.encoding.includes("html")) + ? void 0 + : n; +} +function at({ effect: e, job: t }, n) { + n ? ((e.flags |= 32), (t.flags |= 4)) : ((e.flags &= -33), (t.flags &= -5)); +} +function qi(e, t) { + return (!e || (e && !e.pendingBranch)) && t && !t.persisted; +} +function Gi(e, t, n = !1) { + const s = e.children, + r = t.children; + if (B(s) && B(r)) + for (let i = 0; i < s.length; i++) { + const o = s[i]; + let l = r[i]; + l.shapeFlag & 1 && + !l.dynamicChildren && + ((l.patchFlag <= 0 || l.patchFlag === 32) && + ((l = r[i] = nt(r[i])), (l.el = o.el)), + !n && l.patchFlag !== -2 && Gi(o, l)), + l.type === _t && (l.el = o.el), + l.type === he && !l.el && (l.el = o.el); + } +} +function lc(e) { + const t = e.slice(), + n = [0]; + let s, r, i, o, l; + const c = e.length; + for (s = 0; s < c; s++) { + const u = e[s]; + if (u !== 0) { + if (((r = n[n.length - 1]), e[r] < u)) { + (t[s] = r), n.push(s); + continue; + } + for (i = 0, o = n.length - 1; i < o; ) + (l = (i + o) >> 1), e[n[l]] < u ? (i = l + 1) : (o = l); + u < e[n[i]] && (i > 0 && (t[s] = n[i - 1]), (n[i] = s)); + } + } + for (i = n.length, o = n[i - 1]; i-- > 0; ) (n[i] = o), (o = t[o]); + return n; +} +function Xi(e) { + const t = e.subTree.component; + if (t) return t.asyncDep && !t.asyncResolved ? t : Xi(t); +} +function hr(e) { + if (e) for (let t = 0; t < e.length; t++) e[t].flags |= 8; +} +const cc = Symbol.for("v-scx"), + ac = () => bt(cc); +function Yi(e, t) { + return Wn(e, null, t); +} +function mf(e, t) { + return Wn(e, null, { flush: "post" }); +} +function Le(e, t, n) { + return Wn(e, t, n); +} +function Wn(e, t, n = ne) { + const { immediate: s, deep: r, flush: i, once: o } = n, + l = ue({}, n), + c = (t && s) || (!t && i !== "post"); + let u; + if (zt) { + if (i === "sync") { + const y = ac(); + u = y.__watcherHandles || (y.__watcherHandles = []); + } else if (!c) { + const y = () => {}; + return (y.stop = ke), (y.resume = ke), (y.pause = ke), y; + } + } + const a = fe; + l.call = (y, A, P) => De(y, a, A, P); + let h = !1; + i === "post" + ? (l.scheduler = (y) => { + Ce(y, a && a.suspense); + }) + : i !== "sync" && + ((h = !0), + (l.scheduler = (y, A) => { + A ? y() : ks(y); + })), + (l.augmentJob = (y) => { + t && (y.flags |= 4), + h && ((y.flags |= 2), a && ((y.id = a.uid), (y.i = a))); + }); + const v = _l(e, t, l); + return zt && (u ? u.push(v) : c && v()), v; +} +function fc(e, t, n) { + const s = this.proxy, + r = oe(e) ? (e.includes(".") ? zi(s, e) : () => s[e]) : e.bind(s, s); + let i; + G(t) ? (i = t) : ((i = t.handler), (n = t)); + const o = tn(this), + l = Wn(r, i.bind(s), n); + return o(), l; +} +function zi(e, t) { + const n = t.split("."); + return () => { + let s = e; + for (let r = 0; r < n.length && s; r++) s = s[n[r]]; + return s; + }; +} +const uc = (e, t) => + t === "modelValue" || t === "model-value" + ? e.modelModifiers + : e[`${t}Modifiers`] || e[`${Ne(t)}Modifiers`] || e[`${lt(t)}Modifiers`]; +function dc(e, t, ...n) { + if (e.isUnmounted) return; + const s = e.vnode.props || ne; + let r = n; + const i = t.startsWith("update:"), + o = i && uc(s, t.slice(7)); + o && + (o.trim && (r = n.map((a) => (oe(a) ? a.trim() : a))), + o.number && (r = n.map(Po))); + let l, + c = s[(l = mn(t))] || s[(l = mn(Ne(t)))]; + !c && i && (c = s[(l = mn(lt(t)))]), c && De(c, e, 6, r); + const u = s[l + "Once"]; + if (u) { + if (!e.emitted) e.emitted = {}; + else if (e.emitted[l]) return; + (e.emitted[l] = !0), De(u, e, 6, r); + } +} +function Ji(e, t, n = !1) { + const s = t.emitsCache, + r = s.get(e); + if (r !== void 0) return r; + const i = e.emits; + let o = {}, + l = !1; + if (!G(e)) { + const c = (u) => { + const a = Ji(u, t, !0); + a && ((l = !0), ue(o, a)); + }; + !n && t.mixins.length && t.mixins.forEach(c), + e.extends && c(e.extends), + e.mixins && e.mixins.forEach(c); + } + return !i && !l + ? (se(e) && s.set(e, null), null) + : (B(i) ? i.forEach((c) => (o[c] = null)) : ue(o, i), + se(e) && s.set(e, o), + o); +} +function kn(e, t) { + return !e || !Qt(t) + ? !1 + : ((t = t.slice(2).replace(/Once$/, "")), + Q(e, t[0].toLowerCase() + t.slice(1)) || Q(e, lt(t)) || Q(e, t)); +} +function ts(e) { + const { + type: t, + vnode: n, + proxy: s, + withProxy: r, + propsOptions: [i], + slots: o, + attrs: l, + emit: c, + render: u, + renderCache: a, + props: h, + data: v, + setupState: y, + ctx: A, + inheritAttrs: P, + } = e, + K = Cn(e); + let H, k; + try { + if (n.shapeFlag & 4) { + const g = r || s, + M = g; + (H = Me(u.call(M, g, a, h, y, v, A))), (k = l); + } else { + const g = t; + (H = Me( + g.length > 1 ? g(h, { attrs: l, slots: o, emit: c }) : g(h, null), + )), + (k = t.props ? l : hc(l)); + } + } catch (g) { + (kt.length = 0), Hn(g, e, 1), (H = ge(he)); + } + let p = H; + if (k && P !== !1) { + const g = Object.keys(k), + { shapeFlag: M } = p; + g.length && + M & 7 && + (i && g.some(Ms) && (k = pc(k, i)), (p = ot(p, k, !1, !0))); + } + return ( + n.dirs && + ((p = ot(p, null, !1, !0)), + (p.dirs = p.dirs ? p.dirs.concat(n.dirs) : n.dirs)), + n.transition && qt(p, n.transition), + (H = p), + Cn(K), + H + ); +} +const hc = (e) => { + let t; + for (const n in e) + (n === "class" || n === "style" || Qt(n)) && ((t || (t = {}))[n] = e[n]); + return t; + }, + pc = (e, t) => { + const n = {}; + for (const s in e) (!Ms(s) || !(s.slice(9) in t)) && (n[s] = e[s]); + return n; + }; +function gc(e, t, n) { + const { props: s, children: r, component: i } = e, + { props: o, children: l, patchFlag: c } = t, + u = i.emitsOptions; + if (t.dirs || t.transition) return !0; + if (n && c >= 0) { + if (c & 1024) return !0; + if (c & 16) return s ? pr(s, o, u) : !!o; + if (c & 8) { + const a = t.dynamicProps; + for (let h = 0; h < a.length; h++) { + const v = a[h]; + if (o[v] !== s[v] && !kn(u, v)) return !0; + } + } + } else + return (r || l) && (!l || !l.$stable) + ? !0 + : s === o + ? !1 + : s + ? o + ? pr(s, o, u) + : !0 + : !!o; + return !1; +} +function pr(e, t, n) { + const s = Object.keys(t); + if (s.length !== Object.keys(e).length) return !0; + for (let r = 0; r < s.length; r++) { + const i = s[r]; + if (t[i] !== e[i] && !kn(n, i)) return !0; + } + return !1; +} +function Qi({ vnode: e, parent: t }, n) { + for (; t; ) { + const s = t.subTree; + if ((s.suspense && s.suspense.activeBranch === e && (s.el = e.el), s === e)) + ((e = t.vnode).el = n), (t = t.parent); + else break; + } +} +const Zi = (e) => e.__isSuspense; +function eo(e, t) { + t && t.pendingBranch + ? B(e) + ? t.effects.push(...e) + : t.effects.push(e) + : xl(e); +} +const Se = Symbol.for("v-fgt"), + _t = Symbol.for("v-txt"), + he = Symbol.for("v-cmt"), + Wt = Symbol.for("v-stc"), + kt = []; +let Ae = null; +function Ts(e = !1) { + kt.push((Ae = e ? null : [])); +} +function mc() { + kt.pop(), (Ae = kt[kt.length - 1] || null); +} +let Xt = 1; +function gr(e, t = !1) { + (Xt += e), e < 0 && Ae && t && (Ae.hasOnce = !0); +} +function to(e) { + return ( + (e.dynamicChildren = Xt > 0 ? Ae || At : null), + mc(), + Xt > 0 && Ae && Ae.push(e), + e + ); +} +function vf(e, t, n, s, r, i) { + return to(so(e, t, n, s, r, i, !0)); +} +function Es(e, t, n, s, r) { + return to(ge(e, t, n, s, r, !0)); +} +function Yt(e) { + return e ? e.__v_isVNode === !0 : !1; +} +function ht(e, t) { + return e.type === t.type && e.key === t.key; +} +const no = ({ key: e }) => e ?? null, + yn = ({ ref: e, ref_key: t, ref_for: n }) => ( + typeof e == "number" && (e = "" + e), + e != null + ? oe(e) || ae(e) || G(e) + ? { i: pe, r: e, k: t, f: !!n } + : e + : null + ); +function so( + e, + t = null, + n = null, + s = 0, + r = null, + i = e === Se ? 0 : 1, + o = !1, + l = !1, +) { + const c = { + __v_isVNode: !0, + __v_skip: !0, + type: e, + props: t, + key: t && no(t), + ref: t && yn(t), + scopeId: bi, + slotScopeIds: null, + children: n, + component: null, + suspense: null, + ssContent: null, + ssFallback: null, + dirs: null, + transition: null, + el: null, + anchor: null, + target: null, + targetStart: null, + targetAnchor: null, + staticCount: 0, + shapeFlag: i, + patchFlag: s, + dynamicProps: r, + dynamicChildren: null, + appContext: null, + ctx: pe, + }; + return ( + l + ? (Ks(c, n), i & 128 && e.normalize(c)) + : n && (c.shapeFlag |= oe(n) ? 8 : 16), + Xt > 0 && + !o && + Ae && + (c.patchFlag > 0 || i & 6) && + c.patchFlag !== 32 && + Ae.push(c), + c + ); +} +const ge = vc; +function vc(e, t = null, n = null, s = 0, r = null, i = !1) { + if (((!e || e === Ii) && (e = he), Yt(e))) { + const l = ot(e, t, !0); + return ( + n && Ks(l, n), + Xt > 0 && + !i && + Ae && + (l.shapeFlag & 6 ? (Ae[Ae.indexOf(e)] = l) : Ae.push(l)), + (l.patchFlag = -2), + l + ); + } + if ((Ac(e) && (e = e.__vccOpts), t)) { + t = yc(t); + let { class: l, style: c } = t; + l && !oe(l) && (t.class = Ns(l)), + se(c) && (Vs(c) && !B(c) && (c = ue({}, c)), (t.style = Ls(c))); + } + const o = oe(e) ? 1 : Zi(e) ? 128 : _i(e) ? 64 : se(e) ? 4 : G(e) ? 2 : 0; + return so(e, t, n, s, r, o, i, !0); +} +function yc(e) { + return e ? (Vs(e) || Vi(e) ? ue({}, e) : e) : null; +} +function ot(e, t, n = !1, s = !1) { + const { props: r, ref: i, patchFlag: o, children: l, transition: c } = e, + u = t ? bc(r || {}, t) : r, + a = { + __v_isVNode: !0, + __v_skip: !0, + type: e.type, + props: u, + key: u && no(u), + ref: + t && t.ref + ? n && i + ? B(i) + ? i.concat(yn(t)) + : [i, yn(t)] + : yn(t) + : i, + scopeId: e.scopeId, + slotScopeIds: e.slotScopeIds, + children: l, + target: e.target, + targetStart: e.targetStart, + targetAnchor: e.targetAnchor, + staticCount: e.staticCount, + shapeFlag: e.shapeFlag, + patchFlag: t && e.type !== Se ? (o === -1 ? 16 : o | 16) : o, + dynamicProps: e.dynamicProps, + dynamicChildren: e.dynamicChildren, + appContext: e.appContext, + dirs: e.dirs, + transition: c, + component: e.component, + suspense: e.suspense, + ssContent: e.ssContent && ot(e.ssContent), + ssFallback: e.ssFallback && ot(e.ssFallback), + el: e.el, + anchor: e.anchor, + ctx: e.ctx, + ce: e.ce, + }; + return c && s && qt(a, c.clone(a)), a; +} +function ro(e = " ", t = 0) { + return ge(_t, null, e, t); +} +function yf(e, t) { + const n = ge(Wt, null, e); + return (n.staticCount = t), n; +} +function bf(e = "", t = !1) { + return t ? (Ts(), Es(he, null, e)) : ge(he, null, e); +} +function Me(e) { + return e == null || typeof e == "boolean" + ? ge(he) + : B(e) + ? ge(Se, null, e.slice()) + : Yt(e) + ? nt(e) + : ge(_t, null, String(e)); +} +function nt(e) { + return (e.el === null && e.patchFlag !== -1) || e.memo ? e : ot(e); +} +function Ks(e, t) { + let n = 0; + const { shapeFlag: s } = e; + if (t == null) t = null; + else if (B(t)) n = 16; + else if (typeof t == "object") + if (s & 65) { + const r = t.default; + r && (r._c && (r._d = !1), Ks(e, r()), r._c && (r._d = !0)); + return; + } else { + n = 32; + const r = t._; + !r && !Vi(t) + ? (t._ctx = pe) + : r === 3 && + pe && + (pe.slots._ === 1 ? (t._ = 1) : ((t._ = 2), (e.patchFlag |= 1024))); + } + else + G(t) + ? ((t = { default: t, _ctx: pe }), (n = 32)) + : ((t = String(t)), s & 64 ? ((n = 16), (t = [ro(t)])) : (n = 8)); + (e.children = t), (e.shapeFlag |= n); +} +function bc(...e) { + const t = {}; + for (let n = 0; n < e.length; n++) { + const s = e[n]; + for (const r in s) + if (r === "class") + t.class !== s.class && (t.class = Ns([t.class, s.class])); + else if (r === "style") t.style = Ls([t.style, s.style]); + else if (Qt(r)) { + const i = t[r], + o = s[r]; + o && + i !== o && + !(B(i) && i.includes(o)) && + (t[r] = i ? [].concat(i, o) : o); + } else r !== "" && (t[r] = s[r]); + } + return t; +} +function Oe(e, t, n, s = null) { + De(e, t, 7, [n, s]); +} +const _c = Hi(); +let wc = 0; +function Sc(e, t, n) { + const s = e.type, + r = (t ? t.appContext : e.appContext) || _c, + i = { + uid: wc++, + vnode: e, + type: s, + parent: t, + appContext: r, + root: null, + next: null, + subTree: null, + effect: null, + update: null, + job: null, + scope: new Wo(!0), + render: null, + proxy: null, + exposed: null, + exposeProxy: null, + withProxy: null, + provides: t ? t.provides : Object.create(r.provides), + ids: t ? t.ids : ["", 0, 0], + accessCache: null, + renderCache: [], + components: null, + directives: null, + propsOptions: ki(s, r), + emitsOptions: Ji(s, r), + emit: null, + emitted: null, + propsDefaults: ne, + inheritAttrs: s.inheritAttrs, + ctx: ne, + data: ne, + props: ne, + attrs: ne, + slots: ne, + refs: ne, + setupState: ne, + setupContext: null, + suspense: n, + suspenseId: n ? n.pendingId : 0, + asyncDep: null, + asyncResolved: !1, + isMounted: !1, + isUnmounted: !1, + isDeactivated: !1, + bc: null, + c: null, + bm: null, + m: null, + bu: null, + u: null, + um: null, + bum: null, + da: null, + a: null, + rtg: null, + rtc: null, + ec: null, + sp: null, + }; + return ( + (i.ctx = { _: i }), + (i.root = t ? t.root : i), + (i.emit = dc.bind(null, i)), + e.ce && e.ce(i), + i + ); +} +let fe = null; +const en = () => fe || pe; +let Rn, Cs; +{ + const e = Pn(), + t = (n, s) => { + let r; + return ( + (r = e[n]) || (r = e[n] = []), + r.push(s), + (i) => { + r.length > 1 ? r.forEach((o) => o(i)) : r[0](i); + } + ); + }; + (Rn = t("__VUE_INSTANCE_SETTERS__", (n) => (fe = n))), + (Cs = t("__VUE_SSR_SETTERS__", (n) => (zt = n))); +} +const tn = (e) => { + const t = fe; + return ( + Rn(e), + e.scope.on(), + () => { + e.scope.off(), Rn(t); + } + ); + }, + mr = () => { + fe && fe.scope.off(), Rn(null); + }; +function io(e) { + return e.vnode.shapeFlag & 4; +} +let zt = !1; +function xc(e, t = !1, n = !1) { + t && Cs(t); + const { props: s, children: r } = e.vnode, + i = io(e); + Zl(e, s, i, t), sc(e, r, n || t); + const o = i ? Tc(e, t) : void 0; + return t && Cs(!1), o; +} +function Tc(e, t) { + const n = e.type; + (e.accessCache = Object.create(null)), (e.proxy = new Proxy(e.ctx, Ul)); + const { setup: s } = n; + if (s) { + Ge(); + const r = (e.setupContext = s.length > 1 ? lo(e) : null), + i = tn(e), + o = Zt(s, e, 0, [e.props, r]), + l = qr(o); + if ((Xe(), i(), (l || e.sp) && !vt(e) && Ai(e), l)) { + if ((o.then(mr, mr), t)) + return o + .then((c) => { + vr(e, c); + }) + .catch((c) => { + Hn(c, e, 0); + }); + e.asyncDep = o; + } else vr(e, o); + } else oo(e); +} +function vr(e, t, n) { + G(t) + ? e.type.__ssrInlineRender + ? (e.ssrRender = t) + : (e.render = t) + : se(t) && (e.setupState = gi(t)), + oo(e); +} +function oo(e, t, n) { + const s = e.type; + e.render || (e.render = s.render || ke); + { + const r = tn(e); + Ge(); + try { + Kl(e); + } finally { + Xe(), r(); + } + } +} +const Ec = { + get(e, t) { + return be(e, "get", ""), e[t]; + }, +}; +function lo(e) { + const t = (n) => { + e.exposed = n || {}; + }; + return { + attrs: new Proxy(e.attrs, Ec), + slots: e.slots, + emit: e.emit, + expose: t, + }; +} +function qs(e) { + return e.exposed + ? e.exposeProxy || + (e.exposeProxy = new Proxy(gi(vn(e.exposed)), { + get(t, n) { + if (n in t) return t[n]; + if (n in Vt) return Vt[n](e); + }, + has(t, n) { + return n in t || n in Vt; + }, + })) + : e.proxy; +} +function Cc(e, t = !0) { + return G(e) ? e.displayName || e.name : e.name || (t && e.__name); +} +function Ac(e) { + return G(e) && "__vccOpts" in e; +} +const ie = (e, t) => yl(e, t, zt); +function As(e, t, n) { + const s = arguments.length; + return s === 2 + ? se(t) && !B(t) + ? Yt(t) + ? ge(e, null, [t]) + : ge(e, t) + : ge(e, null, t) + : (s > 3 + ? (n = Array.prototype.slice.call(arguments, 2)) + : s === 3 && Yt(n) && (n = [n]), + ge(e, t, n)); +} +const Rc = "3.5.14"; +/** + * @vue/runtime-dom v3.5.14 + * (c) 2018-present Yuxi (Evan) You and Vue contributors + * @license MIT + **/ let Rs; +const yr = typeof window < "u" && window.trustedTypes; +if (yr) + try { + Rs = yr.createPolicy("vue", { createHTML: (e) => e }); + } catch {} +const co = Rs ? (e) => Rs.createHTML(e) : (e) => e, + Oc = "http://www.w3.org/2000/svg", + Mc = "http://www.w3.org/1998/Math/MathML", + Ke = typeof document < "u" ? document : null, + br = Ke && Ke.createElement("template"), + Ic = { + insert: (e, t, n) => { + t.insertBefore(e, n || null); + }, + remove: (e) => { + const t = e.parentNode; + t && t.removeChild(e); + }, + createElement: (e, t, n, s) => { + const r = + t === "svg" + ? Ke.createElementNS(Oc, e) + : t === "mathml" + ? Ke.createElementNS(Mc, e) + : n + ? Ke.createElement(e, { is: n }) + : Ke.createElement(e); + return ( + e === "select" && + s && + s.multiple != null && + r.setAttribute("multiple", s.multiple), + r + ); + }, + createText: (e) => Ke.createTextNode(e), + createComment: (e) => Ke.createComment(e), + setText: (e, t) => { + e.nodeValue = t; + }, + setElementText: (e, t) => { + e.textContent = t; + }, + parentNode: (e) => e.parentNode, + nextSibling: (e) => e.nextSibling, + querySelector: (e) => Ke.querySelector(e), + setScopeId(e, t) { + e.setAttribute(t, ""); + }, + insertStaticContent(e, t, n, s, r, i) { + const o = n ? n.previousSibling : t.lastChild; + if (r && (r === i || r.nextSibling)) + for ( + ; + t.insertBefore(r.cloneNode(!0), n), + !(r === i || !(r = r.nextSibling)); + + ); + else { + br.innerHTML = co( + s === "svg" + ? `${e}` + : s === "mathml" + ? `${e}` + : e, + ); + const l = br.content; + if (s === "svg" || s === "mathml") { + const c = l.firstChild; + for (; c.firstChild; ) l.appendChild(c.firstChild); + l.removeChild(c); + } + t.insertBefore(l, n); + } + return [ + o ? o.nextSibling : t.firstChild, + n ? n.previousSibling : t.lastChild, + ]; + }, + }, + Ze = "transition", + Ht = "animation", + Jt = Symbol("_vtc"), + ao = { + name: String, + type: String, + css: { type: Boolean, default: !0 }, + duration: [String, Number, Object], + enterFromClass: String, + enterActiveClass: String, + enterToClass: String, + appearFromClass: String, + appearActiveClass: String, + appearToClass: String, + leaveFromClass: String, + leaveActiveClass: String, + leaveToClass: String, + }, + Pc = ue({}, wi, ao), + Lc = (e) => ((e.displayName = "Transition"), (e.props = Pc), e), + _f = Lc((e, { slots: t }) => As(Rl, Nc(e), t)), + ft = (e, t = []) => { + B(e) ? e.forEach((n) => n(...t)) : e && e(...t); + }, + _r = (e) => (e ? (B(e) ? e.some((t) => t.length > 1) : e.length > 1) : !1); +function Nc(e) { + const t = {}; + for (const b in e) b in ao || (t[b] = e[b]); + if (e.css === !1) return t; + const { + name: n = "v", + type: s, + duration: r, + enterFromClass: i = `${n}-enter-from`, + enterActiveClass: o = `${n}-enter-active`, + enterToClass: l = `${n}-enter-to`, + appearFromClass: c = i, + appearActiveClass: u = o, + appearToClass: a = l, + leaveFromClass: h = `${n}-leave-from`, + leaveActiveClass: v = `${n}-leave-active`, + leaveToClass: y = `${n}-leave-to`, + } = e, + A = Fc(r), + P = A && A[0], + K = A && A[1], + { + onBeforeEnter: H, + onEnter: k, + onEnterCancelled: p, + onLeave: g, + onLeaveCancelled: M, + onBeforeAppear: V = H, + onAppear: R = k, + onAppearCancelled: U = p, + } = t, + T = (b, N, Y, re) => { + (b._enterCancelled = re), ut(b, N ? a : l), ut(b, N ? u : o), Y && Y(); + }, + I = (b, N) => { + (b._isLeaving = !1), ut(b, h), ut(b, y), ut(b, v), N && N(); + }, + E = (b) => (N, Y) => { + const re = b ? R : k, + j = () => T(N, b, Y); + ft(re, [N, j]), + wr(() => { + ut(N, b ? c : i), Be(N, b ? a : l), _r(re) || Sr(N, s, P, j); + }); + }; + return ue(t, { + onBeforeEnter(b) { + ft(H, [b]), Be(b, i), Be(b, o); + }, + onBeforeAppear(b) { + ft(V, [b]), Be(b, c), Be(b, u); + }, + onEnter: E(!1), + onAppear: E(!0), + onLeave(b, N) { + b._isLeaving = !0; + const Y = () => I(b, N); + Be(b, h), + b._enterCancelled ? (Be(b, v), Er()) : (Er(), Be(b, v)), + wr(() => { + b._isLeaving && (ut(b, h), Be(b, y), _r(g) || Sr(b, s, K, Y)); + }), + ft(g, [b, Y]); + }, + onEnterCancelled(b) { + T(b, !1, void 0, !0), ft(p, [b]); + }, + onAppearCancelled(b) { + T(b, !0, void 0, !0), ft(U, [b]); + }, + onLeaveCancelled(b) { + I(b), ft(M, [b]); + }, + }); +} +function Fc(e) { + if (e == null) return null; + if (se(e)) return [ns(e.enter), ns(e.leave)]; + { + const t = ns(e); + return [t, t]; + } +} +function ns(e) { + return Lo(e); +} +function Be(e, t) { + t.split(/\s+/).forEach((n) => n && e.classList.add(n)), + (e[Jt] || (e[Jt] = new Set())).add(t); +} +function ut(e, t) { + t.split(/\s+/).forEach((s) => s && e.classList.remove(s)); + const n = e[Jt]; + n && (n.delete(t), n.size || (e[Jt] = void 0)); +} +function wr(e) { + requestAnimationFrame(() => { + requestAnimationFrame(e); + }); +} +let Hc = 0; +function Sr(e, t, n, s) { + const r = (e._endId = ++Hc), + i = () => { + r === e._endId && s(); + }; + if (n != null) return setTimeout(i, n); + const { type: o, timeout: l, propCount: c } = Dc(e, t); + if (!o) return s(); + const u = o + "end"; + let a = 0; + const h = () => { + e.removeEventListener(u, v), i(); + }, + v = (y) => { + y.target === e && ++a >= c && h(); + }; + setTimeout(() => { + a < c && h(); + }, l + 1), + e.addEventListener(u, v); +} +function Dc(e, t) { + const n = window.getComputedStyle(e), + s = (A) => (n[A] || "").split(", "), + r = s(`${Ze}Delay`), + i = s(`${Ze}Duration`), + o = xr(r, i), + l = s(`${Ht}Delay`), + c = s(`${Ht}Duration`), + u = xr(l, c); + let a = null, + h = 0, + v = 0; + t === Ze + ? o > 0 && ((a = Ze), (h = o), (v = i.length)) + : t === Ht + ? u > 0 && ((a = Ht), (h = u), (v = c.length)) + : ((h = Math.max(o, u)), + (a = h > 0 ? (o > u ? Ze : Ht) : null), + (v = a ? (a === Ze ? i.length : c.length) : 0)); + const y = + a === Ze && /\b(transform|all)(,|$)/.test(s(`${Ze}Property`).toString()); + return { type: a, timeout: h, propCount: v, hasTransform: y }; +} +function xr(e, t) { + for (; e.length < t.length; ) e = e.concat(e); + return Math.max(...t.map((n, s) => Tr(n) + Tr(e[s]))); +} +function Tr(e) { + return e === "auto" ? 0 : Number(e.slice(0, -1).replace(",", ".")) * 1e3; +} +function Er() { + return document.body.offsetHeight; +} +function $c(e, t, n) { + const s = e[Jt]; + s && (t = (t ? [t, ...s] : [...s]).join(" ")), + t == null + ? e.removeAttribute("class") + : n + ? e.setAttribute("class", t) + : (e.className = t); +} +const Cr = Symbol("_vod"), + jc = Symbol("_vsh"), + Vc = Symbol(""), + Wc = /(^|;)\s*display\s*:/; +function kc(e, t, n) { + const s = e.style, + r = oe(n); + let i = !1; + if (n && !r) { + if (t) + if (oe(t)) + for (const o of t.split(";")) { + const l = o.slice(0, o.indexOf(":")).trim(); + n[l] == null && bn(s, l, ""); + } + else for (const o in t) n[o] == null && bn(s, o, ""); + for (const o in n) o === "display" && (i = !0), bn(s, o, n[o]); + } else if (r) { + if (t !== n) { + const o = s[Vc]; + o && (n += ";" + o), (s.cssText = n), (i = Wc.test(n)); + } + } else t && e.removeAttribute("style"); + Cr in e && ((e[Cr] = i ? s.display : ""), e[jc] && (s.display = "none")); +} +const Ar = /\s*!important$/; +function bn(e, t, n) { + if (B(n)) n.forEach((s) => bn(e, t, s)); + else if ((n == null && (n = ""), t.startsWith("--"))) e.setProperty(t, n); + else { + const s = Uc(e, t); + Ar.test(n) + ? e.setProperty(lt(s), n.replace(Ar, ""), "important") + : (e[s] = n); + } +} +const Rr = ["Webkit", "Moz", "ms"], + ss = {}; +function Uc(e, t) { + const n = ss[t]; + if (n) return n; + let s = Ne(t); + if (s !== "filter" && s in e) return (ss[t] = s); + s = In(s); + for (let r = 0; r < Rr.length; r++) { + const i = Rr[r] + s; + if (i in e) return (ss[t] = i); + } + return t; +} +const Or = "http://www.w3.org/1999/xlink"; +function Mr(e, t, n, s, r, i = jo(t)) { + s && t.startsWith("xlink:") + ? n == null + ? e.removeAttributeNS(Or, t.slice(6, t.length)) + : e.setAttributeNS(Or, t, n) + : n == null || (i && !zr(n)) + ? e.removeAttribute(t) + : e.setAttribute(t, i ? "" : Je(n) ? String(n) : n); +} +function Ir(e, t, n, s, r) { + if (t === "innerHTML" || t === "textContent") { + n != null && (e[t] = t === "innerHTML" ? co(n) : n); + return; + } + const i = e.tagName; + if (t === "value" && i !== "PROGRESS" && !i.includes("-")) { + const l = i === "OPTION" ? e.getAttribute("value") || "" : e.value, + c = n == null ? (e.type === "checkbox" ? "on" : "") : String(n); + (l !== c || !("_value" in e)) && (e.value = c), + n == null && e.removeAttribute(t), + (e._value = n); + return; + } + let o = !1; + if (n === "" || n == null) { + const l = typeof e[t]; + l === "boolean" + ? (n = zr(n)) + : n == null && l === "string" + ? ((n = ""), (o = !0)) + : l === "number" && ((n = 0), (o = !0)); + } + try { + e[t] = n; + } catch {} + o && e.removeAttribute(r || t); +} +function Bc(e, t, n, s) { + e.addEventListener(t, n, s); +} +function Kc(e, t, n, s) { + e.removeEventListener(t, n, s); +} +const Pr = Symbol("_vei"); +function qc(e, t, n, s, r = null) { + const i = e[Pr] || (e[Pr] = {}), + o = i[t]; + if (s && o) o.value = s; + else { + const [l, c] = Gc(t); + if (s) { + const u = (i[t] = zc(s, r)); + Bc(e, l, u, c); + } else o && (Kc(e, l, o, c), (i[t] = void 0)); + } +} +const Lr = /(?:Once|Passive|Capture)$/; +function Gc(e) { + let t; + if (Lr.test(e)) { + t = {}; + let s; + for (; (s = e.match(Lr)); ) + (e = e.slice(0, e.length - s[0].length)), (t[s[0].toLowerCase()] = !0); + } + return [e[2] === ":" ? e.slice(3) : lt(e.slice(2)), t]; +} +let rs = 0; +const Xc = Promise.resolve(), + Yc = () => rs || (Xc.then(() => (rs = 0)), (rs = Date.now())); +function zc(e, t) { + const n = (s) => { + if (!s._vts) s._vts = Date.now(); + else if (s._vts <= n.attached) return; + De(Jc(s, n.value), t, 5, [s]); + }; + return (n.value = e), (n.attached = Yc()), n; +} +function Jc(e, t) { + if (B(t)) { + const n = e.stopImmediatePropagation; + return ( + (e.stopImmediatePropagation = () => { + n.call(e), (e._stopped = !0); + }), + t.map((s) => (r) => !r._stopped && s && s(r)) + ); + } else return t; +} +const Nr = (e) => + e.charCodeAt(0) === 111 && + e.charCodeAt(1) === 110 && + e.charCodeAt(2) > 96 && + e.charCodeAt(2) < 123, + Qc = (e, t, n, s, r, i) => { + const o = r === "svg"; + t === "class" + ? $c(e, s, o) + : t === "style" + ? kc(e, n, s) + : Qt(t) + ? Ms(t) || qc(e, t, n, s, i) + : ( + t[0] === "." + ? ((t = t.slice(1)), !0) + : t[0] === "^" + ? ((t = t.slice(1)), !1) + : Zc(e, t, s, o) + ) + ? (Ir(e, t, s), + !e.tagName.includes("-") && + (t === "value" || t === "checked" || t === "selected") && + Mr(e, t, s, o, i, t !== "value")) + : e._isVueCE && (/[A-Z]/.test(t) || !oe(s)) + ? Ir(e, Ne(t), s, i, t) + : (t === "true-value" + ? (e._trueValue = s) + : t === "false-value" && (e._falseValue = s), + Mr(e, t, s, o)); + }; +function Zc(e, t, n, s) { + if (s) + return !!( + t === "innerHTML" || + t === "textContent" || + (t in e && Nr(t) && G(n)) + ); + if ( + t === "spellcheck" || + t === "draggable" || + t === "translate" || + t === "autocorrect" || + t === "form" || + (t === "list" && e.tagName === "INPUT") || + (t === "type" && e.tagName === "TEXTAREA") + ) + return !1; + if (t === "width" || t === "height") { + const r = e.tagName; + if (r === "IMG" || r === "VIDEO" || r === "CANVAS" || r === "SOURCE") + return !1; + } + return Nr(t) && oe(n) ? !1 : t in e; +} +const ea = ["ctrl", "shift", "alt", "meta"], + ta = { + stop: (e) => e.stopPropagation(), + prevent: (e) => e.preventDefault(), + self: (e) => e.target !== e.currentTarget, + ctrl: (e) => !e.ctrlKey, + shift: (e) => !e.shiftKey, + alt: (e) => !e.altKey, + meta: (e) => !e.metaKey, + left: (e) => "button" in e && e.button !== 0, + middle: (e) => "button" in e && e.button !== 1, + right: (e) => "button" in e && e.button !== 2, + exact: (e, t) => ea.some((n) => e[`${n}Key`] && !t.includes(n)), + }, + wf = (e, t) => { + const n = e._withMods || (e._withMods = {}), + s = t.join("."); + return ( + n[s] || + (n[s] = (r, ...i) => { + for (let o = 0; o < t.length; o++) { + const l = ta[t[o]]; + if (l && l(r, t)) return; + } + return e(r, ...i); + }) + ); + }, + na = { + esc: "escape", + space: " ", + up: "arrow-up", + left: "arrow-left", + right: "arrow-right", + down: "arrow-down", + delete: "backspace", + }, + Sf = (e, t) => { + const n = e._withKeys || (e._withKeys = {}), + s = t.join("."); + return ( + n[s] || + (n[s] = (r) => { + if (!("key" in r)) return; + const i = lt(r.key); + if (t.some((o) => o === i || na[o] === i)) return e(r); + }) + ); + }, + sa = ue({ patchProp: Qc }, Ic); +let is, + Fr = !1; +function ra() { + return (is = Fr ? is : ic(sa)), (Fr = !0), is; +} +const xf = (...e) => { + const t = ra().createApp(...e), + { mount: n } = t; + return ( + (t.mount = (s) => { + const r = oa(s); + if (r) return n(r, !0, ia(r)); + }), + t + ); +}; +function ia(e) { + if (e instanceof SVGElement) return "svg"; + if (typeof MathMLElement == "function" && e instanceof MathMLElement) + return "mathml"; +} +function oa(e) { + return oe(e) ? document.querySelector(e) : e; +} +const la = window.__VP_SITE_DATA__; +function fo(e) { + return Zr() ? (ko(e), !0) : !1; +} +const os = new WeakMap(), + ca = (...e) => { + var t; + const n = e[0], + s = (t = en()) == null ? void 0 : t.proxy; + if (s == null && !Di()) + throw new Error("injectLocal must be called in setup"); + return s && os.has(s) && n in os.get(s) ? os.get(s)[n] : bt(...e); + }, + uo = typeof window < "u" && typeof document < "u"; +typeof WorkerGlobalScope < "u" && globalThis instanceof WorkerGlobalScope; +const aa = Object.prototype.toString, + fa = (e) => aa.call(e) === "[object Object]", + St = () => {}, + Hr = ua(); +function ua() { + var e, t; + return ( + uo && + ((e = window == null ? void 0 : window.navigator) == null + ? void 0 + : e.userAgent) && + (/iP(?:ad|hone|od)/.test(window.navigator.userAgent) || + (((t = window == null ? void 0 : window.navigator) == null + ? void 0 + : t.maxTouchPoints) > 2 && + /iPad|Macintosh/.test( + window == null ? void 0 : window.navigator.userAgent, + ))) + ); +} +function Gs(e, t) { + function n(...s) { + return new Promise((r, i) => { + Promise.resolve( + e(() => t.apply(this, s), { fn: t, thisArg: this, args: s }), + ) + .then(r) + .catch(i); + }); + } + return n; +} +const ho = (e) => e(); +function da(e, t = {}) { + let n, + s, + r = St; + const i = (c) => { + clearTimeout(c), r(), (r = St); + }; + let o; + return (c) => { + const u = le(e), + a = le(t.maxWait); + return ( + n && i(n), + u <= 0 || (a !== void 0 && a <= 0) + ? (s && (i(s), (s = null)), Promise.resolve(c())) + : new Promise((h, v) => { + (r = t.rejectOnCancel ? v : h), + (o = c), + a && + !s && + (s = setTimeout(() => { + n && i(n), (s = null), h(o()); + }, a)), + (n = setTimeout(() => { + s && i(s), (s = null), h(c()); + }, u)); + }) + ); + }; +} +function ha(...e) { + let t = 0, + n, + s = !0, + r = St, + i, + o, + l, + c, + u; + !ae(e[0]) && typeof e[0] == "object" + ? ({ + delay: o, + trailing: l = !0, + leading: c = !0, + rejectOnCancel: u = !1, + } = e[0]) + : ([o, l = !0, c = !0, u = !1] = e); + const a = () => { + n && (clearTimeout(n), (n = void 0), r(), (r = St)); + }; + return (v) => { + const y = le(o), + A = Date.now() - t, + P = () => (i = v()); + return ( + a(), + y <= 0 + ? ((t = Date.now()), P()) + : (A > y && (c || !s) + ? ((t = Date.now()), P()) + : l && + (i = new Promise((K, H) => { + (r = u ? H : K), + (n = setTimeout( + () => { + (t = Date.now()), (s = !0), K(P()), a(); + }, + Math.max(0, y - A), + )); + })), + !c && !n && (n = setTimeout(() => (s = !0), y)), + (s = !1), + i) + ); + }; +} +function pa(e = ho, t = {}) { + const { initialState: n = "active" } = t, + s = Xs(n === "active"); + function r() { + s.value = !1; + } + function i() { + s.value = !0; + } + const o = (...l) => { + s.value && e(...l); + }; + return { isActive: Fn(s), pause: r, resume: i, eventFilter: o }; +} +function Dr(e) { + return e.endsWith("rem") ? Number.parseFloat(e) * 16 : Number.parseFloat(e); +} +function ga(e) { + return en(); +} +function ls(e) { + return Array.isArray(e) ? e : [e]; +} +function Xs(...e) { + if (e.length !== 1) return gl(...e); + const t = e[0]; + return typeof t == "function" ? Fn(dl(() => ({ get: t, set: St }))) : mt(t); +} +function ma(e, t = 200, n = {}) { + return Gs(da(t, n), e); +} +function va(e, t = 200, n = !1, s = !0, r = !1) { + return Gs(ha(t, n, s, r), e); +} +function ya(e, t, n = {}) { + const { eventFilter: s = ho, ...r } = n; + return Le(e, Gs(s, t), r); +} +function ba(e, t, n = {}) { + const { eventFilter: s, initialState: r = "active", ...i } = n, + { + eventFilter: o, + pause: l, + resume: c, + isActive: u, + } = pa(s, { initialState: r }); + return { + stop: ya(e, t, { ...i, eventFilter: o }), + pause: l, + resume: c, + isActive: u, + }; +} +function Un(e, t = !0, n) { + ga() ? Pt(e, n) : t ? e() : Dn(e); +} +function _a(e, t, n) { + return Le(e, t, { ...n, immediate: !0 }); +} +const Ye = uo ? window : void 0; +function Ys(e) { + var t; + const n = le(e); + return (t = n == null ? void 0 : n.$el) != null ? t : n; +} +function ze(...e) { + const t = [], + n = () => { + t.forEach((l) => l()), (t.length = 0); + }, + s = (l, c, u, a) => ( + l.addEventListener(c, u, a), () => l.removeEventListener(c, u, a) + ), + r = ie(() => { + const l = ls(le(e[0])).filter((c) => c != null); + return l.every((c) => typeof c != "string") ? l : void 0; + }), + i = _a( + () => { + var l, c; + return [ + (c = (l = r.value) == null ? void 0 : l.map((u) => Ys(u))) != null + ? c + : [Ye].filter((u) => u != null), + ls(le(r.value ? e[1] : e[0])), + ls(Ws(r.value ? e[2] : e[1])), + le(r.value ? e[3] : e[2]), + ]; + }, + ([l, c, u, a]) => { + if ( + (n(), + !(l != null && l.length) || + !(c != null && c.length) || + !(u != null && u.length)) + ) + return; + const h = fa(a) ? { ...a } : a; + t.push( + ...l.flatMap((v) => c.flatMap((y) => u.map((A) => s(v, y, A, h)))), + ); + }, + { flush: "post" }, + ), + o = () => { + i(), n(); + }; + return fo(n), o; +} +function wa() { + const e = Pe(!1), + t = en(); + return ( + t && + Pt(() => { + e.value = !0; + }, t), + e + ); +} +function Sa(e) { + const t = wa(); + return ie(() => (t.value, !!e())); +} +function xa(e) { + return typeof e == "function" + ? e + : typeof e == "string" + ? (t) => t.key === e + : Array.isArray(e) + ? (t) => e.includes(t.key) + : () => !0; +} +function Tf(...e) { + let t, + n, + s = {}; + e.length === 3 + ? ((t = e[0]), (n = e[1]), (s = e[2])) + : e.length === 2 + ? typeof e[1] == "object" + ? ((t = !0), (n = e[0]), (s = e[1])) + : ((t = e[0]), (n = e[1])) + : ((t = !0), (n = e[0])); + const { + target: r = Ye, + eventName: i = "keydown", + passive: o = !1, + dedupe: l = !1, + } = s, + c = xa(t); + return ze( + r, + i, + (a) => { + (a.repeat && le(l)) || (c(a) && n(a)); + }, + o, + ); +} +const Ta = Symbol("vueuse-ssr-width"); +function Ea() { + const e = Di() ? ca(Ta, null) : null; + return typeof e == "number" ? e : void 0; +} +function po(e, t = {}) { + const { window: n = Ye, ssrWidth: s = Ea() } = t, + r = Sa(() => n && "matchMedia" in n && typeof n.matchMedia == "function"), + i = Pe(typeof s == "number"), + o = Pe(), + l = Pe(!1), + c = (u) => { + l.value = u.matches; + }; + return ( + Yi(() => { + if (i.value) { + i.value = !r.value; + const u = le(e).split(","); + l.value = u.some((a) => { + const h = a.includes("not all"), + v = a.match(/\(\s*min-width:\s*(-?\d+(?:\.\d*)?[a-z]+\s*)\)/), + y = a.match(/\(\s*max-width:\s*(-?\d+(?:\.\d*)?[a-z]+\s*)\)/); + let A = !!(v || y); + return ( + v && A && (A = s >= Dr(v[1])), + y && A && (A = s <= Dr(y[1])), + h ? !A : A + ); + }); + return; + } + r.value && ((o.value = n.matchMedia(le(e))), (l.value = o.value.matches)); + }), + ze(o, "change", c, { passive: !0 }), + ie(() => l.value) + ); +} +const dn = + typeof globalThis < "u" + ? globalThis + : typeof window < "u" + ? window + : typeof global < "u" + ? global + : typeof self < "u" + ? self + : {}, + hn = "__vueuse_ssr_handlers__", + Ca = Aa(); +function Aa() { + return hn in dn || (dn[hn] = dn[hn] || {}), dn[hn]; +} +function go(e, t) { + return Ca[e] || t; +} +function mo(e) { + return po("(prefers-color-scheme: dark)", e); +} +function Ra(e) { + return e == null + ? "any" + : e instanceof Set + ? "set" + : e instanceof Map + ? "map" + : e instanceof Date + ? "date" + : typeof e == "boolean" + ? "boolean" + : typeof e == "string" + ? "string" + : typeof e == "object" + ? "object" + : Number.isNaN(e) + ? "any" + : "number"; +} +const Oa = { + boolean: { read: (e) => e === "true", write: (e) => String(e) }, + object: { read: (e) => JSON.parse(e), write: (e) => JSON.stringify(e) }, + number: { read: (e) => Number.parseFloat(e), write: (e) => String(e) }, + any: { read: (e) => e, write: (e) => String(e) }, + string: { read: (e) => e, write: (e) => String(e) }, + map: { + read: (e) => new Map(JSON.parse(e)), + write: (e) => JSON.stringify(Array.from(e.entries())), + }, + set: { + read: (e) => new Set(JSON.parse(e)), + write: (e) => JSON.stringify(Array.from(e)), + }, + date: { read: (e) => new Date(e), write: (e) => e.toISOString() }, + }, + $r = "vueuse-storage"; +function Ma(e, t, n, s = {}) { + var r; + const { + flush: i = "pre", + deep: o = !0, + listenToStorageChanges: l = !0, + writeDefaults: c = !0, + mergeDefaults: u = !1, + shallow: a, + window: h = Ye, + eventFilter: v, + onError: y = (E) => { + console.error(E); + }, + initOnMounted: A, + } = s, + P = (a ? Pe : mt)(typeof t == "function" ? t() : t), + K = ie(() => le(e)); + if (!n) + try { + n = go("getDefaultStorage", () => { + var E; + return (E = Ye) == null ? void 0 : E.localStorage; + })(); + } catch (E) { + y(E); + } + if (!n) return P; + const H = le(t), + k = Ra(H), + p = (r = s.serializer) != null ? r : Oa[k], + { pause: g, resume: M } = ba(P, () => R(P.value), { + flush: i, + deep: o, + eventFilter: v, + }); + Le(K, () => T(), { flush: i }), + h && + l && + Un(() => { + n instanceof Storage + ? ze(h, "storage", T, { passive: !0 }) + : ze(h, $r, I), + A && T(); + }), + A || T(); + function V(E, b) { + if (h) { + const N = { key: K.value, oldValue: E, newValue: b, storageArea: n }; + h.dispatchEvent( + n instanceof Storage + ? new StorageEvent("storage", N) + : new CustomEvent($r, { detail: N }), + ); + } + } + function R(E) { + try { + const b = n.getItem(K.value); + if (E == null) V(b, null), n.removeItem(K.value); + else { + const N = p.write(E); + b !== N && (n.setItem(K.value, N), V(b, N)); + } + } catch (b) { + y(b); + } + } + function U(E) { + const b = E ? E.newValue : n.getItem(K.value); + if (b == null) return c && H != null && n.setItem(K.value, p.write(H)), H; + if (!E && u) { + const N = p.read(b); + return typeof u == "function" + ? u(N, H) + : k === "object" && !Array.isArray(N) + ? { ...H, ...N } + : N; + } else return typeof b != "string" ? b : p.read(b); + } + function T(E) { + if (!(E && E.storageArea !== n)) { + if (E && E.key == null) { + P.value = H; + return; + } + if (!(E && E.key !== K.value)) { + g(); + try { + (E == null ? void 0 : E.newValue) !== p.write(P.value) && + (P.value = U(E)); + } catch (b) { + y(b); + } finally { + E ? Dn(M) : M(); + } + } + } + } + function I(E) { + T(E.detail); + } + return P; +} +const Ia = + "*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}"; +function Pa(e = {}) { + const { + selector: t = "html", + attribute: n = "class", + initialValue: s = "auto", + window: r = Ye, + storage: i, + storageKey: o = "vueuse-color-scheme", + listenToStorageChanges: l = !0, + storageRef: c, + emitAuto: u, + disableTransition: a = !0, + } = e, + h = { auto: "", light: "light", dark: "dark", ...(e.modes || {}) }, + v = mo({ window: r }), + y = ie(() => (v.value ? "dark" : "light")), + A = + c || + (o == null + ? Xs(s) + : Ma(o, s, i, { window: r, listenToStorageChanges: l })), + P = ie(() => (A.value === "auto" ? y.value : A.value)), + K = go("updateHTMLAttrs", (g, M, V) => { + const R = + typeof g == "string" + ? r == null + ? void 0 + : r.document.querySelector(g) + : Ys(g); + if (!R) return; + const U = new Set(), + T = new Set(); + let I = null; + if (M === "class") { + const b = V.split(/\s/g); + Object.values(h) + .flatMap((N) => (N || "").split(/\s/g)) + .filter(Boolean) + .forEach((N) => { + b.includes(N) ? U.add(N) : T.add(N); + }); + } else I = { key: M, value: V }; + if (U.size === 0 && T.size === 0 && I === null) return; + let E; + a && + ((E = r.document.createElement("style")), + E.appendChild(document.createTextNode(Ia)), + r.document.head.appendChild(E)); + for (const b of U) R.classList.add(b); + for (const b of T) R.classList.remove(b); + I && R.setAttribute(I.key, I.value), + a && (r.getComputedStyle(E).opacity, document.head.removeChild(E)); + }); + function H(g) { + var M; + K(t, n, (M = h[g]) != null ? M : g); + } + function k(g) { + e.onChanged ? e.onChanged(g, H) : H(g); + } + Le(P, k, { flush: "post", immediate: !0 }), Un(() => k(P.value)); + const p = ie({ + get() { + return u ? A.value : P.value; + }, + set(g) { + A.value = g; + }, + }); + return Object.assign(p, { store: A, system: y, state: P }); +} +function La(e = {}) { + const { valueDark: t = "dark", valueLight: n = "" } = e, + s = Pa({ + ...e, + onChanged: (o, l) => { + var c; + e.onChanged + ? (c = e.onChanged) == null || c.call(e, o === "dark", l, o) + : l(o); + }, + modes: { dark: t, light: n }, + }), + r = ie(() => s.system.value); + return ie({ + get() { + return s.value === "dark"; + }, + set(o) { + const l = o ? "dark" : "light"; + r.value === l ? (s.value = "auto") : (s.value = l); + }, + }); +} +function cs(e) { + return typeof Window < "u" && e instanceof Window + ? e.document.documentElement + : typeof Document < "u" && e instanceof Document + ? e.documentElement + : e; +} +const jr = 1; +function Na(e, t = {}) { + const { + throttle: n = 0, + idle: s = 200, + onStop: r = St, + onScroll: i = St, + offset: o = { left: 0, right: 0, top: 0, bottom: 0 }, + eventListenerOptions: l = { capture: !1, passive: !0 }, + behavior: c = "auto", + window: u = Ye, + onError: a = (R) => { + console.error(R); + }, + } = t, + h = Pe(0), + v = Pe(0), + y = ie({ + get() { + return h.value; + }, + set(R) { + P(R, void 0); + }, + }), + A = ie({ + get() { + return v.value; + }, + set(R) { + P(void 0, R); + }, + }); + function P(R, U) { + var T, I, E, b; + if (!u) return; + const N = le(e); + if (!N) return; + (E = N instanceof Document ? u.document.body : N) == null || + E.scrollTo({ + top: (T = le(U)) != null ? T : A.value, + left: (I = le(R)) != null ? I : y.value, + behavior: le(c), + }); + const Y = + ((b = N == null ? void 0 : N.document) == null + ? void 0 + : b.documentElement) || + (N == null ? void 0 : N.documentElement) || + N; + y != null && (h.value = Y.scrollLeft), A != null && (v.value = Y.scrollTop); + } + const K = Pe(!1), + H = It({ left: !0, right: !1, top: !0, bottom: !1 }), + k = It({ left: !1, right: !1, top: !1, bottom: !1 }), + p = (R) => { + K.value && + ((K.value = !1), + (k.left = !1), + (k.right = !1), + (k.top = !1), + (k.bottom = !1), + r(R)); + }, + g = ma(p, n + s), + M = (R) => { + var U; + if (!u) return; + const T = + ((U = R == null ? void 0 : R.document) == null + ? void 0 + : U.documentElement) || + (R == null ? void 0 : R.documentElement) || + Ys(R), + { display: I, flexDirection: E, direction: b } = getComputedStyle(T), + N = b === "rtl" ? -1 : 1, + Y = T.scrollLeft; + (k.left = Y < h.value), (k.right = Y > h.value); + const re = Math.abs(Y * N) <= (o.left || 0), + j = + Math.abs(Y * N) + T.clientWidth >= + T.scrollWidth - (o.right || 0) - jr; + I === "flex" && E === "row-reverse" + ? ((H.left = j), (H.right = re)) + : ((H.left = re), (H.right = j)), + (h.value = Y); + let X = T.scrollTop; + R === u.document && !X && (X = u.document.body.scrollTop), + (k.top = X < v.value), + (k.bottom = X > v.value); + const D = Math.abs(X) <= (o.top || 0), + ce = + Math.abs(X) + T.clientHeight >= T.scrollHeight - (o.bottom || 0) - jr; + I === "flex" && E === "column-reverse" + ? ((H.top = ce), (H.bottom = D)) + : ((H.top = D), (H.bottom = ce)), + (v.value = X); + }, + V = (R) => { + var U; + if (!u) return; + const T = (U = R.target.documentElement) != null ? U : R.target; + M(T), (K.value = !0), g(R), i(R); + }; + return ( + ze(e, "scroll", n ? va(V, n, !0, !1) : V, l), + Un(() => { + try { + const R = le(e); + if (!R) return; + M(R); + } catch (R) { + a(R); + } + }), + ze(e, "scrollend", p, l), + { + x: y, + y: A, + isScrolling: K, + arrivedState: H, + directions: k, + measure() { + const R = le(e); + u && R && M(R); + }, + } + ); +} +function vo(e) { + const t = window.getComputedStyle(e); + if ( + t.overflowX === "scroll" || + t.overflowY === "scroll" || + (t.overflowX === "auto" && e.clientWidth < e.scrollWidth) || + (t.overflowY === "auto" && e.clientHeight < e.scrollHeight) + ) + return !0; + { + const n = e.parentNode; + return !n || n.tagName === "BODY" ? !1 : vo(n); + } +} +function Fa(e) { + const t = e || window.event, + n = t.target; + return vo(n) + ? !1 + : t.touches.length > 1 + ? !0 + : (t.preventDefault && t.preventDefault(), !1); +} +const as = new WeakMap(); +function Ef(e, t = !1) { + const n = Pe(t); + let s = null, + r = ""; + Le( + Xs(e), + (l) => { + const c = cs(le(l)); + if (c) { + const u = c; + if ( + (as.get(u) || as.set(u, u.style.overflow), + u.style.overflow !== "hidden" && (r = u.style.overflow), + u.style.overflow === "hidden") + ) + return (n.value = !0); + if (n.value) return (u.style.overflow = "hidden"); + } + }, + { immediate: !0 }, + ); + const i = () => { + const l = cs(le(e)); + !l || + n.value || + (Hr && + (s = ze( + l, + "touchmove", + (c) => { + Fa(c); + }, + { passive: !1 }, + )), + (l.style.overflow = "hidden"), + (n.value = !0)); + }, + o = () => { + const l = cs(le(e)); + !l || + !n.value || + (Hr && (s == null || s()), + (l.style.overflow = r), + as.delete(l), + (n.value = !1)); + }; + return ( + fo(o), + ie({ + get() { + return n.value; + }, + set(l) { + l ? i() : o(); + }, + }) + ); +} +function Cf(e = {}) { + const { window: t = Ye, ...n } = e; + return Na(t, n); +} +function Af(e = {}) { + const { + window: t = Ye, + initialWidth: n = Number.POSITIVE_INFINITY, + initialHeight: s = Number.POSITIVE_INFINITY, + listenOrientation: r = !0, + includeScrollbar: i = !0, + type: o = "inner", + } = e, + l = Pe(n), + c = Pe(s), + u = () => { + if (t) + if (o === "outer") (l.value = t.outerWidth), (c.value = t.outerHeight); + else if (o === "visual" && t.visualViewport) { + const { width: h, height: v, scale: y } = t.visualViewport; + (l.value = Math.round(h * y)), (c.value = Math.round(v * y)); + } else + i + ? ((l.value = t.innerWidth), (c.value = t.innerHeight)) + : ((l.value = t.document.documentElement.clientWidth), + (c.value = t.document.documentElement.clientHeight)); + }; + u(), Un(u); + const a = { passive: !0 }; + if ( + (ze("resize", u, a), + t && + o === "visual" && + t.visualViewport && + ze(t.visualViewport, "resize", u, a), + r) + ) { + const h = po("(orientation: portrait)"); + Le(h, () => u()); + } + return { width: l, height: c }; +} +const fs = {}; +var us = {}; +const yo = /^(?:[a-z]+:|\/\/)/i, + Ha = "vitepress-theme-appearance", + Da = /#.*$/, + $a = /[?#].*$/, + ja = /(?:(^|\/)index)?\.(?:md|html)$/, + ye = typeof document < "u", + bo = { + relativePath: "404.md", + filePath: "", + title: "404", + description: "Not Found", + headers: [], + frontmatter: { sidebar: !1, layout: "page" }, + lastUpdated: 0, + isNotFound: !0, + }; +function Va(e, t, n = !1) { + if (t === void 0) return !1; + if (((e = Vr(`/${e}`)), n)) return new RegExp(t).test(e); + if (Vr(t) !== e) return !1; + const s = t.match(Da); + return s ? (ye ? location.hash : "") === s[0] : !0; +} +function Vr(e) { + return decodeURI(e).replace($a, "").replace(ja, "$1"); +} +function Wa(e) { + return yo.test(e); +} +function ka(e, t) { + return ( + Object.keys((e == null ? void 0 : e.locales) || {}).find( + (n) => n !== "root" && !Wa(n) && Va(t, `/${n}/`, !0), + ) || "root" + ); +} +function Ua(e, t) { + var s, r, i, o, l, c, u; + const n = ka(e, t); + return Object.assign({}, e, { + localeIndex: n, + lang: ((s = e.locales[n]) == null ? void 0 : s.lang) ?? e.lang, + dir: ((r = e.locales[n]) == null ? void 0 : r.dir) ?? e.dir, + title: ((i = e.locales[n]) == null ? void 0 : i.title) ?? e.title, + titleTemplate: + ((o = e.locales[n]) == null ? void 0 : o.titleTemplate) ?? + e.titleTemplate, + description: + ((l = e.locales[n]) == null ? void 0 : l.description) ?? e.description, + head: wo(e.head, ((c = e.locales[n]) == null ? void 0 : c.head) ?? []), + themeConfig: { + ...e.themeConfig, + ...((u = e.locales[n]) == null ? void 0 : u.themeConfig), + }, + }); +} +function _o(e, t) { + const n = t.title || e.title, + s = t.titleTemplate ?? e.titleTemplate; + if (typeof s == "string" && s.includes(":title")) + return s.replace(/:title/g, n); + const r = Ba(e.title, s); + return n === r.slice(3) ? n : `${n}${r}`; +} +function Ba(e, t) { + return t === !1 + ? "" + : t === !0 || t === void 0 + ? ` | ${e}` + : e === t + ? "" + : ` | ${t}`; +} +function Ka(e, t) { + const [n, s] = t; + if (n !== "meta") return !1; + const r = Object.entries(s)[0]; + return r == null ? !1 : e.some(([i, o]) => i === n && o[r[0]] === r[1]); +} +function wo(e, t) { + return [...e.filter((n) => !Ka(t, n)), ...t]; +} +const qa = /[\u0000-\u001F"#$&*+,:;<=>?[\]^`{|}\u007F]/g, + Ga = /^[a-z]:/i; +function Wr(e) { + const t = Ga.exec(e), + n = t ? t[0] : ""; + return ( + n + + e + .slice(n.length) + .replace(qa, "_") + .replace(/(^|\/)_+(?=[^/]*$)/, "$1") + ); +} +const ds = new Set(); +function Xa(e) { + if (ds.size === 0) { + const n = + (typeof process == "object" && + (us == null ? void 0 : us.VITE_EXTRA_EXTENSIONS)) || + (fs == null ? void 0 : fs.VITE_EXTRA_EXTENSIONS) || + ""; + ( + "3g2,3gp,aac,ai,apng,au,avif,bin,bmp,cer,class,conf,crl,css,csv,dll,doc,eps,epub,exe,gif,gz,ics,ief,jar,jpe,jpeg,jpg,js,json,jsonld,m4a,man,mid,midi,mjs,mov,mp2,mp3,mp4,mpe,mpeg,mpg,mpp,oga,ogg,ogv,ogx,opus,otf,p10,p7c,p7m,p7s,pdf,png,ps,qt,roff,rtf,rtx,ser,svg,t,tif,tiff,tr,ts,tsv,ttf,txt,vtt,wav,weba,webm,webp,woff,woff2,xhtml,xml,yaml,yml,zip" + + (n && typeof n == "string" ? "," + n : "") + ) + .split(",") + .forEach((s) => ds.add(s)); + } + const t = e.split(".").pop(); + return t == null || !ds.has(t.toLowerCase()); +} +const Ya = Symbol(), + wt = Pe(la); +function Rf(e) { + const t = ie(() => Ua(wt.value, e.data.relativePath)), + n = t.value.appearance, + s = + n === "force-dark" + ? mt(!0) + : n === "force-auto" + ? mo() + : n + ? La({ + storageKey: Ha, + initialValue: () => (n === "dark" ? "dark" : "auto"), + ...(typeof n == "object" ? n : {}), + }) + : mt(!1), + r = mt(ye ? location.hash : ""); + return ( + ye && + window.addEventListener("hashchange", () => { + r.value = location.hash; + }), + Le( + () => e.data, + () => { + r.value = ye ? location.hash : ""; + }, + ), + { + site: t, + theme: ie(() => t.value.themeConfig), + page: ie(() => e.data), + frontmatter: ie(() => e.data.frontmatter), + params: ie(() => e.data.params), + lang: ie(() => t.value.lang), + dir: ie(() => e.data.frontmatter.dir || t.value.dir), + localeIndex: ie(() => t.value.localeIndex || "root"), + title: ie(() => _o(t.value, e.data)), + description: ie(() => e.data.description || t.value.description), + isDark: s, + hash: ie(() => r.value), + } + ); +} +function za() { + const e = bt(Ya); + if (!e) throw new Error("vitepress data not properly injected in app"); + return e; +} +function Ja(e, t) { + return `${e}${t}`.replace(/\/+/g, "/"); +} +function kr(e) { + return yo.test(e) || !e.startsWith("/") ? e : Ja(wt.value.base, e); +} +function Qa(e) { + let t = e.replace(/\.html$/, ""); + if (((t = decodeURIComponent(t)), (t = t.replace(/\/$/, "/index")), ye)) { + const n = "/docs/"; + t = Wr(t.slice(n.length).replace(/\//g, "_") || "index") + ".md"; + let s = __VP_HASH_MAP__[t.toLowerCase()]; + if ( + (s || + ((t = t.endsWith("_index.md") + ? t.slice(0, -9) + ".md" + : t.slice(0, -3) + "_index.md"), + (s = __VP_HASH_MAP__[t.toLowerCase()])), + !s) + ) + return null; + t = `${n}assets/${t}.${s}.js`; + } else t = `./${Wr(t.slice(1).replace(/\//g, "_"))}.md.js`; + return t; +} +let _n = []; +function Of(e) { + _n.push(e), + Vn(() => { + _n = _n.filter((t) => t !== e); + }); +} +function Za() { + let e = wt.value.scrollOffset, + t = 0, + n = 24; + if ( + (typeof e == "object" && + "padding" in e && + ((n = e.padding), (e = e.selector)), + typeof e == "number") + ) + t = e; + else if (typeof e == "string") t = Ur(e, n); + else if (Array.isArray(e)) + for (const s of e) { + const r = Ur(s, n); + if (r) { + t = r; + break; + } + } + return t; +} +function Ur(e, t) { + const n = document.querySelector(e); + if (!n) return 0; + const s = n.getBoundingClientRect().bottom; + return s < 0 ? 0 : s + t; +} +const ef = Symbol(), + So = "http://a.com", + tf = () => ({ path: "/", component: null, data: bo }); +function Mf(e, t) { + const n = It(tf()), + s = { route: n, go: r }; + async function r(l = ye ? location.href : "/") { + var c, u; + (l = hs(l)), + (await ((c = s.onBeforeRouteChange) == null ? void 0 : c.call(s, l))) !== + !1 && + (ye && + l !== hs(location.href) && + (history.replaceState({ scrollPosition: window.scrollY }, ""), + history.pushState({}, "", l)), + await o(l), + await ((u = s.onAfterRouteChange ?? s.onAfterRouteChanged) == null + ? void 0 + : u(l))); + } + let i = null; + async function o(l, c = 0, u = !1) { + var v, y; + if ( + (await ((v = s.onBeforePageLoad) == null ? void 0 : v.call(s, l))) === !1 + ) + return; + const a = new URL(l, So), + h = (i = a.pathname); + try { + let A = await e(h); + if (!A) throw new Error(`Page not found: ${h}`); + if (i === h) { + i = null; + const { default: P, __pageData: K } = A; + if (!P) throw new Error(`Invalid route component: ${P}`); + await ((y = s.onAfterPageLoad) == null ? void 0 : y.call(s, l)), + (n.path = ye ? h : kr(h)), + (n.component = vn(P)), + (n.data = vn(K)), + ye && + Dn(() => { + let H = + wt.value.base + + K.relativePath.replace(/(?:(^|\/)index)?\.md$/, "$1"); + if ( + (!wt.value.cleanUrls && !H.endsWith("/") && (H += ".html"), + H !== a.pathname && + ((a.pathname = H), + (l = H + a.search + a.hash), + history.replaceState({}, "", l)), + a.hash && !c) + ) { + let k = null; + try { + k = document.getElementById( + decodeURIComponent(a.hash).slice(1), + ); + } catch (p) { + console.warn(p); + } + if (k) { + Br(k, a.hash); + return; + } + } + window.scrollTo(0, c); + }); + } + } catch (A) { + if ( + (!/fetch|Page not found/.test(A.message) && + !/^\/404(\.html|\/)?$/.test(l) && + console.error(A), + !u) + ) + try { + const P = await fetch(wt.value.base + "hashmap.json"); + (window.__VP_HASH_MAP__ = await P.json()), await o(l, c, !0); + return; + } catch {} + if (i === h) { + (i = null), (n.path = ye ? h : kr(h)), (n.component = t ? vn(t) : null); + const P = ye + ? h + .replace(/(^|\/)$/, "$1index") + .replace(/(\.html)?$/, ".md") + .replace(/^\//, "") + : "404.md"; + n.data = { ...bo, relativePath: P }; + } + } + } + return ( + ye && + (history.state === null && history.replaceState({}, ""), + window.addEventListener( + "click", + (l) => { + if ( + l.defaultPrevented || + !(l.target instanceof Element) || + l.target.closest("button") || + l.button !== 0 || + l.ctrlKey || + l.shiftKey || + l.altKey || + l.metaKey + ) + return; + const c = l.target.closest("a"); + if ( + !c || + c.closest(".vp-raw") || + c.hasAttribute("download") || + c.hasAttribute("target") + ) + return; + const u = + c.getAttribute("href") ?? + (c instanceof SVGAElement ? c.getAttribute("xlink:href") : null); + if (u == null) return; + const { + href: a, + origin: h, + pathname: v, + hash: y, + search: A, + } = new URL(u, c.baseURI), + P = new URL(location.href); + h === P.origin && + Xa(v) && + (l.preventDefault(), + v === P.pathname && A === P.search + ? (y !== P.hash && + (history.pushState({}, "", a), + window.dispatchEvent( + new HashChangeEvent("hashchange", { + oldURL: P.href, + newURL: a, + }), + )), + y + ? Br(c, y, c.classList.contains("header-anchor")) + : window.scrollTo(0, 0)) + : r(a)); + }, + { capture: !0 }, + ), + window.addEventListener("popstate", async (l) => { + var u; + if (l.state === null) return; + const c = hs(location.href); + await o(c, (l.state && l.state.scrollPosition) || 0), + await ((u = s.onAfterRouteChange ?? s.onAfterRouteChanged) == null + ? void 0 + : u(c)); + }), + window.addEventListener("hashchange", (l) => { + l.preventDefault(); + })), + s + ); +} +function nf() { + const e = bt(ef); + if (!e) throw new Error("useRouter() is called without provider."); + return e; +} +function xo() { + return nf().route; +} +function Br(e, t, n = !1) { + let s = null; + try { + s = e.classList.contains("header-anchor") + ? e + : document.getElementById(decodeURIComponent(t).slice(1)); + } catch (r) { + console.warn(r); + } + if (s) { + let r = function () { + !n || Math.abs(o - window.scrollY) > window.innerHeight + ? window.scrollTo(0, o) + : window.scrollTo({ left: 0, top: o, behavior: "smooth" }); + }; + const i = parseInt(window.getComputedStyle(s).paddingTop, 10), + o = window.scrollY + s.getBoundingClientRect().top - Za() + i; + requestAnimationFrame(r); + } +} +function hs(e) { + const t = new URL(e, So); + return ( + (t.pathname = t.pathname.replace(/(^|\/)index(\.html)?$/, "$1")), + wt.value.cleanUrls + ? (t.pathname = t.pathname.replace(/\.html$/, "")) + : !t.pathname.endsWith("/") && + !t.pathname.endsWith(".html") && + (t.pathname += ".html"), + t.pathname + t.search + t.hash + ); +} +const pn = () => _n.forEach((e) => e()), + If = Ci({ + name: "VitePressContent", + props: { as: { type: [Object, String], default: "div" } }, + setup(e) { + const t = xo(), + { frontmatter: n, site: s } = za(); + return ( + Le(n, pn, { deep: !0, flush: "post" }), + () => + As( + e.as, + s.value.contentProps ?? { style: { position: "relative" } }, + [ + t.component + ? As(t.component, { + onVnodeMounted: pn, + onVnodeUpdated: pn, + onVnodeUnmounted: pn, + }) + : "404 Page Not Found", + ], + ) + ); + }, + }), + Pf = (e, t) => { + const n = e.__vccOpts || e; + for (const [s, r] of t) n[s] = r; + return n; + }, + Lf = Ci({ + setup(e, { slots: t }) { + const n = mt(!1); + return ( + Pt(() => { + n.value = !0; + }), + () => (n.value && t.default ? t.default() : null) + ); + }, + }); +function Nf() { + ye && + window.addEventListener("click", (e) => { + var n; + const t = e.target; + if (t.matches(".vp-code-group input")) { + const s = (n = t.parentElement) == null ? void 0 : n.parentElement; + if (!s) return; + const r = Array.from(s.querySelectorAll("input")).indexOf(t); + if (r < 0) return; + const i = s.querySelector(".blocks"); + if (!i) return; + const o = Array.from(i.children).find((u) => + u.classList.contains("active"), + ); + if (!o) return; + const l = i.children[r]; + if (!l || o === l) return; + o.classList.remove("active"), l.classList.add("active"); + const c = s == null ? void 0 : s.querySelector(`label[for="${t.id}"]`); + c == null || c.scrollIntoView({ block: "nearest" }); + } + }); +} +function Ff() { + if (ye) { + const e = new WeakMap(); + window.addEventListener("click", (t) => { + var s; + const n = t.target; + if (n.matches('div[class*="language-"] > button.copy')) { + const r = n.parentElement, + i = + (s = n.nextElementSibling) == null ? void 0 : s.nextElementSibling; + if (!r || !i) return; + const o = /language-(shellscript|shell|bash|sh|zsh)/.test(r.className), + l = [".vp-copy-ignore", ".diff.remove"], + c = i.cloneNode(!0); + c.querySelectorAll(l.join(",")).forEach((a) => a.remove()); + let u = c.textContent || ""; + o && (u = u.replace(/^ *(\$|>) /gm, "").trim()), + sf(u).then(() => { + n.classList.add("copied"), clearTimeout(e.get(n)); + const a = setTimeout(() => { + n.classList.remove("copied"), n.blur(), e.delete(n); + }, 2e3); + e.set(n, a); + }); + } + }); + } +} +async function sf(e) { + try { + return navigator.clipboard.writeText(e); + } catch { + const t = document.createElement("textarea"), + n = document.activeElement; + (t.value = e), + t.setAttribute("readonly", ""), + (t.style.contain = "strict"), + (t.style.position = "absolute"), + (t.style.left = "-9999px"), + (t.style.fontSize = "12pt"); + const s = document.getSelection(), + r = s ? s.rangeCount > 0 && s.getRangeAt(0) : null; + document.body.appendChild(t), + t.select(), + (t.selectionStart = 0), + (t.selectionEnd = e.length), + document.execCommand("copy"), + document.body.removeChild(t), + r && (s.removeAllRanges(), s.addRange(r)), + n && n.focus(); + } +} +function Hf(e, t) { + let n = !0, + s = []; + const r = (i) => { + if (n) { + (n = !1), + i.forEach((l) => { + const c = ps(l); + for (const u of document.head.children) + if (u.isEqualNode(c)) { + s.push(u); + return; + } + }); + return; + } + const o = i.map(ps); + s.forEach((l, c) => { + const u = o.findIndex((a) => + a == null ? void 0 : a.isEqualNode(l ?? null), + ); + u !== -1 ? delete o[u] : (l == null || l.remove(), delete s[c]); + }), + o.forEach((l) => l && document.head.appendChild(l)), + (s = [...s, ...o].filter(Boolean)); + }; + Yi(() => { + const i = e.data, + o = t.value, + l = i && i.description, + c = (i && i.frontmatter.head) || [], + u = _o(o, i); + u !== document.title && (document.title = u); + const a = l || o.description; + let h = document.querySelector("meta[name=description]"); + h + ? h.getAttribute("content") !== a && h.setAttribute("content", a) + : ps(["meta", { name: "description", content: a }]), + r(wo(o.head, of(c))); + }); +} +function ps([e, t, n]) { + const s = document.createElement(e); + for (const r in t) s.setAttribute(r, t[r]); + return ( + n && (s.innerHTML = n), + e === "script" && t.async == null && (s.async = !1), + s + ); +} +function rf(e) { + return e[0] === "meta" && e[1] && e[1].name === "description"; +} +function of(e) { + return e.filter((t) => !rf(t)); +} +const gs = new Set(), + To = () => document.createElement("link"), + lf = (e) => { + const t = To(); + (t.rel = "prefetch"), (t.href = e), document.head.appendChild(t); + }, + cf = (e) => { + const t = new XMLHttpRequest(); + t.open("GET", e, (t.withCredentials = !0)), t.send(); + }; +let gn; +const af = + ye && + (gn = To()) && + gn.relList && + gn.relList.supports && + gn.relList.supports("prefetch") + ? lf + : cf; +function Df() { + if (!ye || !window.IntersectionObserver) return; + let e; + if ((e = navigator.connection) && (e.saveData || /2g/.test(e.effectiveType))) + return; + const t = window.requestIdleCallback || setTimeout; + let n = null; + const s = () => { + n && n.disconnect(), + (n = new IntersectionObserver((i) => { + i.forEach((o) => { + if (o.isIntersecting) { + const l = o.target; + n.unobserve(l); + const { pathname: c } = l; + if (!gs.has(c)) { + gs.add(c); + const u = Qa(c); + u && af(u); + } + } + }); + })), + t(() => { + document.querySelectorAll("#app a").forEach((i) => { + const { hostname: o, pathname: l } = new URL( + i.href instanceof SVGAnimatedString ? i.href.animVal : i.href, + i.baseURI, + ), + c = l.match(/\.\w+$/); + (c && c[0] !== ".html") || + (i.target !== "_blank" && + o === location.hostname && + (l !== location.pathname ? n.observe(i) : gs.add(l))); + }); + }); + }; + Pt(s); + const r = xo(); + Le(() => r.path, s), + Vn(() => { + n && n.disconnect(); + }); +} +export { + gf as $, + Za as A, + df as B, + ff as C, + Pe as D, + Of as E, + Se as F, + ge as G, + uf as H, + yo as I, + xo as J, + bc as K, + bt as L, + Af as M, + Ls as N, + Tf as O, + Dn as P, + Cf as Q, + ye as R, + Fn as S, + _f as T, + Ef as U, + Ql as V, + pf as W, + Sf as X, + Oi as Y, + wf as Z, + Pf as _, + ro as a, + Hf as a0, + ef as a1, + Rf as a2, + Ya as a3, + If as a4, + Lf as a5, + wt as a6, + Mf as a7, + Qa as a8, + xf as a9, + Df as aa, + Ff as ab, + Nf as ac, + As as ad, + yf as ae, + Es as b, + vf as c, + Ci as d, + bf as e, + Xa as f, + kr as g, + ie as h, + Wa as i, + so as j, + Ws as k, + Va as l, + po as m, + Ns as n, + Ts as o, + mt as p, + Le as q, + hf as r, + Yi as s, + Vo as t, + za as u, + Pt as v, + Tl as w, + Vn as x, + mf as y, + $l as z, +}; diff --git a/public/docs/assets/chunks/theme.u6X5xXdX.js b/public/docs/assets/chunks/theme.u6X5xXdX.js index 14ae28c..441ef11 100644 --- a/public/docs/assets/chunks/theme.u6X5xXdX.js +++ b/public/docs/assets/chunks/theme.u6X5xXdX.js @@ -1 +1,4119 @@ -import{d as m,c as u,r as c,n as N,o as a,a as z,t as M,b as k,w as f,T as ce,e as h,_ as b,u as Ae,i as Be,f as Ce,g as ue,h as $,j as v,k as r,l as W,m as ae,p as T,q as D,s as Q,v as j,x as de,y as ve,z as Ee,A as Fe,F as w,B,C as q,D as ge,E as X,G as _,H as E,I as $e,J as Z,K as U,L as x,M as De,N as ye,O as Oe,P as Pe,Q as Le,R as ee,S as Ge,U as Ve,V as Se,W as Ue,X as je,Y as ze,Z as We,$ as qe}from"./framework.WowTybjF.js";const Ke=m({__name:"VPBadge",props:{text:{},type:{default:"tip"}},setup(s){return(e,t)=>(a(),u("span",{class:N(["VPBadge",e.type])},[c(e.$slots,"default",{},()=>[z(M(e.text),1)])],2))}}),Re={key:0,class:"VPBackdrop"},Je=m({__name:"VPBackdrop",props:{show:{type:Boolean}},setup(s){return(e,t)=>(a(),k(ce,{name:"fade"},{default:f(()=>[e.show?(a(),u("div",Re)):h("",!0)]),_:1}))}}),Ye=b(Je,[["__scopeId","data-v-c79a1216"]]),P=Ae;function Qe(s,e){let t,o=!1;return()=>{t&&clearTimeout(t),o?t=setTimeout(s,e):(s(),(o=!0)&&setTimeout(()=>o=!1,e))}}function re(s){return s.startsWith("/")?s:`/${s}`}function pe(s){const{pathname:e,search:t,hash:o,protocol:n}=new URL(s,"http://a.com");if(Be(s)||s.startsWith("#")||!n.startsWith("http")||!Ce(e))return s;const{site:i}=P(),l=e.endsWith("/")||e.endsWith(".html")?s:s.replace(/(?:(^\.+)\/)?.*$/,`$1${e.replace(/(\.md)?$/,i.value.cleanUrls?"":".html")}${t}${o}`);return ue(l)}function R({correspondingLink:s=!1}={}){const{site:e,localeIndex:t,page:o,theme:n,hash:i}=P(),l=$(()=>{var d,y;return{label:(d=e.value.locales[t.value])==null?void 0:d.label,link:((y=e.value.locales[t.value])==null?void 0:y.link)||(t.value==="root"?"/":`/${t.value}/`)}});return{localeLinks:$(()=>Object.entries(e.value.locales).flatMap(([d,y])=>l.value.label===y.label?[]:{text:y.label,link:Xe(y.link||(d==="root"?"/":`/${d}/`),n.value.i18nRouting!==!1&&s,o.value.relativePath.slice(l.value.link.length-1),!e.value.cleanUrls)+i.value})),currentLang:l}}function Xe(s,e,t,o){return e?s.replace(/\/$/,"")+re(t.replace(/(^|\/)index\.md$/,"$1").replace(/\.md$/,o?".html":"")):s}const Ze={class:"NotFound"},xe={class:"code"},et={class:"title"},tt={class:"quote"},nt={class:"action"},ot=["href","aria-label"],st=m({__name:"NotFound",setup(s){const{theme:e}=P(),{currentLang:t}=R();return(o,n)=>{var i,l,p,d,y;return a(),u("div",Ze,[v("p",xe,M(((i=r(e).notFound)==null?void 0:i.code)??"404"),1),v("h1",et,M(((l=r(e).notFound)==null?void 0:l.title)??"PAGE NOT FOUND"),1),n[0]||(n[0]=v("div",{class:"divider"},null,-1)),v("blockquote",tt,M(((p=r(e).notFound)==null?void 0:p.quote)??"But if you don't change your direction, and if you keep looking, you may end up where you are heading."),1),v("div",nt,[v("a",{class:"link",href:r(ue)(r(t).link),"aria-label":((d=r(e).notFound)==null?void 0:d.linkLabel)??"go to home"},M(((y=r(e).notFound)==null?void 0:y.linkText)??"Take me home"),9,ot)])])}}}),at=b(st,[["__scopeId","data-v-d6be1790"]]);function Te(s,e){if(Array.isArray(s))return J(s);if(s==null)return[];e=re(e);const t=Object.keys(s).sort((n,i)=>i.split("/").length-n.split("/").length).find(n=>e.startsWith(re(n))),o=t?s[t]:[];return Array.isArray(o)?J(o):J(o.items,o.base)}function rt(s){const e=[];let t=0;for(const o in s){const n=s[o];if(n.items){t=e.push(n);continue}e[t]||e.push({items:[]}),e[t].items.push(n)}return e}function it(s){const e=[];function t(o){for(const n of o)n.text&&n.link&&e.push({text:n.text,link:n.link,docFooterText:n.docFooterText}),n.items&&t(n.items)}return t(s),e}function ie(s,e){return Array.isArray(e)?e.some(t=>ie(s,t)):W(s,e.link)?!0:e.items?ie(s,e.items):!1}function J(s,e){return[...s].map(t=>{const o={...t},n=o.base||e;return n&&o.link&&(o.link=n+o.link),o.items&&(o.items=J(o.items,n)),o})}function O(){const{frontmatter:s,page:e,theme:t}=P(),o=ae("(min-width: 960px)"),n=T(!1),i=$(()=>{const A=t.value.sidebar,S=e.value.relativePath;return A?Te(A,S):[]}),l=T(i.value);D(i,(A,S)=>{JSON.stringify(A)!==JSON.stringify(S)&&(l.value=i.value)});const p=$(()=>s.value.sidebar!==!1&&l.value.length>0&&s.value.layout!=="home"),d=$(()=>y?s.value.aside==null?t.value.aside==="left":s.value.aside==="left":!1),y=$(()=>s.value.layout==="home"?!1:s.value.aside!=null?!!s.value.aside:t.value.aside!==!1),L=$(()=>p.value&&o.value),g=$(()=>p.value?rt(l.value):[]);function V(){n.value=!0}function I(){n.value=!1}function H(){n.value?I():V()}return{isOpen:n,sidebar:l,sidebarGroups:g,hasSidebar:p,hasAside:y,leftAside:d,isSidebarEnabled:L,open:V,close:I,toggle:H}}function lt(s,e){let t;Q(()=>{t=s.value?document.activeElement:void 0}),j(()=>{window.addEventListener("keyup",o)}),de(()=>{window.removeEventListener("keyup",o)});function o(n){n.key==="Escape"&&s.value&&(e(),t==null||t.focus())}}function ct(s){const{page:e,hash:t}=P(),o=T(!1),n=$(()=>s.value.collapsed!=null),i=$(()=>!!s.value.link),l=T(!1),p=()=>{l.value=W(e.value.relativePath,s.value.link)};D([e,s,t],p),j(p);const d=$(()=>l.value?!0:s.value.items?ie(e.value.relativePath,s.value.items):!1),y=$(()=>!!(s.value.items&&s.value.items.length));Q(()=>{o.value=!!(n.value&&s.value.collapsed)}),ve(()=>{(l.value||d.value)&&(o.value=!1)});function L(){n.value&&(o.value=!o.value)}return{collapsed:o,collapsible:n,isLink:i,isActiveLink:l,hasActiveLink:d,hasChildren:y,toggle:L}}function ut(){const{hasSidebar:s}=O(),e=ae("(min-width: 960px)"),t=ae("(min-width: 1280px)");return{isAsideEnabled:$(()=>!t.value&&!e.value?!1:s.value?t.value:e.value)}}const dt=/\b(?:VPBadge|header-anchor|footnote-ref|ignore-header)\b/,le=[];function Ne(s){return typeof s.outline=="object"&&!Array.isArray(s.outline)&&s.outline.label||s.outlineTitle||"On this page"}function fe(s){const e=[...document.querySelectorAll(".VPDoc :where(h1,h2,h3,h4,h5,h6)")].filter(t=>t.id&&t.hasChildNodes()).map(t=>{const o=Number(t.tagName[1]);return{element:t,title:vt(t),link:"#"+t.id,level:o}});return pt(e,s)}function vt(s){let e="";for(const t of s.childNodes)if(t.nodeType===1){if(dt.test(t.className))continue;e+=t.textContent}else t.nodeType===3&&(e+=t.textContent);return e.trim()}function pt(s,e){if(e===!1)return[];const t=(typeof e=="object"&&!Array.isArray(e)?e.level:e)||2,[o,n]=typeof t=="number"?[t,t]:t==="deep"?[2,6]:t;return mt(s,o,n)}function ft(s,e){const{isAsideEnabled:t}=ut(),o=Qe(i,100);let n=null;j(()=>{requestAnimationFrame(i),window.addEventListener("scroll",o)}),Ee(()=>{l(location.hash)}),de(()=>{window.removeEventListener("scroll",o)});function i(){if(!t.value)return;const p=window.scrollY,d=window.innerHeight,y=document.body.offsetHeight,L=Math.abs(p+d-y)<1,g=le.map(({element:I,link:H})=>({link:H,top:ht(I)})).filter(({top:I})=>!Number.isNaN(I)).sort((I,H)=>I.top-H.top);if(!g.length){l(null);return}if(p<1){l(null);return}if(L){l(g[g.length-1].link);return}let V=null;for(const{link:I,top:H}of g){if(H>p+Fe()+4)break;V=I}l(V)}function l(p){n&&n.classList.remove("active"),p==null?n=null:n=s.value.querySelector(`a[href="${decodeURIComponent(p)}"]`);const d=n;d?(d.classList.add("active"),e.value.style.top=d.offsetTop+39+"px",e.value.style.opacity="1"):(e.value.style.top="33px",e.value.style.opacity="0")}}function ht(s){let e=0;for(;s!==document.body;){if(s===null)return NaN;e+=s.offsetTop,s=s.offsetParent}return e}function mt(s,e,t){le.length=0;const o=[],n=[];return s.forEach(i=>{const l={...i,children:[]};let p=n[n.length-1];for(;p&&p.level>=l.level;)n.pop(),p=n[n.length-1];if(l.element.classList.contains("ignore-header")||p&&"shouldIgnore"in p){n.push({level:l.level,shouldIgnore:!0});return}l.level>t||l.level{const n=q("VPDocOutlineItem",!0);return a(),u("ul",{class:N(["VPDocOutlineItem",t.root?"root":"nested"])},[(a(!0),u(w,null,B(t.headers,({children:i,link:l,title:p})=>(a(),u("li",null,[v("a",{class:"outline-link",href:l,onClick:e,title:p},M(p),9,_t),i!=null&&i.length?(a(),k(n,{key:0,headers:i},null,8,["headers"])):h("",!0)]))),256))],2)}}}),Me=b(kt,[["__scopeId","data-v-b933a997"]]),bt={class:"content"},gt={"aria-level":"2",class:"outline-title",id:"doc-outline-aria-label",role:"heading"},$t=m({__name:"VPDocAsideOutline",setup(s){const{frontmatter:e,theme:t}=P(),o=ge([]);X(()=>{o.value=fe(e.value.outline??t.value.outline)});const n=T(),i=T();return ft(n,i),(l,p)=>(a(),u("nav",{"aria-labelledby":"doc-outline-aria-label",class:N(["VPDocAsideOutline",{"has-outline":o.value.length>0}]),ref_key:"container",ref:n},[v("div",bt,[v("div",{class:"outline-marker",ref_key:"marker",ref:i},null,512),v("div",gt,M(r(Ne)(r(t))),1),_(Me,{headers:o.value,root:!0},null,8,["headers"])])],2))}}),yt=b($t,[["__scopeId","data-v-a5bbad30"]]),Pt={class:"VPDocAsideCarbonAds"},Lt=m({__name:"VPDocAsideCarbonAds",props:{carbonAds:{}},setup(s){const e=()=>null;return(t,o)=>(a(),u("div",Pt,[_(r(e),{"carbon-ads":t.carbonAds},null,8,["carbon-ads"])]))}}),Vt={class:"VPDocAside"},St=m({__name:"VPDocAside",setup(s){const{theme:e}=P();return(t,o)=>(a(),u("div",Vt,[c(t.$slots,"aside-top",{},void 0,!0),c(t.$slots,"aside-outline-before",{},void 0,!0),_(yt),c(t.$slots,"aside-outline-after",{},void 0,!0),o[0]||(o[0]=v("div",{class:"spacer"},null,-1)),c(t.$slots,"aside-ads-before",{},void 0,!0),r(e).carbonAds?(a(),k(Lt,{key:0,"carbon-ads":r(e).carbonAds},null,8,["carbon-ads"])):h("",!0),c(t.$slots,"aside-ads-after",{},void 0,!0),c(t.$slots,"aside-bottom",{},void 0,!0)]))}}),Tt=b(St,[["__scopeId","data-v-3f215769"]]);function Nt(){const{theme:s,page:e}=P();return $(()=>{const{text:t="Edit this page",pattern:o=""}=s.value.editLink||{};let n;return typeof o=="function"?n=o(e.value):n=o.replace(/:path/g,e.value.filePath),{url:n,text:t}})}function Mt(){const{page:s,theme:e,frontmatter:t}=P();return $(()=>{var y,L,g,V,I,H,A,S;const o=Te(e.value.sidebar,s.value.relativePath),n=it(o),i=It(n,C=>C.link.replace(/[?#].*$/,"")),l=i.findIndex(C=>W(s.value.relativePath,C.link)),p=((y=e.value.docFooter)==null?void 0:y.prev)===!1&&!t.value.prev||t.value.prev===!1,d=((L=e.value.docFooter)==null?void 0:L.next)===!1&&!t.value.next||t.value.next===!1;return{prev:p?void 0:{text:(typeof t.value.prev=="string"?t.value.prev:typeof t.value.prev=="object"?t.value.prev.text:void 0)??((g=i[l-1])==null?void 0:g.docFooterText)??((V=i[l-1])==null?void 0:V.text),link:(typeof t.value.prev=="object"?t.value.prev.link:void 0)??((I=i[l-1])==null?void 0:I.link)},next:d?void 0:{text:(typeof t.value.next=="string"?t.value.next:typeof t.value.next=="object"?t.value.next.text:void 0)??((H=i[l+1])==null?void 0:H.docFooterText)??((A=i[l+1])==null?void 0:A.text),link:(typeof t.value.next=="object"?t.value.next.link:void 0)??((S=i[l+1])==null?void 0:S.link)}}})}function It(s,e){const t=new Set;return s.filter(o=>{const n=e(o);return t.has(n)?!1:t.add(n)})}const F=m({__name:"VPLink",props:{tag:{},href:{},noIcon:{type:Boolean},target:{},rel:{}},setup(s){const e=s,t=$(()=>e.tag??(e.href?"a":"span")),o=$(()=>e.href&&$e.test(e.href)||e.target==="_blank");return(n,i)=>(a(),k(E(t.value),{class:N(["VPLink",{link:n.href,"vp-external-link-icon":o.value,"no-icon":n.noIcon}]),href:n.href?r(pe)(n.href):void 0,target:n.target??(o.value?"_blank":void 0),rel:n.rel??(o.value?"noreferrer":void 0)},{default:f(()=>[c(n.$slots,"default")]),_:3},8,["class","href","target","rel"]))}}),wt={class:"VPLastUpdated"},Ht=["datetime"],At=m({__name:"VPDocFooterLastUpdated",setup(s){const{theme:e,page:t,lang:o}=P(),n=$(()=>new Date(t.value.lastUpdated)),i=$(()=>n.value.toISOString()),l=T("");return j(()=>{Q(()=>{var p,d,y;l.value=new Intl.DateTimeFormat((d=(p=e.value.lastUpdated)==null?void 0:p.formatOptions)!=null&&d.forceLocale?o.value:void 0,((y=e.value.lastUpdated)==null?void 0:y.formatOptions)??{dateStyle:"short",timeStyle:"short"}).format(n.value)})}),(p,d)=>{var y;return a(),u("p",wt,[z(M(((y=r(e).lastUpdated)==null?void 0:y.text)||r(e).lastUpdatedText||"Last updated")+": ",1),v("time",{datetime:i.value},M(l.value),9,Ht)])}}}),Bt=b(At,[["__scopeId","data-v-e98dd255"]]),Ct={key:0,class:"VPDocFooter"},Et={key:0,class:"edit-info"},Ft={key:0,class:"edit-link"},Dt={key:1,class:"last-updated"},Ot={key:1,class:"prev-next","aria-labelledby":"doc-footer-aria-label"},Gt={class:"pager"},Ut=["innerHTML"],jt=["innerHTML"],zt={class:"pager"},Wt=["innerHTML"],qt=["innerHTML"],Kt=m({__name:"VPDocFooter",setup(s){const{theme:e,page:t,frontmatter:o}=P(),n=Nt(),i=Mt(),l=$(()=>e.value.editLink&&o.value.editLink!==!1),p=$(()=>t.value.lastUpdated),d=$(()=>l.value||p.value||i.value.prev||i.value.next);return(y,L)=>{var g,V,I,H;return d.value?(a(),u("footer",Ct,[c(y.$slots,"doc-footer-before",{},void 0,!0),l.value||p.value?(a(),u("div",Et,[l.value?(a(),u("div",Ft,[_(F,{class:"edit-link-button",href:r(n).url,"no-icon":!0},{default:f(()=>[L[0]||(L[0]=v("span",{class:"vpi-square-pen edit-link-icon"},null,-1)),z(" "+M(r(n).text),1)]),_:1,__:[0]},8,["href"])])):h("",!0),p.value?(a(),u("div",Dt,[_(Bt)])):h("",!0)])):h("",!0),(g=r(i).prev)!=null&&g.link||(V=r(i).next)!=null&&V.link?(a(),u("nav",Ot,[L[1]||(L[1]=v("span",{class:"visually-hidden",id:"doc-footer-aria-label"},"Pager",-1)),v("div",Gt,[(I=r(i).prev)!=null&&I.link?(a(),k(F,{key:0,class:"pager-link prev",href:r(i).prev.link},{default:f(()=>{var A;return[v("span",{class:"desc",innerHTML:((A=r(e).docFooter)==null?void 0:A.prev)||"Previous page"},null,8,Ut),v("span",{class:"title",innerHTML:r(i).prev.text},null,8,jt)]}),_:1},8,["href"])):h("",!0)]),v("div",zt,[(H=r(i).next)!=null&&H.link?(a(),k(F,{key:0,class:"pager-link next",href:r(i).next.link},{default:f(()=>{var A;return[v("span",{class:"desc",innerHTML:((A=r(e).docFooter)==null?void 0:A.next)||"Next page"},null,8,Wt),v("span",{class:"title",innerHTML:r(i).next.text},null,8,qt)]}),_:1},8,["href"])):h("",!0)])])):h("",!0)])):h("",!0)}}}),Rt=b(Kt,[["__scopeId","data-v-e257564d"]]),Jt={class:"container"},Yt={class:"aside-container"},Qt={class:"aside-content"},Xt={class:"content"},Zt={class:"content-container"},xt={class:"main"},en=m({__name:"VPDoc",setup(s){const{theme:e}=P(),t=Z(),{hasSidebar:o,hasAside:n,leftAside:i}=O(),l=$(()=>t.path.replace(/[./]+/g,"_").replace(/_html$/,""));return(p,d)=>{const y=q("Content");return a(),u("div",{class:N(["VPDoc",{"has-sidebar":r(o),"has-aside":r(n)}])},[c(p.$slots,"doc-top",{},void 0,!0),v("div",Jt,[r(n)?(a(),u("div",{key:0,class:N(["aside",{"left-aside":r(i)}])},[d[0]||(d[0]=v("div",{class:"aside-curtain"},null,-1)),v("div",Yt,[v("div",Qt,[_(Tt,null,{"aside-top":f(()=>[c(p.$slots,"aside-top",{},void 0,!0)]),"aside-bottom":f(()=>[c(p.$slots,"aside-bottom",{},void 0,!0)]),"aside-outline-before":f(()=>[c(p.$slots,"aside-outline-before",{},void 0,!0)]),"aside-outline-after":f(()=>[c(p.$slots,"aside-outline-after",{},void 0,!0)]),"aside-ads-before":f(()=>[c(p.$slots,"aside-ads-before",{},void 0,!0)]),"aside-ads-after":f(()=>[c(p.$slots,"aside-ads-after",{},void 0,!0)]),_:3})])])],2)):h("",!0),v("div",Xt,[v("div",Zt,[c(p.$slots,"doc-before",{},void 0,!0),v("main",xt,[_(y,{class:N(["vp-doc",[l.value,r(e).externalLinkIcon&&"external-link-icon-enabled"]])},null,8,["class"])]),_(Rt,null,{"doc-footer-before":f(()=>[c(p.$slots,"doc-footer-before",{},void 0,!0)]),_:3}),c(p.$slots,"doc-after",{},void 0,!0)])])]),c(p.$slots,"doc-bottom",{},void 0,!0)],2)}}}),tn=b(en,[["__scopeId","data-v-39a288b8"]]),nn=m({__name:"VPButton",props:{tag:{},size:{default:"medium"},theme:{default:"brand"},text:{},href:{},target:{},rel:{}},setup(s){const e=s,t=$(()=>e.href&&$e.test(e.href)),o=$(()=>e.tag||(e.href?"a":"button"));return(n,i)=>(a(),k(E(o.value),{class:N(["VPButton",[n.size,n.theme]]),href:n.href?r(pe)(n.href):void 0,target:e.target??(t.value?"_blank":void 0),rel:e.rel??(t.value?"noreferrer":void 0)},{default:f(()=>[z(M(n.text),1)]),_:1},8,["class","href","target","rel"]))}}),on=b(nn,[["__scopeId","data-v-fa7799d5"]]),sn=["src","alt"],an=m({inheritAttrs:!1,__name:"VPImage",props:{image:{},alt:{}},setup(s){return(e,t)=>{const o=q("VPImage",!0);return e.image?(a(),u(w,{key:0},[typeof e.image=="string"||"src"in e.image?(a(),u("img",U({key:0,class:"VPImage"},typeof e.image=="string"?e.$attrs:{...e.image,...e.$attrs},{src:r(ue)(typeof e.image=="string"?e.image:e.image.src),alt:e.alt??(typeof e.image=="string"?"":e.image.alt||"")}),null,16,sn)):(a(),u(w,{key:1},[_(o,U({class:"dark",image:e.image.dark,alt:e.image.alt},e.$attrs),null,16,["image","alt"]),_(o,U({class:"light",image:e.image.light,alt:e.image.alt},e.$attrs),null,16,["image","alt"])],64))],64)):h("",!0)}}}),Y=b(an,[["__scopeId","data-v-8426fc1a"]]),rn={class:"container"},ln={class:"main"},cn={class:"heading"},un=["innerHTML"],dn=["innerHTML"],vn=["innerHTML"],pn={key:0,class:"actions"},fn={key:0,class:"image"},hn={class:"image-container"},mn=m({__name:"VPHero",props:{name:{},text:{},tagline:{},image:{},actions:{}},setup(s){const e=x("hero-image-slot-exists");return(t,o)=>(a(),u("div",{class:N(["VPHero",{"has-image":t.image||r(e)}])},[v("div",rn,[v("div",ln,[c(t.$slots,"home-hero-info-before",{},void 0,!0),c(t.$slots,"home-hero-info",{},()=>[v("h1",cn,[t.name?(a(),u("span",{key:0,innerHTML:t.name,class:"name clip"},null,8,un)):h("",!0),t.text?(a(),u("span",{key:1,innerHTML:t.text,class:"text"},null,8,dn)):h("",!0)]),t.tagline?(a(),u("p",{key:0,innerHTML:t.tagline,class:"tagline"},null,8,vn)):h("",!0)],!0),c(t.$slots,"home-hero-info-after",{},void 0,!0),t.actions?(a(),u("div",pn,[(a(!0),u(w,null,B(t.actions,n=>(a(),u("div",{key:n.link,class:"action"},[_(on,{tag:"a",size:"medium",theme:n.theme,text:n.text,href:n.link,target:n.target,rel:n.rel},null,8,["theme","text","href","target","rel"])]))),128))])):h("",!0),c(t.$slots,"home-hero-actions-after",{},void 0,!0)]),t.image||r(e)?(a(),u("div",fn,[v("div",hn,[o[0]||(o[0]=v("div",{class:"image-bg"},null,-1)),c(t.$slots,"home-hero-image",{},()=>[t.image?(a(),k(Y,{key:0,class:"image-src",image:t.image},null,8,["image"])):h("",!0)],!0)])])):h("",!0)])],2))}}),_n=b(mn,[["__scopeId","data-v-4f9c455b"]]),kn=m({__name:"VPHomeHero",setup(s){const{frontmatter:e}=P();return(t,o)=>r(e).hero?(a(),k(_n,{key:0,class:"VPHomeHero",name:r(e).hero.name,text:r(e).hero.text,tagline:r(e).hero.tagline,image:r(e).hero.image,actions:r(e).hero.actions},{"home-hero-info-before":f(()=>[c(t.$slots,"home-hero-info-before")]),"home-hero-info":f(()=>[c(t.$slots,"home-hero-info")]),"home-hero-info-after":f(()=>[c(t.$slots,"home-hero-info-after")]),"home-hero-actions-after":f(()=>[c(t.$slots,"home-hero-actions-after")]),"home-hero-image":f(()=>[c(t.$slots,"home-hero-image")]),_:3},8,["name","text","tagline","image","actions"])):h("",!0)}}),bn={class:"box"},gn={key:0,class:"icon"},$n=["innerHTML"],yn=["innerHTML"],Pn=["innerHTML"],Ln={key:4,class:"link-text"},Vn={class:"link-text-value"},Sn=m({__name:"VPFeature",props:{icon:{},title:{},details:{},link:{},linkText:{},rel:{},target:{}},setup(s){return(e,t)=>(a(),k(F,{class:"VPFeature",href:e.link,rel:e.rel,target:e.target,"no-icon":!0,tag:e.link?"a":"div"},{default:f(()=>[v("article",bn,[typeof e.icon=="object"&&e.icon.wrap?(a(),u("div",gn,[_(Y,{image:e.icon,alt:e.icon.alt,height:e.icon.height||48,width:e.icon.width||48},null,8,["image","alt","height","width"])])):typeof e.icon=="object"?(a(),k(Y,{key:1,image:e.icon,alt:e.icon.alt,height:e.icon.height||48,width:e.icon.width||48},null,8,["image","alt","height","width"])):e.icon?(a(),u("div",{key:2,class:"icon",innerHTML:e.icon},null,8,$n)):h("",!0),v("h2",{class:"title",innerHTML:e.title},null,8,yn),e.details?(a(),u("p",{key:3,class:"details",innerHTML:e.details},null,8,Pn)):h("",!0),e.linkText?(a(),u("div",Ln,[v("p",Vn,[z(M(e.linkText)+" ",1),t[0]||(t[0]=v("span",{class:"vpi-arrow-right link-text-icon"},null,-1))])])):h("",!0)])]),_:1},8,["href","rel","target","tag"]))}}),Tn=b(Sn,[["__scopeId","data-v-a3976bdc"]]),Nn={key:0,class:"VPFeatures"},Mn={class:"container"},In={class:"items"},wn=m({__name:"VPFeatures",props:{features:{}},setup(s){const e=s,t=$(()=>{const o=e.features.length;if(o){if(o===2)return"grid-2";if(o===3)return"grid-3";if(o%3===0)return"grid-6";if(o>3)return"grid-4"}else return});return(o,n)=>o.features?(a(),u("div",Nn,[v("div",Mn,[v("div",In,[(a(!0),u(w,null,B(o.features,i=>(a(),u("div",{key:i.title,class:N(["item",[t.value]])},[_(Tn,{icon:i.icon,title:i.title,details:i.details,link:i.link,"link-text":i.linkText,rel:i.rel,target:i.target},null,8,["icon","title","details","link","link-text","rel","target"])],2))),128))])])])):h("",!0)}}),Hn=b(wn,[["__scopeId","data-v-a6181336"]]),An=m({__name:"VPHomeFeatures",setup(s){const{frontmatter:e}=P();return(t,o)=>r(e).features?(a(),k(Hn,{key:0,class:"VPHomeFeatures",features:r(e).features},null,8,["features"])):h("",!0)}}),Bn=m({__name:"VPHomeContent",setup(s){const{width:e}=De({initialWidth:0,includeScrollbar:!1});return(t,o)=>(a(),u("div",{class:"vp-doc container",style:ye(r(e)?{"--vp-offset":`calc(50% - ${r(e)/2}px)`}:{})},[c(t.$slots,"default",{},void 0,!0)],4))}}),Cn=b(Bn,[["__scopeId","data-v-8e2d4988"]]),En=m({__name:"VPHome",setup(s){const{frontmatter:e,theme:t}=P();return(o,n)=>{const i=q("Content");return a(),u("div",{class:N(["VPHome",{"external-link-icon-enabled":r(t).externalLinkIcon}])},[c(o.$slots,"home-hero-before",{},void 0,!0),_(kn,null,{"home-hero-info-before":f(()=>[c(o.$slots,"home-hero-info-before",{},void 0,!0)]),"home-hero-info":f(()=>[c(o.$slots,"home-hero-info",{},void 0,!0)]),"home-hero-info-after":f(()=>[c(o.$slots,"home-hero-info-after",{},void 0,!0)]),"home-hero-actions-after":f(()=>[c(o.$slots,"home-hero-actions-after",{},void 0,!0)]),"home-hero-image":f(()=>[c(o.$slots,"home-hero-image",{},void 0,!0)]),_:3}),c(o.$slots,"home-hero-after",{},void 0,!0),c(o.$slots,"home-features-before",{},void 0,!0),_(An),c(o.$slots,"home-features-after",{},void 0,!0),r(e).markdownStyles!==!1?(a(),k(Cn,{key:0},{default:f(()=>[_(i)]),_:1})):(a(),k(i,{key:1}))],2)}}}),Fn=b(En,[["__scopeId","data-v-8b561e3d"]]),Dn={},On={class:"VPPage"};function Gn(s,e){const t=q("Content");return a(),u("div",On,[c(s.$slots,"page-top"),_(t),c(s.$slots,"page-bottom")])}const Un=b(Dn,[["render",Gn]]),jn=m({__name:"VPContent",setup(s){const{page:e,frontmatter:t}=P(),{hasSidebar:o}=O();return(n,i)=>(a(),u("div",{class:N(["VPContent",{"has-sidebar":r(o),"is-home":r(t).layout==="home"}]),id:"VPContent"},[r(e).isNotFound?c(n.$slots,"not-found",{key:0},()=>[_(at)],!0):r(t).layout==="page"?(a(),k(Un,{key:1},{"page-top":f(()=>[c(n.$slots,"page-top",{},void 0,!0)]),"page-bottom":f(()=>[c(n.$slots,"page-bottom",{},void 0,!0)]),_:3})):r(t).layout==="home"?(a(),k(Fn,{key:2},{"home-hero-before":f(()=>[c(n.$slots,"home-hero-before",{},void 0,!0)]),"home-hero-info-before":f(()=>[c(n.$slots,"home-hero-info-before",{},void 0,!0)]),"home-hero-info":f(()=>[c(n.$slots,"home-hero-info",{},void 0,!0)]),"home-hero-info-after":f(()=>[c(n.$slots,"home-hero-info-after",{},void 0,!0)]),"home-hero-actions-after":f(()=>[c(n.$slots,"home-hero-actions-after",{},void 0,!0)]),"home-hero-image":f(()=>[c(n.$slots,"home-hero-image",{},void 0,!0)]),"home-hero-after":f(()=>[c(n.$slots,"home-hero-after",{},void 0,!0)]),"home-features-before":f(()=>[c(n.$slots,"home-features-before",{},void 0,!0)]),"home-features-after":f(()=>[c(n.$slots,"home-features-after",{},void 0,!0)]),_:3})):r(t).layout&&r(t).layout!=="doc"?(a(),k(E(r(t).layout),{key:3})):(a(),k(tn,{key:4},{"doc-top":f(()=>[c(n.$slots,"doc-top",{},void 0,!0)]),"doc-bottom":f(()=>[c(n.$slots,"doc-bottom",{},void 0,!0)]),"doc-footer-before":f(()=>[c(n.$slots,"doc-footer-before",{},void 0,!0)]),"doc-before":f(()=>[c(n.$slots,"doc-before",{},void 0,!0)]),"doc-after":f(()=>[c(n.$slots,"doc-after",{},void 0,!0)]),"aside-top":f(()=>[c(n.$slots,"aside-top",{},void 0,!0)]),"aside-outline-before":f(()=>[c(n.$slots,"aside-outline-before",{},void 0,!0)]),"aside-outline-after":f(()=>[c(n.$slots,"aside-outline-after",{},void 0,!0)]),"aside-ads-before":f(()=>[c(n.$slots,"aside-ads-before",{},void 0,!0)]),"aside-ads-after":f(()=>[c(n.$slots,"aside-ads-after",{},void 0,!0)]),"aside-bottom":f(()=>[c(n.$slots,"aside-bottom",{},void 0,!0)]),_:3}))],2))}}),zn=b(jn,[["__scopeId","data-v-1428d186"]]),Wn={class:"container"},qn=["innerHTML"],Kn=["innerHTML"],Rn=m({__name:"VPFooter",setup(s){const{theme:e,frontmatter:t}=P(),{hasSidebar:o}=O();return(n,i)=>r(e).footer&&r(t).footer!==!1?(a(),u("footer",{key:0,class:N(["VPFooter",{"has-sidebar":r(o)}])},[v("div",Wn,[r(e).footer.message?(a(),u("p",{key:0,class:"message",innerHTML:r(e).footer.message},null,8,qn)):h("",!0),r(e).footer.copyright?(a(),u("p",{key:1,class:"copyright",innerHTML:r(e).footer.copyright},null,8,Kn)):h("",!0)])],2)):h("",!0)}}),Jn=b(Rn,[["__scopeId","data-v-e315a0ad"]]);function Yn(){const{theme:s,frontmatter:e}=P(),t=ge([]),o=$(()=>t.value.length>0);return X(()=>{t.value=fe(e.value.outline??s.value.outline)}),{headers:t,hasLocalNav:o}}const Qn={class:"menu-text"},Xn={class:"header"},Zn={class:"outline"},xn=m({__name:"VPLocalNavOutlineDropdown",props:{headers:{},navHeight:{}},setup(s){const e=s,{theme:t}=P(),o=T(!1),n=T(0),i=T(),l=T();function p(g){var V;(V=i.value)!=null&&V.contains(g.target)||(o.value=!1)}D(o,g=>{if(g){document.addEventListener("click",p);return}document.removeEventListener("click",p)}),Oe("Escape",()=>{o.value=!1}),X(()=>{o.value=!1});function d(){o.value=!o.value,n.value=window.innerHeight+Math.min(window.scrollY-e.navHeight,0)}function y(g){g.target.classList.contains("outline-link")&&(l.value&&(l.value.style.transition="none"),Pe(()=>{o.value=!1}))}function L(){o.value=!1,window.scrollTo({top:0,left:0,behavior:"smooth"})}return(g,V)=>(a(),u("div",{class:"VPLocalNavOutlineDropdown",style:ye({"--vp-vh":n.value+"px"}),ref_key:"main",ref:i},[g.headers.length>0?(a(),u("button",{key:0,onClick:d,class:N({open:o.value})},[v("span",Qn,M(r(Ne)(r(t))),1),V[0]||(V[0]=v("span",{class:"vpi-chevron-right icon"},null,-1))],2)):(a(),u("button",{key:1,onClick:L},M(r(t).returnToTopLabel||"Return to top"),1)),_(ce,{name:"flyout"},{default:f(()=>[o.value?(a(),u("div",{key:0,ref_key:"items",ref:l,class:"items",onClick:y},[v("div",Xn,[v("a",{class:"top-link",href:"#",onClick:L},M(r(t).returnToTopLabel||"Return to top"),1)]),v("div",Zn,[_(Me,{headers:g.headers},null,8,["headers"])])],512)):h("",!0)]),_:1})],4))}}),eo=b(xn,[["__scopeId","data-v-8a42e2b4"]]),to={class:"container"},no=["aria-expanded"],oo={class:"menu-text"},so=m({__name:"VPLocalNav",props:{open:{type:Boolean}},emits:["open-menu"],setup(s){const{theme:e,frontmatter:t}=P(),{hasSidebar:o}=O(),{headers:n}=Yn(),{y:i}=Le(),l=T(0);j(()=>{l.value=parseInt(getComputedStyle(document.documentElement).getPropertyValue("--vp-nav-height"))}),X(()=>{n.value=fe(t.value.outline??e.value.outline)});const p=$(()=>n.value.length===0),d=$(()=>p.value&&!o.value),y=$(()=>({VPLocalNav:!0,"has-sidebar":o.value,empty:p.value,fixed:d.value}));return(L,g)=>r(t).layout!=="home"&&(!d.value||r(i)>=l.value)?(a(),u("div",{key:0,class:N(y.value)},[v("div",to,[r(o)?(a(),u("button",{key:0,class:"menu","aria-expanded":L.open,"aria-controls":"VPSidebarNav",onClick:g[0]||(g[0]=V=>L.$emit("open-menu"))},[g[1]||(g[1]=v("span",{class:"vpi-align-left menu-icon"},null,-1)),v("span",oo,M(r(e).sidebarMenuLabel||"Menu"),1)],8,no)):h("",!0),_(eo,{headers:r(n),navHeight:l.value},null,8,["headers","navHeight"])])],2)):h("",!0)}}),ao=b(so,[["__scopeId","data-v-a6f0e41e"]]);function ro(){const s=T(!1);function e(){s.value=!0,window.addEventListener("resize",n)}function t(){s.value=!1,window.removeEventListener("resize",n)}function o(){s.value?t():e()}function n(){window.outerWidth>=768&&t()}const i=Z();return D(()=>i.path,t),{isScreenOpen:s,openScreen:e,closeScreen:t,toggleScreen:o}}const io={},lo={class:"VPSwitch",type:"button",role:"switch"},co={class:"check"},uo={key:0,class:"icon"};function vo(s,e){return a(),u("button",lo,[v("span",co,[s.$slots.default?(a(),u("span",uo,[c(s.$slots,"default",{},void 0,!0)])):h("",!0)])])}const po=b(io,[["render",vo],["__scopeId","data-v-1d5665e3"]]),fo=m({__name:"VPSwitchAppearance",setup(s){const{isDark:e,theme:t}=P(),o=x("toggle-appearance",()=>{e.value=!e.value}),n=T("");return ve(()=>{n.value=e.value?t.value.lightModeSwitchTitle||"Switch to light theme":t.value.darkModeSwitchTitle||"Switch to dark theme"}),(i,l)=>(a(),k(po,{title:n.value,class:"VPSwitchAppearance","aria-checked":r(e),onClick:r(o)},{default:f(()=>l[0]||(l[0]=[v("span",{class:"vpi-sun sun"},null,-1),v("span",{class:"vpi-moon moon"},null,-1)])),_:1,__:[0]},8,["title","aria-checked","onClick"]))}}),he=b(fo,[["__scopeId","data-v-5337faa4"]]),ho={key:0,class:"VPNavBarAppearance"},mo=m({__name:"VPNavBarAppearance",setup(s){const{site:e}=P();return(t,o)=>r(e).appearance&&r(e).appearance!=="force-dark"&&r(e).appearance!=="force-auto"?(a(),u("div",ho,[_(he)])):h("",!0)}}),_o=b(mo,[["__scopeId","data-v-6c893767"]]),me=T();let Ie=!1,se=0;function ko(s){const e=T(!1);if(ee){!Ie&&bo(),se++;const t=D(me,o=>{var n,i,l;o===s.el.value||(n=s.el.value)!=null&&n.contains(o)?(e.value=!0,(i=s.onFocus)==null||i.call(s)):(e.value=!1,(l=s.onBlur)==null||l.call(s))});de(()=>{t(),se--,se||go()})}return Ge(e)}function bo(){document.addEventListener("focusin",we),Ie=!0,me.value=document.activeElement}function go(){document.removeEventListener("focusin",we)}function we(){me.value=document.activeElement}const $o={class:"VPMenuLink"},yo=["innerHTML"],Po=m({__name:"VPMenuLink",props:{item:{}},setup(s){const{page:e}=P();return(t,o)=>(a(),u("div",$o,[_(F,{class:N({active:r(W)(r(e).relativePath,t.item.activeMatch||t.item.link,!!t.item.activeMatch)}),href:t.item.link,target:t.item.target,rel:t.item.rel,"no-icon":t.item.noIcon},{default:f(()=>[v("span",{innerHTML:t.item.text},null,8,yo)]),_:1},8,["class","href","target","rel","no-icon"])]))}}),te=b(Po,[["__scopeId","data-v-35975db6"]]),Lo={class:"VPMenuGroup"},Vo={key:0,class:"title"},So=m({__name:"VPMenuGroup",props:{text:{},items:{}},setup(s){return(e,t)=>(a(),u("div",Lo,[e.text?(a(),u("p",Vo,M(e.text),1)):h("",!0),(a(!0),u(w,null,B(e.items,o=>(a(),u(w,null,["link"in o?(a(),k(te,{key:0,item:o},null,8,["item"])):h("",!0)],64))),256))]))}}),To=b(So,[["__scopeId","data-v-69e747b5"]]),No={class:"VPMenu"},Mo={key:0,class:"items"},Io=m({__name:"VPMenu",props:{items:{}},setup(s){return(e,t)=>(a(),u("div",No,[e.items?(a(),u("div",Mo,[(a(!0),u(w,null,B(e.items,o=>(a(),u(w,{key:JSON.stringify(o)},["link"in o?(a(),k(te,{key:0,item:o},null,8,["item"])):"component"in o?(a(),k(E(o.component),U({key:1,ref_for:!0},o.props),null,16)):(a(),k(To,{key:2,text:o.text,items:o.items},null,8,["text","items"]))],64))),128))])):h("",!0),c(e.$slots,"default",{},void 0,!0)]))}}),wo=b(Io,[["__scopeId","data-v-b98bc113"]]),Ho=["aria-expanded","aria-label"],Ao={key:0,class:"text"},Bo=["innerHTML"],Co={key:1,class:"vpi-more-horizontal icon"},Eo={class:"menu"},Fo=m({__name:"VPFlyout",props:{icon:{},button:{},label:{},items:{}},setup(s){const e=T(!1),t=T();ko({el:t,onBlur:o});function o(){e.value=!1}return(n,i)=>(a(),u("div",{class:"VPFlyout",ref_key:"el",ref:t,onMouseenter:i[1]||(i[1]=l=>e.value=!0),onMouseleave:i[2]||(i[2]=l=>e.value=!1)},[v("button",{type:"button",class:"button","aria-haspopup":"true","aria-expanded":e.value,"aria-label":n.label,onClick:i[0]||(i[0]=l=>e.value=!e.value)},[n.button||n.icon?(a(),u("span",Ao,[n.icon?(a(),u("span",{key:0,class:N([n.icon,"option-icon"])},null,2)):h("",!0),n.button?(a(),u("span",{key:1,innerHTML:n.button},null,8,Bo)):h("",!0),i[3]||(i[3]=v("span",{class:"vpi-chevron-down text-icon"},null,-1))])):(a(),u("span",Co))],8,Ho),v("div",Eo,[_(wo,{items:n.items},{default:f(()=>[c(n.$slots,"default",{},void 0,!0)]),_:3},8,["items"])])],544))}}),_e=b(Fo,[["__scopeId","data-v-cf11d7a2"]]),Do=["href","aria-label","innerHTML"],Oo=m({__name:"VPSocialLink",props:{icon:{},link:{},ariaLabel:{}},setup(s){const e=s,t=T();j(async()=>{var i;await Pe();const n=(i=t.value)==null?void 0:i.children[0];n instanceof HTMLElement&&n.className.startsWith("vpi-social-")&&(getComputedStyle(n).maskImage||getComputedStyle(n).webkitMaskImage)==="none"&&n.style.setProperty("--icon",`url('https://api.iconify.design/simple-icons/${e.icon}.svg')`)});const o=$(()=>typeof e.icon=="object"?e.icon.svg:``);return(n,i)=>(a(),u("a",{ref_key:"el",ref:t,class:"VPSocialLink no-icon",href:n.link,"aria-label":n.ariaLabel??(typeof n.icon=="string"?n.icon:""),target:"_blank",rel:"noopener",innerHTML:o.value},null,8,Do))}}),Go=b(Oo,[["__scopeId","data-v-bd121fe5"]]),Uo={class:"VPSocialLinks"},jo=m({__name:"VPSocialLinks",props:{links:{}},setup(s){return(e,t)=>(a(),u("div",Uo,[(a(!0),u(w,null,B(e.links,({link:o,icon:n,ariaLabel:i})=>(a(),k(Go,{key:o,icon:n,link:o,ariaLabel:i},null,8,["icon","link","ariaLabel"]))),128))]))}}),ke=b(jo,[["__scopeId","data-v-7bc22406"]]),zo={key:0,class:"group translations"},Wo={class:"trans-title"},qo={key:1,class:"group"},Ko={class:"item appearance"},Ro={class:"label"},Jo={class:"appearance-action"},Yo={key:2,class:"group"},Qo={class:"item social-links"},Xo=m({__name:"VPNavBarExtra",setup(s){const{site:e,theme:t}=P(),{localeLinks:o,currentLang:n}=R({correspondingLink:!0}),i=$(()=>o.value.length&&n.value.label||e.value.appearance||t.value.socialLinks);return(l,p)=>i.value?(a(),k(_e,{key:0,class:"VPNavBarExtra",label:"extra navigation"},{default:f(()=>[r(o).length&&r(n).label?(a(),u("div",zo,[v("p",Wo,M(r(n).label),1),(a(!0),u(w,null,B(r(o),d=>(a(),k(te,{key:d.link,item:d},null,8,["item"]))),128))])):h("",!0),r(e).appearance&&r(e).appearance!=="force-dark"&&r(e).appearance!=="force-auto"?(a(),u("div",qo,[v("div",Ko,[v("p",Ro,M(r(t).darkModeSwitchLabel||"Appearance"),1),v("div",Jo,[_(he)])])])):h("",!0),r(t).socialLinks?(a(),u("div",Yo,[v("div",Qo,[_(ke,{class:"social-links-list",links:r(t).socialLinks},null,8,["links"])])])):h("",!0)]),_:1})):h("",!0)}}),Zo=b(Xo,[["__scopeId","data-v-bb2aa2f0"]]),xo=["aria-expanded"],es=m({__name:"VPNavBarHamburger",props:{active:{type:Boolean}},emits:["click"],setup(s){return(e,t)=>(a(),u("button",{type:"button",class:N(["VPNavBarHamburger",{active:e.active}]),"aria-label":"mobile navigation","aria-expanded":e.active,"aria-controls":"VPNavScreen",onClick:t[0]||(t[0]=o=>e.$emit("click"))},t[1]||(t[1]=[v("span",{class:"container"},[v("span",{class:"top"}),v("span",{class:"middle"}),v("span",{class:"bottom"})],-1)]),10,xo))}}),ts=b(es,[["__scopeId","data-v-e5dd9c1c"]]),ns=["innerHTML"],os=m({__name:"VPNavBarMenuLink",props:{item:{}},setup(s){const{page:e}=P();return(t,o)=>(a(),k(F,{class:N({VPNavBarMenuLink:!0,active:r(W)(r(e).relativePath,t.item.activeMatch||t.item.link,!!t.item.activeMatch)}),href:t.item.link,target:t.item.target,rel:t.item.rel,"no-icon":t.item.noIcon,tabindex:"0"},{default:f(()=>[v("span",{innerHTML:t.item.text},null,8,ns)]),_:1},8,["class","href","target","rel","no-icon"]))}}),ss=b(os,[["__scopeId","data-v-e56f3d57"]]),as=m({__name:"VPNavBarMenuGroup",props:{item:{}},setup(s){const e=s,{page:t}=P(),o=i=>"component"in i?!1:"link"in i?W(t.value.relativePath,i.link,!!e.item.activeMatch):i.items.some(o),n=$(()=>o(e.item));return(i,l)=>(a(),k(_e,{class:N({VPNavBarMenuGroup:!0,active:r(W)(r(t).relativePath,i.item.activeMatch,!!i.item.activeMatch)||n.value}),button:i.item.text,items:i.item.items},null,8,["class","button","items"]))}}),rs={key:0,"aria-labelledby":"main-nav-aria-label",class:"VPNavBarMenu"},is=m({__name:"VPNavBarMenu",setup(s){const{theme:e}=P();return(t,o)=>r(e).nav?(a(),u("nav",rs,[o[0]||(o[0]=v("span",{id:"main-nav-aria-label",class:"visually-hidden"}," Main Navigation ",-1)),(a(!0),u(w,null,B(r(e).nav,n=>(a(),u(w,{key:JSON.stringify(n)},["link"in n?(a(),k(ss,{key:0,item:n},null,8,["item"])):"component"in n?(a(),k(E(n.component),U({key:1,ref_for:!0},n.props),null,16)):(a(),k(as,{key:2,item:n},null,8,["item"]))],64))),128))])):h("",!0)}}),ls=b(is,[["__scopeId","data-v-dc692963"]]);function cs(s){const{localeIndex:e,theme:t}=P();function o(n){var H,A,S;const i=n.split("."),l=(H=t.value.search)==null?void 0:H.options,p=l&&typeof l=="object",d=p&&((S=(A=l.locales)==null?void 0:A[e.value])==null?void 0:S.translations)||null,y=p&&l.translations||null;let L=d,g=y,V=s;const I=i.pop();for(const C of i){let G=null;const K=V==null?void 0:V[C];K&&(G=V=K);const ne=g==null?void 0:g[C];ne&&(G=g=ne);const oe=L==null?void 0:L[C];oe&&(G=L=oe),K||(V=G),ne||(g=G),oe||(L=G)}return(L==null?void 0:L[I])??(g==null?void 0:g[I])??(V==null?void 0:V[I])??""}return o}const us=["aria-label"],ds={class:"DocSearch-Button-Container"},vs={class:"DocSearch-Button-Placeholder"},be=m({__name:"VPNavBarSearchButton",setup(s){const t=cs({button:{buttonText:"Search",buttonAriaLabel:"Search"}});return(o,n)=>(a(),u("button",{type:"button",class:"DocSearch DocSearch-Button","aria-label":r(t)("button.buttonAriaLabel")},[v("span",ds,[n[0]||(n[0]=v("span",{class:"vp-icon DocSearch-Search-Icon"},null,-1)),v("span",vs,M(r(t)("button.buttonText")),1)]),n[1]||(n[1]=v("span",{class:"DocSearch-Button-Keys"},[v("kbd",{class:"DocSearch-Button-Key"}),v("kbd",{class:"DocSearch-Button-Key"},"K")],-1))],8,us))}}),ps={class:"VPNavBarSearch"},fs={id:"local-search"},hs={key:1,id:"docsearch"},ms=m({__name:"VPNavBarSearch",setup(s){const e=()=>null,t=()=>null,{theme:o}=P(),n=T(!1),i=T(!1);j(()=>{});function l(){n.value||(n.value=!0,setTimeout(p,16))}function p(){const L=new Event("keydown");L.key="k",L.metaKey=!0,window.dispatchEvent(L),setTimeout(()=>{document.querySelector(".DocSearch-Modal")||p()},16)}const d=T(!1),y="";return(L,g)=>{var V;return a(),u("div",ps,[r(y)==="local"?(a(),u(w,{key:0},[d.value?(a(),k(r(e),{key:0,onClose:g[0]||(g[0]=I=>d.value=!1)})):h("",!0),v("div",fs,[_(be,{onClick:g[1]||(g[1]=I=>d.value=!0)})])],64)):r(y)==="algolia"?(a(),u(w,{key:1},[n.value?(a(),k(r(t),{key:0,algolia:((V=r(o).search)==null?void 0:V.options)??r(o).algolia,onVnodeBeforeMount:g[2]||(g[2]=I=>i.value=!0)},null,8,["algolia"])):h("",!0),i.value?h("",!0):(a(),u("div",hs,[_(be,{onClick:l})]))],64)):h("",!0)])}}}),_s=m({__name:"VPNavBarSocialLinks",setup(s){const{theme:e}=P();return(t,o)=>r(e).socialLinks?(a(),k(ke,{key:0,class:"VPNavBarSocialLinks",links:r(e).socialLinks},null,8,["links"])):h("",!0)}}),ks=b(_s,[["__scopeId","data-v-0394ad82"]]),bs=["href","rel","target"],gs=["innerHTML"],$s={key:2},ys=m({__name:"VPNavBarTitle",setup(s){const{site:e,theme:t}=P(),{hasSidebar:o}=O(),{currentLang:n}=R(),i=$(()=>{var d;return typeof t.value.logoLink=="string"?t.value.logoLink:(d=t.value.logoLink)==null?void 0:d.link}),l=$(()=>{var d;return typeof t.value.logoLink=="string"||(d=t.value.logoLink)==null?void 0:d.rel}),p=$(()=>{var d;return typeof t.value.logoLink=="string"||(d=t.value.logoLink)==null?void 0:d.target});return(d,y)=>(a(),u("div",{class:N(["VPNavBarTitle",{"has-sidebar":r(o)}])},[v("a",{class:"title",href:i.value??r(pe)(r(n).link),rel:l.value,target:p.value},[c(d.$slots,"nav-bar-title-before",{},void 0,!0),r(t).logo?(a(),k(Y,{key:0,class:"logo",image:r(t).logo},null,8,["image"])):h("",!0),r(t).siteTitle?(a(),u("span",{key:1,innerHTML:r(t).siteTitle},null,8,gs)):r(t).siteTitle===void 0?(a(),u("span",$s,M(r(e).title),1)):h("",!0),c(d.$slots,"nav-bar-title-after",{},void 0,!0)],8,bs)],2))}}),Ps=b(ys,[["__scopeId","data-v-1168a8e4"]]),Ls={class:"items"},Vs={class:"title"},Ss=m({__name:"VPNavBarTranslations",setup(s){const{theme:e}=P(),{localeLinks:t,currentLang:o}=R({correspondingLink:!0});return(n,i)=>r(t).length&&r(o).label?(a(),k(_e,{key:0,class:"VPNavBarTranslations",icon:"vpi-languages",label:r(e).langMenuLabel||"Change language"},{default:f(()=>[v("div",Ls,[v("p",Vs,M(r(o).label),1),(a(!0),u(w,null,B(r(t),l=>(a(),k(te,{key:l.link,item:l},null,8,["item"]))),128))])]),_:1},8,["label"])):h("",!0)}}),Ts=b(Ss,[["__scopeId","data-v-88af2de4"]]),Ns={class:"wrapper"},Ms={class:"container"},Is={class:"title"},ws={class:"content"},Hs={class:"content-body"},As=m({__name:"VPNavBar",props:{isScreenOpen:{type:Boolean}},emits:["toggle-screen"],setup(s){const e=s,{y:t}=Le(),{hasSidebar:o}=O(),{frontmatter:n}=P(),i=T({});return ve(()=>{i.value={"has-sidebar":o.value,home:n.value.layout==="home",top:t.value===0,"screen-open":e.isScreenOpen}}),(l,p)=>(a(),u("div",{class:N(["VPNavBar",i.value])},[v("div",Ns,[v("div",Ms,[v("div",Is,[_(Ps,null,{"nav-bar-title-before":f(()=>[c(l.$slots,"nav-bar-title-before",{},void 0,!0)]),"nav-bar-title-after":f(()=>[c(l.$slots,"nav-bar-title-after",{},void 0,!0)]),_:3})]),v("div",ws,[v("div",Hs,[c(l.$slots,"nav-bar-content-before",{},void 0,!0),_(ms,{class:"search"}),_(ls,{class:"menu"}),_(Ts,{class:"translations"}),_(_o,{class:"appearance"}),_(ks,{class:"social-links"}),_(Zo,{class:"extra"}),c(l.$slots,"nav-bar-content-after",{},void 0,!0),_(ts,{class:"hamburger",active:l.isScreenOpen,onClick:p[0]||(p[0]=d=>l.$emit("toggle-screen"))},null,8,["active"])])])])]),p[1]||(p[1]=v("div",{class:"divider"},[v("div",{class:"divider-line"})],-1))],2))}}),Bs=b(As,[["__scopeId","data-v-6aa21345"]]),Cs={key:0,class:"VPNavScreenAppearance"},Es={class:"text"},Fs=m({__name:"VPNavScreenAppearance",setup(s){const{site:e,theme:t}=P();return(o,n)=>r(e).appearance&&r(e).appearance!=="force-dark"&&r(e).appearance!=="force-auto"?(a(),u("div",Cs,[v("p",Es,M(r(t).darkModeSwitchLabel||"Appearance"),1),_(he)])):h("",!0)}}),Ds=b(Fs,[["__scopeId","data-v-b44890b2"]]),Os=["innerHTML"],Gs=m({__name:"VPNavScreenMenuLink",props:{item:{}},setup(s){const e=x("close-screen");return(t,o)=>(a(),k(F,{class:"VPNavScreenMenuLink",href:t.item.link,target:t.item.target,rel:t.item.rel,"no-icon":t.item.noIcon,onClick:r(e)},{default:f(()=>[v("span",{innerHTML:t.item.text},null,8,Os)]),_:1},8,["href","target","rel","no-icon","onClick"]))}}),Us=b(Gs,[["__scopeId","data-v-df37e6dd"]]),js=["innerHTML"],zs=m({__name:"VPNavScreenMenuGroupLink",props:{item:{}},setup(s){const e=x("close-screen");return(t,o)=>(a(),k(F,{class:"VPNavScreenMenuGroupLink",href:t.item.link,target:t.item.target,rel:t.item.rel,"no-icon":t.item.noIcon,onClick:r(e)},{default:f(()=>[v("span",{innerHTML:t.item.text},null,8,js)]),_:1},8,["href","target","rel","no-icon","onClick"]))}}),He=b(zs,[["__scopeId","data-v-3e9c20e4"]]),Ws={class:"VPNavScreenMenuGroupSection"},qs={key:0,class:"title"},Ks=m({__name:"VPNavScreenMenuGroupSection",props:{text:{},items:{}},setup(s){return(e,t)=>(a(),u("div",Ws,[e.text?(a(),u("p",qs,M(e.text),1)):h("",!0),(a(!0),u(w,null,B(e.items,o=>(a(),k(He,{key:o.text,item:o},null,8,["item"]))),128))]))}}),Rs=b(Ks,[["__scopeId","data-v-8133b170"]]),Js=["aria-controls","aria-expanded"],Ys=["innerHTML"],Qs=["id"],Xs={key:0,class:"item"},Zs={key:1,class:"item"},xs={key:2,class:"group"},ea=m({__name:"VPNavScreenMenuGroup",props:{text:{},items:{}},setup(s){const e=s,t=T(!1),o=$(()=>`NavScreenGroup-${e.text.replace(" ","-").toLowerCase()}`);function n(){t.value=!t.value}return(i,l)=>(a(),u("div",{class:N(["VPNavScreenMenuGroup",{open:t.value}])},[v("button",{class:"button","aria-controls":o.value,"aria-expanded":t.value,onClick:n},[v("span",{class:"button-text",innerHTML:i.text},null,8,Ys),l[0]||(l[0]=v("span",{class:"vpi-plus button-icon"},null,-1))],8,Js),v("div",{id:o.value,class:"items"},[(a(!0),u(w,null,B(i.items,p=>(a(),u(w,{key:JSON.stringify(p)},["link"in p?(a(),u("div",Xs,[_(He,{item:p},null,8,["item"])])):"component"in p?(a(),u("div",Zs,[(a(),k(E(p.component),U({ref_for:!0},p.props,{"screen-menu":""}),null,16))])):(a(),u("div",xs,[_(Rs,{text:p.text,items:p.items},null,8,["text","items"])]))],64))),128))],8,Qs)],2))}}),ta=b(ea,[["__scopeId","data-v-b9ab8c58"]]),na={key:0,class:"VPNavScreenMenu"},oa=m({__name:"VPNavScreenMenu",setup(s){const{theme:e}=P();return(t,o)=>r(e).nav?(a(),u("nav",na,[(a(!0),u(w,null,B(r(e).nav,n=>(a(),u(w,{key:JSON.stringify(n)},["link"in n?(a(),k(Us,{key:0,item:n},null,8,["item"])):"component"in n?(a(),k(E(n.component),U({key:1,ref_for:!0},n.props,{"screen-menu":""}),null,16)):(a(),k(ta,{key:2,text:n.text||"",items:n.items},null,8,["text","items"]))],64))),128))])):h("",!0)}}),sa=m({__name:"VPNavScreenSocialLinks",setup(s){const{theme:e}=P();return(t,o)=>r(e).socialLinks?(a(),k(ke,{key:0,class:"VPNavScreenSocialLinks",links:r(e).socialLinks},null,8,["links"])):h("",!0)}}),aa={class:"list"},ra=m({__name:"VPNavScreenTranslations",setup(s){const{localeLinks:e,currentLang:t}=R({correspondingLink:!0}),o=T(!1);function n(){o.value=!o.value}return(i,l)=>r(e).length&&r(t).label?(a(),u("div",{key:0,class:N(["VPNavScreenTranslations",{open:o.value}])},[v("button",{class:"title",onClick:n},[l[0]||(l[0]=v("span",{class:"vpi-languages icon lang"},null,-1)),z(" "+M(r(t).label)+" ",1),l[1]||(l[1]=v("span",{class:"vpi-chevron-down icon chevron"},null,-1))]),v("ul",aa,[(a(!0),u(w,null,B(r(e),p=>(a(),u("li",{key:p.link,class:"item"},[_(F,{class:"link",href:p.link},{default:f(()=>[z(M(p.text),1)]),_:2},1032,["href"])]))),128))])],2)):h("",!0)}}),ia=b(ra,[["__scopeId","data-v-858fe1a4"]]),la={class:"container"},ca=m({__name:"VPNavScreen",props:{open:{type:Boolean}},setup(s){const e=T(null),t=Ve(ee?document.body:null);return(o,n)=>(a(),k(ce,{name:"fade",onEnter:n[0]||(n[0]=i=>t.value=!0),onAfterLeave:n[1]||(n[1]=i=>t.value=!1)},{default:f(()=>[o.open?(a(),u("div",{key:0,class:"VPNavScreen",ref_key:"screen",ref:e,id:"VPNavScreen"},[v("div",la,[c(o.$slots,"nav-screen-content-before",{},void 0,!0),_(oa,{class:"menu"}),_(ia,{class:"translations"}),_(Ds,{class:"appearance"}),_(sa,{class:"social-links"}),c(o.$slots,"nav-screen-content-after",{},void 0,!0)])],512)):h("",!0)]),_:3}))}}),ua=b(ca,[["__scopeId","data-v-f2779853"]]),da={key:0,class:"VPNav"},va=m({__name:"VPNav",setup(s){const{isScreenOpen:e,closeScreen:t,toggleScreen:o}=ro(),{frontmatter:n}=P(),i=$(()=>n.value.navbar!==!1);return Se("close-screen",t),Q(()=>{ee&&document.documentElement.classList.toggle("hide-nav",!i.value)}),(l,p)=>i.value?(a(),u("header",da,[_(Bs,{"is-screen-open":r(e),onToggleScreen:r(o)},{"nav-bar-title-before":f(()=>[c(l.$slots,"nav-bar-title-before",{},void 0,!0)]),"nav-bar-title-after":f(()=>[c(l.$slots,"nav-bar-title-after",{},void 0,!0)]),"nav-bar-content-before":f(()=>[c(l.$slots,"nav-bar-content-before",{},void 0,!0)]),"nav-bar-content-after":f(()=>[c(l.$slots,"nav-bar-content-after",{},void 0,!0)]),_:3},8,["is-screen-open","onToggleScreen"]),_(ua,{open:r(e)},{"nav-screen-content-before":f(()=>[c(l.$slots,"nav-screen-content-before",{},void 0,!0)]),"nav-screen-content-after":f(()=>[c(l.$slots,"nav-screen-content-after",{},void 0,!0)]),_:3},8,["open"])])):h("",!0)}}),pa=b(va,[["__scopeId","data-v-ae24b3ad"]]),fa=["role","tabindex"],ha={key:1,class:"items"},ma=m({__name:"VPSidebarItem",props:{item:{},depth:{}},setup(s){const e=s,{collapsed:t,collapsible:o,isLink:n,isActiveLink:i,hasActiveLink:l,hasChildren:p,toggle:d}=ct($(()=>e.item)),y=$(()=>p.value?"section":"div"),L=$(()=>n.value?"a":"div"),g=$(()=>p.value?e.depth+2===7?"p":`h${e.depth+2}`:"p"),V=$(()=>n.value?void 0:"button"),I=$(()=>[[`level-${e.depth}`],{collapsible:o.value},{collapsed:t.value},{"is-link":n.value},{"is-active":i.value},{"has-active":l.value}]);function H(S){"key"in S&&S.key!=="Enter"||!e.item.link&&d()}function A(){e.item.link&&d()}return(S,C)=>{const G=q("VPSidebarItem",!0);return a(),k(E(y.value),{class:N(["VPSidebarItem",I.value])},{default:f(()=>[S.item.text?(a(),u("div",U({key:0,class:"item",role:V.value},Ue(S.item.items?{click:H,keydown:H}:{},!0),{tabindex:S.item.items&&0}),[C[1]||(C[1]=v("div",{class:"indicator"},null,-1)),S.item.link?(a(),k(F,{key:0,tag:L.value,class:"link",href:S.item.link,rel:S.item.rel,target:S.item.target},{default:f(()=>[(a(),k(E(g.value),{class:"text",innerHTML:S.item.text},null,8,["innerHTML"]))]),_:1},8,["tag","href","rel","target"])):(a(),k(E(g.value),{key:1,class:"text",innerHTML:S.item.text},null,8,["innerHTML"])),S.item.collapsed!=null&&S.item.items&&S.item.items.length?(a(),u("div",{key:2,class:"caret",role:"button","aria-label":"toggle section",onClick:A,onKeydown:je(A,["enter"]),tabindex:"0"},C[0]||(C[0]=[v("span",{class:"vpi-chevron-right caret-icon"},null,-1)]),32)):h("",!0)],16,fa)):h("",!0),S.item.items&&S.item.items.length?(a(),u("div",ha,[S.depth<5?(a(!0),u(w,{key:0},B(S.item.items,K=>(a(),k(G,{key:K.text,item:K,depth:S.depth+1},null,8,["item","depth"]))),128)):h("",!0)])):h("",!0)]),_:1},8,["class"])}}}),_a=b(ma,[["__scopeId","data-v-b3fd67f8"]]),ka=m({__name:"VPSidebarGroup",props:{items:{}},setup(s){const e=T(!0);let t=null;return j(()=>{t=setTimeout(()=>{t=null,e.value=!1},300)}),ze(()=>{t!=null&&(clearTimeout(t),t=null)}),(o,n)=>(a(!0),u(w,null,B(o.items,i=>(a(),u("div",{key:i.text,class:N(["group",{"no-transition":e.value}])},[_(_a,{item:i,depth:0},null,8,["item"])],2))),128))}}),ba=b(ka,[["__scopeId","data-v-c40bc020"]]),ga={class:"nav",id:"VPSidebarNav","aria-labelledby":"sidebar-aria-label",tabindex:"-1"},$a=m({__name:"VPSidebar",props:{open:{type:Boolean}},setup(s){const{sidebarGroups:e,hasSidebar:t}=O(),o=s,n=T(null),i=Ve(ee?document.body:null);D([o,n],()=>{var p;o.open?(i.value=!0,(p=n.value)==null||p.focus()):i.value=!1},{immediate:!0,flush:"post"});const l=T(0);return D(e,()=>{l.value+=1},{deep:!0}),(p,d)=>r(t)?(a(),u("aside",{key:0,class:N(["VPSidebar",{open:p.open}]),ref_key:"navEl",ref:n,onClick:d[0]||(d[0]=We(()=>{},["stop"]))},[d[2]||(d[2]=v("div",{class:"curtain"},null,-1)),v("nav",ga,[d[1]||(d[1]=v("span",{class:"visually-hidden",id:"sidebar-aria-label"}," Sidebar Navigation ",-1)),c(p.$slots,"sidebar-nav-before",{},void 0,!0),(a(),k(ba,{items:r(e),key:l.value},null,8,["items"])),c(p.$slots,"sidebar-nav-after",{},void 0,!0)])],2)):h("",!0)}}),ya=b($a,[["__scopeId","data-v-319d5ca6"]]),Pa=m({__name:"VPSkipLink",setup(s){const{theme:e}=P(),t=Z(),o=T();D(()=>t.path,()=>o.value.focus());function n({target:i}){const l=document.getElementById(decodeURIComponent(i.hash).slice(1));if(l){const p=()=>{l.removeAttribute("tabindex"),l.removeEventListener("blur",p)};l.setAttribute("tabindex","-1"),l.addEventListener("blur",p),l.focus(),window.scrollTo(0,0)}}return(i,l)=>(a(),u(w,null,[v("span",{ref_key:"backToTop",ref:o,tabindex:"-1"},null,512),v("a",{href:"#VPContent",class:"VPSkipLink visually-hidden",onClick:n},M(r(e).skipToContentLabel||"Skip to content"),1)],64))}}),La=b(Pa,[["__scopeId","data-v-0b0ada53"]]),Va=m({__name:"Layout",setup(s){const{isOpen:e,open:t,close:o}=O(),n=Z();D(()=>n.path,o),lt(e,o);const{frontmatter:i}=P(),l=qe(),p=$(()=>!!l["home-hero-image"]);return Se("hero-image-slot-exists",p),(d,y)=>{const L=q("Content");return r(i).layout!==!1?(a(),u("div",{key:0,class:N(["Layout",r(i).pageClass])},[c(d.$slots,"layout-top",{},void 0,!0),_(La),_(Ye,{class:"backdrop",show:r(e),onClick:r(o)},null,8,["show","onClick"]),_(pa,null,{"nav-bar-title-before":f(()=>[c(d.$slots,"nav-bar-title-before",{},void 0,!0)]),"nav-bar-title-after":f(()=>[c(d.$slots,"nav-bar-title-after",{},void 0,!0)]),"nav-bar-content-before":f(()=>[c(d.$slots,"nav-bar-content-before",{},void 0,!0)]),"nav-bar-content-after":f(()=>[c(d.$slots,"nav-bar-content-after",{},void 0,!0)]),"nav-screen-content-before":f(()=>[c(d.$slots,"nav-screen-content-before",{},void 0,!0)]),"nav-screen-content-after":f(()=>[c(d.$slots,"nav-screen-content-after",{},void 0,!0)]),_:3}),_(ao,{open:r(e),onOpenMenu:r(t)},null,8,["open","onOpenMenu"]),_(ya,{open:r(e)},{"sidebar-nav-before":f(()=>[c(d.$slots,"sidebar-nav-before",{},void 0,!0)]),"sidebar-nav-after":f(()=>[c(d.$slots,"sidebar-nav-after",{},void 0,!0)]),_:3},8,["open"]),_(zn,null,{"page-top":f(()=>[c(d.$slots,"page-top",{},void 0,!0)]),"page-bottom":f(()=>[c(d.$slots,"page-bottom",{},void 0,!0)]),"not-found":f(()=>[c(d.$slots,"not-found",{},void 0,!0)]),"home-hero-before":f(()=>[c(d.$slots,"home-hero-before",{},void 0,!0)]),"home-hero-info-before":f(()=>[c(d.$slots,"home-hero-info-before",{},void 0,!0)]),"home-hero-info":f(()=>[c(d.$slots,"home-hero-info",{},void 0,!0)]),"home-hero-info-after":f(()=>[c(d.$slots,"home-hero-info-after",{},void 0,!0)]),"home-hero-actions-after":f(()=>[c(d.$slots,"home-hero-actions-after",{},void 0,!0)]),"home-hero-image":f(()=>[c(d.$slots,"home-hero-image",{},void 0,!0)]),"home-hero-after":f(()=>[c(d.$slots,"home-hero-after",{},void 0,!0)]),"home-features-before":f(()=>[c(d.$slots,"home-features-before",{},void 0,!0)]),"home-features-after":f(()=>[c(d.$slots,"home-features-after",{},void 0,!0)]),"doc-footer-before":f(()=>[c(d.$slots,"doc-footer-before",{},void 0,!0)]),"doc-before":f(()=>[c(d.$slots,"doc-before",{},void 0,!0)]),"doc-after":f(()=>[c(d.$slots,"doc-after",{},void 0,!0)]),"doc-top":f(()=>[c(d.$slots,"doc-top",{},void 0,!0)]),"doc-bottom":f(()=>[c(d.$slots,"doc-bottom",{},void 0,!0)]),"aside-top":f(()=>[c(d.$slots,"aside-top",{},void 0,!0)]),"aside-bottom":f(()=>[c(d.$slots,"aside-bottom",{},void 0,!0)]),"aside-outline-before":f(()=>[c(d.$slots,"aside-outline-before",{},void 0,!0)]),"aside-outline-after":f(()=>[c(d.$slots,"aside-outline-after",{},void 0,!0)]),"aside-ads-before":f(()=>[c(d.$slots,"aside-ads-before",{},void 0,!0)]),"aside-ads-after":f(()=>[c(d.$slots,"aside-ads-after",{},void 0,!0)]),_:3}),_(Jn),c(d.$slots,"layout-bottom",{},void 0,!0)],2)):(a(),k(L,{key:1}))}}}),Sa=b(Va,[["__scopeId","data-v-5d98c3a5"]]),Na={Layout:Sa,enhanceApp:({app:s})=>{s.component("Badge",Ke)}};export{Na as t}; +import { + d as m, + c as u, + r as c, + n as N, + o as a, + a as z, + t as M, + b as k, + w as f, + T as ce, + e as h, + _ as b, + u as Ae, + i as Be, + f as Ce, + g as ue, + h as $, + j as v, + k as r, + l as W, + m as ae, + p as T, + q as D, + s as Q, + v as j, + x as de, + y as ve, + z as Ee, + A as Fe, + F as w, + B, + C as q, + D as ge, + E as X, + G as _, + H as E, + I as $e, + J as Z, + K as U, + L as x, + M as De, + N as ye, + O as Oe, + P as Pe, + Q as Le, + R as ee, + S as Ge, + U as Ve, + V as Se, + W as Ue, + X as je, + Y as ze, + Z as We, + $ as qe, +} from "./framework.WowTybjF.js"; +const Ke = m({ + __name: "VPBadge", + props: { text: {}, type: { default: "tip" } }, + setup(s) { + return (e, t) => ( + a(), + u( + "span", + { class: N(["VPBadge", e.type]) }, + [c(e.$slots, "default", {}, () => [z(M(e.text), 1)])], + 2, + ) + ); + }, + }), + Re = { key: 0, class: "VPBackdrop" }, + Je = m({ + __name: "VPBackdrop", + props: { show: { type: Boolean } }, + setup(s) { + return (e, t) => ( + a(), + k( + ce, + { name: "fade" }, + { + default: f(() => [e.show ? (a(), u("div", Re)) : h("", !0)]), + _: 1, + }, + ) + ); + }, + }), + Ye = b(Je, [["__scopeId", "data-v-c79a1216"]]), + P = Ae; +function Qe(s, e) { + let t, + o = !1; + return () => { + t && clearTimeout(t), + o + ? (t = setTimeout(s, e)) + : (s(), (o = !0) && setTimeout(() => (o = !1), e)); + }; +} +function re(s) { + return s.startsWith("/") ? s : `/${s}`; +} +function pe(s) { + const { + pathname: e, + search: t, + hash: o, + protocol: n, + } = new URL(s, "http://a.com"); + if (Be(s) || s.startsWith("#") || !n.startsWith("http") || !Ce(e)) return s; + const { site: i } = P(), + l = + e.endsWith("/") || e.endsWith(".html") + ? s + : s.replace( + /(?:(^\.+)\/)?.*$/, + `$1${e.replace(/(\.md)?$/, i.value.cleanUrls ? "" : ".html")}${t}${o}`, + ); + return ue(l); +} +function R({ correspondingLink: s = !1 } = {}) { + const { site: e, localeIndex: t, page: o, theme: n, hash: i } = P(), + l = $(() => { + var d, y; + return { + label: (d = e.value.locales[t.value]) == null ? void 0 : d.label, + link: + ((y = e.value.locales[t.value]) == null ? void 0 : y.link) || + (t.value === "root" ? "/" : `/${t.value}/`), + }; + }); + return { + localeLinks: $(() => + Object.entries(e.value.locales).flatMap(([d, y]) => + l.value.label === y.label + ? [] + : { + text: y.label, + link: + Xe( + y.link || (d === "root" ? "/" : `/${d}/`), + n.value.i18nRouting !== !1 && s, + o.value.relativePath.slice(l.value.link.length - 1), + !e.value.cleanUrls, + ) + i.value, + }, + ), + ), + currentLang: l, + }; +} +function Xe(s, e, t, o) { + return e + ? s.replace(/\/$/, "") + + re( + t + .replace(/(^|\/)index\.md$/, "$1") + .replace(/\.md$/, o ? ".html" : ""), + ) + : s; +} +const Ze = { class: "NotFound" }, + xe = { class: "code" }, + et = { class: "title" }, + tt = { class: "quote" }, + nt = { class: "action" }, + ot = ["href", "aria-label"], + st = m({ + __name: "NotFound", + setup(s) { + const { theme: e } = P(), + { currentLang: t } = R(); + return (o, n) => { + var i, l, p, d, y; + return ( + a(), + u("div", Ze, [ + v( + "p", + xe, + M(((i = r(e).notFound) == null ? void 0 : i.code) ?? "404"), + 1, + ), + v( + "h1", + et, + M( + ((l = r(e).notFound) == null ? void 0 : l.title) ?? + "PAGE NOT FOUND", + ), + 1, + ), + n[0] || (n[0] = v("div", { class: "divider" }, null, -1)), + v( + "blockquote", + tt, + M( + ((p = r(e).notFound) == null ? void 0 : p.quote) ?? + "But if you don't change your direction, and if you keep looking, you may end up where you are heading.", + ), + 1, + ), + v("div", nt, [ + v( + "a", + { + class: "link", + href: r(ue)(r(t).link), + "aria-label": + ((d = r(e).notFound) == null ? void 0 : d.linkLabel) ?? + "go to home", + }, + M( + ((y = r(e).notFound) == null ? void 0 : y.linkText) ?? + "Take me home", + ), + 9, + ot, + ), + ]), + ]) + ); + }; + }, + }), + at = b(st, [["__scopeId", "data-v-d6be1790"]]); +function Te(s, e) { + if (Array.isArray(s)) return J(s); + if (s == null) return []; + e = re(e); + const t = Object.keys(s) + .sort((n, i) => i.split("/").length - n.split("/").length) + .find((n) => e.startsWith(re(n))), + o = t ? s[t] : []; + return Array.isArray(o) ? J(o) : J(o.items, o.base); +} +function rt(s) { + const e = []; + let t = 0; + for (const o in s) { + const n = s[o]; + if (n.items) { + t = e.push(n); + continue; + } + e[t] || e.push({ items: [] }), e[t].items.push(n); + } + return e; +} +function it(s) { + const e = []; + function t(o) { + for (const n of o) + n.text && + n.link && + e.push({ text: n.text, link: n.link, docFooterText: n.docFooterText }), + n.items && t(n.items); + } + return t(s), e; +} +function ie(s, e) { + return Array.isArray(e) + ? e.some((t) => ie(s, t)) + : W(s, e.link) + ? !0 + : e.items + ? ie(s, e.items) + : !1; +} +function J(s, e) { + return [...s].map((t) => { + const o = { ...t }, + n = o.base || e; + return ( + n && o.link && (o.link = n + o.link), + o.items && (o.items = J(o.items, n)), + o + ); + }); +} +function O() { + const { frontmatter: s, page: e, theme: t } = P(), + o = ae("(min-width: 960px)"), + n = T(!1), + i = $(() => { + const A = t.value.sidebar, + S = e.value.relativePath; + return A ? Te(A, S) : []; + }), + l = T(i.value); + D(i, (A, S) => { + JSON.stringify(A) !== JSON.stringify(S) && (l.value = i.value); + }); + const p = $( + () => + s.value.sidebar !== !1 && + l.value.length > 0 && + s.value.layout !== "home", + ), + d = $(() => + y + ? s.value.aside == null + ? t.value.aside === "left" + : s.value.aside === "left" + : !1, + ), + y = $(() => + s.value.layout === "home" + ? !1 + : s.value.aside != null + ? !!s.value.aside + : t.value.aside !== !1, + ), + L = $(() => p.value && o.value), + g = $(() => (p.value ? rt(l.value) : [])); + function V() { + n.value = !0; + } + function I() { + n.value = !1; + } + function H() { + n.value ? I() : V(); + } + return { + isOpen: n, + sidebar: l, + sidebarGroups: g, + hasSidebar: p, + hasAside: y, + leftAside: d, + isSidebarEnabled: L, + open: V, + close: I, + toggle: H, + }; +} +function lt(s, e) { + let t; + Q(() => { + t = s.value ? document.activeElement : void 0; + }), + j(() => { + window.addEventListener("keyup", o); + }), + de(() => { + window.removeEventListener("keyup", o); + }); + function o(n) { + n.key === "Escape" && s.value && (e(), t == null || t.focus()); + } +} +function ct(s) { + const { page: e, hash: t } = P(), + o = T(!1), + n = $(() => s.value.collapsed != null), + i = $(() => !!s.value.link), + l = T(!1), + p = () => { + l.value = W(e.value.relativePath, s.value.link); + }; + D([e, s, t], p), j(p); + const d = $(() => + l.value + ? !0 + : s.value.items + ? ie(e.value.relativePath, s.value.items) + : !1, + ), + y = $(() => !!(s.value.items && s.value.items.length)); + Q(() => { + o.value = !!(n.value && s.value.collapsed); + }), + ve(() => { + (l.value || d.value) && (o.value = !1); + }); + function L() { + n.value && (o.value = !o.value); + } + return { + collapsed: o, + collapsible: n, + isLink: i, + isActiveLink: l, + hasActiveLink: d, + hasChildren: y, + toggle: L, + }; +} +function ut() { + const { hasSidebar: s } = O(), + e = ae("(min-width: 960px)"), + t = ae("(min-width: 1280px)"); + return { + isAsideEnabled: $(() => + !t.value && !e.value ? !1 : s.value ? t.value : e.value, + ), + }; +} +const dt = /\b(?:VPBadge|header-anchor|footnote-ref|ignore-header)\b/, + le = []; +function Ne(s) { + return ( + (typeof s.outline == "object" && + !Array.isArray(s.outline) && + s.outline.label) || + s.outlineTitle || + "On this page" + ); +} +function fe(s) { + const e = [...document.querySelectorAll(".VPDoc :where(h1,h2,h3,h4,h5,h6)")] + .filter((t) => t.id && t.hasChildNodes()) + .map((t) => { + const o = Number(t.tagName[1]); + return { element: t, title: vt(t), link: "#" + t.id, level: o }; + }); + return pt(e, s); +} +function vt(s) { + let e = ""; + for (const t of s.childNodes) + if (t.nodeType === 1) { + if (dt.test(t.className)) continue; + e += t.textContent; + } else t.nodeType === 3 && (e += t.textContent); + return e.trim(); +} +function pt(s, e) { + if (e === !1) return []; + const t = (typeof e == "object" && !Array.isArray(e) ? e.level : e) || 2, + [o, n] = typeof t == "number" ? [t, t] : t === "deep" ? [2, 6] : t; + return mt(s, o, n); +} +function ft(s, e) { + const { isAsideEnabled: t } = ut(), + o = Qe(i, 100); + let n = null; + j(() => { + requestAnimationFrame(i), window.addEventListener("scroll", o); + }), + Ee(() => { + l(location.hash); + }), + de(() => { + window.removeEventListener("scroll", o); + }); + function i() { + if (!t.value) return; + const p = window.scrollY, + d = window.innerHeight, + y = document.body.offsetHeight, + L = Math.abs(p + d - y) < 1, + g = le + .map(({ element: I, link: H }) => ({ link: H, top: ht(I) })) + .filter(({ top: I }) => !Number.isNaN(I)) + .sort((I, H) => I.top - H.top); + if (!g.length) { + l(null); + return; + } + if (p < 1) { + l(null); + return; + } + if (L) { + l(g[g.length - 1].link); + return; + } + let V = null; + for (const { link: I, top: H } of g) { + if (H > p + Fe() + 4) break; + V = I; + } + l(V); + } + function l(p) { + n && n.classList.remove("active"), + p == null + ? (n = null) + : (n = s.value.querySelector(`a[href="${decodeURIComponent(p)}"]`)); + const d = n; + d + ? (d.classList.add("active"), + (e.value.style.top = d.offsetTop + 39 + "px"), + (e.value.style.opacity = "1")) + : ((e.value.style.top = "33px"), (e.value.style.opacity = "0")); + } +} +function ht(s) { + let e = 0; + for (; s !== document.body; ) { + if (s === null) return NaN; + (e += s.offsetTop), (s = s.offsetParent); + } + return e; +} +function mt(s, e, t) { + le.length = 0; + const o = [], + n = []; + return ( + s.forEach((i) => { + const l = { ...i, children: [] }; + let p = n[n.length - 1]; + for (; p && p.level >= l.level; ) n.pop(), (p = n[n.length - 1]); + if ( + l.element.classList.contains("ignore-header") || + (p && "shouldIgnore" in p) + ) { + n.push({ level: l.level, shouldIgnore: !0 }); + return; + } + l.level > t || + l.level < e || + (le.push({ element: l.element, link: l.link }), + p ? p.children.push(l) : o.push(l), + n.push(l)); + }), + o + ); +} +const _t = ["href", "title"], + kt = m({ + __name: "VPDocOutlineItem", + props: { headers: {}, root: { type: Boolean } }, + setup(s) { + function e({ target: t }) { + const o = t.href.split("#")[1], + n = document.getElementById(decodeURIComponent(o)); + n == null || n.focus({ preventScroll: !0 }); + } + return (t, o) => { + const n = q("VPDocOutlineItem", !0); + return ( + a(), + u( + "ul", + { class: N(["VPDocOutlineItem", t.root ? "root" : "nested"]) }, + [ + (a(!0), + u( + w, + null, + B( + t.headers, + ({ children: i, link: l, title: p }) => ( + a(), + u("li", null, [ + v( + "a", + { + class: "outline-link", + href: l, + onClick: e, + title: p, + }, + M(p), + 9, + _t, + ), + i != null && i.length + ? (a(), + k(n, { key: 0, headers: i }, null, 8, ["headers"])) + : h("", !0), + ]) + ), + ), + 256, + )), + ], + 2, + ) + ); + }; + }, + }), + Me = b(kt, [["__scopeId", "data-v-b933a997"]]), + bt = { class: "content" }, + gt = { + "aria-level": "2", + class: "outline-title", + id: "doc-outline-aria-label", + role: "heading", + }, + $t = m({ + __name: "VPDocAsideOutline", + setup(s) { + const { frontmatter: e, theme: t } = P(), + o = ge([]); + X(() => { + o.value = fe(e.value.outline ?? t.value.outline); + }); + const n = T(), + i = T(); + return ( + ft(n, i), + (l, p) => ( + a(), + u( + "nav", + { + "aria-labelledby": "doc-outline-aria-label", + class: N([ + "VPDocAsideOutline", + { "has-outline": o.value.length > 0 }, + ]), + ref_key: "container", + ref: n, + }, + [ + v("div", bt, [ + v( + "div", + { class: "outline-marker", ref_key: "marker", ref: i }, + null, + 512, + ), + v("div", gt, M(r(Ne)(r(t))), 1), + _(Me, { headers: o.value, root: !0 }, null, 8, ["headers"]), + ]), + ], + 2, + ) + ) + ); + }, + }), + yt = b($t, [["__scopeId", "data-v-a5bbad30"]]), + Pt = { class: "VPDocAsideCarbonAds" }, + Lt = m({ + __name: "VPDocAsideCarbonAds", + props: { carbonAds: {} }, + setup(s) { + const e = () => null; + return (t, o) => ( + a(), + u("div", Pt, [ + _(r(e), { "carbon-ads": t.carbonAds }, null, 8, ["carbon-ads"]), + ]) + ); + }, + }), + Vt = { class: "VPDocAside" }, + St = m({ + __name: "VPDocAside", + setup(s) { + const { theme: e } = P(); + return (t, o) => ( + a(), + u("div", Vt, [ + c(t.$slots, "aside-top", {}, void 0, !0), + c(t.$slots, "aside-outline-before", {}, void 0, !0), + _(yt), + c(t.$slots, "aside-outline-after", {}, void 0, !0), + o[0] || (o[0] = v("div", { class: "spacer" }, null, -1)), + c(t.$slots, "aside-ads-before", {}, void 0, !0), + r(e).carbonAds + ? (a(), + k(Lt, { key: 0, "carbon-ads": r(e).carbonAds }, null, 8, [ + "carbon-ads", + ])) + : h("", !0), + c(t.$slots, "aside-ads-after", {}, void 0, !0), + c(t.$slots, "aside-bottom", {}, void 0, !0), + ]) + ); + }, + }), + Tt = b(St, [["__scopeId", "data-v-3f215769"]]); +function Nt() { + const { theme: s, page: e } = P(); + return $(() => { + const { text: t = "Edit this page", pattern: o = "" } = + s.value.editLink || {}; + let n; + return ( + typeof o == "function" + ? (n = o(e.value)) + : (n = o.replace(/:path/g, e.value.filePath)), + { url: n, text: t } + ); + }); +} +function Mt() { + const { page: s, theme: e, frontmatter: t } = P(); + return $(() => { + var y, L, g, V, I, H, A, S; + const o = Te(e.value.sidebar, s.value.relativePath), + n = it(o), + i = It(n, (C) => C.link.replace(/[?#].*$/, "")), + l = i.findIndex((C) => W(s.value.relativePath, C.link)), + p = + (((y = e.value.docFooter) == null ? void 0 : y.prev) === !1 && + !t.value.prev) || + t.value.prev === !1, + d = + (((L = e.value.docFooter) == null ? void 0 : L.next) === !1 && + !t.value.next) || + t.value.next === !1; + return { + prev: p + ? void 0 + : { + text: + (typeof t.value.prev == "string" + ? t.value.prev + : typeof t.value.prev == "object" + ? t.value.prev.text + : void 0) ?? + ((g = i[l - 1]) == null ? void 0 : g.docFooterText) ?? + ((V = i[l - 1]) == null ? void 0 : V.text), + link: + (typeof t.value.prev == "object" ? t.value.prev.link : void 0) ?? + ((I = i[l - 1]) == null ? void 0 : I.link), + }, + next: d + ? void 0 + : { + text: + (typeof t.value.next == "string" + ? t.value.next + : typeof t.value.next == "object" + ? t.value.next.text + : void 0) ?? + ((H = i[l + 1]) == null ? void 0 : H.docFooterText) ?? + ((A = i[l + 1]) == null ? void 0 : A.text), + link: + (typeof t.value.next == "object" ? t.value.next.link : void 0) ?? + ((S = i[l + 1]) == null ? void 0 : S.link), + }, + }; + }); +} +function It(s, e) { + const t = new Set(); + return s.filter((o) => { + const n = e(o); + return t.has(n) ? !1 : t.add(n); + }); +} +const F = m({ + __name: "VPLink", + props: { + tag: {}, + href: {}, + noIcon: { type: Boolean }, + target: {}, + rel: {}, + }, + setup(s) { + const e = s, + t = $(() => e.tag ?? (e.href ? "a" : "span")), + o = $(() => (e.href && $e.test(e.href)) || e.target === "_blank"); + return (n, i) => ( + a(), + k( + E(t.value), + { + class: N([ + "VPLink", + { + link: n.href, + "vp-external-link-icon": o.value, + "no-icon": n.noIcon, + }, + ]), + href: n.href ? r(pe)(n.href) : void 0, + target: n.target ?? (o.value ? "_blank" : void 0), + rel: n.rel ?? (o.value ? "noreferrer" : void 0), + }, + { default: f(() => [c(n.$slots, "default")]), _: 3 }, + 8, + ["class", "href", "target", "rel"], + ) + ); + }, + }), + wt = { class: "VPLastUpdated" }, + Ht = ["datetime"], + At = m({ + __name: "VPDocFooterLastUpdated", + setup(s) { + const { theme: e, page: t, lang: o } = P(), + n = $(() => new Date(t.value.lastUpdated)), + i = $(() => n.value.toISOString()), + l = T(""); + return ( + j(() => { + Q(() => { + var p, d, y; + l.value = new Intl.DateTimeFormat( + (d = + (p = e.value.lastUpdated) == null ? void 0 : p.formatOptions) != + null && d.forceLocale + ? o.value + : void 0, + ((y = e.value.lastUpdated) == null + ? void 0 + : y.formatOptions) ?? { + dateStyle: "short", + timeStyle: "short", + }, + ).format(n.value); + }); + }), + (p, d) => { + var y; + return ( + a(), + u("p", wt, [ + z( + M( + ((y = r(e).lastUpdated) == null ? void 0 : y.text) || + r(e).lastUpdatedText || + "Last updated", + ) + ": ", + 1, + ), + v("time", { datetime: i.value }, M(l.value), 9, Ht), + ]) + ); + } + ); + }, + }), + Bt = b(At, [["__scopeId", "data-v-e98dd255"]]), + Ct = { key: 0, class: "VPDocFooter" }, + Et = { key: 0, class: "edit-info" }, + Ft = { key: 0, class: "edit-link" }, + Dt = { key: 1, class: "last-updated" }, + Ot = { + key: 1, + class: "prev-next", + "aria-labelledby": "doc-footer-aria-label", + }, + Gt = { class: "pager" }, + Ut = ["innerHTML"], + jt = ["innerHTML"], + zt = { class: "pager" }, + Wt = ["innerHTML"], + qt = ["innerHTML"], + Kt = m({ + __name: "VPDocFooter", + setup(s) { + const { theme: e, page: t, frontmatter: o } = P(), + n = Nt(), + i = Mt(), + l = $(() => e.value.editLink && o.value.editLink !== !1), + p = $(() => t.value.lastUpdated), + d = $(() => l.value || p.value || i.value.prev || i.value.next); + return (y, L) => { + var g, V, I, H; + return d.value + ? (a(), + u("footer", Ct, [ + c(y.$slots, "doc-footer-before", {}, void 0, !0), + l.value || p.value + ? (a(), + u("div", Et, [ + l.value + ? (a(), + u("div", Ft, [ + _( + F, + { + class: "edit-link-button", + href: r(n).url, + "no-icon": !0, + }, + { + default: f(() => [ + L[0] || + (L[0] = v( + "span", + { class: "vpi-square-pen edit-link-icon" }, + null, + -1, + )), + z(" " + M(r(n).text), 1), + ]), + _: 1, + __: [0], + }, + 8, + ["href"], + ), + ])) + : h("", !0), + p.value ? (a(), u("div", Dt, [_(Bt)])) : h("", !0), + ])) + : h("", !0), + ((g = r(i).prev) != null && g.link) || + ((V = r(i).next) != null && V.link) + ? (a(), + u("nav", Ot, [ + L[1] || + (L[1] = v( + "span", + { + class: "visually-hidden", + id: "doc-footer-aria-label", + }, + "Pager", + -1, + )), + v("div", Gt, [ + (I = r(i).prev) != null && I.link + ? (a(), + k( + F, + { + key: 0, + class: "pager-link prev", + href: r(i).prev.link, + }, + { + default: f(() => { + var A; + return [ + v( + "span", + { + class: "desc", + innerHTML: + ((A = r(e).docFooter) == null + ? void 0 + : A.prev) || "Previous page", + }, + null, + 8, + Ut, + ), + v( + "span", + { + class: "title", + innerHTML: r(i).prev.text, + }, + null, + 8, + jt, + ), + ]; + }), + _: 1, + }, + 8, + ["href"], + )) + : h("", !0), + ]), + v("div", zt, [ + (H = r(i).next) != null && H.link + ? (a(), + k( + F, + { + key: 0, + class: "pager-link next", + href: r(i).next.link, + }, + { + default: f(() => { + var A; + return [ + v( + "span", + { + class: "desc", + innerHTML: + ((A = r(e).docFooter) == null + ? void 0 + : A.next) || "Next page", + }, + null, + 8, + Wt, + ), + v( + "span", + { + class: "title", + innerHTML: r(i).next.text, + }, + null, + 8, + qt, + ), + ]; + }), + _: 1, + }, + 8, + ["href"], + )) + : h("", !0), + ]), + ])) + : h("", !0), + ])) + : h("", !0); + }; + }, + }), + Rt = b(Kt, [["__scopeId", "data-v-e257564d"]]), + Jt = { class: "container" }, + Yt = { class: "aside-container" }, + Qt = { class: "aside-content" }, + Xt = { class: "content" }, + Zt = { class: "content-container" }, + xt = { class: "main" }, + en = m({ + __name: "VPDoc", + setup(s) { + const { theme: e } = P(), + t = Z(), + { hasSidebar: o, hasAside: n, leftAside: i } = O(), + l = $(() => t.path.replace(/[./]+/g, "_").replace(/_html$/, "")); + return (p, d) => { + const y = q("Content"); + return ( + a(), + u( + "div", + { class: N(["VPDoc", { "has-sidebar": r(o), "has-aside": r(n) }]) }, + [ + c(p.$slots, "doc-top", {}, void 0, !0), + v("div", Jt, [ + r(n) + ? (a(), + u( + "div", + { key: 0, class: N(["aside", { "left-aside": r(i) }]) }, + [ + d[0] || + (d[0] = v( + "div", + { class: "aside-curtain" }, + null, + -1, + )), + v("div", Yt, [ + v("div", Qt, [ + _(Tt, null, { + "aside-top": f(() => [ + c(p.$slots, "aside-top", {}, void 0, !0), + ]), + "aside-bottom": f(() => [ + c(p.$slots, "aside-bottom", {}, void 0, !0), + ]), + "aside-outline-before": f(() => [ + c( + p.$slots, + "aside-outline-before", + {}, + void 0, + !0, + ), + ]), + "aside-outline-after": f(() => [ + c( + p.$slots, + "aside-outline-after", + {}, + void 0, + !0, + ), + ]), + "aside-ads-before": f(() => [ + c(p.$slots, "aside-ads-before", {}, void 0, !0), + ]), + "aside-ads-after": f(() => [ + c(p.$slots, "aside-ads-after", {}, void 0, !0), + ]), + _: 3, + }), + ]), + ]), + ], + 2, + )) + : h("", !0), + v("div", Xt, [ + v("div", Zt, [ + c(p.$slots, "doc-before", {}, void 0, !0), + v("main", xt, [ + _( + y, + { + class: N([ + "vp-doc", + [ + l.value, + r(e).externalLinkIcon && + "external-link-icon-enabled", + ], + ]), + }, + null, + 8, + ["class"], + ), + ]), + _(Rt, null, { + "doc-footer-before": f(() => [ + c(p.$slots, "doc-footer-before", {}, void 0, !0), + ]), + _: 3, + }), + c(p.$slots, "doc-after", {}, void 0, !0), + ]), + ]), + ]), + c(p.$slots, "doc-bottom", {}, void 0, !0), + ], + 2, + ) + ); + }; + }, + }), + tn = b(en, [["__scopeId", "data-v-39a288b8"]]), + nn = m({ + __name: "VPButton", + props: { + tag: {}, + size: { default: "medium" }, + theme: { default: "brand" }, + text: {}, + href: {}, + target: {}, + rel: {}, + }, + setup(s) { + const e = s, + t = $(() => e.href && $e.test(e.href)), + o = $(() => e.tag || (e.href ? "a" : "button")); + return (n, i) => ( + a(), + k( + E(o.value), + { + class: N(["VPButton", [n.size, n.theme]]), + href: n.href ? r(pe)(n.href) : void 0, + target: e.target ?? (t.value ? "_blank" : void 0), + rel: e.rel ?? (t.value ? "noreferrer" : void 0), + }, + { default: f(() => [z(M(n.text), 1)]), _: 1 }, + 8, + ["class", "href", "target", "rel"], + ) + ); + }, + }), + on = b(nn, [["__scopeId", "data-v-fa7799d5"]]), + sn = ["src", "alt"], + an = m({ + inheritAttrs: !1, + __name: "VPImage", + props: { image: {}, alt: {} }, + setup(s) { + return (e, t) => { + const o = q("VPImage", !0); + return e.image + ? (a(), + u( + w, + { key: 0 }, + [ + typeof e.image == "string" || "src" in e.image + ? (a(), + u( + "img", + U( + { key: 0, class: "VPImage" }, + typeof e.image == "string" + ? e.$attrs + : { ...e.image, ...e.$attrs }, + { + src: r(ue)( + typeof e.image == "string" ? e.image : e.image.src, + ), + alt: + e.alt ?? + (typeof e.image == "string" + ? "" + : e.image.alt || ""), + }, + ), + null, + 16, + sn, + )) + : (a(), + u( + w, + { key: 1 }, + [ + _( + o, + U( + { + class: "dark", + image: e.image.dark, + alt: e.image.alt, + }, + e.$attrs, + ), + null, + 16, + ["image", "alt"], + ), + _( + o, + U( + { + class: "light", + image: e.image.light, + alt: e.image.alt, + }, + e.$attrs, + ), + null, + 16, + ["image", "alt"], + ), + ], + 64, + )), + ], + 64, + )) + : h("", !0); + }; + }, + }), + Y = b(an, [["__scopeId", "data-v-8426fc1a"]]), + rn = { class: "container" }, + ln = { class: "main" }, + cn = { class: "heading" }, + un = ["innerHTML"], + dn = ["innerHTML"], + vn = ["innerHTML"], + pn = { key: 0, class: "actions" }, + fn = { key: 0, class: "image" }, + hn = { class: "image-container" }, + mn = m({ + __name: "VPHero", + props: { name: {}, text: {}, tagline: {}, image: {}, actions: {} }, + setup(s) { + const e = x("hero-image-slot-exists"); + return (t, o) => ( + a(), + u( + "div", + { class: N(["VPHero", { "has-image": t.image || r(e) }]) }, + [ + v("div", rn, [ + v("div", ln, [ + c(t.$slots, "home-hero-info-before", {}, void 0, !0), + c( + t.$slots, + "home-hero-info", + {}, + () => [ + v("h1", cn, [ + t.name + ? (a(), + u( + "span", + { key: 0, innerHTML: t.name, class: "name clip" }, + null, + 8, + un, + )) + : h("", !0), + t.text + ? (a(), + u( + "span", + { key: 1, innerHTML: t.text, class: "text" }, + null, + 8, + dn, + )) + : h("", !0), + ]), + t.tagline + ? (a(), + u( + "p", + { key: 0, innerHTML: t.tagline, class: "tagline" }, + null, + 8, + vn, + )) + : h("", !0), + ], + !0, + ), + c(t.$slots, "home-hero-info-after", {}, void 0, !0), + t.actions + ? (a(), + u("div", pn, [ + (a(!0), + u( + w, + null, + B( + t.actions, + (n) => ( + a(), + u("div", { key: n.link, class: "action" }, [ + _( + on, + { + tag: "a", + size: "medium", + theme: n.theme, + text: n.text, + href: n.link, + target: n.target, + rel: n.rel, + }, + null, + 8, + ["theme", "text", "href", "target", "rel"], + ), + ]) + ), + ), + 128, + )), + ])) + : h("", !0), + c(t.$slots, "home-hero-actions-after", {}, void 0, !0), + ]), + t.image || r(e) + ? (a(), + u("div", fn, [ + v("div", hn, [ + o[0] || + (o[0] = v("div", { class: "image-bg" }, null, -1)), + c( + t.$slots, + "home-hero-image", + {}, + () => [ + t.image + ? (a(), + k( + Y, + { key: 0, class: "image-src", image: t.image }, + null, + 8, + ["image"], + )) + : h("", !0), + ], + !0, + ), + ]), + ])) + : h("", !0), + ]), + ], + 2, + ) + ); + }, + }), + _n = b(mn, [["__scopeId", "data-v-4f9c455b"]]), + kn = m({ + __name: "VPHomeHero", + setup(s) { + const { frontmatter: e } = P(); + return (t, o) => + r(e).hero + ? (a(), + k( + _n, + { + key: 0, + class: "VPHomeHero", + name: r(e).hero.name, + text: r(e).hero.text, + tagline: r(e).hero.tagline, + image: r(e).hero.image, + actions: r(e).hero.actions, + }, + { + "home-hero-info-before": f(() => [ + c(t.$slots, "home-hero-info-before"), + ]), + "home-hero-info": f(() => [c(t.$slots, "home-hero-info")]), + "home-hero-info-after": f(() => [ + c(t.$slots, "home-hero-info-after"), + ]), + "home-hero-actions-after": f(() => [ + c(t.$slots, "home-hero-actions-after"), + ]), + "home-hero-image": f(() => [c(t.$slots, "home-hero-image")]), + _: 3, + }, + 8, + ["name", "text", "tagline", "image", "actions"], + )) + : h("", !0); + }, + }), + bn = { class: "box" }, + gn = { key: 0, class: "icon" }, + $n = ["innerHTML"], + yn = ["innerHTML"], + Pn = ["innerHTML"], + Ln = { key: 4, class: "link-text" }, + Vn = { class: "link-text-value" }, + Sn = m({ + __name: "VPFeature", + props: { + icon: {}, + title: {}, + details: {}, + link: {}, + linkText: {}, + rel: {}, + target: {}, + }, + setup(s) { + return (e, t) => ( + a(), + k( + F, + { + class: "VPFeature", + href: e.link, + rel: e.rel, + target: e.target, + "no-icon": !0, + tag: e.link ? "a" : "div", + }, + { + default: f(() => [ + v("article", bn, [ + typeof e.icon == "object" && e.icon.wrap + ? (a(), + u("div", gn, [ + _( + Y, + { + image: e.icon, + alt: e.icon.alt, + height: e.icon.height || 48, + width: e.icon.width || 48, + }, + null, + 8, + ["image", "alt", "height", "width"], + ), + ])) + : typeof e.icon == "object" + ? (a(), + k( + Y, + { + key: 1, + image: e.icon, + alt: e.icon.alt, + height: e.icon.height || 48, + width: e.icon.width || 48, + }, + null, + 8, + ["image", "alt", "height", "width"], + )) + : e.icon + ? (a(), + u( + "div", + { key: 2, class: "icon", innerHTML: e.icon }, + null, + 8, + $n, + )) + : h("", !0), + v("h2", { class: "title", innerHTML: e.title }, null, 8, yn), + e.details + ? (a(), + u( + "p", + { key: 3, class: "details", innerHTML: e.details }, + null, + 8, + Pn, + )) + : h("", !0), + e.linkText + ? (a(), + u("div", Ln, [ + v("p", Vn, [ + z(M(e.linkText) + " ", 1), + t[0] || + (t[0] = v( + "span", + { class: "vpi-arrow-right link-text-icon" }, + null, + -1, + )), + ]), + ])) + : h("", !0), + ]), + ]), + _: 1, + }, + 8, + ["href", "rel", "target", "tag"], + ) + ); + }, + }), + Tn = b(Sn, [["__scopeId", "data-v-a3976bdc"]]), + Nn = { key: 0, class: "VPFeatures" }, + Mn = { class: "container" }, + In = { class: "items" }, + wn = m({ + __name: "VPFeatures", + props: { features: {} }, + setup(s) { + const e = s, + t = $(() => { + const o = e.features.length; + if (o) { + if (o === 2) return "grid-2"; + if (o === 3) return "grid-3"; + if (o % 3 === 0) return "grid-6"; + if (o > 3) return "grid-4"; + } else return; + }); + return (o, n) => + o.features + ? (a(), + u("div", Nn, [ + v("div", Mn, [ + v("div", In, [ + (a(!0), + u( + w, + null, + B( + o.features, + (i) => ( + a(), + u( + "div", + { key: i.title, class: N(["item", [t.value]]) }, + [ + _( + Tn, + { + icon: i.icon, + title: i.title, + details: i.details, + link: i.link, + "link-text": i.linkText, + rel: i.rel, + target: i.target, + }, + null, + 8, + [ + "icon", + "title", + "details", + "link", + "link-text", + "rel", + "target", + ], + ), + ], + 2, + ) + ), + ), + 128, + )), + ]), + ]), + ])) + : h("", !0); + }, + }), + Hn = b(wn, [["__scopeId", "data-v-a6181336"]]), + An = m({ + __name: "VPHomeFeatures", + setup(s) { + const { frontmatter: e } = P(); + return (t, o) => + r(e).features + ? (a(), + k( + Hn, + { key: 0, class: "VPHomeFeatures", features: r(e).features }, + null, + 8, + ["features"], + )) + : h("", !0); + }, + }), + Bn = m({ + __name: "VPHomeContent", + setup(s) { + const { width: e } = De({ initialWidth: 0, includeScrollbar: !1 }); + return (t, o) => ( + a(), + u( + "div", + { + class: "vp-doc container", + style: ye( + r(e) ? { "--vp-offset": `calc(50% - ${r(e) / 2}px)` } : {}, + ), + }, + [c(t.$slots, "default", {}, void 0, !0)], + 4, + ) + ); + }, + }), + Cn = b(Bn, [["__scopeId", "data-v-8e2d4988"]]), + En = m({ + __name: "VPHome", + setup(s) { + const { frontmatter: e, theme: t } = P(); + return (o, n) => { + const i = q("Content"); + return ( + a(), + u( + "div", + { + class: N([ + "VPHome", + { "external-link-icon-enabled": r(t).externalLinkIcon }, + ]), + }, + [ + c(o.$slots, "home-hero-before", {}, void 0, !0), + _(kn, null, { + "home-hero-info-before": f(() => [ + c(o.$slots, "home-hero-info-before", {}, void 0, !0), + ]), + "home-hero-info": f(() => [ + c(o.$slots, "home-hero-info", {}, void 0, !0), + ]), + "home-hero-info-after": f(() => [ + c(o.$slots, "home-hero-info-after", {}, void 0, !0), + ]), + "home-hero-actions-after": f(() => [ + c(o.$slots, "home-hero-actions-after", {}, void 0, !0), + ]), + "home-hero-image": f(() => [ + c(o.$slots, "home-hero-image", {}, void 0, !0), + ]), + _: 3, + }), + c(o.$slots, "home-hero-after", {}, void 0, !0), + c(o.$slots, "home-features-before", {}, void 0, !0), + _(An), + c(o.$slots, "home-features-after", {}, void 0, !0), + r(e).markdownStyles !== !1 + ? (a(), k(Cn, { key: 0 }, { default: f(() => [_(i)]), _: 1 })) + : (a(), k(i, { key: 1 })), + ], + 2, + ) + ); + }; + }, + }), + Fn = b(En, [["__scopeId", "data-v-8b561e3d"]]), + Dn = {}, + On = { class: "VPPage" }; +function Gn(s, e) { + const t = q("Content"); + return ( + a(), + u("div", On, [c(s.$slots, "page-top"), _(t), c(s.$slots, "page-bottom")]) + ); +} +const Un = b(Dn, [["render", Gn]]), + jn = m({ + __name: "VPContent", + setup(s) { + const { page: e, frontmatter: t } = P(), + { hasSidebar: o } = O(); + return (n, i) => ( + a(), + u( + "div", + { + class: N([ + "VPContent", + { "has-sidebar": r(o), "is-home": r(t).layout === "home" }, + ]), + id: "VPContent", + }, + [ + r(e).isNotFound + ? c(n.$slots, "not-found", { key: 0 }, () => [_(at)], !0) + : r(t).layout === "page" + ? (a(), + k( + Un, + { key: 1 }, + { + "page-top": f(() => [ + c(n.$slots, "page-top", {}, void 0, !0), + ]), + "page-bottom": f(() => [ + c(n.$slots, "page-bottom", {}, void 0, !0), + ]), + _: 3, + }, + )) + : r(t).layout === "home" + ? (a(), + k( + Fn, + { key: 2 }, + { + "home-hero-before": f(() => [ + c(n.$slots, "home-hero-before", {}, void 0, !0), + ]), + "home-hero-info-before": f(() => [ + c(n.$slots, "home-hero-info-before", {}, void 0, !0), + ]), + "home-hero-info": f(() => [ + c(n.$slots, "home-hero-info", {}, void 0, !0), + ]), + "home-hero-info-after": f(() => [ + c(n.$slots, "home-hero-info-after", {}, void 0, !0), + ]), + "home-hero-actions-after": f(() => [ + c( + n.$slots, + "home-hero-actions-after", + {}, + void 0, + !0, + ), + ]), + "home-hero-image": f(() => [ + c(n.$slots, "home-hero-image", {}, void 0, !0), + ]), + "home-hero-after": f(() => [ + c(n.$slots, "home-hero-after", {}, void 0, !0), + ]), + "home-features-before": f(() => [ + c(n.$slots, "home-features-before", {}, void 0, !0), + ]), + "home-features-after": f(() => [ + c(n.$slots, "home-features-after", {}, void 0, !0), + ]), + _: 3, + }, + )) + : r(t).layout && r(t).layout !== "doc" + ? (a(), k(E(r(t).layout), { key: 3 })) + : (a(), + k( + tn, + { key: 4 }, + { + "doc-top": f(() => [ + c(n.$slots, "doc-top", {}, void 0, !0), + ]), + "doc-bottom": f(() => [ + c(n.$slots, "doc-bottom", {}, void 0, !0), + ]), + "doc-footer-before": f(() => [ + c(n.$slots, "doc-footer-before", {}, void 0, !0), + ]), + "doc-before": f(() => [ + c(n.$slots, "doc-before", {}, void 0, !0), + ]), + "doc-after": f(() => [ + c(n.$slots, "doc-after", {}, void 0, !0), + ]), + "aside-top": f(() => [ + c(n.$slots, "aside-top", {}, void 0, !0), + ]), + "aside-outline-before": f(() => [ + c(n.$slots, "aside-outline-before", {}, void 0, !0), + ]), + "aside-outline-after": f(() => [ + c(n.$slots, "aside-outline-after", {}, void 0, !0), + ]), + "aside-ads-before": f(() => [ + c(n.$slots, "aside-ads-before", {}, void 0, !0), + ]), + "aside-ads-after": f(() => [ + c(n.$slots, "aside-ads-after", {}, void 0, !0), + ]), + "aside-bottom": f(() => [ + c(n.$slots, "aside-bottom", {}, void 0, !0), + ]), + _: 3, + }, + )), + ], + 2, + ) + ); + }, + }), + zn = b(jn, [["__scopeId", "data-v-1428d186"]]), + Wn = { class: "container" }, + qn = ["innerHTML"], + Kn = ["innerHTML"], + Rn = m({ + __name: "VPFooter", + setup(s) { + const { theme: e, frontmatter: t } = P(), + { hasSidebar: o } = O(); + return (n, i) => + r(e).footer && r(t).footer !== !1 + ? (a(), + u( + "footer", + { key: 0, class: N(["VPFooter", { "has-sidebar": r(o) }]) }, + [ + v("div", Wn, [ + r(e).footer.message + ? (a(), + u( + "p", + { + key: 0, + class: "message", + innerHTML: r(e).footer.message, + }, + null, + 8, + qn, + )) + : h("", !0), + r(e).footer.copyright + ? (a(), + u( + "p", + { + key: 1, + class: "copyright", + innerHTML: r(e).footer.copyright, + }, + null, + 8, + Kn, + )) + : h("", !0), + ]), + ], + 2, + )) + : h("", !0); + }, + }), + Jn = b(Rn, [["__scopeId", "data-v-e315a0ad"]]); +function Yn() { + const { theme: s, frontmatter: e } = P(), + t = ge([]), + o = $(() => t.value.length > 0); + return ( + X(() => { + t.value = fe(e.value.outline ?? s.value.outline); + }), + { headers: t, hasLocalNav: o } + ); +} +const Qn = { class: "menu-text" }, + Xn = { class: "header" }, + Zn = { class: "outline" }, + xn = m({ + __name: "VPLocalNavOutlineDropdown", + props: { headers: {}, navHeight: {} }, + setup(s) { + const e = s, + { theme: t } = P(), + o = T(!1), + n = T(0), + i = T(), + l = T(); + function p(g) { + var V; + ((V = i.value) != null && V.contains(g.target)) || (o.value = !1); + } + D(o, (g) => { + if (g) { + document.addEventListener("click", p); + return; + } + document.removeEventListener("click", p); + }), + Oe("Escape", () => { + o.value = !1; + }), + X(() => { + o.value = !1; + }); + function d() { + (o.value = !o.value), + (n.value = + window.innerHeight + Math.min(window.scrollY - e.navHeight, 0)); + } + function y(g) { + g.target.classList.contains("outline-link") && + (l.value && (l.value.style.transition = "none"), + Pe(() => { + o.value = !1; + })); + } + function L() { + (o.value = !1), + window.scrollTo({ top: 0, left: 0, behavior: "smooth" }); + } + return (g, V) => ( + a(), + u( + "div", + { + class: "VPLocalNavOutlineDropdown", + style: ye({ "--vp-vh": n.value + "px" }), + ref_key: "main", + ref: i, + }, + [ + g.headers.length > 0 + ? (a(), + u( + "button", + { key: 0, onClick: d, class: N({ open: o.value }) }, + [ + v("span", Qn, M(r(Ne)(r(t))), 1), + V[0] || + (V[0] = v( + "span", + { class: "vpi-chevron-right icon" }, + null, + -1, + )), + ], + 2, + )) + : (a(), + u( + "button", + { key: 1, onClick: L }, + M(r(t).returnToTopLabel || "Return to top"), + 1, + )), + _( + ce, + { name: "flyout" }, + { + default: f(() => [ + o.value + ? (a(), + u( + "div", + { + key: 0, + ref_key: "items", + ref: l, + class: "items", + onClick: y, + }, + [ + v("div", Xn, [ + v( + "a", + { class: "top-link", href: "#", onClick: L }, + M(r(t).returnToTopLabel || "Return to top"), + 1, + ), + ]), + v("div", Zn, [ + _(Me, { headers: g.headers }, null, 8, ["headers"]), + ]), + ], + 512, + )) + : h("", !0), + ]), + _: 1, + }, + ), + ], + 4, + ) + ); + }, + }), + eo = b(xn, [["__scopeId", "data-v-8a42e2b4"]]), + to = { class: "container" }, + no = ["aria-expanded"], + oo = { class: "menu-text" }, + so = m({ + __name: "VPLocalNav", + props: { open: { type: Boolean } }, + emits: ["open-menu"], + setup(s) { + const { theme: e, frontmatter: t } = P(), + { hasSidebar: o } = O(), + { headers: n } = Yn(), + { y: i } = Le(), + l = T(0); + j(() => { + l.value = parseInt( + getComputedStyle(document.documentElement).getPropertyValue( + "--vp-nav-height", + ), + ); + }), + X(() => { + n.value = fe(t.value.outline ?? e.value.outline); + }); + const p = $(() => n.value.length === 0), + d = $(() => p.value && !o.value), + y = $(() => ({ + VPLocalNav: !0, + "has-sidebar": o.value, + empty: p.value, + fixed: d.value, + })); + return (L, g) => + r(t).layout !== "home" && (!d.value || r(i) >= l.value) + ? (a(), + u( + "div", + { key: 0, class: N(y.value) }, + [ + v("div", to, [ + r(o) + ? (a(), + u( + "button", + { + key: 0, + class: "menu", + "aria-expanded": L.open, + "aria-controls": "VPSidebarNav", + onClick: g[0] || (g[0] = (V) => L.$emit("open-menu")), + }, + [ + g[1] || + (g[1] = v( + "span", + { class: "vpi-align-left menu-icon" }, + null, + -1, + )), + v("span", oo, M(r(e).sidebarMenuLabel || "Menu"), 1), + ], + 8, + no, + )) + : h("", !0), + _(eo, { headers: r(n), navHeight: l.value }, null, 8, [ + "headers", + "navHeight", + ]), + ]), + ], + 2, + )) + : h("", !0); + }, + }), + ao = b(so, [["__scopeId", "data-v-a6f0e41e"]]); +function ro() { + const s = T(!1); + function e() { + (s.value = !0), window.addEventListener("resize", n); + } + function t() { + (s.value = !1), window.removeEventListener("resize", n); + } + function o() { + s.value ? t() : e(); + } + function n() { + window.outerWidth >= 768 && t(); + } + const i = Z(); + return ( + D(() => i.path, t), + { isScreenOpen: s, openScreen: e, closeScreen: t, toggleScreen: o } + ); +} +const io = {}, + lo = { class: "VPSwitch", type: "button", role: "switch" }, + co = { class: "check" }, + uo = { key: 0, class: "icon" }; +function vo(s, e) { + return ( + a(), + u("button", lo, [ + v("span", co, [ + s.$slots.default + ? (a(), u("span", uo, [c(s.$slots, "default", {}, void 0, !0)])) + : h("", !0), + ]), + ]) + ); +} +const po = b(io, [ + ["render", vo], + ["__scopeId", "data-v-1d5665e3"], + ]), + fo = m({ + __name: "VPSwitchAppearance", + setup(s) { + const { isDark: e, theme: t } = P(), + o = x("toggle-appearance", () => { + e.value = !e.value; + }), + n = T(""); + return ( + ve(() => { + n.value = e.value + ? t.value.lightModeSwitchTitle || "Switch to light theme" + : t.value.darkModeSwitchTitle || "Switch to dark theme"; + }), + (i, l) => ( + a(), + k( + po, + { + title: n.value, + class: "VPSwitchAppearance", + "aria-checked": r(e), + onClick: r(o), + }, + { + default: f( + () => + l[0] || + (l[0] = [ + v("span", { class: "vpi-sun sun" }, null, -1), + v("span", { class: "vpi-moon moon" }, null, -1), + ]), + ), + _: 1, + __: [0], + }, + 8, + ["title", "aria-checked", "onClick"], + ) + ) + ); + }, + }), + he = b(fo, [["__scopeId", "data-v-5337faa4"]]), + ho = { key: 0, class: "VPNavBarAppearance" }, + mo = m({ + __name: "VPNavBarAppearance", + setup(s) { + const { site: e } = P(); + return (t, o) => + r(e).appearance && + r(e).appearance !== "force-dark" && + r(e).appearance !== "force-auto" + ? (a(), u("div", ho, [_(he)])) + : h("", !0); + }, + }), + _o = b(mo, [["__scopeId", "data-v-6c893767"]]), + me = T(); +let Ie = !1, + se = 0; +function ko(s) { + const e = T(!1); + if (ee) { + !Ie && bo(), se++; + const t = D(me, (o) => { + var n, i, l; + o === s.el.value || ((n = s.el.value) != null && n.contains(o)) + ? ((e.value = !0), (i = s.onFocus) == null || i.call(s)) + : ((e.value = !1), (l = s.onBlur) == null || l.call(s)); + }); + de(() => { + t(), se--, se || go(); + }); + } + return Ge(e); +} +function bo() { + document.addEventListener("focusin", we), + (Ie = !0), + (me.value = document.activeElement); +} +function go() { + document.removeEventListener("focusin", we); +} +function we() { + me.value = document.activeElement; +} +const $o = { class: "VPMenuLink" }, + yo = ["innerHTML"], + Po = m({ + __name: "VPMenuLink", + props: { item: {} }, + setup(s) { + const { page: e } = P(); + return (t, o) => ( + a(), + u("div", $o, [ + _( + F, + { + class: N({ + active: r(W)( + r(e).relativePath, + t.item.activeMatch || t.item.link, + !!t.item.activeMatch, + ), + }), + href: t.item.link, + target: t.item.target, + rel: t.item.rel, + "no-icon": t.item.noIcon, + }, + { + default: f(() => [ + v("span", { innerHTML: t.item.text }, null, 8, yo), + ]), + _: 1, + }, + 8, + ["class", "href", "target", "rel", "no-icon"], + ), + ]) + ); + }, + }), + te = b(Po, [["__scopeId", "data-v-35975db6"]]), + Lo = { class: "VPMenuGroup" }, + Vo = { key: 0, class: "title" }, + So = m({ + __name: "VPMenuGroup", + props: { text: {}, items: {} }, + setup(s) { + return (e, t) => ( + a(), + u("div", Lo, [ + e.text ? (a(), u("p", Vo, M(e.text), 1)) : h("", !0), + (a(!0), + u( + w, + null, + B( + e.items, + (o) => ( + a(), + u( + w, + null, + [ + "link" in o + ? (a(), k(te, { key: 0, item: o }, null, 8, ["item"])) + : h("", !0), + ], + 64, + ) + ), + ), + 256, + )), + ]) + ); + }, + }), + To = b(So, [["__scopeId", "data-v-69e747b5"]]), + No = { class: "VPMenu" }, + Mo = { key: 0, class: "items" }, + Io = m({ + __name: "VPMenu", + props: { items: {} }, + setup(s) { + return (e, t) => ( + a(), + u("div", No, [ + e.items + ? (a(), + u("div", Mo, [ + (a(!0), + u( + w, + null, + B( + e.items, + (o) => ( + a(), + u( + w, + { key: JSON.stringify(o) }, + [ + "link" in o + ? (a(), + k(te, { key: 0, item: o }, null, 8, ["item"])) + : "component" in o + ? (a(), + k( + E(o.component), + U({ key: 1, ref_for: !0 }, o.props), + null, + 16, + )) + : (a(), + k( + To, + { key: 2, text: o.text, items: o.items }, + null, + 8, + ["text", "items"], + )), + ], + 64, + ) + ), + ), + 128, + )), + ])) + : h("", !0), + c(e.$slots, "default", {}, void 0, !0), + ]) + ); + }, + }), + wo = b(Io, [["__scopeId", "data-v-b98bc113"]]), + Ho = ["aria-expanded", "aria-label"], + Ao = { key: 0, class: "text" }, + Bo = ["innerHTML"], + Co = { key: 1, class: "vpi-more-horizontal icon" }, + Eo = { class: "menu" }, + Fo = m({ + __name: "VPFlyout", + props: { icon: {}, button: {}, label: {}, items: {} }, + setup(s) { + const e = T(!1), + t = T(); + ko({ el: t, onBlur: o }); + function o() { + e.value = !1; + } + return (n, i) => ( + a(), + u( + "div", + { + class: "VPFlyout", + ref_key: "el", + ref: t, + onMouseenter: i[1] || (i[1] = (l) => (e.value = !0)), + onMouseleave: i[2] || (i[2] = (l) => (e.value = !1)), + }, + [ + v( + "button", + { + type: "button", + class: "button", + "aria-haspopup": "true", + "aria-expanded": e.value, + "aria-label": n.label, + onClick: i[0] || (i[0] = (l) => (e.value = !e.value)), + }, + [ + n.button || n.icon + ? (a(), + u("span", Ao, [ + n.icon + ? (a(), + u( + "span", + { key: 0, class: N([n.icon, "option-icon"]) }, + null, + 2, + )) + : h("", !0), + n.button + ? (a(), + u( + "span", + { key: 1, innerHTML: n.button }, + null, + 8, + Bo, + )) + : h("", !0), + i[3] || + (i[3] = v( + "span", + { class: "vpi-chevron-down text-icon" }, + null, + -1, + )), + ])) + : (a(), u("span", Co)), + ], + 8, + Ho, + ), + v("div", Eo, [ + _( + wo, + { items: n.items }, + { + default: f(() => [c(n.$slots, "default", {}, void 0, !0)]), + _: 3, + }, + 8, + ["items"], + ), + ]), + ], + 544, + ) + ); + }, + }), + _e = b(Fo, [["__scopeId", "data-v-cf11d7a2"]]), + Do = ["href", "aria-label", "innerHTML"], + Oo = m({ + __name: "VPSocialLink", + props: { icon: {}, link: {}, ariaLabel: {} }, + setup(s) { + const e = s, + t = T(); + j(async () => { + var i; + await Pe(); + const n = (i = t.value) == null ? void 0 : i.children[0]; + n instanceof HTMLElement && + n.className.startsWith("vpi-social-") && + (getComputedStyle(n).maskImage || + getComputedStyle(n).webkitMaskImage) === "none" && + n.style.setProperty( + "--icon", + `url('https://api.iconify.design/simple-icons/${e.icon}.svg')`, + ); + }); + const o = $(() => + typeof e.icon == "object" + ? e.icon.svg + : ``, + ); + return (n, i) => ( + a(), + u( + "a", + { + ref_key: "el", + ref: t, + class: "VPSocialLink no-icon", + href: n.link, + "aria-label": + n.ariaLabel ?? (typeof n.icon == "string" ? n.icon : ""), + target: "_blank", + rel: "noopener", + innerHTML: o.value, + }, + null, + 8, + Do, + ) + ); + }, + }), + Go = b(Oo, [["__scopeId", "data-v-bd121fe5"]]), + Uo = { class: "VPSocialLinks" }, + jo = m({ + __name: "VPSocialLinks", + props: { links: {} }, + setup(s) { + return (e, t) => ( + a(), + u("div", Uo, [ + (a(!0), + u( + w, + null, + B( + e.links, + ({ link: o, icon: n, ariaLabel: i }) => ( + a(), + k(Go, { key: o, icon: n, link: o, ariaLabel: i }, null, 8, [ + "icon", + "link", + "ariaLabel", + ]) + ), + ), + 128, + )), + ]) + ); + }, + }), + ke = b(jo, [["__scopeId", "data-v-7bc22406"]]), + zo = { key: 0, class: "group translations" }, + Wo = { class: "trans-title" }, + qo = { key: 1, class: "group" }, + Ko = { class: "item appearance" }, + Ro = { class: "label" }, + Jo = { class: "appearance-action" }, + Yo = { key: 2, class: "group" }, + Qo = { class: "item social-links" }, + Xo = m({ + __name: "VPNavBarExtra", + setup(s) { + const { site: e, theme: t } = P(), + { localeLinks: o, currentLang: n } = R({ correspondingLink: !0 }), + i = $( + () => + (o.value.length && n.value.label) || + e.value.appearance || + t.value.socialLinks, + ); + return (l, p) => + i.value + ? (a(), + k( + _e, + { key: 0, class: "VPNavBarExtra", label: "extra navigation" }, + { + default: f(() => [ + r(o).length && r(n).label + ? (a(), + u("div", zo, [ + v("p", Wo, M(r(n).label), 1), + (a(!0), + u( + w, + null, + B( + r(o), + (d) => ( + a(), + k(te, { key: d.link, item: d }, null, 8, ["item"]) + ), + ), + 128, + )), + ])) + : h("", !0), + r(e).appearance && + r(e).appearance !== "force-dark" && + r(e).appearance !== "force-auto" + ? (a(), + u("div", qo, [ + v("div", Ko, [ + v( + "p", + Ro, + M(r(t).darkModeSwitchLabel || "Appearance"), + 1, + ), + v("div", Jo, [_(he)]), + ]), + ])) + : h("", !0), + r(t).socialLinks + ? (a(), + u("div", Yo, [ + v("div", Qo, [ + _( + ke, + { + class: "social-links-list", + links: r(t).socialLinks, + }, + null, + 8, + ["links"], + ), + ]), + ])) + : h("", !0), + ]), + _: 1, + }, + )) + : h("", !0); + }, + }), + Zo = b(Xo, [["__scopeId", "data-v-bb2aa2f0"]]), + xo = ["aria-expanded"], + es = m({ + __name: "VPNavBarHamburger", + props: { active: { type: Boolean } }, + emits: ["click"], + setup(s) { + return (e, t) => ( + a(), + u( + "button", + { + type: "button", + class: N(["VPNavBarHamburger", { active: e.active }]), + "aria-label": "mobile navigation", + "aria-expanded": e.active, + "aria-controls": "VPNavScreen", + onClick: t[0] || (t[0] = (o) => e.$emit("click")), + }, + t[1] || + (t[1] = [ + v( + "span", + { class: "container" }, + [ + v("span", { class: "top" }), + v("span", { class: "middle" }), + v("span", { class: "bottom" }), + ], + -1, + ), + ]), + 10, + xo, + ) + ); + }, + }), + ts = b(es, [["__scopeId", "data-v-e5dd9c1c"]]), + ns = ["innerHTML"], + os = m({ + __name: "VPNavBarMenuLink", + props: { item: {} }, + setup(s) { + const { page: e } = P(); + return (t, o) => ( + a(), + k( + F, + { + class: N({ + VPNavBarMenuLink: !0, + active: r(W)( + r(e).relativePath, + t.item.activeMatch || t.item.link, + !!t.item.activeMatch, + ), + }), + href: t.item.link, + target: t.item.target, + rel: t.item.rel, + "no-icon": t.item.noIcon, + tabindex: "0", + }, + { + default: f(() => [ + v("span", { innerHTML: t.item.text }, null, 8, ns), + ]), + _: 1, + }, + 8, + ["class", "href", "target", "rel", "no-icon"], + ) + ); + }, + }), + ss = b(os, [["__scopeId", "data-v-e56f3d57"]]), + as = m({ + __name: "VPNavBarMenuGroup", + props: { item: {} }, + setup(s) { + const e = s, + { page: t } = P(), + o = (i) => + "component" in i + ? !1 + : "link" in i + ? W(t.value.relativePath, i.link, !!e.item.activeMatch) + : i.items.some(o), + n = $(() => o(e.item)); + return (i, l) => ( + a(), + k( + _e, + { + class: N({ + VPNavBarMenuGroup: !0, + active: + r(W)( + r(t).relativePath, + i.item.activeMatch, + !!i.item.activeMatch, + ) || n.value, + }), + button: i.item.text, + items: i.item.items, + }, + null, + 8, + ["class", "button", "items"], + ) + ); + }, + }), + rs = { + key: 0, + "aria-labelledby": "main-nav-aria-label", + class: "VPNavBarMenu", + }, + is = m({ + __name: "VPNavBarMenu", + setup(s) { + const { theme: e } = P(); + return (t, o) => + r(e).nav + ? (a(), + u("nav", rs, [ + o[0] || + (o[0] = v( + "span", + { id: "main-nav-aria-label", class: "visually-hidden" }, + " Main Navigation ", + -1, + )), + (a(!0), + u( + w, + null, + B( + r(e).nav, + (n) => ( + a(), + u( + w, + { key: JSON.stringify(n) }, + [ + "link" in n + ? (a(), k(ss, { key: 0, item: n }, null, 8, ["item"])) + : "component" in n + ? (a(), + k( + E(n.component), + U({ key: 1, ref_for: !0 }, n.props), + null, + 16, + )) + : (a(), + k(as, { key: 2, item: n }, null, 8, ["item"])), + ], + 64, + ) + ), + ), + 128, + )), + ])) + : h("", !0); + }, + }), + ls = b(is, [["__scopeId", "data-v-dc692963"]]); +function cs(s) { + const { localeIndex: e, theme: t } = P(); + function o(n) { + var H, A, S; + const i = n.split("."), + l = (H = t.value.search) == null ? void 0 : H.options, + p = l && typeof l == "object", + d = + (p && + ((S = (A = l.locales) == null ? void 0 : A[e.value]) == null + ? void 0 + : S.translations)) || + null, + y = (p && l.translations) || null; + let L = d, + g = y, + V = s; + const I = i.pop(); + for (const C of i) { + let G = null; + const K = V == null ? void 0 : V[C]; + K && (G = V = K); + const ne = g == null ? void 0 : g[C]; + ne && (G = g = ne); + const oe = L == null ? void 0 : L[C]; + oe && (G = L = oe), K || (V = G), ne || (g = G), oe || (L = G); + } + return ( + (L == null ? void 0 : L[I]) ?? + (g == null ? void 0 : g[I]) ?? + (V == null ? void 0 : V[I]) ?? + "" + ); + } + return o; +} +const us = ["aria-label"], + ds = { class: "DocSearch-Button-Container" }, + vs = { class: "DocSearch-Button-Placeholder" }, + be = m({ + __name: "VPNavBarSearchButton", + setup(s) { + const t = cs({ + button: { buttonText: "Search", buttonAriaLabel: "Search" }, + }); + return (o, n) => ( + a(), + u( + "button", + { + type: "button", + class: "DocSearch DocSearch-Button", + "aria-label": r(t)("button.buttonAriaLabel"), + }, + [ + v("span", ds, [ + n[0] || + (n[0] = v( + "span", + { class: "vp-icon DocSearch-Search-Icon" }, + null, + -1, + )), + v("span", vs, M(r(t)("button.buttonText")), 1), + ]), + n[1] || + (n[1] = v( + "span", + { class: "DocSearch-Button-Keys" }, + [ + v("kbd", { class: "DocSearch-Button-Key" }), + v("kbd", { class: "DocSearch-Button-Key" }, "K"), + ], + -1, + )), + ], + 8, + us, + ) + ); + }, + }), + ps = { class: "VPNavBarSearch" }, + fs = { id: "local-search" }, + hs = { key: 1, id: "docsearch" }, + ms = m({ + __name: "VPNavBarSearch", + setup(s) { + const e = () => null, + t = () => null, + { theme: o } = P(), + n = T(!1), + i = T(!1); + j(() => {}); + function l() { + n.value || ((n.value = !0), setTimeout(p, 16)); + } + function p() { + const L = new Event("keydown"); + (L.key = "k"), + (L.metaKey = !0), + window.dispatchEvent(L), + setTimeout(() => { + document.querySelector(".DocSearch-Modal") || p(); + }, 16); + } + const d = T(!1), + y = ""; + return (L, g) => { + var V; + return ( + a(), + u("div", ps, [ + r(y) === "local" + ? (a(), + u( + w, + { key: 0 }, + [ + d.value + ? (a(), + k(r(e), { + key: 0, + onClose: g[0] || (g[0] = (I) => (d.value = !1)), + })) + : h("", !0), + v("div", fs, [ + _(be, { + onClick: g[1] || (g[1] = (I) => (d.value = !0)), + }), + ]), + ], + 64, + )) + : r(y) === "algolia" + ? (a(), + u( + w, + { key: 1 }, + [ + n.value + ? (a(), + k( + r(t), + { + key: 0, + algolia: + ((V = r(o).search) == null + ? void 0 + : V.options) ?? r(o).algolia, + onVnodeBeforeMount: + g[2] || (g[2] = (I) => (i.value = !0)), + }, + null, + 8, + ["algolia"], + )) + : h("", !0), + i.value + ? h("", !0) + : (a(), u("div", hs, [_(be, { onClick: l })])), + ], + 64, + )) + : h("", !0), + ]) + ); + }; + }, + }), + _s = m({ + __name: "VPNavBarSocialLinks", + setup(s) { + const { theme: e } = P(); + return (t, o) => + r(e).socialLinks + ? (a(), + k( + ke, + { key: 0, class: "VPNavBarSocialLinks", links: r(e).socialLinks }, + null, + 8, + ["links"], + )) + : h("", !0); + }, + }), + ks = b(_s, [["__scopeId", "data-v-0394ad82"]]), + bs = ["href", "rel", "target"], + gs = ["innerHTML"], + $s = { key: 2 }, + ys = m({ + __name: "VPNavBarTitle", + setup(s) { + const { site: e, theme: t } = P(), + { hasSidebar: o } = O(), + { currentLang: n } = R(), + i = $(() => { + var d; + return typeof t.value.logoLink == "string" + ? t.value.logoLink + : (d = t.value.logoLink) == null + ? void 0 + : d.link; + }), + l = $(() => { + var d; + return typeof t.value.logoLink == "string" || + (d = t.value.logoLink) == null + ? void 0 + : d.rel; + }), + p = $(() => { + var d; + return typeof t.value.logoLink == "string" || + (d = t.value.logoLink) == null + ? void 0 + : d.target; + }); + return (d, y) => ( + a(), + u( + "div", + { class: N(["VPNavBarTitle", { "has-sidebar": r(o) }]) }, + [ + v( + "a", + { + class: "title", + href: i.value ?? r(pe)(r(n).link), + rel: l.value, + target: p.value, + }, + [ + c(d.$slots, "nav-bar-title-before", {}, void 0, !0), + r(t).logo + ? (a(), + k(Y, { key: 0, class: "logo", image: r(t).logo }, null, 8, [ + "image", + ])) + : h("", !0), + r(t).siteTitle + ? (a(), + u( + "span", + { key: 1, innerHTML: r(t).siteTitle }, + null, + 8, + gs, + )) + : r(t).siteTitle === void 0 + ? (a(), u("span", $s, M(r(e).title), 1)) + : h("", !0), + c(d.$slots, "nav-bar-title-after", {}, void 0, !0), + ], + 8, + bs, + ), + ], + 2, + ) + ); + }, + }), + Ps = b(ys, [["__scopeId", "data-v-1168a8e4"]]), + Ls = { class: "items" }, + Vs = { class: "title" }, + Ss = m({ + __name: "VPNavBarTranslations", + setup(s) { + const { theme: e } = P(), + { localeLinks: t, currentLang: o } = R({ correspondingLink: !0 }); + return (n, i) => + r(t).length && r(o).label + ? (a(), + k( + _e, + { + key: 0, + class: "VPNavBarTranslations", + icon: "vpi-languages", + label: r(e).langMenuLabel || "Change language", + }, + { + default: f(() => [ + v("div", Ls, [ + v("p", Vs, M(r(o).label), 1), + (a(!0), + u( + w, + null, + B( + r(t), + (l) => ( + a(), + k(te, { key: l.link, item: l }, null, 8, ["item"]) + ), + ), + 128, + )), + ]), + ]), + _: 1, + }, + 8, + ["label"], + )) + : h("", !0); + }, + }), + Ts = b(Ss, [["__scopeId", "data-v-88af2de4"]]), + Ns = { class: "wrapper" }, + Ms = { class: "container" }, + Is = { class: "title" }, + ws = { class: "content" }, + Hs = { class: "content-body" }, + As = m({ + __name: "VPNavBar", + props: { isScreenOpen: { type: Boolean } }, + emits: ["toggle-screen"], + setup(s) { + const e = s, + { y: t } = Le(), + { hasSidebar: o } = O(), + { frontmatter: n } = P(), + i = T({}); + return ( + ve(() => { + i.value = { + "has-sidebar": o.value, + home: n.value.layout === "home", + top: t.value === 0, + "screen-open": e.isScreenOpen, + }; + }), + (l, p) => ( + a(), + u( + "div", + { class: N(["VPNavBar", i.value]) }, + [ + v("div", Ns, [ + v("div", Ms, [ + v("div", Is, [ + _(Ps, null, { + "nav-bar-title-before": f(() => [ + c(l.$slots, "nav-bar-title-before", {}, void 0, !0), + ]), + "nav-bar-title-after": f(() => [ + c(l.$slots, "nav-bar-title-after", {}, void 0, !0), + ]), + _: 3, + }), + ]), + v("div", ws, [ + v("div", Hs, [ + c(l.$slots, "nav-bar-content-before", {}, void 0, !0), + _(ms, { class: "search" }), + _(ls, { class: "menu" }), + _(Ts, { class: "translations" }), + _(_o, { class: "appearance" }), + _(ks, { class: "social-links" }), + _(Zo, { class: "extra" }), + c(l.$slots, "nav-bar-content-after", {}, void 0, !0), + _( + ts, + { + class: "hamburger", + active: l.isScreenOpen, + onClick: + p[0] || (p[0] = (d) => l.$emit("toggle-screen")), + }, + null, + 8, + ["active"], + ), + ]), + ]), + ]), + ]), + p[1] || + (p[1] = v( + "div", + { class: "divider" }, + [v("div", { class: "divider-line" })], + -1, + )), + ], + 2, + ) + ) + ); + }, + }), + Bs = b(As, [["__scopeId", "data-v-6aa21345"]]), + Cs = { key: 0, class: "VPNavScreenAppearance" }, + Es = { class: "text" }, + Fs = m({ + __name: "VPNavScreenAppearance", + setup(s) { + const { site: e, theme: t } = P(); + return (o, n) => + r(e).appearance && + r(e).appearance !== "force-dark" && + r(e).appearance !== "force-auto" + ? (a(), + u("div", Cs, [ + v("p", Es, M(r(t).darkModeSwitchLabel || "Appearance"), 1), + _(he), + ])) + : h("", !0); + }, + }), + Ds = b(Fs, [["__scopeId", "data-v-b44890b2"]]), + Os = ["innerHTML"], + Gs = m({ + __name: "VPNavScreenMenuLink", + props: { item: {} }, + setup(s) { + const e = x("close-screen"); + return (t, o) => ( + a(), + k( + F, + { + class: "VPNavScreenMenuLink", + href: t.item.link, + target: t.item.target, + rel: t.item.rel, + "no-icon": t.item.noIcon, + onClick: r(e), + }, + { + default: f(() => [ + v("span", { innerHTML: t.item.text }, null, 8, Os), + ]), + _: 1, + }, + 8, + ["href", "target", "rel", "no-icon", "onClick"], + ) + ); + }, + }), + Us = b(Gs, [["__scopeId", "data-v-df37e6dd"]]), + js = ["innerHTML"], + zs = m({ + __name: "VPNavScreenMenuGroupLink", + props: { item: {} }, + setup(s) { + const e = x("close-screen"); + return (t, o) => ( + a(), + k( + F, + { + class: "VPNavScreenMenuGroupLink", + href: t.item.link, + target: t.item.target, + rel: t.item.rel, + "no-icon": t.item.noIcon, + onClick: r(e), + }, + { + default: f(() => [ + v("span", { innerHTML: t.item.text }, null, 8, js), + ]), + _: 1, + }, + 8, + ["href", "target", "rel", "no-icon", "onClick"], + ) + ); + }, + }), + He = b(zs, [["__scopeId", "data-v-3e9c20e4"]]), + Ws = { class: "VPNavScreenMenuGroupSection" }, + qs = { key: 0, class: "title" }, + Ks = m({ + __name: "VPNavScreenMenuGroupSection", + props: { text: {}, items: {} }, + setup(s) { + return (e, t) => ( + a(), + u("div", Ws, [ + e.text ? (a(), u("p", qs, M(e.text), 1)) : h("", !0), + (a(!0), + u( + w, + null, + B( + e.items, + (o) => (a(), k(He, { key: o.text, item: o }, null, 8, ["item"])), + ), + 128, + )), + ]) + ); + }, + }), + Rs = b(Ks, [["__scopeId", "data-v-8133b170"]]), + Js = ["aria-controls", "aria-expanded"], + Ys = ["innerHTML"], + Qs = ["id"], + Xs = { key: 0, class: "item" }, + Zs = { key: 1, class: "item" }, + xs = { key: 2, class: "group" }, + ea = m({ + __name: "VPNavScreenMenuGroup", + props: { text: {}, items: {} }, + setup(s) { + const e = s, + t = T(!1), + o = $(() => `NavScreenGroup-${e.text.replace(" ", "-").toLowerCase()}`); + function n() { + t.value = !t.value; + } + return (i, l) => ( + a(), + u( + "div", + { class: N(["VPNavScreenMenuGroup", { open: t.value }]) }, + [ + v( + "button", + { + class: "button", + "aria-controls": o.value, + "aria-expanded": t.value, + onClick: n, + }, + [ + v( + "span", + { class: "button-text", innerHTML: i.text }, + null, + 8, + Ys, + ), + l[0] || + (l[0] = v( + "span", + { class: "vpi-plus button-icon" }, + null, + -1, + )), + ], + 8, + Js, + ), + v( + "div", + { id: o.value, class: "items" }, + [ + (a(!0), + u( + w, + null, + B( + i.items, + (p) => ( + a(), + u( + w, + { key: JSON.stringify(p) }, + [ + "link" in p + ? (a(), + u("div", Xs, [ + _(He, { item: p }, null, 8, ["item"]), + ])) + : "component" in p + ? (a(), + u("div", Zs, [ + (a(), + k( + E(p.component), + U({ ref_for: !0 }, p.props, { + "screen-menu": "", + }), + null, + 16, + )), + ])) + : (a(), + u("div", xs, [ + _( + Rs, + { text: p.text, items: p.items }, + null, + 8, + ["text", "items"], + ), + ])), + ], + 64, + ) + ), + ), + 128, + )), + ], + 8, + Qs, + ), + ], + 2, + ) + ); + }, + }), + ta = b(ea, [["__scopeId", "data-v-b9ab8c58"]]), + na = { key: 0, class: "VPNavScreenMenu" }, + oa = m({ + __name: "VPNavScreenMenu", + setup(s) { + const { theme: e } = P(); + return (t, o) => + r(e).nav + ? (a(), + u("nav", na, [ + (a(!0), + u( + w, + null, + B( + r(e).nav, + (n) => ( + a(), + u( + w, + { key: JSON.stringify(n) }, + [ + "link" in n + ? (a(), k(Us, { key: 0, item: n }, null, 8, ["item"])) + : "component" in n + ? (a(), + k( + E(n.component), + U({ key: 1, ref_for: !0 }, n.props, { + "screen-menu": "", + }), + null, + 16, + )) + : (a(), + k( + ta, + { key: 2, text: n.text || "", items: n.items }, + null, + 8, + ["text", "items"], + )), + ], + 64, + ) + ), + ), + 128, + )), + ])) + : h("", !0); + }, + }), + sa = m({ + __name: "VPNavScreenSocialLinks", + setup(s) { + const { theme: e } = P(); + return (t, o) => + r(e).socialLinks + ? (a(), + k( + ke, + { + key: 0, + class: "VPNavScreenSocialLinks", + links: r(e).socialLinks, + }, + null, + 8, + ["links"], + )) + : h("", !0); + }, + }), + aa = { class: "list" }, + ra = m({ + __name: "VPNavScreenTranslations", + setup(s) { + const { localeLinks: e, currentLang: t } = R({ correspondingLink: !0 }), + o = T(!1); + function n() { + o.value = !o.value; + } + return (i, l) => + r(e).length && r(t).label + ? (a(), + u( + "div", + { + key: 0, + class: N(["VPNavScreenTranslations", { open: o.value }]), + }, + [ + v("button", { class: "title", onClick: n }, [ + l[0] || + (l[0] = v( + "span", + { class: "vpi-languages icon lang" }, + null, + -1, + )), + z(" " + M(r(t).label) + " ", 1), + l[1] || + (l[1] = v( + "span", + { class: "vpi-chevron-down icon chevron" }, + null, + -1, + )), + ]), + v("ul", aa, [ + (a(!0), + u( + w, + null, + B( + r(e), + (p) => ( + a(), + u("li", { key: p.link, class: "item" }, [ + _( + F, + { class: "link", href: p.link }, + { default: f(() => [z(M(p.text), 1)]), _: 2 }, + 1032, + ["href"], + ), + ]) + ), + ), + 128, + )), + ]), + ], + 2, + )) + : h("", !0); + }, + }), + ia = b(ra, [["__scopeId", "data-v-858fe1a4"]]), + la = { class: "container" }, + ca = m({ + __name: "VPNavScreen", + props: { open: { type: Boolean } }, + setup(s) { + const e = T(null), + t = Ve(ee ? document.body : null); + return (o, n) => ( + a(), + k( + ce, + { + name: "fade", + onEnter: n[0] || (n[0] = (i) => (t.value = !0)), + onAfterLeave: n[1] || (n[1] = (i) => (t.value = !1)), + }, + { + default: f(() => [ + o.open + ? (a(), + u( + "div", + { + key: 0, + class: "VPNavScreen", + ref_key: "screen", + ref: e, + id: "VPNavScreen", + }, + [ + v("div", la, [ + c( + o.$slots, + "nav-screen-content-before", + {}, + void 0, + !0, + ), + _(oa, { class: "menu" }), + _(ia, { class: "translations" }), + _(Ds, { class: "appearance" }), + _(sa, { class: "social-links" }), + c(o.$slots, "nav-screen-content-after", {}, void 0, !0), + ]), + ], + 512, + )) + : h("", !0), + ]), + _: 3, + }, + ) + ); + }, + }), + ua = b(ca, [["__scopeId", "data-v-f2779853"]]), + da = { key: 0, class: "VPNav" }, + va = m({ + __name: "VPNav", + setup(s) { + const { isScreenOpen: e, closeScreen: t, toggleScreen: o } = ro(), + { frontmatter: n } = P(), + i = $(() => n.value.navbar !== !1); + return ( + Se("close-screen", t), + Q(() => { + ee && document.documentElement.classList.toggle("hide-nav", !i.value); + }), + (l, p) => + i.value + ? (a(), + u("header", da, [ + _( + Bs, + { "is-screen-open": r(e), onToggleScreen: r(o) }, + { + "nav-bar-title-before": f(() => [ + c(l.$slots, "nav-bar-title-before", {}, void 0, !0), + ]), + "nav-bar-title-after": f(() => [ + c(l.$slots, "nav-bar-title-after", {}, void 0, !0), + ]), + "nav-bar-content-before": f(() => [ + c(l.$slots, "nav-bar-content-before", {}, void 0, !0), + ]), + "nav-bar-content-after": f(() => [ + c(l.$slots, "nav-bar-content-after", {}, void 0, !0), + ]), + _: 3, + }, + 8, + ["is-screen-open", "onToggleScreen"], + ), + _( + ua, + { open: r(e) }, + { + "nav-screen-content-before": f(() => [ + c(l.$slots, "nav-screen-content-before", {}, void 0, !0), + ]), + "nav-screen-content-after": f(() => [ + c(l.$slots, "nav-screen-content-after", {}, void 0, !0), + ]), + _: 3, + }, + 8, + ["open"], + ), + ])) + : h("", !0) + ); + }, + }), + pa = b(va, [["__scopeId", "data-v-ae24b3ad"]]), + fa = ["role", "tabindex"], + ha = { key: 1, class: "items" }, + ma = m({ + __name: "VPSidebarItem", + props: { item: {}, depth: {} }, + setup(s) { + const e = s, + { + collapsed: t, + collapsible: o, + isLink: n, + isActiveLink: i, + hasActiveLink: l, + hasChildren: p, + toggle: d, + } = ct($(() => e.item)), + y = $(() => (p.value ? "section" : "div")), + L = $(() => (n.value ? "a" : "div")), + g = $(() => + p.value ? (e.depth + 2 === 7 ? "p" : `h${e.depth + 2}`) : "p", + ), + V = $(() => (n.value ? void 0 : "button")), + I = $(() => [ + [`level-${e.depth}`], + { collapsible: o.value }, + { collapsed: t.value }, + { "is-link": n.value }, + { "is-active": i.value }, + { "has-active": l.value }, + ]); + function H(S) { + ("key" in S && S.key !== "Enter") || (!e.item.link && d()); + } + function A() { + e.item.link && d(); + } + return (S, C) => { + const G = q("VPSidebarItem", !0); + return ( + a(), + k( + E(y.value), + { class: N(["VPSidebarItem", I.value]) }, + { + default: f(() => [ + S.item.text + ? (a(), + u( + "div", + U( + { key: 0, class: "item", role: V.value }, + Ue(S.item.items ? { click: H, keydown: H } : {}, !0), + { tabindex: S.item.items && 0 }, + ), + [ + C[1] || + (C[1] = v("div", { class: "indicator" }, null, -1)), + S.item.link + ? (a(), + k( + F, + { + key: 0, + tag: L.value, + class: "link", + href: S.item.link, + rel: S.item.rel, + target: S.item.target, + }, + { + default: f(() => [ + (a(), + k( + E(g.value), + { class: "text", innerHTML: S.item.text }, + null, + 8, + ["innerHTML"], + )), + ]), + _: 1, + }, + 8, + ["tag", "href", "rel", "target"], + )) + : (a(), + k( + E(g.value), + { key: 1, class: "text", innerHTML: S.item.text }, + null, + 8, + ["innerHTML"], + )), + S.item.collapsed != null && + S.item.items && + S.item.items.length + ? (a(), + u( + "div", + { + key: 2, + class: "caret", + role: "button", + "aria-label": "toggle section", + onClick: A, + onKeydown: je(A, ["enter"]), + tabindex: "0", + }, + C[0] || + (C[0] = [ + v( + "span", + { class: "vpi-chevron-right caret-icon" }, + null, + -1, + ), + ]), + 32, + )) + : h("", !0), + ], + 16, + fa, + )) + : h("", !0), + S.item.items && S.item.items.length + ? (a(), + u("div", ha, [ + S.depth < 5 + ? (a(!0), + u( + w, + { key: 0 }, + B( + S.item.items, + (K) => ( + a(), + k( + G, + { key: K.text, item: K, depth: S.depth + 1 }, + null, + 8, + ["item", "depth"], + ) + ), + ), + 128, + )) + : h("", !0), + ])) + : h("", !0), + ]), + _: 1, + }, + 8, + ["class"], + ) + ); + }; + }, + }), + _a = b(ma, [["__scopeId", "data-v-b3fd67f8"]]), + ka = m({ + __name: "VPSidebarGroup", + props: { items: {} }, + setup(s) { + const e = T(!0); + let t = null; + return ( + j(() => { + t = setTimeout(() => { + (t = null), (e.value = !1); + }, 300); + }), + ze(() => { + t != null && (clearTimeout(t), (t = null)); + }), + (o, n) => ( + a(!0), + u( + w, + null, + B( + o.items, + (i) => ( + a(), + u( + "div", + { + key: i.text, + class: N(["group", { "no-transition": e.value }]), + }, + [_(_a, { item: i, depth: 0 }, null, 8, ["item"])], + 2, + ) + ), + ), + 128, + ) + ) + ); + }, + }), + ba = b(ka, [["__scopeId", "data-v-c40bc020"]]), + ga = { + class: "nav", + id: "VPSidebarNav", + "aria-labelledby": "sidebar-aria-label", + tabindex: "-1", + }, + $a = m({ + __name: "VPSidebar", + props: { open: { type: Boolean } }, + setup(s) { + const { sidebarGroups: e, hasSidebar: t } = O(), + o = s, + n = T(null), + i = Ve(ee ? document.body : null); + D( + [o, n], + () => { + var p; + o.open + ? ((i.value = !0), (p = n.value) == null || p.focus()) + : (i.value = !1); + }, + { immediate: !0, flush: "post" }, + ); + const l = T(0); + return ( + D( + e, + () => { + l.value += 1; + }, + { deep: !0 }, + ), + (p, d) => + r(t) + ? (a(), + u( + "aside", + { + key: 0, + class: N(["VPSidebar", { open: p.open }]), + ref_key: "navEl", + ref: n, + onClick: d[0] || (d[0] = We(() => {}, ["stop"])), + }, + [ + d[2] || (d[2] = v("div", { class: "curtain" }, null, -1)), + v("nav", ga, [ + d[1] || + (d[1] = v( + "span", + { class: "visually-hidden", id: "sidebar-aria-label" }, + " Sidebar Navigation ", + -1, + )), + c(p.$slots, "sidebar-nav-before", {}, void 0, !0), + (a(), + k(ba, { items: r(e), key: l.value }, null, 8, ["items"])), + c(p.$slots, "sidebar-nav-after", {}, void 0, !0), + ]), + ], + 2, + )) + : h("", !0) + ); + }, + }), + ya = b($a, [["__scopeId", "data-v-319d5ca6"]]), + Pa = m({ + __name: "VPSkipLink", + setup(s) { + const { theme: e } = P(), + t = Z(), + o = T(); + D( + () => t.path, + () => o.value.focus(), + ); + function n({ target: i }) { + const l = document.getElementById(decodeURIComponent(i.hash).slice(1)); + if (l) { + const p = () => { + l.removeAttribute("tabindex"), l.removeEventListener("blur", p); + }; + l.setAttribute("tabindex", "-1"), + l.addEventListener("blur", p), + l.focus(), + window.scrollTo(0, 0); + } + } + return (i, l) => ( + a(), + u( + w, + null, + [ + v( + "span", + { ref_key: "backToTop", ref: o, tabindex: "-1" }, + null, + 512, + ), + v( + "a", + { + href: "#VPContent", + class: "VPSkipLink visually-hidden", + onClick: n, + }, + M(r(e).skipToContentLabel || "Skip to content"), + 1, + ), + ], + 64, + ) + ); + }, + }), + La = b(Pa, [["__scopeId", "data-v-0b0ada53"]]), + Va = m({ + __name: "Layout", + setup(s) { + const { isOpen: e, open: t, close: o } = O(), + n = Z(); + D(() => n.path, o), lt(e, o); + const { frontmatter: i } = P(), + l = qe(), + p = $(() => !!l["home-hero-image"]); + return ( + Se("hero-image-slot-exists", p), + (d, y) => { + const L = q("Content"); + return r(i).layout !== !1 + ? (a(), + u( + "div", + { key: 0, class: N(["Layout", r(i).pageClass]) }, + [ + c(d.$slots, "layout-top", {}, void 0, !0), + _(La), + _( + Ye, + { class: "backdrop", show: r(e), onClick: r(o) }, + null, + 8, + ["show", "onClick"], + ), + _(pa, null, { + "nav-bar-title-before": f(() => [ + c(d.$slots, "nav-bar-title-before", {}, void 0, !0), + ]), + "nav-bar-title-after": f(() => [ + c(d.$slots, "nav-bar-title-after", {}, void 0, !0), + ]), + "nav-bar-content-before": f(() => [ + c(d.$slots, "nav-bar-content-before", {}, void 0, !0), + ]), + "nav-bar-content-after": f(() => [ + c(d.$slots, "nav-bar-content-after", {}, void 0, !0), + ]), + "nav-screen-content-before": f(() => [ + c(d.$slots, "nav-screen-content-before", {}, void 0, !0), + ]), + "nav-screen-content-after": f(() => [ + c(d.$slots, "nav-screen-content-after", {}, void 0, !0), + ]), + _: 3, + }), + _(ao, { open: r(e), onOpenMenu: r(t) }, null, 8, [ + "open", + "onOpenMenu", + ]), + _( + ya, + { open: r(e) }, + { + "sidebar-nav-before": f(() => [ + c(d.$slots, "sidebar-nav-before", {}, void 0, !0), + ]), + "sidebar-nav-after": f(() => [ + c(d.$slots, "sidebar-nav-after", {}, void 0, !0), + ]), + _: 3, + }, + 8, + ["open"], + ), + _(zn, null, { + "page-top": f(() => [ + c(d.$slots, "page-top", {}, void 0, !0), + ]), + "page-bottom": f(() => [ + c(d.$slots, "page-bottom", {}, void 0, !0), + ]), + "not-found": f(() => [ + c(d.$slots, "not-found", {}, void 0, !0), + ]), + "home-hero-before": f(() => [ + c(d.$slots, "home-hero-before", {}, void 0, !0), + ]), + "home-hero-info-before": f(() => [ + c(d.$slots, "home-hero-info-before", {}, void 0, !0), + ]), + "home-hero-info": f(() => [ + c(d.$slots, "home-hero-info", {}, void 0, !0), + ]), + "home-hero-info-after": f(() => [ + c(d.$slots, "home-hero-info-after", {}, void 0, !0), + ]), + "home-hero-actions-after": f(() => [ + c(d.$slots, "home-hero-actions-after", {}, void 0, !0), + ]), + "home-hero-image": f(() => [ + c(d.$slots, "home-hero-image", {}, void 0, !0), + ]), + "home-hero-after": f(() => [ + c(d.$slots, "home-hero-after", {}, void 0, !0), + ]), + "home-features-before": f(() => [ + c(d.$slots, "home-features-before", {}, void 0, !0), + ]), + "home-features-after": f(() => [ + c(d.$slots, "home-features-after", {}, void 0, !0), + ]), + "doc-footer-before": f(() => [ + c(d.$slots, "doc-footer-before", {}, void 0, !0), + ]), + "doc-before": f(() => [ + c(d.$slots, "doc-before", {}, void 0, !0), + ]), + "doc-after": f(() => [ + c(d.$slots, "doc-after", {}, void 0, !0), + ]), + "doc-top": f(() => [ + c(d.$slots, "doc-top", {}, void 0, !0), + ]), + "doc-bottom": f(() => [ + c(d.$slots, "doc-bottom", {}, void 0, !0), + ]), + "aside-top": f(() => [ + c(d.$slots, "aside-top", {}, void 0, !0), + ]), + "aside-bottom": f(() => [ + c(d.$slots, "aside-bottom", {}, void 0, !0), + ]), + "aside-outline-before": f(() => [ + c(d.$slots, "aside-outline-before", {}, void 0, !0), + ]), + "aside-outline-after": f(() => [ + c(d.$slots, "aside-outline-after", {}, void 0, !0), + ]), + "aside-ads-before": f(() => [ + c(d.$slots, "aside-ads-before", {}, void 0, !0), + ]), + "aside-ads-after": f(() => [ + c(d.$slots, "aside-ads-after", {}, void 0, !0), + ]), + _: 3, + }), + _(Jn), + c(d.$slots, "layout-bottom", {}, void 0, !0), + ], + 2, + )) + : (a(), k(L, { key: 1 })); + } + ); + }, + }), + Sa = b(Va, [["__scopeId", "data-v-5d98c3a5"]]), + Na = { + Layout: Sa, + enhanceApp: ({ app: s }) => { + s.component("Badge", Ke); + }, + }; +export { Na as t }; diff --git a/public/docs/assets/index.md.ZzqtzDg7.js b/public/docs/assets/index.md.ZzqtzDg7.js index a29297a..5b94e27 100644 --- a/public/docs/assets/index.md.ZzqtzDg7.js +++ b/public/docs/assets/index.md.ZzqtzDg7.js @@ -1 +1,10 @@ -import{_ as e,c as t,o as a}from"./chunks/framework.WowTybjF.js";const p=JSON.parse('{"title":"","description":"","frontmatter":{"layout":"home","hero":{"name":"News Analzye Docs","text":"The documentation for news analyze the project.","tagline":"My great project tagline","actions":[{"theme":"brand","text":"Markdown Examples","link":"/markdown-examples"},{"theme":"alt","text":"API Examples","link":"/api-examples"}]},"features":[{"title":"Feature A","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature B","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature C","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"}]},"headers":[],"relativePath":"index.md","filePath":"index.md"}'),i={name:"index.md"};function o(s,n,r,l,c,m){return a(),t("div")}const u=e(i,[["render",o]]);export{p as __pageData,u as default}; +import { _ as e, c as t, o as a } from "./chunks/framework.WowTybjF.js"; +const p = JSON.parse( + '{"title":"","description":"","frontmatter":{"layout":"home","hero":{"name":"News Analzye Docs","text":"The documentation for news analyze the project.","tagline":"My great project tagline","actions":[{"theme":"brand","text":"Markdown Examples","link":"/markdown-examples"},{"theme":"alt","text":"API Examples","link":"/api-examples"}]},"features":[{"title":"Feature A","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature B","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature C","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"}]},"headers":[],"relativePath":"index.md","filePath":"index.md"}', + ), + i = { name: "index.md" }; +function o(s, n, r, l, c, m) { + return a(), t("div"); +} +const u = e(i, [["render", o]]); +export { p as __pageData, u as default }; diff --git a/public/docs/assets/index.md.ZzqtzDg7.lean.js b/public/docs/assets/index.md.ZzqtzDg7.lean.js index a29297a..5b94e27 100644 --- a/public/docs/assets/index.md.ZzqtzDg7.lean.js +++ b/public/docs/assets/index.md.ZzqtzDg7.lean.js @@ -1 +1,10 @@ -import{_ as e,c as t,o as a}from"./chunks/framework.WowTybjF.js";const p=JSON.parse('{"title":"","description":"","frontmatter":{"layout":"home","hero":{"name":"News Analzye Docs","text":"The documentation for news analyze the project.","tagline":"My great project tagline","actions":[{"theme":"brand","text":"Markdown Examples","link":"/markdown-examples"},{"theme":"alt","text":"API Examples","link":"/api-examples"}]},"features":[{"title":"Feature A","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature B","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature C","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"}]},"headers":[],"relativePath":"index.md","filePath":"index.md"}'),i={name:"index.md"};function o(s,n,r,l,c,m){return a(),t("div")}const u=e(i,[["render",o]]);export{p as __pageData,u as default}; +import { _ as e, c as t, o as a } from "./chunks/framework.WowTybjF.js"; +const p = JSON.parse( + '{"title":"","description":"","frontmatter":{"layout":"home","hero":{"name":"News Analzye Docs","text":"The documentation for news analyze the project.","tagline":"My great project tagline","actions":[{"theme":"brand","text":"Markdown Examples","link":"/markdown-examples"},{"theme":"alt","text":"API Examples","link":"/api-examples"}]},"features":[{"title":"Feature A","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature B","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"},{"title":"Feature C","details":"Lorem ipsum dolor sit amet, consectetur adipiscing elit"}]},"headers":[],"relativePath":"index.md","filePath":"index.md"}', + ), + i = { name: "index.md" }; +function o(s, n, r, l, c, m) { + return a(), t("div"); +} +const u = e(i, [["render", o]]); +export { p as __pageData, u as default }; diff --git a/public/docs/assets/markdown-examples.md.OYFiuX35.js b/public/docs/assets/markdown-examples.md.OYFiuX35.js index cdd0c11..41eab91 100644 --- a/public/docs/assets/markdown-examples.md.OYFiuX35.js +++ b/public/docs/assets/markdown-examples.md.OYFiuX35.js @@ -1,4 +1,23 @@ -import{_ as a,c as i,o as n,ae as e}from"./chunks/framework.WowTybjF.js";const E=JSON.parse('{"title":"Markdown Extension Examples","description":"","frontmatter":{},"headers":[],"relativePath":"markdown-examples.md","filePath":"markdown-examples.md"}'),t={name:"markdown-examples.md"};function l(p,s,h,k,r,o){return n(),i("div",null,s[0]||(s[0]=[e(`

Markdown Extension Examples ​

This page demonstrates some of the built-in markdown extensions provided by VitePress.

Syntax Highlighting ​

VitePress provides Syntax Highlighting powered by Shiki, with additional features like line-highlighting:

Input

md
\`\`\`js{4}
+import {
+  _ as a,
+  c as i,
+  o as n,
+  ae as e,
+} from "./chunks/framework.WowTybjF.js";
+const E = JSON.parse(
+    '{"title":"Markdown Extension Examples","description":"","frontmatter":{},"headers":[],"relativePath":"markdown-examples.md","filePath":"markdown-examples.md"}',
+  ),
+  t = { name: "markdown-examples.md" };
+function l(p, s, h, k, r, o) {
+  return (
+    n(),
+    i(
+      "div",
+      null,
+      s[0] ||
+        (s[0] = [
+          e(
+            `
Markdown Extension Examples ​
This page demonstrates some of the built-in markdown extensions provided by VitePress.
Syntax Highlighting ​
VitePress provides Syntax Highlighting powered by Shiki, with additional features like line-highlighting:
Input
md
\`\`\`js{4}
 export default {
   data () {
     return {
@@ -30,4 +49,12 @@ import{_ as a,c as i,o as n,ae as e}from"./chunks/framework.WowTybjF.js";const E
 
 ::: details
 This is a details block.
-:::
Output
INFO
This is an info box.
TIP
This is a tip.
WARNING
This is a warning.
DANGER
This is a dangerous warning.
Details
This is a details block.
More ​
Check out the documentation for the full list of markdown extensions.
`,19)]))}const c=a(t,[["render",l]]);export{E as __pageData,c as default};
+:::

Output

INFO

This is an info box.

TIP

This is a tip.

WARNING

This is a warning.

DANGER

This is a dangerous warning.

Details

This is a details block.

More ​

Check out the documentation for the full list of markdown extensions.

`, + 19, + ), + ]), + ) + ); +} +const c = a(t, [["render", l]]); +export { E as __pageData, c as default }; diff --git a/public/docs/assets/markdown-examples.md.OYFiuX35.lean.js b/public/docs/assets/markdown-examples.md.OYFiuX35.lean.js index 2cad9bf..c046129 100644 --- a/public/docs/assets/markdown-examples.md.OYFiuX35.lean.js +++ b/public/docs/assets/markdown-examples.md.OYFiuX35.lean.js @@ -1 +1,15 @@ -import{_ as a,c as i,o as n,ae as e}from"./chunks/framework.WowTybjF.js";const E=JSON.parse('{"title":"Markdown Extension Examples","description":"","frontmatter":{},"headers":[],"relativePath":"markdown-examples.md","filePath":"markdown-examples.md"}'),t={name:"markdown-examples.md"};function l(p,s,h,k,r,o){return n(),i("div",null,s[0]||(s[0]=[e("",19)]))}const c=a(t,[["render",l]]);export{E as __pageData,c as default}; +import { + _ as a, + c as i, + o as n, + ae as e, +} from "./chunks/framework.WowTybjF.js"; +const E = JSON.parse( + '{"title":"Markdown Extension Examples","description":"","frontmatter":{},"headers":[],"relativePath":"markdown-examples.md","filePath":"markdown-examples.md"}', + ), + t = { name: "markdown-examples.md" }; +function l(p, s, h, k, r, o) { + return n(), i("div", null, s[0] || (s[0] = [e("", 19)])); +} +const c = a(t, [["render", l]]); +export { E as __pageData, c as default }; diff --git a/public/docs/assets/style.DuOwLuGy.css b/public/docs/assets/style.DuOwLuGy.css index c76ab4d..d816f02 100644 --- a/public/docs/assets/style.DuOwLuGy.css +++ b/public/docs/assets/style.DuOwLuGy.css @@ -1 +1,5023 @@ -@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-cyrillic-ext.BBPuwvHQ.woff2) format("woff2");unicode-range:U+0460-052F,U+1C80-1C88,U+20B4,U+2DE0-2DFF,U+A640-A69F,U+FE2E-FE2F}@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-cyrillic.C5lxZ8CY.woff2) format("woff2");unicode-range:U+0301,U+0400-045F,U+0490-0491,U+04B0-04B1,U+2116}@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-greek-ext.CqjqNYQ-.woff2) format("woff2");unicode-range:U+1F00-1FFF}@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-greek.BBVDIX6e.woff2) format("woff2");unicode-range:U+0370-0377,U+037A-037F,U+0384-038A,U+038C,U+038E-03A1,U+03A3-03FF}@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-vietnamese.BjW4sHH5.woff2) format("woff2");unicode-range:U+0102-0103,U+0110-0111,U+0128-0129,U+0168-0169,U+01A0-01A1,U+01AF-01B0,U+0300-0301,U+0303-0304,U+0308-0309,U+0323,U+0329,U+1EA0-1EF9,U+20AB}@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-latin-ext.4ZJIpNVo.woff2) format("woff2");unicode-range:U+0100-02AF,U+0304,U+0308,U+0329,U+1E00-1E9F,U+1EF2-1EFF,U+2020,U+20A0-20AB,U+20AD-20C0,U+2113,U+2C60-2C7F,U+A720-A7FF}@font-face{font-family:Inter;font-style:normal;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-roman-latin.Di8DUHzh.woff2) format("woff2");unicode-range:U+0000-00FF,U+0131,U+0152-0153,U+02BB-02BC,U+02C6,U+02DA,U+02DC,U+0304,U+0308,U+0329,U+2000-206F,U+2074,U+20AC,U+2122,U+2191,U+2193,U+2212,U+2215,U+FEFF,U+FFFD}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-cyrillic-ext.r48I6akx.woff2) format("woff2");unicode-range:U+0460-052F,U+1C80-1C88,U+20B4,U+2DE0-2DFF,U+A640-A69F,U+FE2E-FE2F}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-cyrillic.By2_1cv3.woff2) format("woff2");unicode-range:U+0301,U+0400-045F,U+0490-0491,U+04B0-04B1,U+2116}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-greek-ext.1u6EdAuj.woff2) format("woff2");unicode-range:U+1F00-1FFF}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-greek.DJ8dCoTZ.woff2) format("woff2");unicode-range:U+0370-0377,U+037A-037F,U+0384-038A,U+038C,U+038E-03A1,U+03A3-03FF}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-vietnamese.BSbpV94h.woff2) format("woff2");unicode-range:U+0102-0103,U+0110-0111,U+0128-0129,U+0168-0169,U+01A0-01A1,U+01AF-01B0,U+0300-0301,U+0303-0304,U+0308-0309,U+0323,U+0329,U+1EA0-1EF9,U+20AB}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-latin-ext.CN1xVJS-.woff2) format("woff2");unicode-range:U+0100-02AF,U+0304,U+0308,U+0329,U+1E00-1E9F,U+1EF2-1EFF,U+2020,U+20A0-20AB,U+20AD-20C0,U+2113,U+2C60-2C7F,U+A720-A7FF}@font-face{font-family:Inter;font-style:italic;font-weight:100 900;font-display:swap;src:url(/docs/assets/inter-italic-latin.C2AdPX0b.woff2) format("woff2");unicode-range:U+0000-00FF,U+0131,U+0152-0153,U+02BB-02BC,U+02C6,U+02DA,U+02DC,U+0304,U+0308,U+0329,U+2000-206F,U+2074,U+20AC,U+2122,U+2191,U+2193,U+2212,U+2215,U+FEFF,U+FFFD}@font-face{font-family:Punctuation SC;font-weight:400;src:local("PingFang SC Regular"),local("Noto Sans CJK SC"),local("Microsoft YaHei");unicode-range:U+201C,U+201D,U+2018,U+2019,U+2E3A,U+2014,U+2013,U+2026,U+00B7,U+007E,U+002F}@font-face{font-family:Punctuation SC;font-weight:500;src:local("PingFang SC Medium"),local("Noto Sans CJK SC"),local("Microsoft YaHei");unicode-range:U+201C,U+201D,U+2018,U+2019,U+2E3A,U+2014,U+2013,U+2026,U+00B7,U+007E,U+002F}@font-face{font-family:Punctuation SC;font-weight:600;src:local("PingFang SC Semibold"),local("Noto Sans CJK SC Bold"),local("Microsoft YaHei Bold");unicode-range:U+201C,U+201D,U+2018,U+2019,U+2E3A,U+2014,U+2013,U+2026,U+00B7,U+007E,U+002F}@font-face{font-family:Punctuation SC;font-weight:700;src:local("PingFang SC Semibold"),local("Noto Sans CJK SC Bold"),local("Microsoft YaHei Bold");unicode-range:U+201C,U+201D,U+2018,U+2019,U+2E3A,U+2014,U+2013,U+2026,U+00B7,U+007E,U+002F}:root{--vp-c-white: #ffffff;--vp-c-black: #000000;--vp-c-neutral: var(--vp-c-black);--vp-c-neutral-inverse: var(--vp-c-white)}.dark{--vp-c-neutral: var(--vp-c-white);--vp-c-neutral-inverse: var(--vp-c-black)}:root{--vp-c-gray-1: #dddde3;--vp-c-gray-2: #e4e4e9;--vp-c-gray-3: #ebebef;--vp-c-gray-soft: rgba(142, 150, 170, .14);--vp-c-indigo-1: #3451b2;--vp-c-indigo-2: #3a5ccc;--vp-c-indigo-3: #5672cd;--vp-c-indigo-soft: rgba(100, 108, 255, .14);--vp-c-purple-1: #6f42c1;--vp-c-purple-2: #7e4cc9;--vp-c-purple-3: #8e5cd9;--vp-c-purple-soft: rgba(159, 122, 234, .14);--vp-c-green-1: #18794e;--vp-c-green-2: #299764;--vp-c-green-3: #30a46c;--vp-c-green-soft: rgba(16, 185, 129, .14);--vp-c-yellow-1: #915930;--vp-c-yellow-2: #946300;--vp-c-yellow-3: #9f6a00;--vp-c-yellow-soft: rgba(234, 179, 8, .14);--vp-c-red-1: #b8272c;--vp-c-red-2: #d5393e;--vp-c-red-3: #e0575b;--vp-c-red-soft: rgba(244, 63, 94, .14);--vp-c-sponsor: #db2777}.dark{--vp-c-gray-1: #515c67;--vp-c-gray-2: #414853;--vp-c-gray-3: #32363f;--vp-c-gray-soft: rgba(101, 117, 133, .16);--vp-c-indigo-1: #a8b1ff;--vp-c-indigo-2: #5c73e7;--vp-c-indigo-3: #3e63dd;--vp-c-indigo-soft: rgba(100, 108, 255, .16);--vp-c-purple-1: #c8abfa;--vp-c-purple-2: #a879e6;--vp-c-purple-3: #8e5cd9;--vp-c-purple-soft: rgba(159, 122, 234, .16);--vp-c-green-1: #3dd68c;--vp-c-green-2: #30a46c;--vp-c-green-3: #298459;--vp-c-green-soft: rgba(16, 185, 129, .16);--vp-c-yellow-1: #f9b44e;--vp-c-yellow-2: #da8b17;--vp-c-yellow-3: #a46a0a;--vp-c-yellow-soft: rgba(234, 179, 8, .16);--vp-c-red-1: #f66f81;--vp-c-red-2: #f14158;--vp-c-red-3: #b62a3c;--vp-c-red-soft: rgba(244, 63, 94, .16)}:root{--vp-c-bg: #ffffff;--vp-c-bg-alt: #f6f6f7;--vp-c-bg-elv: #ffffff;--vp-c-bg-soft: #f6f6f7}.dark{--vp-c-bg: #1b1b1f;--vp-c-bg-alt: #161618;--vp-c-bg-elv: #202127;--vp-c-bg-soft: #202127}:root{--vp-c-border: #c2c2c4;--vp-c-divider: #e2e2e3;--vp-c-gutter: #e2e2e3}.dark{--vp-c-border: #3c3f44;--vp-c-divider: #2e2e32;--vp-c-gutter: #000000}:root{--vp-c-text-1: #3c3c43;--vp-c-text-2: #67676c;--vp-c-text-3: #929295}.dark{--vp-c-text-1: #dfdfd6;--vp-c-text-2: #98989f;--vp-c-text-3: #6a6a71}:root{--vp-c-default-1: var(--vp-c-gray-1);--vp-c-default-2: var(--vp-c-gray-2);--vp-c-default-3: var(--vp-c-gray-3);--vp-c-default-soft: var(--vp-c-gray-soft);--vp-c-brand-1: var(--vp-c-indigo-1);--vp-c-brand-2: var(--vp-c-indigo-2);--vp-c-brand-3: var(--vp-c-indigo-3);--vp-c-brand-soft: var(--vp-c-indigo-soft);--vp-c-brand: var(--vp-c-brand-1);--vp-c-tip-1: var(--vp-c-brand-1);--vp-c-tip-2: var(--vp-c-brand-2);--vp-c-tip-3: var(--vp-c-brand-3);--vp-c-tip-soft: var(--vp-c-brand-soft);--vp-c-note-1: var(--vp-c-brand-1);--vp-c-note-2: var(--vp-c-brand-2);--vp-c-note-3: var(--vp-c-brand-3);--vp-c-note-soft: var(--vp-c-brand-soft);--vp-c-success-1: var(--vp-c-green-1);--vp-c-success-2: var(--vp-c-green-2);--vp-c-success-3: var(--vp-c-green-3);--vp-c-success-soft: var(--vp-c-green-soft);--vp-c-important-1: var(--vp-c-purple-1);--vp-c-important-2: var(--vp-c-purple-2);--vp-c-important-3: var(--vp-c-purple-3);--vp-c-important-soft: var(--vp-c-purple-soft);--vp-c-warning-1: var(--vp-c-yellow-1);--vp-c-warning-2: var(--vp-c-yellow-2);--vp-c-warning-3: var(--vp-c-yellow-3);--vp-c-warning-soft: var(--vp-c-yellow-soft);--vp-c-danger-1: var(--vp-c-red-1);--vp-c-danger-2: var(--vp-c-red-2);--vp-c-danger-3: var(--vp-c-red-3);--vp-c-danger-soft: var(--vp-c-red-soft);--vp-c-caution-1: var(--vp-c-red-1);--vp-c-caution-2: var(--vp-c-red-2);--vp-c-caution-3: var(--vp-c-red-3);--vp-c-caution-soft: var(--vp-c-red-soft)}:root{--vp-font-family-base: "Inter", ui-sans-serif, system-ui, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--vp-font-family-mono: ui-monospace, "Menlo", "Monaco", "Consolas", "Liberation Mono", "Courier New", monospace;font-optical-sizing:auto}:root:where(:lang(zh)){--vp-font-family-base: "Punctuation SC", "Inter", ui-sans-serif, system-ui, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"}:root{--vp-shadow-1: 0 1px 2px rgba(0, 0, 0, .04), 0 1px 2px rgba(0, 0, 0, .06);--vp-shadow-2: 0 3px 12px rgba(0, 0, 0, .07), 0 1px 4px rgba(0, 0, 0, .07);--vp-shadow-3: 0 12px 32px rgba(0, 0, 0, .1), 0 2px 6px rgba(0, 0, 0, .08);--vp-shadow-4: 0 14px 44px rgba(0, 0, 0, .12), 0 3px 9px rgba(0, 0, 0, .12);--vp-shadow-5: 0 18px 56px rgba(0, 0, 0, .16), 0 4px 12px rgba(0, 0, 0, .16)}:root{--vp-z-index-footer: 10;--vp-z-index-local-nav: 20;--vp-z-index-nav: 30;--vp-z-index-layout-top: 40;--vp-z-index-backdrop: 50;--vp-z-index-sidebar: 60}@media (min-width: 960px){:root{--vp-z-index-sidebar: 25}}:root{--vp-layout-max-width: 1440px}:root{--vp-header-anchor-symbol: "#"}:root{--vp-code-line-height: 1.7;--vp-code-font-size: .875em;--vp-code-color: var(--vp-c-brand-1);--vp-code-link-color: var(--vp-c-brand-1);--vp-code-link-hover-color: var(--vp-c-brand-2);--vp-code-bg: var(--vp-c-default-soft);--vp-code-block-color: var(--vp-c-text-2);--vp-code-block-bg: var(--vp-c-bg-alt);--vp-code-block-divider-color: var(--vp-c-gutter);--vp-code-lang-color: var(--vp-c-text-3);--vp-code-line-highlight-color: var(--vp-c-default-soft);--vp-code-line-number-color: var(--vp-c-text-3);--vp-code-line-diff-add-color: var(--vp-c-success-soft);--vp-code-line-diff-add-symbol-color: var(--vp-c-success-1);--vp-code-line-diff-remove-color: var(--vp-c-danger-soft);--vp-code-line-diff-remove-symbol-color: var(--vp-c-danger-1);--vp-code-line-warning-color: var(--vp-c-warning-soft);--vp-code-line-error-color: var(--vp-c-danger-soft);--vp-code-copy-code-border-color: var(--vp-c-divider);--vp-code-copy-code-bg: var(--vp-c-bg-soft);--vp-code-copy-code-hover-border-color: var(--vp-c-divider);--vp-code-copy-code-hover-bg: var(--vp-c-bg);--vp-code-copy-code-active-text: var(--vp-c-text-2);--vp-code-copy-copied-text-content: "Copied";--vp-code-tab-divider: var(--vp-code-block-divider-color);--vp-code-tab-text-color: var(--vp-c-text-2);--vp-code-tab-bg: var(--vp-code-block-bg);--vp-code-tab-hover-text-color: var(--vp-c-text-1);--vp-code-tab-active-text-color: var(--vp-c-text-1);--vp-code-tab-active-bar-color: var(--vp-c-brand-1)}:lang(es),:lang(pt){--vp-code-copy-copied-text-content: "Copiado"}:lang(fa){--vp-code-copy-copied-text-content: "کپی شد"}:lang(ko){--vp-code-copy-copied-text-content: "복사됨"}:lang(ru){--vp-code-copy-copied-text-content: "Скопировано"}:lang(zh){--vp-code-copy-copied-text-content: "已复制"}:root{--vp-button-brand-border: transparent;--vp-button-brand-text: var(--vp-c-white);--vp-button-brand-bg: var(--vp-c-brand-3);--vp-button-brand-hover-border: transparent;--vp-button-brand-hover-text: var(--vp-c-white);--vp-button-brand-hover-bg: var(--vp-c-brand-2);--vp-button-brand-active-border: transparent;--vp-button-brand-active-text: var(--vp-c-white);--vp-button-brand-active-bg: var(--vp-c-brand-1);--vp-button-alt-border: transparent;--vp-button-alt-text: var(--vp-c-text-1);--vp-button-alt-bg: var(--vp-c-default-3);--vp-button-alt-hover-border: transparent;--vp-button-alt-hover-text: var(--vp-c-text-1);--vp-button-alt-hover-bg: var(--vp-c-default-2);--vp-button-alt-active-border: transparent;--vp-button-alt-active-text: var(--vp-c-text-1);--vp-button-alt-active-bg: var(--vp-c-default-1);--vp-button-sponsor-border: var(--vp-c-text-2);--vp-button-sponsor-text: var(--vp-c-text-2);--vp-button-sponsor-bg: transparent;--vp-button-sponsor-hover-border: var(--vp-c-sponsor);--vp-button-sponsor-hover-text: var(--vp-c-sponsor);--vp-button-sponsor-hover-bg: transparent;--vp-button-sponsor-active-border: var(--vp-c-sponsor);--vp-button-sponsor-active-text: var(--vp-c-sponsor);--vp-button-sponsor-active-bg: transparent}:root{--vp-custom-block-font-size: 14px;--vp-custom-block-code-font-size: 13px;--vp-custom-block-info-border: transparent;--vp-custom-block-info-text: var(--vp-c-text-1);--vp-custom-block-info-bg: var(--vp-c-default-soft);--vp-custom-block-info-code-bg: var(--vp-c-default-soft);--vp-custom-block-note-border: transparent;--vp-custom-block-note-text: var(--vp-c-text-1);--vp-custom-block-note-bg: var(--vp-c-default-soft);--vp-custom-block-note-code-bg: var(--vp-c-default-soft);--vp-custom-block-tip-border: transparent;--vp-custom-block-tip-text: var(--vp-c-text-1);--vp-custom-block-tip-bg: var(--vp-c-tip-soft);--vp-custom-block-tip-code-bg: var(--vp-c-tip-soft);--vp-custom-block-important-border: transparent;--vp-custom-block-important-text: var(--vp-c-text-1);--vp-custom-block-important-bg: var(--vp-c-important-soft);--vp-custom-block-important-code-bg: var(--vp-c-important-soft);--vp-custom-block-warning-border: transparent;--vp-custom-block-warning-text: var(--vp-c-text-1);--vp-custom-block-warning-bg: var(--vp-c-warning-soft);--vp-custom-block-warning-code-bg: var(--vp-c-warning-soft);--vp-custom-block-danger-border: transparent;--vp-custom-block-danger-text: var(--vp-c-text-1);--vp-custom-block-danger-bg: var(--vp-c-danger-soft);--vp-custom-block-danger-code-bg: var(--vp-c-danger-soft);--vp-custom-block-caution-border: transparent;--vp-custom-block-caution-text: var(--vp-c-text-1);--vp-custom-block-caution-bg: var(--vp-c-caution-soft);--vp-custom-block-caution-code-bg: var(--vp-c-caution-soft);--vp-custom-block-details-border: var(--vp-custom-block-info-border);--vp-custom-block-details-text: var(--vp-custom-block-info-text);--vp-custom-block-details-bg: var(--vp-custom-block-info-bg);--vp-custom-block-details-code-bg: var(--vp-custom-block-info-code-bg)}:root{--vp-input-border-color: var(--vp-c-border);--vp-input-bg-color: var(--vp-c-bg-alt);--vp-input-switch-bg-color: var(--vp-c-default-soft)}:root{--vp-nav-height: 64px;--vp-nav-bg-color: var(--vp-c-bg);--vp-nav-screen-bg-color: var(--vp-c-bg);--vp-nav-logo-height: 24px}.hide-nav{--vp-nav-height: 0px}.hide-nav .VPSidebar{--vp-nav-height: 22px}:root{--vp-local-nav-bg-color: var(--vp-c-bg)}:root{--vp-sidebar-width: 272px;--vp-sidebar-bg-color: var(--vp-c-bg-alt)}:root{--vp-backdrop-bg-color: rgba(0, 0, 0, .6)}:root{--vp-home-hero-name-color: var(--vp-c-brand-1);--vp-home-hero-name-background: transparent;--vp-home-hero-image-background-image: none;--vp-home-hero-image-filter: none}:root{--vp-badge-info-border: transparent;--vp-badge-info-text: var(--vp-c-text-2);--vp-badge-info-bg: var(--vp-c-default-soft);--vp-badge-tip-border: transparent;--vp-badge-tip-text: var(--vp-c-tip-1);--vp-badge-tip-bg: var(--vp-c-tip-soft);--vp-badge-warning-border: transparent;--vp-badge-warning-text: var(--vp-c-warning-1);--vp-badge-warning-bg: var(--vp-c-warning-soft);--vp-badge-danger-border: transparent;--vp-badge-danger-text: var(--vp-c-danger-1);--vp-badge-danger-bg: var(--vp-c-danger-soft)}:root{--vp-carbon-ads-text-color: var(--vp-c-text-1);--vp-carbon-ads-poweredby-color: var(--vp-c-text-2);--vp-carbon-ads-bg-color: var(--vp-c-bg-soft);--vp-carbon-ads-hover-text-color: var(--vp-c-brand-1);--vp-carbon-ads-hover-poweredby-color: var(--vp-c-text-1)}:root{--vp-local-search-bg: var(--vp-c-bg);--vp-local-search-result-bg: var(--vp-c-bg);--vp-local-search-result-border: var(--vp-c-divider);--vp-local-search-result-selected-bg: var(--vp-c-bg);--vp-local-search-result-selected-border: var(--vp-c-brand-1);--vp-local-search-highlight-bg: var(--vp-c-brand-1);--vp-local-search-highlight-text: var(--vp-c-neutral-inverse)}@media (prefers-reduced-motion: reduce){*,:before,:after{animation-delay:-1ms!important;animation-duration:1ms!important;animation-iteration-count:1!important;background-attachment:initial!important;scroll-behavior:auto!important;transition-duration:0s!important;transition-delay:0s!important}}*,:before,:after{box-sizing:border-box}html{line-height:1.4;font-size:16px;-webkit-text-size-adjust:100%}html.dark{color-scheme:dark}body{margin:0;width:100%;min-width:320px;min-height:100vh;line-height:24px;font-family:var(--vp-font-family-base);font-size:16px;font-weight:400;color:var(--vp-c-text-1);background-color:var(--vp-c-bg);font-synthesis:style;text-rendering:optimizeLegibility;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}main{display:block}h1,h2,h3,h4,h5,h6{margin:0;line-height:24px;font-size:16px;font-weight:400}p{margin:0}strong,b{font-weight:600}a,area,button,[role=button],input,label,select,summary,textarea{touch-action:manipulation}a{color:inherit;text-decoration:inherit}ol,ul{list-style:none;margin:0;padding:0}blockquote{margin:0}pre,code,kbd,samp{font-family:var(--vp-font-family-mono)}img,svg,video,canvas,audio,iframe,embed,object{display:block}figure{margin:0}img,video{max-width:100%;height:auto}button,input,optgroup,select,textarea{border:0;padding:0;line-height:inherit;color:inherit}button{padding:0;font-family:inherit;background-color:transparent;background-image:none}button:enabled,[role=button]:enabled{cursor:pointer}button:focus,button:focus-visible{outline:1px dotted;outline:4px auto -webkit-focus-ring-color}button:focus:not(:focus-visible){outline:none!important}input:focus,textarea:focus,select:focus{outline:none}table{border-collapse:collapse}input{background-color:transparent}input:-ms-input-placeholder,textarea:-ms-input-placeholder{color:var(--vp-c-text-3)}input::-ms-input-placeholder,textarea::-ms-input-placeholder{color:var(--vp-c-text-3)}input::placeholder,textarea::placeholder{color:var(--vp-c-text-3)}input::-webkit-outer-spin-button,input::-webkit-inner-spin-button{-webkit-appearance:none;margin:0}input[type=number]{-moz-appearance:textfield}textarea{resize:vertical}select{-webkit-appearance:none}fieldset{margin:0;padding:0}h1,h2,h3,h4,h5,h6,li,p{overflow-wrap:break-word}vite-error-overlay{z-index:9999}mjx-container{overflow-x:auto}mjx-container>svg{display:inline-block;margin:auto}[class^=vpi-],[class*=" vpi-"],.vp-icon{width:1em;height:1em}[class^=vpi-].bg,[class*=" vpi-"].bg,.vp-icon.bg{background-size:100% 100%;background-color:transparent}[class^=vpi-]:not(.bg),[class*=" vpi-"]:not(.bg),.vp-icon:not(.bg){-webkit-mask:var(--icon) no-repeat;mask:var(--icon) no-repeat;-webkit-mask-size:100% 100%;mask-size:100% 100%;background-color:currentColor;color:inherit}.vpi-align-left{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M21 6H3M15 12H3M17 18H3'/%3E%3C/svg%3E")}.vpi-arrow-right,.vpi-arrow-down,.vpi-arrow-left,.vpi-arrow-up{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M5 12h14M12 5l7 7-7 7'/%3E%3C/svg%3E")}.vpi-chevron-right,.vpi-chevron-down,.vpi-chevron-left,.vpi-chevron-up{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='m9 18 6-6-6-6'/%3E%3C/svg%3E")}.vpi-chevron-down,.vpi-arrow-down{transform:rotate(90deg)}.vpi-chevron-left,.vpi-arrow-left{transform:rotate(180deg)}.vpi-chevron-up,.vpi-arrow-up{transform:rotate(-90deg)}.vpi-square-pen{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M12 3H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2v-7'/%3E%3Cpath d='M18.375 2.625a2.121 2.121 0 1 1 3 3L12 15l-4 1 1-4Z'/%3E%3C/svg%3E")}.vpi-plus{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M5 12h14M12 5v14'/%3E%3C/svg%3E")}.vpi-sun{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Ccircle cx='12' cy='12' r='4'/%3E%3Cpath d='M12 2v2M12 20v2M4.93 4.93l1.41 1.41M17.66 17.66l1.41 1.41M2 12h2M20 12h2M6.34 17.66l-1.41 1.41M19.07 4.93l-1.41 1.41'/%3E%3C/svg%3E")}.vpi-moon{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M12 3a6 6 0 0 0 9 9 9 9 0 1 1-9-9Z'/%3E%3C/svg%3E")}.vpi-more-horizontal{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Ccircle cx='12' cy='12' r='1'/%3E%3Ccircle cx='19' cy='12' r='1'/%3E%3Ccircle cx='5' cy='12' r='1'/%3E%3C/svg%3E")}.vpi-languages{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='m5 8 6 6M4 14l6-6 2-3M2 5h12M7 2h1M22 22l-5-10-5 10M14 18h6'/%3E%3C/svg%3E")}.vpi-heart{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M19 14c1.49-1.46 3-3.21 3-5.5A5.5 5.5 0 0 0 16.5 3c-1.76 0-3 .5-4.5 2-1.5-1.5-2.74-2-4.5-2A5.5 5.5 0 0 0 2 8.5c0 2.3 1.5 4.05 3 5.5l7 7Z'/%3E%3C/svg%3E")}.vpi-search{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Ccircle cx='11' cy='11' r='8'/%3E%3Cpath d='m21 21-4.3-4.3'/%3E%3C/svg%3E")}.vpi-layout-list{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Crect width='7' height='7' x='3' y='3' rx='1'/%3E%3Crect width='7' height='7' x='3' y='14' rx='1'/%3E%3Cpath d='M14 4h7M14 9h7M14 15h7M14 20h7'/%3E%3C/svg%3E")}.vpi-delete{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M20 5H9l-7 7 7 7h11a2 2 0 0 0 2-2V7a2 2 0 0 0-2-2ZM18 9l-6 6M12 9l6 6'/%3E%3C/svg%3E")}.vpi-corner-down-left{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='m9 10-5 5 5 5'/%3E%3Cpath d='M20 4v7a4 4 0 0 1-4 4H4'/%3E%3C/svg%3E")}:root{--vp-icon-copy: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='rgba(128,128,128,1)' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Crect width='8' height='4' x='8' y='2' rx='1' ry='1'/%3E%3Cpath d='M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2'/%3E%3C/svg%3E");--vp-icon-copied: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='rgba(128,128,128,1)' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Crect width='8' height='4' x='8' y='2' rx='1' ry='1'/%3E%3Cpath d='M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2'/%3E%3Cpath d='m9 14 2 2 4-4'/%3E%3C/svg%3E")}.visually-hidden{position:absolute;width:1px;height:1px;white-space:nowrap;clip:rect(0 0 0 0);clip-path:inset(50%);overflow:hidden}.custom-block{border:1px solid transparent;border-radius:8px;padding:16px 16px 8px;line-height:24px;font-size:var(--vp-custom-block-font-size);color:var(--vp-c-text-2)}.custom-block.info{border-color:var(--vp-custom-block-info-border);color:var(--vp-custom-block-info-text);background-color:var(--vp-custom-block-info-bg)}.custom-block.info a,.custom-block.info code{color:var(--vp-c-brand-1)}.custom-block.info a:hover,.custom-block.info a:hover>code{color:var(--vp-c-brand-2)}.custom-block.info code{background-color:var(--vp-custom-block-info-code-bg)}.custom-block.note{border-color:var(--vp-custom-block-note-border);color:var(--vp-custom-block-note-text);background-color:var(--vp-custom-block-note-bg)}.custom-block.note a,.custom-block.note code{color:var(--vp-c-brand-1)}.custom-block.note a:hover,.custom-block.note a:hover>code{color:var(--vp-c-brand-2)}.custom-block.note code{background-color:var(--vp-custom-block-note-code-bg)}.custom-block.tip{border-color:var(--vp-custom-block-tip-border);color:var(--vp-custom-block-tip-text);background-color:var(--vp-custom-block-tip-bg)}.custom-block.tip a,.custom-block.tip code{color:var(--vp-c-tip-1)}.custom-block.tip a:hover,.custom-block.tip a:hover>code{color:var(--vp-c-tip-2)}.custom-block.tip code{background-color:var(--vp-custom-block-tip-code-bg)}.custom-block.important{border-color:var(--vp-custom-block-important-border);color:var(--vp-custom-block-important-text);background-color:var(--vp-custom-block-important-bg)}.custom-block.important a,.custom-block.important code{color:var(--vp-c-important-1)}.custom-block.important a:hover,.custom-block.important a:hover>code{color:var(--vp-c-important-2)}.custom-block.important code{background-color:var(--vp-custom-block-important-code-bg)}.custom-block.warning{border-color:var(--vp-custom-block-warning-border);color:var(--vp-custom-block-warning-text);background-color:var(--vp-custom-block-warning-bg)}.custom-block.warning a,.custom-block.warning code{color:var(--vp-c-warning-1)}.custom-block.warning a:hover,.custom-block.warning a:hover>code{color:var(--vp-c-warning-2)}.custom-block.warning code{background-color:var(--vp-custom-block-warning-code-bg)}.custom-block.danger{border-color:var(--vp-custom-block-danger-border);color:var(--vp-custom-block-danger-text);background-color:var(--vp-custom-block-danger-bg)}.custom-block.danger a,.custom-block.danger code{color:var(--vp-c-danger-1)}.custom-block.danger a:hover,.custom-block.danger a:hover>code{color:var(--vp-c-danger-2)}.custom-block.danger code{background-color:var(--vp-custom-block-danger-code-bg)}.custom-block.caution{border-color:var(--vp-custom-block-caution-border);color:var(--vp-custom-block-caution-text);background-color:var(--vp-custom-block-caution-bg)}.custom-block.caution a,.custom-block.caution code{color:var(--vp-c-caution-1)}.custom-block.caution a:hover,.custom-block.caution a:hover>code{color:var(--vp-c-caution-2)}.custom-block.caution code{background-color:var(--vp-custom-block-caution-code-bg)}.custom-block.details{border-color:var(--vp-custom-block-details-border);color:var(--vp-custom-block-details-text);background-color:var(--vp-custom-block-details-bg)}.custom-block.details a{color:var(--vp-c-brand-1)}.custom-block.details a:hover,.custom-block.details a:hover>code{color:var(--vp-c-brand-2)}.custom-block.details code{background-color:var(--vp-custom-block-details-code-bg)}.custom-block-title{font-weight:600}.custom-block p+p{margin:8px 0}.custom-block.details summary{margin:0 0 8px;font-weight:700;cursor:pointer;-webkit-user-select:none;user-select:none}.custom-block.details summary+p{margin:8px 0}.custom-block a{color:inherit;font-weight:600;text-decoration:underline;text-underline-offset:2px;transition:opacity .25s}.custom-block a:hover{opacity:.75}.custom-block code{font-size:var(--vp-custom-block-code-font-size)}.custom-block.custom-block th,.custom-block.custom-block blockquote>p{font-size:var(--vp-custom-block-font-size);color:inherit}.dark .vp-code span{color:var(--shiki-dark, inherit)}html:not(.dark) .vp-code span{color:var(--shiki-light, inherit)}.vp-code-group{margin-top:16px}.vp-code-group .tabs{position:relative;display:flex;margin-right:-24px;margin-left:-24px;padding:0 12px;background-color:var(--vp-code-tab-bg);overflow-x:auto;overflow-y:hidden;box-shadow:inset 0 -1px var(--vp-code-tab-divider)}@media (min-width: 640px){.vp-code-group .tabs{margin-right:0;margin-left:0;border-radius:8px 8px 0 0}}.vp-code-group .tabs input{position:fixed;opacity:0;pointer-events:none}.vp-code-group .tabs label{position:relative;display:inline-block;border-bottom:1px solid transparent;padding:0 12px;line-height:48px;font-size:14px;font-weight:500;color:var(--vp-code-tab-text-color);white-space:nowrap;cursor:pointer;transition:color .25s}.vp-code-group .tabs label:after{position:absolute;right:8px;bottom:-1px;left:8px;z-index:1;height:2px;border-radius:2px;content:"";background-color:transparent;transition:background-color .25s}.vp-code-group label:hover{color:var(--vp-code-tab-hover-text-color)}.vp-code-group input:checked+label{color:var(--vp-code-tab-active-text-color)}.vp-code-group input:checked+label:after{background-color:var(--vp-code-tab-active-bar-color)}.vp-code-group div[class*=language-],.vp-block{display:none;margin-top:0!important;border-top-left-radius:0!important;border-top-right-radius:0!important}.vp-code-group div[class*=language-].active,.vp-block.active{display:block}.vp-block{padding:20px 24px}.vp-doc h1,.vp-doc h2,.vp-doc h3,.vp-doc h4,.vp-doc h5,.vp-doc h6{position:relative;font-weight:600;outline:none}.vp-doc h1{letter-spacing:-.02em;line-height:40px;font-size:28px}.vp-doc h2{margin:48px 0 16px;border-top:1px solid var(--vp-c-divider);padding-top:24px;letter-spacing:-.02em;line-height:32px;font-size:24px}.vp-doc h3{margin:32px 0 0;letter-spacing:-.01em;line-height:28px;font-size:20px}.vp-doc h4{margin:24px 0 0;letter-spacing:-.01em;line-height:24px;font-size:18px}.vp-doc .header-anchor{position:absolute;top:0;left:0;margin-left:-.87em;font-weight:500;-webkit-user-select:none;user-select:none;opacity:0;text-decoration:none;transition:color .25s,opacity .25s}.vp-doc .header-anchor:before{content:var(--vp-header-anchor-symbol)}.vp-doc h1:hover .header-anchor,.vp-doc h1 .header-anchor:focus,.vp-doc h2:hover .header-anchor,.vp-doc h2 .header-anchor:focus,.vp-doc h3:hover .header-anchor,.vp-doc h3 .header-anchor:focus,.vp-doc h4:hover .header-anchor,.vp-doc h4 .header-anchor:focus,.vp-doc h5:hover .header-anchor,.vp-doc h5 .header-anchor:focus,.vp-doc h6:hover .header-anchor,.vp-doc h6 .header-anchor:focus{opacity:1}@media (min-width: 768px){.vp-doc h1{letter-spacing:-.02em;line-height:40px;font-size:32px}}.vp-doc h2 .header-anchor{top:24px}.vp-doc p,.vp-doc summary{margin:16px 0}.vp-doc p{line-height:28px}.vp-doc blockquote{margin:16px 0;border-left:2px solid var(--vp-c-divider);padding-left:16px;transition:border-color .5s;color:var(--vp-c-text-2)}.vp-doc blockquote>p{margin:0;font-size:16px;transition:color .5s}.vp-doc a{font-weight:500;color:var(--vp-c-brand-1);text-decoration:underline;text-underline-offset:2px;transition:color .25s,opacity .25s}.vp-doc a:hover{color:var(--vp-c-brand-2)}.vp-doc strong{font-weight:600}.vp-doc ul,.vp-doc ol{padding-left:1.25rem;margin:16px 0}.vp-doc ul{list-style:disc}.vp-doc ol{list-style:decimal}.vp-doc li+li{margin-top:8px}.vp-doc li>ol,.vp-doc li>ul{margin:8px 0 0}.vp-doc table{display:block;border-collapse:collapse;margin:20px 0;overflow-x:auto}.vp-doc tr{background-color:var(--vp-c-bg);border-top:1px solid var(--vp-c-divider);transition:background-color .5s}.vp-doc tr:nth-child(2n){background-color:var(--vp-c-bg-soft)}.vp-doc th,.vp-doc td{border:1px solid var(--vp-c-divider);padding:8px 16px}.vp-doc th{text-align:left;font-size:14px;font-weight:600;color:var(--vp-c-text-2);background-color:var(--vp-c-bg-soft)}.vp-doc td{font-size:14px}.vp-doc hr{margin:16px 0;border:none;border-top:1px solid var(--vp-c-divider)}.vp-doc .custom-block{margin:16px 0}.vp-doc .custom-block p{margin:8px 0;line-height:24px}.vp-doc .custom-block p:first-child{margin:0}.vp-doc .custom-block div[class*=language-]{margin:8px 0;border-radius:8px}.vp-doc .custom-block div[class*=language-] code{font-weight:400;background-color:transparent}.vp-doc .custom-block .vp-code-group .tabs{margin:0;border-radius:8px 8px 0 0}.vp-doc :not(pre,h1,h2,h3,h4,h5,h6)>code{font-size:var(--vp-code-font-size);color:var(--vp-code-color)}.vp-doc :not(pre)>code{border-radius:4px;padding:3px 6px;background-color:var(--vp-code-bg);transition:color .25s,background-color .5s}.vp-doc a>code{color:var(--vp-code-link-color)}.vp-doc a:hover>code{color:var(--vp-code-link-hover-color)}.vp-doc h1>code,.vp-doc h2>code,.vp-doc h3>code,.vp-doc h4>code{font-size:.9em}.vp-doc div[class*=language-],.vp-block{position:relative;margin:16px -24px;background-color:var(--vp-code-block-bg);overflow-x:auto;transition:background-color .5s}@media (min-width: 640px){.vp-doc div[class*=language-],.vp-block{border-radius:8px;margin:16px 0}}@media (max-width: 639px){.vp-doc li div[class*=language-]{border-radius:8px 0 0 8px}}.vp-doc div[class*=language-]+div[class*=language-],.vp-doc div[class$=-api]+div[class*=language-],.vp-doc div[class*=language-]+div[class$=-api]>div[class*=language-]{margin-top:-8px}.vp-doc [class*=language-] pre,.vp-doc [class*=language-] code{direction:ltr;text-align:left;white-space:pre;word-spacing:normal;word-break:normal;word-wrap:normal;-moz-tab-size:4;-o-tab-size:4;tab-size:4;-webkit-hyphens:none;-moz-hyphens:none;-ms-hyphens:none;hyphens:none}.vp-doc [class*=language-] pre{position:relative;z-index:1;margin:0;padding:20px 0;background:transparent;overflow-x:auto}.vp-doc [class*=language-] code{display:block;padding:0 24px;width:fit-content;min-width:100%;line-height:var(--vp-code-line-height);font-size:var(--vp-code-font-size);color:var(--vp-code-block-color);transition:color .5s}.vp-doc [class*=language-] code .highlighted{background-color:var(--vp-code-line-highlight-color);transition:background-color .5s;margin:0 -24px;padding:0 24px;width:calc(100% + 48px);display:inline-block}.vp-doc [class*=language-] code .highlighted.error{background-color:var(--vp-code-line-error-color)}.vp-doc [class*=language-] code .highlighted.warning{background-color:var(--vp-code-line-warning-color)}.vp-doc [class*=language-] code .diff{transition:background-color .5s;margin:0 -24px;padding:0 24px;width:calc(100% + 48px);display:inline-block}.vp-doc [class*=language-] code .diff:before{position:absolute;left:10px}.vp-doc [class*=language-] .has-focused-lines .line:not(.has-focus){filter:blur(.095rem);opacity:.4;transition:filter .35s,opacity .35s}.vp-doc [class*=language-] .has-focused-lines .line:not(.has-focus){opacity:.7;transition:filter .35s,opacity .35s}.vp-doc [class*=language-]:hover .has-focused-lines .line:not(.has-focus){filter:blur(0);opacity:1}.vp-doc [class*=language-] code .diff.remove{background-color:var(--vp-code-line-diff-remove-color);opacity:.7}.vp-doc [class*=language-] code .diff.remove:before{content:"-";color:var(--vp-code-line-diff-remove-symbol-color)}.vp-doc [class*=language-] code .diff.add{background-color:var(--vp-code-line-diff-add-color)}.vp-doc [class*=language-] code .diff.add:before{content:"+";color:var(--vp-code-line-diff-add-symbol-color)}.vp-doc div[class*=language-].line-numbers-mode{padding-left:32px}.vp-doc .line-numbers-wrapper{position:absolute;top:0;bottom:0;left:0;z-index:3;border-right:1px solid var(--vp-code-block-divider-color);padding-top:20px;width:32px;text-align:center;font-family:var(--vp-font-family-mono);line-height:var(--vp-code-line-height);font-size:var(--vp-code-font-size);color:var(--vp-code-line-number-color);transition:border-color .5s,color .5s}.vp-doc [class*=language-]>button.copy{direction:ltr;position:absolute;top:12px;right:12px;z-index:3;border:1px solid var(--vp-code-copy-code-border-color);border-radius:4px;width:40px;height:40px;background-color:var(--vp-code-copy-code-bg);opacity:0;cursor:pointer;background-image:var(--vp-icon-copy);background-position:50%;background-size:20px;background-repeat:no-repeat;transition:border-color .25s,background-color .25s,opacity .25s}.vp-doc [class*=language-]:hover>button.copy,.vp-doc [class*=language-]>button.copy:focus{opacity:1}.vp-doc [class*=language-]>button.copy:hover,.vp-doc [class*=language-]>button.copy.copied{border-color:var(--vp-code-copy-code-hover-border-color);background-color:var(--vp-code-copy-code-hover-bg)}.vp-doc [class*=language-]>button.copy.copied,.vp-doc [class*=language-]>button.copy:hover.copied{border-radius:0 4px 4px 0;background-color:var(--vp-code-copy-code-hover-bg);background-image:var(--vp-icon-copied)}.vp-doc [class*=language-]>button.copy.copied:before,.vp-doc [class*=language-]>button.copy:hover.copied:before{position:relative;top:-1px;transform:translate(calc(-100% - 1px));display:flex;justify-content:center;align-items:center;border:1px solid var(--vp-code-copy-code-hover-border-color);border-right:0;border-radius:4px 0 0 4px;padding:0 10px;width:fit-content;height:40px;text-align:center;font-size:12px;font-weight:500;color:var(--vp-code-copy-code-active-text);background-color:var(--vp-code-copy-code-hover-bg);white-space:nowrap;content:var(--vp-code-copy-copied-text-content)}.vp-doc [class*=language-]>span.lang{position:absolute;top:2px;right:8px;z-index:2;font-size:12px;font-weight:500;-webkit-user-select:none;user-select:none;color:var(--vp-code-lang-color);transition:color .4s,opacity .4s}.vp-doc [class*=language-]:hover>button.copy+span.lang,.vp-doc [class*=language-]>button.copy:focus+span.lang{opacity:0}.vp-doc .VPTeamMembers{margin-top:24px}.vp-doc .VPTeamMembers.small.count-1 .container{margin:0!important;max-width:calc((100% - 24px)/2)!important}.vp-doc .VPTeamMembers.small.count-2 .container,.vp-doc .VPTeamMembers.small.count-3 .container{max-width:100%!important}.vp-doc .VPTeamMembers.medium.count-1 .container{margin:0!important;max-width:calc((100% - 24px)/2)!important}:is(.vp-external-link-icon,.vp-doc a[href*="://"],.vp-doc a[target=_blank]):not(:is(.no-icon,svg a,:has(img,svg))):after{display:inline-block;margin-top:-1px;margin-left:4px;width:11px;height:11px;background:currentColor;color:var(--vp-c-text-3);flex-shrink:0;--icon: url("data:image/svg+xml, %3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' %3E%3Cpath d='M0 0h24v24H0V0z' fill='none' /%3E%3Cpath d='M9 5v2h6.59L4 18.59 5.41 20 17 8.41V15h2V5H9z' /%3E%3C/svg%3E");-webkit-mask-image:var(--icon);mask-image:var(--icon)}.vp-external-link-icon:after{content:""}.external-link-icon-enabled :is(.vp-doc a[href*="://"],.vp-doc a[target=_blank]):not(:is(.no-icon,svg a,:has(img,svg))):after{content:"";color:currentColor}.vp-sponsor{border-radius:16px;overflow:hidden}.vp-sponsor.aside{border-radius:12px}.vp-sponsor-section+.vp-sponsor-section{margin-top:4px}.vp-sponsor-tier{margin:0 0 4px!important;text-align:center;letter-spacing:1px!important;line-height:24px;width:100%;font-weight:600;color:var(--vp-c-text-2);background-color:var(--vp-c-bg-soft)}.vp-sponsor.normal .vp-sponsor-tier{padding:13px 0 11px;font-size:14px}.vp-sponsor.aside .vp-sponsor-tier{padding:9px 0 7px;font-size:12px}.vp-sponsor-grid+.vp-sponsor-tier{margin-top:4px}.vp-sponsor-grid{display:flex;flex-wrap:wrap;gap:4px}.vp-sponsor-grid.xmini .vp-sponsor-grid-link{height:64px}.vp-sponsor-grid.xmini .vp-sponsor-grid-image{max-width:64px;max-height:22px}.vp-sponsor-grid.mini .vp-sponsor-grid-link{height:72px}.vp-sponsor-grid.mini .vp-sponsor-grid-image{max-width:96px;max-height:24px}.vp-sponsor-grid.small .vp-sponsor-grid-link{height:96px}.vp-sponsor-grid.small .vp-sponsor-grid-image{max-width:96px;max-height:24px}.vp-sponsor-grid.medium .vp-sponsor-grid-link{height:112px}.vp-sponsor-grid.medium .vp-sponsor-grid-image{max-width:120px;max-height:36px}.vp-sponsor-grid.big .vp-sponsor-grid-link{height:184px}.vp-sponsor-grid.big .vp-sponsor-grid-image{max-width:192px;max-height:56px}.vp-sponsor-grid[data-vp-grid="2"] .vp-sponsor-grid-item{width:calc((100% - 4px)/2)}.vp-sponsor-grid[data-vp-grid="3"] .vp-sponsor-grid-item{width:calc((100% - 4px * 2) / 3)}.vp-sponsor-grid[data-vp-grid="4"] .vp-sponsor-grid-item{width:calc((100% - 12px)/4)}.vp-sponsor-grid[data-vp-grid="5"] .vp-sponsor-grid-item{width:calc((100% - 16px)/5)}.vp-sponsor-grid[data-vp-grid="6"] .vp-sponsor-grid-item{width:calc((100% - 4px * 5) / 6)}.vp-sponsor-grid-item{flex-shrink:0;width:100%;background-color:var(--vp-c-bg-soft);transition:background-color .25s}.vp-sponsor-grid-item:hover{background-color:var(--vp-c-default-soft)}.vp-sponsor-grid-item:hover .vp-sponsor-grid-image{filter:grayscale(0) invert(0)}.vp-sponsor-grid-item.empty:hover{background-color:var(--vp-c-bg-soft)}.dark .vp-sponsor-grid-item:hover{background-color:var(--vp-c-white)}.dark .vp-sponsor-grid-item.empty:hover{background-color:var(--vp-c-bg-soft)}.vp-sponsor-grid-link{display:flex}.vp-sponsor-grid-box{display:flex;justify-content:center;align-items:center;width:100%}.vp-sponsor-grid-image{max-width:100%;filter:grayscale(1);transition:filter .25s}.dark .vp-sponsor-grid-image{filter:grayscale(1) invert(1)}.VPBadge{display:inline-block;margin-left:2px;border:1px solid transparent;border-radius:12px;padding:0 10px;line-height:22px;font-size:12px;font-weight:500;transform:translateY(-2px)}.VPBadge.small{padding:0 6px;line-height:18px;font-size:10px;transform:translateY(-8px)}.VPDocFooter .VPBadge{display:none}.vp-doc h1>.VPBadge{margin-top:4px;vertical-align:top}.vp-doc h2>.VPBadge{margin-top:3px;padding:0 8px;vertical-align:top}.vp-doc h3>.VPBadge{vertical-align:middle}.vp-doc h4>.VPBadge,.vp-doc h5>.VPBadge,.vp-doc h6>.VPBadge{vertical-align:middle;line-height:18px}.VPBadge.info{border-color:var(--vp-badge-info-border);color:var(--vp-badge-info-text);background-color:var(--vp-badge-info-bg)}.VPBadge.tip{border-color:var(--vp-badge-tip-border);color:var(--vp-badge-tip-text);background-color:var(--vp-badge-tip-bg)}.VPBadge.warning{border-color:var(--vp-badge-warning-border);color:var(--vp-badge-warning-text);background-color:var(--vp-badge-warning-bg)}.VPBadge.danger{border-color:var(--vp-badge-danger-border);color:var(--vp-badge-danger-text);background-color:var(--vp-badge-danger-bg)}.VPBackdrop[data-v-c79a1216]{position:fixed;top:0;right:0;bottom:0;left:0;z-index:var(--vp-z-index-backdrop);background:var(--vp-backdrop-bg-color);transition:opacity .5s}.VPBackdrop.fade-enter-from[data-v-c79a1216],.VPBackdrop.fade-leave-to[data-v-c79a1216]{opacity:0}.VPBackdrop.fade-leave-active[data-v-c79a1216]{transition-duration:.25s}@media (min-width: 1280px){.VPBackdrop[data-v-c79a1216]{display:none}}.NotFound[data-v-d6be1790]{padding:64px 24px 96px;text-align:center}@media (min-width: 768px){.NotFound[data-v-d6be1790]{padding:96px 32px 168px}}.code[data-v-d6be1790]{line-height:64px;font-size:64px;font-weight:600}.title[data-v-d6be1790]{padding-top:12px;letter-spacing:2px;line-height:20px;font-size:20px;font-weight:700}.divider[data-v-d6be1790]{margin:24px auto 18px;width:64px;height:1px;background-color:var(--vp-c-divider)}.quote[data-v-d6be1790]{margin:0 auto;max-width:256px;font-size:14px;font-weight:500;color:var(--vp-c-text-2)}.action[data-v-d6be1790]{padding-top:20px}.link[data-v-d6be1790]{display:inline-block;border:1px solid var(--vp-c-brand-1);border-radius:16px;padding:3px 16px;font-size:14px;font-weight:500;color:var(--vp-c-brand-1);transition:border-color .25s,color .25s}.link[data-v-d6be1790]:hover{border-color:var(--vp-c-brand-2);color:var(--vp-c-brand-2)}.root[data-v-b933a997]{position:relative;z-index:1}.nested[data-v-b933a997]{padding-right:16px;padding-left:16px}.outline-link[data-v-b933a997]{display:block;line-height:32px;font-size:14px;font-weight:400;color:var(--vp-c-text-2);white-space:nowrap;overflow:hidden;text-overflow:ellipsis;transition:color .5s}.outline-link[data-v-b933a997]:hover,.outline-link.active[data-v-b933a997]{color:var(--vp-c-text-1);transition:color .25s}.outline-link.nested[data-v-b933a997]{padding-left:13px}.VPDocAsideOutline[data-v-a5bbad30]{display:none}.VPDocAsideOutline.has-outline[data-v-a5bbad30]{display:block}.content[data-v-a5bbad30]{position:relative;border-left:1px solid var(--vp-c-divider);padding-left:16px;font-size:13px;font-weight:500}.outline-marker[data-v-a5bbad30]{position:absolute;top:32px;left:-1px;z-index:0;opacity:0;width:2px;border-radius:2px;height:18px;background-color:var(--vp-c-brand-1);transition:top .25s cubic-bezier(0,1,.5,1),background-color .5s,opacity .25s}.outline-title[data-v-a5bbad30]{line-height:32px;font-size:14px;font-weight:600}.VPDocAside[data-v-3f215769]{display:flex;flex-direction:column;flex-grow:1}.spacer[data-v-3f215769]{flex-grow:1}.VPDocAside[data-v-3f215769] .spacer+.VPDocAsideSponsors,.VPDocAside[data-v-3f215769] .spacer+.VPDocAsideCarbonAds{margin-top:24px}.VPDocAside[data-v-3f215769] .VPDocAsideSponsors+.VPDocAsideCarbonAds{margin-top:16px}.VPLastUpdated[data-v-e98dd255]{line-height:24px;font-size:14px;font-weight:500;color:var(--vp-c-text-2)}@media (min-width: 640px){.VPLastUpdated[data-v-e98dd255]{line-height:32px;font-size:14px;font-weight:500}}.VPDocFooter[data-v-e257564d]{margin-top:64px}.edit-info[data-v-e257564d]{padding-bottom:18px}@media (min-width: 640px){.edit-info[data-v-e257564d]{display:flex;justify-content:space-between;align-items:center;padding-bottom:14px}}.edit-link-button[data-v-e257564d]{display:flex;align-items:center;border:0;line-height:32px;font-size:14px;font-weight:500;color:var(--vp-c-brand-1);transition:color .25s}.edit-link-button[data-v-e257564d]:hover{color:var(--vp-c-brand-2)}.edit-link-icon[data-v-e257564d]{margin-right:8px}.prev-next[data-v-e257564d]{border-top:1px solid var(--vp-c-divider);padding-top:24px;display:grid;grid-row-gap:8px}@media (min-width: 640px){.prev-next[data-v-e257564d]{grid-template-columns:repeat(2,1fr);grid-column-gap:16px}}.pager-link[data-v-e257564d]{display:block;border:1px solid var(--vp-c-divider);border-radius:8px;padding:11px 16px 13px;width:100%;height:100%;transition:border-color .25s}.pager-link[data-v-e257564d]:hover{border-color:var(--vp-c-brand-1)}.pager-link.next[data-v-e257564d]{margin-left:auto;text-align:right}.desc[data-v-e257564d]{display:block;line-height:20px;font-size:12px;font-weight:500;color:var(--vp-c-text-2)}.title[data-v-e257564d]{display:block;line-height:20px;font-size:14px;font-weight:500;color:var(--vp-c-brand-1);transition:color .25s}.VPDoc[data-v-39a288b8]{padding:32px 24px 96px;width:100%}@media (min-width: 768px){.VPDoc[data-v-39a288b8]{padding:48px 32px 128px}}@media (min-width: 960px){.VPDoc[data-v-39a288b8]{padding:48px 32px 0}.VPDoc:not(.has-sidebar) .container[data-v-39a288b8]{display:flex;justify-content:center;max-width:992px}.VPDoc:not(.has-sidebar) .content[data-v-39a288b8]{max-width:752px}}@media (min-width: 1280px){.VPDoc .container[data-v-39a288b8]{display:flex;justify-content:center}.VPDoc .aside[data-v-39a288b8]{display:block}}@media (min-width: 1440px){.VPDoc:not(.has-sidebar) .content[data-v-39a288b8]{max-width:784px}.VPDoc:not(.has-sidebar) .container[data-v-39a288b8]{max-width:1104px}}.container[data-v-39a288b8]{margin:0 auto;width:100%}.aside[data-v-39a288b8]{position:relative;display:none;order:2;flex-grow:1;padding-left:32px;width:100%;max-width:256px}.left-aside[data-v-39a288b8]{order:1;padding-left:unset;padding-right:32px}.aside-container[data-v-39a288b8]{position:fixed;top:0;padding-top:calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + var(--vp-doc-top-height, 0px) + 48px);width:224px;height:100vh;overflow-x:hidden;overflow-y:auto;scrollbar-width:none}.aside-container[data-v-39a288b8]::-webkit-scrollbar{display:none}.aside-curtain[data-v-39a288b8]{position:fixed;bottom:0;z-index:10;width:224px;height:32px;background:linear-gradient(transparent,var(--vp-c-bg) 70%)}.aside-content[data-v-39a288b8]{display:flex;flex-direction:column;min-height:calc(100vh - (var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 48px));padding-bottom:32px}.content[data-v-39a288b8]{position:relative;margin:0 auto;width:100%}@media (min-width: 960px){.content[data-v-39a288b8]{padding:0 32px 128px}}@media (min-width: 1280px){.content[data-v-39a288b8]{order:1;margin:0;min-width:640px}}.content-container[data-v-39a288b8]{margin:0 auto}.VPDoc.has-aside .content-container[data-v-39a288b8]{max-width:688px}.VPButton[data-v-fa7799d5]{display:inline-block;border:1px solid transparent;text-align:center;font-weight:600;white-space:nowrap;transition:color .25s,border-color .25s,background-color .25s}.VPButton[data-v-fa7799d5]:active{transition:color .1s,border-color .1s,background-color .1s}.VPButton.medium[data-v-fa7799d5]{border-radius:20px;padding:0 20px;line-height:38px;font-size:14px}.VPButton.big[data-v-fa7799d5]{border-radius:24px;padding:0 24px;line-height:46px;font-size:16px}.VPButton.brand[data-v-fa7799d5]{border-color:var(--vp-button-brand-border);color:var(--vp-button-brand-text);background-color:var(--vp-button-brand-bg)}.VPButton.brand[data-v-fa7799d5]:hover{border-color:var(--vp-button-brand-hover-border);color:var(--vp-button-brand-hover-text);background-color:var(--vp-button-brand-hover-bg)}.VPButton.brand[data-v-fa7799d5]:active{border-color:var(--vp-button-brand-active-border);color:var(--vp-button-brand-active-text);background-color:var(--vp-button-brand-active-bg)}.VPButton.alt[data-v-fa7799d5]{border-color:var(--vp-button-alt-border);color:var(--vp-button-alt-text);background-color:var(--vp-button-alt-bg)}.VPButton.alt[data-v-fa7799d5]:hover{border-color:var(--vp-button-alt-hover-border);color:var(--vp-button-alt-hover-text);background-color:var(--vp-button-alt-hover-bg)}.VPButton.alt[data-v-fa7799d5]:active{border-color:var(--vp-button-alt-active-border);color:var(--vp-button-alt-active-text);background-color:var(--vp-button-alt-active-bg)}.VPButton.sponsor[data-v-fa7799d5]{border-color:var(--vp-button-sponsor-border);color:var(--vp-button-sponsor-text);background-color:var(--vp-button-sponsor-bg)}.VPButton.sponsor[data-v-fa7799d5]:hover{border-color:var(--vp-button-sponsor-hover-border);color:var(--vp-button-sponsor-hover-text);background-color:var(--vp-button-sponsor-hover-bg)}.VPButton.sponsor[data-v-fa7799d5]:active{border-color:var(--vp-button-sponsor-active-border);color:var(--vp-button-sponsor-active-text);background-color:var(--vp-button-sponsor-active-bg)}html:not(.dark) .VPImage.dark[data-v-8426fc1a]{display:none}.dark .VPImage.light[data-v-8426fc1a]{display:none}.VPHero[data-v-4f9c455b]{margin-top:calc((var(--vp-nav-height) + var(--vp-layout-top-height, 0px)) * -1);padding:calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 48px) 24px 48px}@media (min-width: 640px){.VPHero[data-v-4f9c455b]{padding:calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 80px) 48px 64px}}@media (min-width: 960px){.VPHero[data-v-4f9c455b]{padding:calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 80px) 64px 64px}}.container[data-v-4f9c455b]{display:flex;flex-direction:column;margin:0 auto;max-width:1152px}@media (min-width: 960px){.container[data-v-4f9c455b]{flex-direction:row}}.main[data-v-4f9c455b]{position:relative;z-index:10;order:2;flex-grow:1;flex-shrink:0}.VPHero.has-image .container[data-v-4f9c455b]{text-align:center}@media (min-width: 960px){.VPHero.has-image .container[data-v-4f9c455b]{text-align:left}}@media (min-width: 960px){.main[data-v-4f9c455b]{order:1;width:calc((100% / 3) * 2)}.VPHero.has-image .main[data-v-4f9c455b]{max-width:592px}}.heading[data-v-4f9c455b]{display:flex;flex-direction:column}.name[data-v-4f9c455b],.text[data-v-4f9c455b]{width:fit-content;max-width:392px;letter-spacing:-.4px;line-height:40px;font-size:32px;font-weight:700;white-space:pre-wrap}.VPHero.has-image .name[data-v-4f9c455b],.VPHero.has-image .text[data-v-4f9c455b]{margin:0 auto}.name[data-v-4f9c455b]{color:var(--vp-home-hero-name-color)}.clip[data-v-4f9c455b]{background:var(--vp-home-hero-name-background);-webkit-background-clip:text;background-clip:text;-webkit-text-fill-color:var(--vp-home-hero-name-color)}@media (min-width: 640px){.name[data-v-4f9c455b],.text[data-v-4f9c455b]{max-width:576px;line-height:56px;font-size:48px}}@media (min-width: 960px){.name[data-v-4f9c455b],.text[data-v-4f9c455b]{line-height:64px;font-size:56px}.VPHero.has-image .name[data-v-4f9c455b],.VPHero.has-image .text[data-v-4f9c455b]{margin:0}}.tagline[data-v-4f9c455b]{padding-top:8px;max-width:392px;line-height:28px;font-size:18px;font-weight:500;white-space:pre-wrap;color:var(--vp-c-text-2)}.VPHero.has-image .tagline[data-v-4f9c455b]{margin:0 auto}@media (min-width: 640px){.tagline[data-v-4f9c455b]{padding-top:12px;max-width:576px;line-height:32px;font-size:20px}}@media (min-width: 960px){.tagline[data-v-4f9c455b]{line-height:36px;font-size:24px}.VPHero.has-image .tagline[data-v-4f9c455b]{margin:0}}.actions[data-v-4f9c455b]{display:flex;flex-wrap:wrap;margin:-6px;padding-top:24px}.VPHero.has-image .actions[data-v-4f9c455b]{justify-content:center}@media (min-width: 640px){.actions[data-v-4f9c455b]{padding-top:32px}}@media (min-width: 960px){.VPHero.has-image .actions[data-v-4f9c455b]{justify-content:flex-start}}.action[data-v-4f9c455b]{flex-shrink:0;padding:6px}.image[data-v-4f9c455b]{order:1;margin:-76px -24px -48px}@media (min-width: 640px){.image[data-v-4f9c455b]{margin:-108px -24px -48px}}@media (min-width: 960px){.image[data-v-4f9c455b]{flex-grow:1;order:2;margin:0;min-height:100%}}.image-container[data-v-4f9c455b]{position:relative;margin:0 auto;width:320px;height:320px}@media (min-width: 640px){.image-container[data-v-4f9c455b]{width:392px;height:392px}}@media (min-width: 960px){.image-container[data-v-4f9c455b]{display:flex;justify-content:center;align-items:center;width:100%;height:100%;transform:translate(-32px,-32px)}}.image-bg[data-v-4f9c455b]{position:absolute;top:50%;left:50%;border-radius:50%;width:192px;height:192px;background-image:var(--vp-home-hero-image-background-image);filter:var(--vp-home-hero-image-filter);transform:translate(-50%,-50%)}@media (min-width: 640px){.image-bg[data-v-4f9c455b]{width:256px;height:256px}}@media (min-width: 960px){.image-bg[data-v-4f9c455b]{width:320px;height:320px}}[data-v-4f9c455b] .image-src{position:absolute;top:50%;left:50%;max-width:192px;max-height:192px;transform:translate(-50%,-50%)}@media (min-width: 640px){[data-v-4f9c455b] .image-src{max-width:256px;max-height:256px}}@media (min-width: 960px){[data-v-4f9c455b] .image-src{max-width:320px;max-height:320px}}.VPFeature[data-v-a3976bdc]{display:block;border:1px solid var(--vp-c-bg-soft);border-radius:12px;height:100%;background-color:var(--vp-c-bg-soft);transition:border-color .25s,background-color .25s}.VPFeature.link[data-v-a3976bdc]:hover{border-color:var(--vp-c-brand-1)}.box[data-v-a3976bdc]{display:flex;flex-direction:column;padding:24px;height:100%}.box[data-v-a3976bdc]>.VPImage{margin-bottom:20px}.icon[data-v-a3976bdc]{display:flex;justify-content:center;align-items:center;margin-bottom:20px;border-radius:6px;background-color:var(--vp-c-default-soft);width:48px;height:48px;font-size:24px;transition:background-color .25s}.title[data-v-a3976bdc]{line-height:24px;font-size:16px;font-weight:600}.details[data-v-a3976bdc]{flex-grow:1;padding-top:8px;line-height:24px;font-size:14px;font-weight:500;color:var(--vp-c-text-2)}.link-text[data-v-a3976bdc]{padding-top:8px}.link-text-value[data-v-a3976bdc]{display:flex;align-items:center;font-size:14px;font-weight:500;color:var(--vp-c-brand-1)}.link-text-icon[data-v-a3976bdc]{margin-left:6px}.VPFeatures[data-v-a6181336]{position:relative;padding:0 24px}@media (min-width: 640px){.VPFeatures[data-v-a6181336]{padding:0 48px}}@media (min-width: 960px){.VPFeatures[data-v-a6181336]{padding:0 64px}}.container[data-v-a6181336]{margin:0 auto;max-width:1152px}.items[data-v-a6181336]{display:flex;flex-wrap:wrap;margin:-8px}.item[data-v-a6181336]{padding:8px;width:100%}@media (min-width: 640px){.item.grid-2[data-v-a6181336],.item.grid-4[data-v-a6181336],.item.grid-6[data-v-a6181336]{width:50%}}@media (min-width: 768px){.item.grid-2[data-v-a6181336],.item.grid-4[data-v-a6181336]{width:50%}.item.grid-3[data-v-a6181336],.item.grid-6[data-v-a6181336]{width:calc(100% / 3)}}@media (min-width: 960px){.item.grid-4[data-v-a6181336]{width:25%}}.container[data-v-8e2d4988]{margin:auto;width:100%;max-width:1280px;padding:0 24px}@media (min-width: 640px){.container[data-v-8e2d4988]{padding:0 48px}}@media (min-width: 960px){.container[data-v-8e2d4988]{width:100%;padding:0 64px}}.vp-doc[data-v-8e2d4988] .VPHomeSponsors,.vp-doc[data-v-8e2d4988] .VPTeamPage{margin-left:var(--vp-offset, calc(50% - 50vw) );margin-right:var(--vp-offset, calc(50% - 50vw) )}.vp-doc[data-v-8e2d4988] .VPHomeSponsors h2{border-top:none;letter-spacing:normal}.vp-doc[data-v-8e2d4988] .VPHomeSponsors a,.vp-doc[data-v-8e2d4988] .VPTeamPage a{text-decoration:none}.VPHome[data-v-8b561e3d]{margin-bottom:96px}@media (min-width: 768px){.VPHome[data-v-8b561e3d]{margin-bottom:128px}}.VPContent[data-v-1428d186]{flex-grow:1;flex-shrink:0;margin:var(--vp-layout-top-height, 0px) auto 0;width:100%}.VPContent.is-home[data-v-1428d186]{width:100%;max-width:100%}.VPContent.has-sidebar[data-v-1428d186]{margin:0}@media (min-width: 960px){.VPContent[data-v-1428d186]{padding-top:var(--vp-nav-height)}.VPContent.has-sidebar[data-v-1428d186]{margin:var(--vp-layout-top-height, 0px) 0 0;padding-left:var(--vp-sidebar-width)}}@media (min-width: 1440px){.VPContent.has-sidebar[data-v-1428d186]{padding-right:calc((100vw - var(--vp-layout-max-width)) / 2);padding-left:calc((100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width))}}.VPFooter[data-v-e315a0ad]{position:relative;z-index:var(--vp-z-index-footer);border-top:1px solid var(--vp-c-gutter);padding:32px 24px;background-color:var(--vp-c-bg)}.VPFooter.has-sidebar[data-v-e315a0ad]{display:none}.VPFooter[data-v-e315a0ad] a{text-decoration-line:underline;text-underline-offset:2px;transition:color .25s}.VPFooter[data-v-e315a0ad] a:hover{color:var(--vp-c-text-1)}@media (min-width: 768px){.VPFooter[data-v-e315a0ad]{padding:32px}}.container[data-v-e315a0ad]{margin:0 auto;max-width:var(--vp-layout-max-width);text-align:center}.message[data-v-e315a0ad],.copyright[data-v-e315a0ad]{line-height:24px;font-size:14px;font-weight:500;color:var(--vp-c-text-2)}.VPLocalNavOutlineDropdown[data-v-8a42e2b4]{padding:12px 20px 11px}@media (min-width: 960px){.VPLocalNavOutlineDropdown[data-v-8a42e2b4]{padding:12px 36px 11px}}.VPLocalNavOutlineDropdown button[data-v-8a42e2b4]{display:block;font-size:12px;font-weight:500;line-height:24px;color:var(--vp-c-text-2);transition:color .5s;position:relative}.VPLocalNavOutlineDropdown button[data-v-8a42e2b4]:hover{color:var(--vp-c-text-1);transition:color .25s}.VPLocalNavOutlineDropdown button.open[data-v-8a42e2b4]{color:var(--vp-c-text-1)}.icon[data-v-8a42e2b4]{display:inline-block;vertical-align:middle;margin-left:2px;font-size:14px;transform:rotate(0);transition:transform .25s}@media (min-width: 960px){.VPLocalNavOutlineDropdown button[data-v-8a42e2b4]{font-size:14px}.icon[data-v-8a42e2b4]{font-size:16px}}.open>.icon[data-v-8a42e2b4]{transform:rotate(90deg)}.items[data-v-8a42e2b4]{position:absolute;top:40px;right:16px;left:16px;display:grid;gap:1px;border:1px solid var(--vp-c-border);border-radius:8px;background-color:var(--vp-c-gutter);max-height:calc(var(--vp-vh, 100vh) - 86px);overflow:hidden auto;box-shadow:var(--vp-shadow-3)}@media (min-width: 960px){.items[data-v-8a42e2b4]{right:auto;left:calc(var(--vp-sidebar-width) + 32px);width:320px}}.header[data-v-8a42e2b4]{background-color:var(--vp-c-bg-soft)}.top-link[data-v-8a42e2b4]{display:block;padding:0 16px;line-height:48px;font-size:14px;font-weight:500;color:var(--vp-c-brand-1)}.outline[data-v-8a42e2b4]{padding:8px 0;background-color:var(--vp-c-bg-soft)}.flyout-enter-active[data-v-8a42e2b4]{transition:all .2s ease-out}.flyout-leave-active[data-v-8a42e2b4]{transition:all .15s ease-in}.flyout-enter-from[data-v-8a42e2b4],.flyout-leave-to[data-v-8a42e2b4]{opacity:0;transform:translateY(-16px)}.VPLocalNav[data-v-a6f0e41e]{position:sticky;top:0;left:0;z-index:var(--vp-z-index-local-nav);border-bottom:1px solid var(--vp-c-gutter);padding-top:var(--vp-layout-top-height, 0px);width:100%;background-color:var(--vp-local-nav-bg-color)}.VPLocalNav.fixed[data-v-a6f0e41e]{position:fixed}@media (min-width: 960px){.VPLocalNav[data-v-a6f0e41e]{top:var(--vp-nav-height)}.VPLocalNav.has-sidebar[data-v-a6f0e41e]{padding-left:var(--vp-sidebar-width)}.VPLocalNav.empty[data-v-a6f0e41e]{display:none}}@media (min-width: 1280px){.VPLocalNav[data-v-a6f0e41e]{display:none}}@media (min-width: 1440px){.VPLocalNav.has-sidebar[data-v-a6f0e41e]{padding-left:calc((100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width))}}.container[data-v-a6f0e41e]{display:flex;justify-content:space-between;align-items:center}.menu[data-v-a6f0e41e]{display:flex;align-items:center;padding:12px 24px 11px;line-height:24px;font-size:12px;font-weight:500;color:var(--vp-c-text-2);transition:color .5s}.menu[data-v-a6f0e41e]:hover{color:var(--vp-c-text-1);transition:color .25s}@media (min-width: 768px){.menu[data-v-a6f0e41e]{padding:0 32px}}@media (min-width: 960px){.menu[data-v-a6f0e41e]{display:none}}.menu-icon[data-v-a6f0e41e]{margin-right:8px;font-size:14px}.VPOutlineDropdown[data-v-a6f0e41e]{padding:12px 24px 11px}@media (min-width: 768px){.VPOutlineDropdown[data-v-a6f0e41e]{padding:12px 32px 11px}}.VPSwitch[data-v-1d5665e3]{position:relative;border-radius:11px;display:block;width:40px;height:22px;flex-shrink:0;border:1px solid var(--vp-input-border-color);background-color:var(--vp-input-switch-bg-color);transition:border-color .25s!important}.VPSwitch[data-v-1d5665e3]:hover{border-color:var(--vp-c-brand-1)}.check[data-v-1d5665e3]{position:absolute;top:1px;left:1px;width:18px;height:18px;border-radius:50%;background-color:var(--vp-c-neutral-inverse);box-shadow:var(--vp-shadow-1);transition:transform .25s!important}.icon[data-v-1d5665e3]{position:relative;display:block;width:18px;height:18px;border-radius:50%;overflow:hidden}.icon[data-v-1d5665e3] [class^=vpi-]{position:absolute;top:3px;left:3px;width:12px;height:12px;color:var(--vp-c-text-2)}.dark .icon[data-v-1d5665e3] [class^=vpi-]{color:var(--vp-c-text-1);transition:opacity .25s!important}.sun[data-v-5337faa4]{opacity:1}.moon[data-v-5337faa4],.dark .sun[data-v-5337faa4]{opacity:0}.dark .moon[data-v-5337faa4]{opacity:1}.dark .VPSwitchAppearance[data-v-5337faa4] .check{transform:translate(18px)}.VPNavBarAppearance[data-v-6c893767]{display:none}@media (min-width: 1280px){.VPNavBarAppearance[data-v-6c893767]{display:flex;align-items:center}}.VPMenuGroup+.VPMenuLink[data-v-35975db6]{margin:12px -12px 0;border-top:1px solid var(--vp-c-divider);padding:12px 12px 0}.link[data-v-35975db6]{display:block;border-radius:6px;padding:0 12px;line-height:32px;font-size:14px;font-weight:500;color:var(--vp-c-text-1);white-space:nowrap;transition:background-color .25s,color .25s}.link[data-v-35975db6]:hover{color:var(--vp-c-brand-1);background-color:var(--vp-c-default-soft)}.link.active[data-v-35975db6]{color:var(--vp-c-brand-1)}.VPMenuGroup[data-v-69e747b5]{margin:12px -12px 0;border-top:1px solid var(--vp-c-divider);padding:12px 12px 0}.VPMenuGroup[data-v-69e747b5]:first-child{margin-top:0;border-top:0;padding-top:0}.VPMenuGroup+.VPMenuGroup[data-v-69e747b5]{margin-top:12px;border-top:1px solid var(--vp-c-divider)}.title[data-v-69e747b5]{padding:0 12px;line-height:32px;font-size:14px;font-weight:600;color:var(--vp-c-text-2);white-space:nowrap;transition:color .25s}.VPMenu[data-v-b98bc113]{border-radius:12px;padding:12px;min-width:128px;border:1px solid var(--vp-c-divider);background-color:var(--vp-c-bg-elv);box-shadow:var(--vp-shadow-3);transition:background-color .5s;max-height:calc(100vh - var(--vp-nav-height));overflow-y:auto}.VPMenu[data-v-b98bc113] .group{margin:0 -12px;padding:0 12px 12px}.VPMenu[data-v-b98bc113] .group+.group{border-top:1px solid var(--vp-c-divider);padding:11px 12px 12px}.VPMenu[data-v-b98bc113] .group:last-child{padding-bottom:0}.VPMenu[data-v-b98bc113] .group+.item{border-top:1px solid var(--vp-c-divider);padding:11px 16px 0}.VPMenu[data-v-b98bc113] .item{padding:0 16px;white-space:nowrap}.VPMenu[data-v-b98bc113] .label{flex-grow:1;line-height:28px;font-size:12px;font-weight:500;color:var(--vp-c-text-2);transition:color .5s}.VPMenu[data-v-b98bc113] .action{padding-left:24px}.VPFlyout[data-v-cf11d7a2]{position:relative}.VPFlyout[data-v-cf11d7a2]:hover{color:var(--vp-c-brand-1);transition:color .25s}.VPFlyout:hover .text[data-v-cf11d7a2]{color:var(--vp-c-text-2)}.VPFlyout:hover .icon[data-v-cf11d7a2]{fill:var(--vp-c-text-2)}.VPFlyout.active .text[data-v-cf11d7a2]{color:var(--vp-c-brand-1)}.VPFlyout.active:hover .text[data-v-cf11d7a2]{color:var(--vp-c-brand-2)}.button[aria-expanded=false]+.menu[data-v-cf11d7a2]{opacity:0;visibility:hidden;transform:translateY(0)}.VPFlyout:hover .menu[data-v-cf11d7a2],.button[aria-expanded=true]+.menu[data-v-cf11d7a2]{opacity:1;visibility:visible;transform:translateY(0)}.button[data-v-cf11d7a2]{display:flex;align-items:center;padding:0 12px;height:var(--vp-nav-height);color:var(--vp-c-text-1);transition:color .5s}.text[data-v-cf11d7a2]{display:flex;align-items:center;line-height:var(--vp-nav-height);font-size:14px;font-weight:500;color:var(--vp-c-text-1);transition:color .25s}.option-icon[data-v-cf11d7a2]{margin-right:0;font-size:16px}.text-icon[data-v-cf11d7a2]{margin-left:4px;font-size:14px}.icon[data-v-cf11d7a2]{font-size:20px;transition:fill .25s}.menu[data-v-cf11d7a2]{position:absolute;top:calc(var(--vp-nav-height) / 2 + 20px);right:0;opacity:0;visibility:hidden;transition:opacity .25s,visibility .25s,transform .25s}.VPSocialLink[data-v-bd121fe5]{display:flex;justify-content:center;align-items:center;width:36px;height:36px;color:var(--vp-c-text-2);transition:color .5s}.VPSocialLink[data-v-bd121fe5]:hover{color:var(--vp-c-text-1);transition:color .25s}.VPSocialLink[data-v-bd121fe5]>svg,.VPSocialLink[data-v-bd121fe5]>[class^=vpi-social-]{width:20px;height:20px;fill:currentColor}.VPSocialLinks[data-v-7bc22406]{display:flex;justify-content:center}.VPNavBarExtra[data-v-bb2aa2f0]{display:none;margin-right:-12px}@media (min-width: 768px){.VPNavBarExtra[data-v-bb2aa2f0]{display:block}}@media (min-width: 1280px){.VPNavBarExtra[data-v-bb2aa2f0]{display:none}}.trans-title[data-v-bb2aa2f0]{padding:0 24px 0 12px;line-height:32px;font-size:14px;font-weight:700;color:var(--vp-c-text-1)}.item.appearance[data-v-bb2aa2f0],.item.social-links[data-v-bb2aa2f0]{display:flex;align-items:center;padding:0 12px}.item.appearance[data-v-bb2aa2f0]{min-width:176px}.appearance-action[data-v-bb2aa2f0]{margin-right:-2px}.social-links-list[data-v-bb2aa2f0]{margin:-4px -8px}.VPNavBarHamburger[data-v-e5dd9c1c]{display:flex;justify-content:center;align-items:center;width:48px;height:var(--vp-nav-height)}@media (min-width: 768px){.VPNavBarHamburger[data-v-e5dd9c1c]{display:none}}.container[data-v-e5dd9c1c]{position:relative;width:16px;height:14px;overflow:hidden}.VPNavBarHamburger:hover .top[data-v-e5dd9c1c]{top:0;left:0;transform:translate(4px)}.VPNavBarHamburger:hover .middle[data-v-e5dd9c1c]{top:6px;left:0;transform:translate(0)}.VPNavBarHamburger:hover .bottom[data-v-e5dd9c1c]{top:12px;left:0;transform:translate(8px)}.VPNavBarHamburger.active .top[data-v-e5dd9c1c]{top:6px;transform:translate(0) rotate(225deg)}.VPNavBarHamburger.active .middle[data-v-e5dd9c1c]{top:6px;transform:translate(16px)}.VPNavBarHamburger.active .bottom[data-v-e5dd9c1c]{top:6px;transform:translate(0) rotate(135deg)}.VPNavBarHamburger.active:hover .top[data-v-e5dd9c1c],.VPNavBarHamburger.active:hover .middle[data-v-e5dd9c1c],.VPNavBarHamburger.active:hover .bottom[data-v-e5dd9c1c]{background-color:var(--vp-c-text-2);transition:top .25s,background-color .25s,transform .25s}.top[data-v-e5dd9c1c],.middle[data-v-e5dd9c1c],.bottom[data-v-e5dd9c1c]{position:absolute;width:16px;height:2px;background-color:var(--vp-c-text-1);transition:top .25s,background-color .5s,transform .25s}.top[data-v-e5dd9c1c]{top:0;left:0;transform:translate(0)}.middle[data-v-e5dd9c1c]{top:6px;left:0;transform:translate(8px)}.bottom[data-v-e5dd9c1c]{top:12px;left:0;transform:translate(4px)}.VPNavBarMenuLink[data-v-e56f3d57]{display:flex;align-items:center;padding:0 12px;line-height:var(--vp-nav-height);font-size:14px;font-weight:500;color:var(--vp-c-text-1);transition:color .25s}.VPNavBarMenuLink.active[data-v-e56f3d57],.VPNavBarMenuLink[data-v-e56f3d57]:hover{color:var(--vp-c-brand-1)}.VPNavBarMenu[data-v-dc692963]{display:none}@media (min-width: 768px){.VPNavBarMenu[data-v-dc692963]{display:flex}}/*! @docsearch/css 3.8.2 | MIT License | © Algolia, Inc. and contributors | https://docsearch.algolia.com */:root{--docsearch-primary-color:#5468ff;--docsearch-text-color:#1c1e21;--docsearch-spacing:12px;--docsearch-icon-stroke-width:1.4;--docsearch-highlight-color:var(--docsearch-primary-color);--docsearch-muted-color:#969faf;--docsearch-container-background:rgba(101,108,133,.8);--docsearch-logo-color:#5468ff;--docsearch-modal-width:560px;--docsearch-modal-height:600px;--docsearch-modal-background:#f5f6f7;--docsearch-modal-shadow:inset 1px 1px 0 0 hsla(0,0%,100%,.5),0 3px 8px 0 #555a64;--docsearch-searchbox-height:56px;--docsearch-searchbox-background:#ebedf0;--docsearch-searchbox-focus-background:#fff;--docsearch-searchbox-shadow:inset 0 0 0 2px var(--docsearch-primary-color);--docsearch-hit-height:56px;--docsearch-hit-color:#444950;--docsearch-hit-active-color:#fff;--docsearch-hit-background:#fff;--docsearch-hit-shadow:0 1px 3px 0 #d4d9e1;--docsearch-key-gradient:linear-gradient(-225deg,#d5dbe4,#f8f8f8);--docsearch-key-shadow:inset 0 -2px 0 0 #cdcde6,inset 0 0 1px 1px #fff,0 1px 2px 1px rgba(30,35,90,.4);--docsearch-key-pressed-shadow:inset 0 -2px 0 0 #cdcde6,inset 0 0 1px 1px #fff,0 1px 1px 0 rgba(30,35,90,.4);--docsearch-footer-height:44px;--docsearch-footer-background:#fff;--docsearch-footer-shadow:0 -1px 0 0 #e0e3e8,0 -3px 6px 0 rgba(69,98,155,.12)}html[data-theme=dark]{--docsearch-text-color:#f5f6f7;--docsearch-container-background:rgba(9,10,17,.8);--docsearch-modal-background:#15172a;--docsearch-modal-shadow:inset 1px 1px 0 0 #2c2e40,0 3px 8px 0 #000309;--docsearch-searchbox-background:#090a11;--docsearch-searchbox-focus-background:#000;--docsearch-hit-color:#bec3c9;--docsearch-hit-shadow:none;--docsearch-hit-background:#090a11;--docsearch-key-gradient:linear-gradient(-26.5deg,#565872,#31355b);--docsearch-key-shadow:inset 0 -2px 0 0 #282d55,inset 0 0 1px 1px #51577d,0 2px 2px 0 rgba(3,4,9,.3);--docsearch-key-pressed-shadow:inset 0 -2px 0 0 #282d55,inset 0 0 1px 1px #51577d,0 1px 1px 0 #0304094d;--docsearch-footer-background:#1e2136;--docsearch-footer-shadow:inset 0 1px 0 0 rgba(73,76,106,.5),0 -4px 8px 0 rgba(0,0,0,.2);--docsearch-logo-color:#fff;--docsearch-muted-color:#7f8497}.DocSearch-Button{align-items:center;background:var(--docsearch-searchbox-background);border:0;border-radius:40px;color:var(--docsearch-muted-color);cursor:pointer;display:flex;font-weight:500;height:36px;justify-content:space-between;margin:0 0 0 16px;padding:0 8px;-webkit-user-select:none;user-select:none}.DocSearch-Button:active,.DocSearch-Button:focus,.DocSearch-Button:hover{background:var(--docsearch-searchbox-focus-background);box-shadow:var(--docsearch-searchbox-shadow);color:var(--docsearch-text-color);outline:none}.DocSearch-Button-Container{align-items:center;display:flex}.DocSearch-Search-Icon{stroke-width:1.6}.DocSearch-Button .DocSearch-Search-Icon{color:var(--docsearch-text-color)}.DocSearch-Button-Placeholder{font-size:1rem;padding:0 12px 0 6px}.DocSearch-Button-Keys{display:flex;min-width:calc(40px + .8em)}.DocSearch-Button-Key{align-items:center;background:var(--docsearch-key-gradient);border:0;border-radius:3px;box-shadow:var(--docsearch-key-shadow);color:var(--docsearch-muted-color);display:flex;height:18px;justify-content:center;margin-right:.4em;padding:0 0 2px;position:relative;top:-1px;width:20px}.DocSearch-Button-Key--pressed{box-shadow:var(--docsearch-key-pressed-shadow);transform:translate3d(0,1px,0)}@media (max-width:768px){.DocSearch-Button-Keys,.DocSearch-Button-Placeholder{display:none}}.DocSearch--active{overflow:hidden!important}.DocSearch-Container,.DocSearch-Container *{box-sizing:border-box}.DocSearch-Container{background-color:var(--docsearch-container-background);height:100vh;left:0;position:fixed;top:0;width:100vw;z-index:200}.DocSearch-Container a{text-decoration:none}.DocSearch-Link{-webkit-appearance:none;-moz-appearance:none;appearance:none;background:none;border:0;color:var(--docsearch-highlight-color);cursor:pointer;font:inherit;margin:0;padding:0}.DocSearch-Modal{background:var(--docsearch-modal-background);border-radius:6px;box-shadow:var(--docsearch-modal-shadow);flex-direction:column;margin:60px auto auto;max-width:var(--docsearch-modal-width);position:relative}.DocSearch-SearchBar{display:flex;padding:var(--docsearch-spacing) var(--docsearch-spacing) 0}.DocSearch-Form{align-items:center;background:var(--docsearch-searchbox-focus-background);border-radius:4px;box-shadow:var(--docsearch-searchbox-shadow);display:flex;height:var(--docsearch-searchbox-height);margin:0;padding:0 var(--docsearch-spacing);position:relative;width:100%}.DocSearch-Input{-webkit-appearance:none;-moz-appearance:none;appearance:none;background:transparent;border:0;color:var(--docsearch-text-color);flex:1;font:inherit;font-size:1.2em;height:100%;outline:none;padding:0 0 0 8px;width:80%}.DocSearch-Input::placeholder{color:var(--docsearch-muted-color);opacity:1}.DocSearch-Input::-webkit-search-cancel-button,.DocSearch-Input::-webkit-search-decoration,.DocSearch-Input::-webkit-search-results-button,.DocSearch-Input::-webkit-search-results-decoration{display:none}.DocSearch-LoadingIndicator,.DocSearch-MagnifierLabel,.DocSearch-Reset{margin:0;padding:0}.DocSearch-MagnifierLabel,.DocSearch-Reset{align-items:center;color:var(--docsearch-highlight-color);display:flex;justify-content:center}.DocSearch-Container--Stalled .DocSearch-MagnifierLabel,.DocSearch-LoadingIndicator{display:none}.DocSearch-Container--Stalled .DocSearch-LoadingIndicator{align-items:center;color:var(--docsearch-highlight-color);display:flex;justify-content:center}@media screen and (prefers-reduced-motion:reduce){.DocSearch-Reset{animation:none;-webkit-appearance:none;-moz-appearance:none;appearance:none;background:none;border:0;border-radius:50%;color:var(--docsearch-icon-color);cursor:pointer;right:0;stroke-width:var(--docsearch-icon-stroke-width)}}.DocSearch-Reset{animation:fade-in .1s ease-in forwards;-webkit-appearance:none;-moz-appearance:none;appearance:none;background:none;border:0;border-radius:50%;color:var(--docsearch-icon-color);cursor:pointer;padding:2px;right:0;stroke-width:var(--docsearch-icon-stroke-width)}.DocSearch-Reset[hidden]{display:none}.DocSearch-Reset:hover{color:var(--docsearch-highlight-color)}.DocSearch-LoadingIndicator svg,.DocSearch-MagnifierLabel svg{height:24px;width:24px}.DocSearch-Cancel{display:none}.DocSearch-Dropdown{max-height:calc(var(--docsearch-modal-height) - var(--docsearch-searchbox-height) - var(--docsearch-spacing) - var(--docsearch-footer-height));min-height:var(--docsearch-spacing);overflow-y:auto;overflow-y:overlay;padding:0 var(--docsearch-spacing);scrollbar-color:var(--docsearch-muted-color) var(--docsearch-modal-background);scrollbar-width:thin}.DocSearch-Dropdown::-webkit-scrollbar{width:12px}.DocSearch-Dropdown::-webkit-scrollbar-track{background:transparent}.DocSearch-Dropdown::-webkit-scrollbar-thumb{background-color:var(--docsearch-muted-color);border:3px solid var(--docsearch-modal-background);border-radius:20px}.DocSearch-Dropdown ul{list-style:none;margin:0;padding:0}.DocSearch-Label{font-size:.75em;line-height:1.6em}.DocSearch-Help,.DocSearch-Label{color:var(--docsearch-muted-color)}.DocSearch-Help{font-size:.9em;margin:0;-webkit-user-select:none;user-select:none}.DocSearch-Title{font-size:1.2em}.DocSearch-Logo a{display:flex}.DocSearch-Logo svg{color:var(--docsearch-logo-color);margin-left:8px}.DocSearch-Hits:last-of-type{margin-bottom:24px}.DocSearch-Hits mark{background:none;color:var(--docsearch-highlight-color)}.DocSearch-HitsFooter{color:var(--docsearch-muted-color);display:flex;font-size:.85em;justify-content:center;margin-bottom:var(--docsearch-spacing);padding:var(--docsearch-spacing)}.DocSearch-HitsFooter a{border-bottom:1px solid;color:inherit}.DocSearch-Hit{border-radius:4px;display:flex;padding-bottom:4px;position:relative}@media screen and (prefers-reduced-motion:reduce){.DocSearch-Hit--deleting{transition:none}}.DocSearch-Hit--deleting{opacity:0;transition:all .25s linear}@media screen and (prefers-reduced-motion:reduce){.DocSearch-Hit--favoriting{transition:none}}.DocSearch-Hit--favoriting{transform:scale(0);transform-origin:top center;transition:all .25s linear;transition-delay:.25s}.DocSearch-Hit a{background:var(--docsearch-hit-background);border-radius:4px;box-shadow:var(--docsearch-hit-shadow);display:block;padding-left:var(--docsearch-spacing);width:100%}.DocSearch-Hit-source{background:var(--docsearch-modal-background);color:var(--docsearch-highlight-color);font-size:.85em;font-weight:600;line-height:32px;margin:0 -4px;padding:8px 4px 0;position:sticky;top:0;z-index:10}.DocSearch-Hit-Tree{color:var(--docsearch-muted-color);height:var(--docsearch-hit-height);opacity:.5;stroke-width:var(--docsearch-icon-stroke-width);width:24px}.DocSearch-Hit[aria-selected=true] a{background-color:var(--docsearch-highlight-color)}.DocSearch-Hit[aria-selected=true] mark{text-decoration:underline}.DocSearch-Hit-Container{align-items:center;color:var(--docsearch-hit-color);display:flex;flex-direction:row;height:var(--docsearch-hit-height);padding:0 var(--docsearch-spacing) 0 0}.DocSearch-Hit-icon{height:20px;width:20px}.DocSearch-Hit-action,.DocSearch-Hit-icon{color:var(--docsearch-muted-color);stroke-width:var(--docsearch-icon-stroke-width)}.DocSearch-Hit-action{align-items:center;display:flex;height:22px;width:22px}.DocSearch-Hit-action svg{display:block;height:18px;width:18px}.DocSearch-Hit-action+.DocSearch-Hit-action{margin-left:6px}.DocSearch-Hit-action-button{-webkit-appearance:none;-moz-appearance:none;appearance:none;background:none;border:0;border-radius:50%;color:inherit;cursor:pointer;padding:2px}svg.DocSearch-Hit-Select-Icon{display:none}.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-Select-Icon{display:block}.DocSearch-Hit-action-button:focus,.DocSearch-Hit-action-button:hover{background:#0003;transition:background-color .1s ease-in}@media screen and (prefers-reduced-motion:reduce){.DocSearch-Hit-action-button:focus,.DocSearch-Hit-action-button:hover{transition:none}}.DocSearch-Hit-action-button:focus path,.DocSearch-Hit-action-button:hover path{fill:#fff}.DocSearch-Hit-content-wrapper{display:flex;flex:1 1 auto;flex-direction:column;font-weight:500;justify-content:center;line-height:1.2em;margin:0 8px;overflow-x:hidden;position:relative;text-overflow:ellipsis;white-space:nowrap;width:80%}.DocSearch-Hit-title{font-size:.9em}.DocSearch-Hit-path{color:var(--docsearch-muted-color);font-size:.75em}.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-Tree,.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-action,.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-icon,.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-path,.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-text,.DocSearch-Hit[aria-selected=true] .DocSearch-Hit-title,.DocSearch-Hit[aria-selected=true] mark{color:var(--docsearch-hit-active-color)!important}@media screen and (prefers-reduced-motion:reduce){.DocSearch-Hit-action-button:focus,.DocSearch-Hit-action-button:hover{background:#0003;transition:none}}.DocSearch-ErrorScreen,.DocSearch-NoResults,.DocSearch-StartScreen{font-size:.9em;margin:0 auto;padding:36px 0;text-align:center;width:80%}.DocSearch-Screen-Icon{color:var(--docsearch-muted-color);padding-bottom:12px}.DocSearch-NoResults-Prefill-List{display:inline-block;padding-bottom:24px;text-align:left}.DocSearch-NoResults-Prefill-List ul{display:inline-block;padding:8px 0 0}.DocSearch-NoResults-Prefill-List li{list-style-position:inside;list-style-type:"» "}.DocSearch-Prefill{-webkit-appearance:none;-moz-appearance:none;appearance:none;background:none;border:0;border-radius:1em;color:var(--docsearch-highlight-color);cursor:pointer;display:inline-block;font-size:1em;font-weight:700;padding:0}.DocSearch-Prefill:focus,.DocSearch-Prefill:hover{outline:none;text-decoration:underline}.DocSearch-Footer{align-items:center;background:var(--docsearch-footer-background);border-radius:0 0 8px 8px;box-shadow:var(--docsearch-footer-shadow);display:flex;flex-direction:row-reverse;flex-shrink:0;height:var(--docsearch-footer-height);justify-content:space-between;padding:0 var(--docsearch-spacing);position:relative;-webkit-user-select:none;user-select:none;width:100%;z-index:300}.DocSearch-Commands{color:var(--docsearch-muted-color);display:flex;list-style:none;margin:0;padding:0}.DocSearch-Commands li{align-items:center;display:flex}.DocSearch-Commands li:not(:last-of-type){margin-right:.8em}.DocSearch-Commands-Key{align-items:center;background:var(--docsearch-key-gradient);border:0;border-radius:2px;box-shadow:var(--docsearch-key-shadow);color:var(--docsearch-muted-color);display:flex;height:18px;justify-content:center;margin-right:.4em;padding:0 0 1px;width:20px}.DocSearch-VisuallyHiddenForAccessibility{clip:rect(0 0 0 0);clip-path:inset(50%);height:1px;overflow:hidden;position:absolute;white-space:nowrap;width:1px}@media (max-width:768px){:root{--docsearch-spacing:10px;--docsearch-footer-height:40px}.DocSearch-Dropdown{height:100%}.DocSearch-Container{height:100vh;height:-webkit-fill-available;height:calc(var(--docsearch-vh, 1vh)*100);position:absolute}.DocSearch-Footer{border-radius:0;bottom:0;position:absolute}.DocSearch-Hit-content-wrapper{display:flex;position:relative;width:80%}.DocSearch-Modal{border-radius:0;box-shadow:none;height:100vh;height:-webkit-fill-available;height:calc(var(--docsearch-vh, 1vh)*100);margin:0;max-width:100%;width:100%}.DocSearch-Dropdown{max-height:calc(var(--docsearch-vh, 1vh)*100 - var(--docsearch-searchbox-height) - var(--docsearch-spacing) - var(--docsearch-footer-height))}.DocSearch-Cancel{-webkit-appearance:none;-moz-appearance:none;appearance:none;background:none;border:0;color:var(--docsearch-highlight-color);cursor:pointer;display:inline-block;flex:none;font:inherit;font-size:1em;font-weight:500;margin-left:var(--docsearch-spacing);outline:none;overflow:hidden;padding:0;-webkit-user-select:none;user-select:none;white-space:nowrap}.DocSearch-Commands,.DocSearch-Hit-Tree{display:none}}@keyframes fade-in{0%{opacity:0}to{opacity:1}}[class*=DocSearch]{--docsearch-primary-color: var(--vp-c-brand-1);--docsearch-highlight-color: var(--docsearch-primary-color);--docsearch-text-color: var(--vp-c-text-1);--docsearch-muted-color: var(--vp-c-text-2);--docsearch-searchbox-shadow: none;--docsearch-searchbox-background: transparent;--docsearch-searchbox-focus-background: transparent;--docsearch-key-gradient: transparent;--docsearch-key-shadow: none;--docsearch-modal-background: var(--vp-c-bg-soft);--docsearch-footer-background: var(--vp-c-bg)}.dark [class*=DocSearch]{--docsearch-modal-shadow: none;--docsearch-footer-shadow: none;--docsearch-logo-color: var(--vp-c-text-2);--docsearch-hit-background: var(--vp-c-default-soft);--docsearch-hit-color: var(--vp-c-text-2);--docsearch-hit-shadow: none}.DocSearch-Button{display:flex;justify-content:center;align-items:center;margin:0;padding:0;width:48px;height:55px;background:transparent;transition:border-color .25s}.DocSearch-Button:hover{background:transparent}.DocSearch-Button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}.DocSearch-Button-Key--pressed{transform:none;box-shadow:none}.DocSearch-Button:focus:not(:focus-visible){outline:none!important}@media (min-width: 768px){.DocSearch-Button{justify-content:flex-start;border:1px solid transparent;border-radius:8px;padding:0 10px 0 12px;width:100%;height:40px;background-color:var(--vp-c-bg-alt)}.DocSearch-Button:hover{border-color:var(--vp-c-brand-1);background:var(--vp-c-bg-alt)}}.DocSearch-Button .DocSearch-Button-Container{display:flex;align-items:center}.DocSearch-Button .DocSearch-Search-Icon{position:relative;width:16px;height:16px;color:var(--vp-c-text-1);fill:currentColor;transition:color .5s}.DocSearch-Button:hover .DocSearch-Search-Icon{color:var(--vp-c-text-1)}@media (min-width: 768px){.DocSearch-Button .DocSearch-Search-Icon{top:1px;margin-right:8px;width:14px;height:14px;color:var(--vp-c-text-2)}}.DocSearch-Button .DocSearch-Button-Placeholder{display:none;margin-top:2px;padding:0 16px 0 0;font-size:13px;font-weight:500;color:var(--vp-c-text-2);transition:color .5s}.DocSearch-Button:hover .DocSearch-Button-Placeholder{color:var(--vp-c-text-1)}@media (min-width: 768px){.DocSearch-Button .DocSearch-Button-Placeholder{display:inline-block}}.DocSearch-Button .DocSearch-Button-Keys{direction:ltr;display:none;min-width:auto}@media (min-width: 768px){.DocSearch-Button .DocSearch-Button-Keys{display:flex;align-items:center}}.DocSearch-Button .DocSearch-Button-Key{display:block;margin:2px 0 0;border:1px solid var(--vp-c-divider);border-right:none;border-radius:4px 0 0 4px;padding-left:6px;min-width:0;width:auto;height:22px;line-height:22px;font-family:var(--vp-font-family-base);font-size:12px;font-weight:500;transition:color .5s,border-color .5s}.DocSearch-Button .DocSearch-Button-Key+.DocSearch-Button-Key{border-right:1px solid var(--vp-c-divider);border-left:none;border-radius:0 4px 4px 0;padding-left:2px;padding-right:6px}.DocSearch-Button .DocSearch-Button-Key:first-child{font-size:0!important}.DocSearch-Button .DocSearch-Button-Key:first-child:after{content:"Ctrl";font-size:12px;letter-spacing:normal;color:var(--docsearch-muted-color)}.mac .DocSearch-Button .DocSearch-Button-Key:first-child:after{content:"⌘"}.DocSearch-Button .DocSearch-Button-Key:first-child>*{display:none}.DocSearch-Search-Icon{--icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' stroke-width='1.6' viewBox='0 0 20 20'%3E%3Cpath fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' d='m14.386 14.386 4.088 4.088-4.088-4.088A7.533 7.533 0 1 1 3.733 3.733a7.533 7.533 0 0 1 10.653 10.653z'/%3E%3C/svg%3E")}.VPNavBarSearch{display:flex;align-items:center}@media (min-width: 768px){.VPNavBarSearch{flex-grow:1;padding-left:24px}}@media (min-width: 960px){.VPNavBarSearch{padding-left:32px}}.dark .DocSearch-Footer{border-top:1px solid var(--vp-c-divider)}.DocSearch-Form{border:1px solid var(--vp-c-brand-1);background-color:var(--vp-c-white)}.dark .DocSearch-Form{background-color:var(--vp-c-default-soft)}.DocSearch-Screen-Icon>svg{margin:auto}.VPNavBarSocialLinks[data-v-0394ad82]{display:none}@media (min-width: 1280px){.VPNavBarSocialLinks[data-v-0394ad82]{display:flex;align-items:center}}.title[data-v-1168a8e4]{display:flex;align-items:center;border-bottom:1px solid transparent;width:100%;height:var(--vp-nav-height);font-size:16px;font-weight:600;color:var(--vp-c-text-1);transition:opacity .25s}@media (min-width: 960px){.title[data-v-1168a8e4]{flex-shrink:0}.VPNavBarTitle.has-sidebar .title[data-v-1168a8e4]{border-bottom-color:var(--vp-c-divider)}}[data-v-1168a8e4] .logo{margin-right:8px;height:var(--vp-nav-logo-height)}.VPNavBarTranslations[data-v-88af2de4]{display:none}@media (min-width: 1280px){.VPNavBarTranslations[data-v-88af2de4]{display:flex;align-items:center}}.title[data-v-88af2de4]{padding:0 24px 0 12px;line-height:32px;font-size:14px;font-weight:700;color:var(--vp-c-text-1)}.VPNavBar[data-v-6aa21345]{position:relative;height:var(--vp-nav-height);pointer-events:none;white-space:nowrap;transition:background-color .25s}.VPNavBar.screen-open[data-v-6aa21345]{transition:none;background-color:var(--vp-nav-bg-color);border-bottom:1px solid var(--vp-c-divider)}.VPNavBar[data-v-6aa21345]:not(.home){background-color:var(--vp-nav-bg-color)}@media (min-width: 960px){.VPNavBar[data-v-6aa21345]:not(.home){background-color:transparent}.VPNavBar[data-v-6aa21345]:not(.has-sidebar):not(.home.top){background-color:var(--vp-nav-bg-color)}}.wrapper[data-v-6aa21345]{padding:0 8px 0 24px}@media (min-width: 768px){.wrapper[data-v-6aa21345]{padding:0 32px}}@media (min-width: 960px){.VPNavBar.has-sidebar .wrapper[data-v-6aa21345]{padding:0}}.container[data-v-6aa21345]{display:flex;justify-content:space-between;margin:0 auto;max-width:calc(var(--vp-layout-max-width) - 64px);height:var(--vp-nav-height);pointer-events:none}.container>.title[data-v-6aa21345],.container>.content[data-v-6aa21345]{pointer-events:none}.container[data-v-6aa21345] *{pointer-events:auto}@media (min-width: 960px){.VPNavBar.has-sidebar .container[data-v-6aa21345]{max-width:100%}}.title[data-v-6aa21345]{flex-shrink:0;height:calc(var(--vp-nav-height) - 1px);transition:background-color .5s}@media (min-width: 960px){.VPNavBar.has-sidebar .title[data-v-6aa21345]{position:absolute;top:0;left:0;z-index:2;padding:0 32px;width:var(--vp-sidebar-width);height:var(--vp-nav-height);background-color:transparent}}@media (min-width: 1440px){.VPNavBar.has-sidebar .title[data-v-6aa21345]{padding-left:max(32px,calc((100% - (var(--vp-layout-max-width) - 64px)) / 2));width:calc((100% - (var(--vp-layout-max-width) - 64px)) / 2 + var(--vp-sidebar-width) - 32px)}}.content[data-v-6aa21345]{flex-grow:1}@media (min-width: 960px){.VPNavBar.has-sidebar .content[data-v-6aa21345]{position:relative;z-index:1;padding-right:32px;padding-left:var(--vp-sidebar-width)}}@media (min-width: 1440px){.VPNavBar.has-sidebar .content[data-v-6aa21345]{padding-right:calc((100vw - var(--vp-layout-max-width)) / 2 + 32px);padding-left:calc((100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width))}}.content-body[data-v-6aa21345]{display:flex;justify-content:flex-end;align-items:center;height:var(--vp-nav-height);transition:background-color .5s}@media (min-width: 960px){.VPNavBar:not(.home.top) .content-body[data-v-6aa21345]{position:relative;background-color:var(--vp-nav-bg-color)}.VPNavBar:not(.has-sidebar):not(.home.top) .content-body[data-v-6aa21345]{background-color:transparent}}@media (max-width: 767px){.content-body[data-v-6aa21345]{column-gap:.5rem}}.menu+.translations[data-v-6aa21345]:before,.menu+.appearance[data-v-6aa21345]:before,.menu+.social-links[data-v-6aa21345]:before,.translations+.appearance[data-v-6aa21345]:before,.appearance+.social-links[data-v-6aa21345]:before{margin-right:8px;margin-left:8px;width:1px;height:24px;background-color:var(--vp-c-divider);content:""}.menu+.appearance[data-v-6aa21345]:before,.translations+.appearance[data-v-6aa21345]:before{margin-right:16px}.appearance+.social-links[data-v-6aa21345]:before{margin-left:16px}.social-links[data-v-6aa21345]{margin-right:-8px}.divider[data-v-6aa21345]{width:100%;height:1px}@media (min-width: 960px){.VPNavBar.has-sidebar .divider[data-v-6aa21345]{padding-left:var(--vp-sidebar-width)}}@media (min-width: 1440px){.VPNavBar.has-sidebar .divider[data-v-6aa21345]{padding-left:calc((100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width))}}.divider-line[data-v-6aa21345]{width:100%;height:1px;transition:background-color .5s}.VPNavBar:not(.home) .divider-line[data-v-6aa21345]{background-color:var(--vp-c-gutter)}@media (min-width: 960px){.VPNavBar:not(.home.top) .divider-line[data-v-6aa21345]{background-color:var(--vp-c-gutter)}.VPNavBar:not(.has-sidebar):not(.home.top) .divider[data-v-6aa21345]{background-color:var(--vp-c-gutter)}}.VPNavScreenAppearance[data-v-b44890b2]{display:flex;justify-content:space-between;align-items:center;border-radius:8px;padding:12px 14px 12px 16px;background-color:var(--vp-c-bg-soft)}.text[data-v-b44890b2]{line-height:24px;font-size:12px;font-weight:500;color:var(--vp-c-text-2)}.VPNavScreenMenuLink[data-v-df37e6dd]{display:block;border-bottom:1px solid var(--vp-c-divider);padding:12px 0 11px;line-height:24px;font-size:14px;font-weight:500;color:var(--vp-c-text-1);transition:border-color .25s,color .25s}.VPNavScreenMenuLink[data-v-df37e6dd]:hover{color:var(--vp-c-brand-1)}.VPNavScreenMenuGroupLink[data-v-3e9c20e4]{display:block;margin-left:12px;line-height:32px;font-size:14px;font-weight:400;color:var(--vp-c-text-1);transition:color .25s}.VPNavScreenMenuGroupLink[data-v-3e9c20e4]:hover{color:var(--vp-c-brand-1)}.VPNavScreenMenuGroupSection[data-v-8133b170]{display:block}.title[data-v-8133b170]{line-height:32px;font-size:13px;font-weight:700;color:var(--vp-c-text-2);transition:color .25s}.VPNavScreenMenuGroup[data-v-b9ab8c58]{border-bottom:1px solid var(--vp-c-divider);height:48px;overflow:hidden;transition:border-color .5s}.VPNavScreenMenuGroup .items[data-v-b9ab8c58]{visibility:hidden}.VPNavScreenMenuGroup.open .items[data-v-b9ab8c58]{visibility:visible}.VPNavScreenMenuGroup.open[data-v-b9ab8c58]{padding-bottom:10px;height:auto}.VPNavScreenMenuGroup.open .button[data-v-b9ab8c58]{padding-bottom:6px;color:var(--vp-c-brand-1)}.VPNavScreenMenuGroup.open .button-icon[data-v-b9ab8c58]{transform:rotate(45deg)}.button[data-v-b9ab8c58]{display:flex;justify-content:space-between;align-items:center;padding:12px 4px 11px 0;width:100%;line-height:24px;font-size:14px;font-weight:500;color:var(--vp-c-text-1);transition:color .25s}.button[data-v-b9ab8c58]:hover{color:var(--vp-c-brand-1)}.button-icon[data-v-b9ab8c58]{transition:transform .25s}.group[data-v-b9ab8c58]:first-child{padding-top:0}.group+.group[data-v-b9ab8c58],.group+.item[data-v-b9ab8c58]{padding-top:4px}.VPNavScreenTranslations[data-v-858fe1a4]{height:24px;overflow:hidden}.VPNavScreenTranslations.open[data-v-858fe1a4]{height:auto}.title[data-v-858fe1a4]{display:flex;align-items:center;font-size:14px;font-weight:500;color:var(--vp-c-text-1)}.icon[data-v-858fe1a4]{font-size:16px}.icon.lang[data-v-858fe1a4]{margin-right:8px}.icon.chevron[data-v-858fe1a4]{margin-left:4px}.list[data-v-858fe1a4]{padding:4px 0 0 24px}.link[data-v-858fe1a4]{line-height:32px;font-size:13px;color:var(--vp-c-text-1)}.VPNavScreen[data-v-f2779853]{position:fixed;top:calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px));right:0;bottom:0;left:0;padding:0 32px;width:100%;background-color:var(--vp-nav-screen-bg-color);overflow-y:auto;transition:background-color .25s;pointer-events:auto}.VPNavScreen.fade-enter-active[data-v-f2779853],.VPNavScreen.fade-leave-active[data-v-f2779853]{transition:opacity .25s}.VPNavScreen.fade-enter-active .container[data-v-f2779853],.VPNavScreen.fade-leave-active .container[data-v-f2779853]{transition:transform .25s ease}.VPNavScreen.fade-enter-from[data-v-f2779853],.VPNavScreen.fade-leave-to[data-v-f2779853]{opacity:0}.VPNavScreen.fade-enter-from .container[data-v-f2779853],.VPNavScreen.fade-leave-to .container[data-v-f2779853]{transform:translateY(-8px)}@media (min-width: 768px){.VPNavScreen[data-v-f2779853]{display:none}}.container[data-v-f2779853]{margin:0 auto;padding:24px 0 96px;max-width:288px}.menu+.translations[data-v-f2779853],.menu+.appearance[data-v-f2779853],.translations+.appearance[data-v-f2779853]{margin-top:24px}.menu+.social-links[data-v-f2779853]{margin-top:16px}.appearance+.social-links[data-v-f2779853]{margin-top:16px}.VPNav[data-v-ae24b3ad]{position:relative;top:var(--vp-layout-top-height, 0px);left:0;z-index:var(--vp-z-index-nav);width:100%;pointer-events:none;transition:background-color .5s}@media (min-width: 960px){.VPNav[data-v-ae24b3ad]{position:fixed}}.VPSidebarItem.level-0[data-v-b3fd67f8]{padding-bottom:24px}.VPSidebarItem.collapsed.level-0[data-v-b3fd67f8]{padding-bottom:10px}.item[data-v-b3fd67f8]{position:relative;display:flex;width:100%}.VPSidebarItem.collapsible>.item[data-v-b3fd67f8]{cursor:pointer}.indicator[data-v-b3fd67f8]{position:absolute;top:6px;bottom:6px;left:-17px;width:2px;border-radius:2px;transition:background-color .25s}.VPSidebarItem.level-2.is-active>.item>.indicator[data-v-b3fd67f8],.VPSidebarItem.level-3.is-active>.item>.indicator[data-v-b3fd67f8],.VPSidebarItem.level-4.is-active>.item>.indicator[data-v-b3fd67f8],.VPSidebarItem.level-5.is-active>.item>.indicator[data-v-b3fd67f8]{background-color:var(--vp-c-brand-1)}.link[data-v-b3fd67f8]{display:flex;align-items:center;flex-grow:1}.text[data-v-b3fd67f8]{flex-grow:1;padding:4px 0;line-height:24px;font-size:14px;transition:color .25s}.VPSidebarItem.level-0 .text[data-v-b3fd67f8]{font-weight:700;color:var(--vp-c-text-1)}.VPSidebarItem.level-1 .text[data-v-b3fd67f8],.VPSidebarItem.level-2 .text[data-v-b3fd67f8],.VPSidebarItem.level-3 .text[data-v-b3fd67f8],.VPSidebarItem.level-4 .text[data-v-b3fd67f8],.VPSidebarItem.level-5 .text[data-v-b3fd67f8]{font-weight:500;color:var(--vp-c-text-2)}.VPSidebarItem.level-0.is-link>.item>.link:hover .text[data-v-b3fd67f8],.VPSidebarItem.level-1.is-link>.item>.link:hover .text[data-v-b3fd67f8],.VPSidebarItem.level-2.is-link>.item>.link:hover .text[data-v-b3fd67f8],.VPSidebarItem.level-3.is-link>.item>.link:hover .text[data-v-b3fd67f8],.VPSidebarItem.level-4.is-link>.item>.link:hover .text[data-v-b3fd67f8],.VPSidebarItem.level-5.is-link>.item>.link:hover .text[data-v-b3fd67f8]{color:var(--vp-c-brand-1)}.VPSidebarItem.level-0.has-active>.item>.text[data-v-b3fd67f8],.VPSidebarItem.level-1.has-active>.item>.text[data-v-b3fd67f8],.VPSidebarItem.level-2.has-active>.item>.text[data-v-b3fd67f8],.VPSidebarItem.level-3.has-active>.item>.text[data-v-b3fd67f8],.VPSidebarItem.level-4.has-active>.item>.text[data-v-b3fd67f8],.VPSidebarItem.level-5.has-active>.item>.text[data-v-b3fd67f8],.VPSidebarItem.level-0.has-active>.item>.link>.text[data-v-b3fd67f8],.VPSidebarItem.level-1.has-active>.item>.link>.text[data-v-b3fd67f8],.VPSidebarItem.level-2.has-active>.item>.link>.text[data-v-b3fd67f8],.VPSidebarItem.level-3.has-active>.item>.link>.text[data-v-b3fd67f8],.VPSidebarItem.level-4.has-active>.item>.link>.text[data-v-b3fd67f8],.VPSidebarItem.level-5.has-active>.item>.link>.text[data-v-b3fd67f8]{color:var(--vp-c-text-1)}.VPSidebarItem.level-0.is-active>.item .link>.text[data-v-b3fd67f8],.VPSidebarItem.level-1.is-active>.item .link>.text[data-v-b3fd67f8],.VPSidebarItem.level-2.is-active>.item .link>.text[data-v-b3fd67f8],.VPSidebarItem.level-3.is-active>.item .link>.text[data-v-b3fd67f8],.VPSidebarItem.level-4.is-active>.item .link>.text[data-v-b3fd67f8],.VPSidebarItem.level-5.is-active>.item .link>.text[data-v-b3fd67f8]{color:var(--vp-c-brand-1)}.caret[data-v-b3fd67f8]{display:flex;justify-content:center;align-items:center;margin-right:-7px;width:32px;height:32px;color:var(--vp-c-text-3);cursor:pointer;transition:color .25s;flex-shrink:0}.item:hover .caret[data-v-b3fd67f8]{color:var(--vp-c-text-2)}.item:hover .caret[data-v-b3fd67f8]:hover{color:var(--vp-c-text-1)}.caret-icon[data-v-b3fd67f8]{font-size:18px;transform:rotate(90deg);transition:transform .25s}.VPSidebarItem.collapsed .caret-icon[data-v-b3fd67f8]{transform:rotate(0)}.VPSidebarItem.level-1 .items[data-v-b3fd67f8],.VPSidebarItem.level-2 .items[data-v-b3fd67f8],.VPSidebarItem.level-3 .items[data-v-b3fd67f8],.VPSidebarItem.level-4 .items[data-v-b3fd67f8],.VPSidebarItem.level-5 .items[data-v-b3fd67f8]{border-left:1px solid var(--vp-c-divider);padding-left:16px}.VPSidebarItem.collapsed .items[data-v-b3fd67f8]{display:none}.no-transition[data-v-c40bc020] .caret-icon{transition:none}.group+.group[data-v-c40bc020]{border-top:1px solid var(--vp-c-divider);padding-top:10px}@media (min-width: 960px){.group[data-v-c40bc020]{padding-top:10px;width:calc(var(--vp-sidebar-width) - 64px)}}.VPSidebar[data-v-319d5ca6]{position:fixed;top:var(--vp-layout-top-height, 0px);bottom:0;left:0;z-index:var(--vp-z-index-sidebar);padding:32px 32px 96px;width:calc(100vw - 64px);max-width:320px;background-color:var(--vp-sidebar-bg-color);opacity:0;box-shadow:var(--vp-c-shadow-3);overflow-x:hidden;overflow-y:auto;transform:translate(-100%);transition:opacity .5s,transform .25s ease;overscroll-behavior:contain}.VPSidebar.open[data-v-319d5ca6]{opacity:1;visibility:visible;transform:translate(0);transition:opacity .25s,transform .5s cubic-bezier(.19,1,.22,1)}.dark .VPSidebar[data-v-319d5ca6]{box-shadow:var(--vp-shadow-1)}@media (min-width: 960px){.VPSidebar[data-v-319d5ca6]{padding-top:var(--vp-nav-height);width:var(--vp-sidebar-width);max-width:100%;background-color:var(--vp-sidebar-bg-color);opacity:1;visibility:visible;box-shadow:none;transform:translate(0)}}@media (min-width: 1440px){.VPSidebar[data-v-319d5ca6]{padding-left:max(32px,calc((100% - (var(--vp-layout-max-width) - 64px)) / 2));width:calc((100% - (var(--vp-layout-max-width) - 64px)) / 2 + var(--vp-sidebar-width) - 32px)}}@media (min-width: 960px){.curtain[data-v-319d5ca6]{position:sticky;top:-64px;left:0;z-index:1;margin-top:calc(var(--vp-nav-height) * -1);margin-right:-32px;margin-left:-32px;height:var(--vp-nav-height);background-color:var(--vp-sidebar-bg-color)}}.nav[data-v-319d5ca6]{outline:0}.VPSkipLink[data-v-0b0ada53]{top:8px;left:8px;padding:8px 16px;z-index:999;border-radius:8px;font-size:12px;font-weight:700;text-decoration:none;color:var(--vp-c-brand-1);box-shadow:var(--vp-shadow-3);background-color:var(--vp-c-bg)}.VPSkipLink[data-v-0b0ada53]:focus{height:auto;width:auto;clip:auto;clip-path:none}@media (min-width: 1280px){.VPSkipLink[data-v-0b0ada53]{top:14px;left:16px}}.Layout[data-v-5d98c3a5]{display:flex;flex-direction:column;min-height:100vh}.VPHomeSponsors[data-v-3d121b4a]{border-top:1px solid var(--vp-c-gutter);padding-top:88px!important}.VPHomeSponsors[data-v-3d121b4a]{margin:96px 0}@media (min-width: 768px){.VPHomeSponsors[data-v-3d121b4a]{margin:128px 0}}.VPHomeSponsors[data-v-3d121b4a]{padding:0 24px}@media (min-width: 768px){.VPHomeSponsors[data-v-3d121b4a]{padding:0 48px}}@media (min-width: 960px){.VPHomeSponsors[data-v-3d121b4a]{padding:0 64px}}.container[data-v-3d121b4a]{margin:0 auto;max-width:1152px}.love[data-v-3d121b4a]{margin:0 auto;width:fit-content;font-size:28px;color:var(--vp-c-text-3)}.icon[data-v-3d121b4a]{display:inline-block}.message[data-v-3d121b4a]{margin:0 auto;padding-top:10px;max-width:320px;text-align:center;line-height:24px;font-size:16px;font-weight:500;color:var(--vp-c-text-2)}.sponsors[data-v-3d121b4a]{padding-top:32px}.action[data-v-3d121b4a]{padding-top:40px;text-align:center}.VPTeamMembersItem[data-v-f3fa364a]{display:flex;flex-direction:column;gap:2px;border-radius:12px;width:100%;height:100%;overflow:hidden}.VPTeamMembersItem.small .profile[data-v-f3fa364a]{padding:32px}.VPTeamMembersItem.small .data[data-v-f3fa364a]{padding-top:20px}.VPTeamMembersItem.small .avatar[data-v-f3fa364a]{width:64px;height:64px}.VPTeamMembersItem.small .name[data-v-f3fa364a]{line-height:24px;font-size:16px}.VPTeamMembersItem.small .affiliation[data-v-f3fa364a]{padding-top:4px;line-height:20px;font-size:14px}.VPTeamMembersItem.small .desc[data-v-f3fa364a]{padding-top:12px;line-height:20px;font-size:14px}.VPTeamMembersItem.small .links[data-v-f3fa364a]{margin:0 -16px -20px;padding:10px 0 0}.VPTeamMembersItem.medium .profile[data-v-f3fa364a]{padding:48px 32px}.VPTeamMembersItem.medium .data[data-v-f3fa364a]{padding-top:24px;text-align:center}.VPTeamMembersItem.medium .avatar[data-v-f3fa364a]{width:96px;height:96px}.VPTeamMembersItem.medium .name[data-v-f3fa364a]{letter-spacing:.15px;line-height:28px;font-size:20px}.VPTeamMembersItem.medium .affiliation[data-v-f3fa364a]{padding-top:4px;font-size:16px}.VPTeamMembersItem.medium .desc[data-v-f3fa364a]{padding-top:16px;max-width:288px;font-size:16px}.VPTeamMembersItem.medium .links[data-v-f3fa364a]{margin:0 -16px -12px;padding:16px 12px 0}.profile[data-v-f3fa364a]{flex-grow:1;background-color:var(--vp-c-bg-soft)}.data[data-v-f3fa364a]{text-align:center}.avatar[data-v-f3fa364a]{position:relative;flex-shrink:0;margin:0 auto;border-radius:50%;box-shadow:var(--vp-shadow-3)}.avatar-img[data-v-f3fa364a]{position:absolute;top:0;right:0;bottom:0;left:0;border-radius:50%;object-fit:cover}.name[data-v-f3fa364a]{margin:0;font-weight:600}.affiliation[data-v-f3fa364a]{margin:0;font-weight:500;color:var(--vp-c-text-2)}.org.link[data-v-f3fa364a]{color:var(--vp-c-text-2);transition:color .25s}.org.link[data-v-f3fa364a]:hover{color:var(--vp-c-brand-1)}.desc[data-v-f3fa364a]{margin:0 auto}.desc[data-v-f3fa364a] a{font-weight:500;color:var(--vp-c-brand-1);text-decoration-style:dotted;transition:color .25s}.links[data-v-f3fa364a]{display:flex;justify-content:center;height:56px}.sp-link[data-v-f3fa364a]{display:flex;justify-content:center;align-items:center;text-align:center;padding:16px;font-size:14px;font-weight:500;color:var(--vp-c-sponsor);background-color:var(--vp-c-bg-soft);transition:color .25s,background-color .25s}.sp .sp-link.link[data-v-f3fa364a]:hover,.sp .sp-link.link[data-v-f3fa364a]:focus{outline:none;color:var(--vp-c-white);background-color:var(--vp-c-sponsor)}.sp-icon[data-v-f3fa364a]{margin-right:8px;font-size:16px}.VPTeamMembers.small .container[data-v-6cb0dbc4]{grid-template-columns:repeat(auto-fit,minmax(224px,1fr))}.VPTeamMembers.small.count-1 .container[data-v-6cb0dbc4]{max-width:276px}.VPTeamMembers.small.count-2 .container[data-v-6cb0dbc4]{max-width:576px}.VPTeamMembers.small.count-3 .container[data-v-6cb0dbc4]{max-width:876px}.VPTeamMembers.medium .container[data-v-6cb0dbc4]{grid-template-columns:repeat(auto-fit,minmax(256px,1fr))}@media (min-width: 375px){.VPTeamMembers.medium .container[data-v-6cb0dbc4]{grid-template-columns:repeat(auto-fit,minmax(288px,1fr))}}.VPTeamMembers.medium.count-1 .container[data-v-6cb0dbc4]{max-width:368px}.VPTeamMembers.medium.count-2 .container[data-v-6cb0dbc4]{max-width:760px}.container[data-v-6cb0dbc4]{display:grid;gap:24px;margin:0 auto;max-width:1152px}.VPTeamPage[data-v-7c57f839]{margin:96px 0}@media (min-width: 768px){.VPTeamPage[data-v-7c57f839]{margin:128px 0}}.VPHome .VPTeamPageTitle[data-v-7c57f839-s]{border-top:1px solid var(--vp-c-gutter);padding-top:88px!important}.VPTeamPageSection+.VPTeamPageSection[data-v-7c57f839-s],.VPTeamMembers+.VPTeamPageSection[data-v-7c57f839-s]{margin-top:64px}.VPTeamMembers+.VPTeamMembers[data-v-7c57f839-s]{margin-top:24px}@media (min-width: 768px){.VPTeamPageTitle+.VPTeamPageSection[data-v-7c57f839-s]{margin-top:16px}.VPTeamPageSection+.VPTeamPageSection[data-v-7c57f839-s],.VPTeamMembers+.VPTeamPageSection[data-v-7c57f839-s]{margin-top:96px}}.VPTeamMembers[data-v-7c57f839-s]{padding:0 24px}@media (min-width: 768px){.VPTeamMembers[data-v-7c57f839-s]{padding:0 48px}}@media (min-width: 960px){.VPTeamMembers[data-v-7c57f839-s]{padding:0 64px}}.VPTeamPageSection[data-v-b1a88750]{padding:0 32px}@media (min-width: 768px){.VPTeamPageSection[data-v-b1a88750]{padding:0 48px}}@media (min-width: 960px){.VPTeamPageSection[data-v-b1a88750]{padding:0 64px}}.title[data-v-b1a88750]{position:relative;margin:0 auto;max-width:1152px;text-align:center;color:var(--vp-c-text-2)}.title-line[data-v-b1a88750]{position:absolute;top:16px;left:0;width:100%;height:1px;background-color:var(--vp-c-divider)}.title-text[data-v-b1a88750]{position:relative;display:inline-block;padding:0 24px;letter-spacing:0;line-height:32px;font-size:20px;font-weight:500;background-color:var(--vp-c-bg)}.lead[data-v-b1a88750]{margin:0 auto;max-width:480px;padding-top:12px;text-align:center;line-height:24px;font-size:16px;font-weight:500;color:var(--vp-c-text-2)}.members[data-v-b1a88750]{padding-top:40px}.VPTeamPageTitle[data-v-bf2cbdac]{padding:48px 32px;text-align:center}@media (min-width: 768px){.VPTeamPageTitle[data-v-bf2cbdac]{padding:64px 48px 48px}}@media (min-width: 960px){.VPTeamPageTitle[data-v-bf2cbdac]{padding:80px 64px 48px}}.title[data-v-bf2cbdac]{letter-spacing:0;line-height:44px;font-size:36px;font-weight:500}@media (min-width: 768px){.title[data-v-bf2cbdac]{letter-spacing:-.5px;line-height:56px;font-size:48px}}.lead[data-v-bf2cbdac]{margin:0 auto;max-width:512px;padding-top:12px;line-height:24px;font-size:16px;font-weight:500;color:var(--vp-c-text-2)}@media (min-width: 768px){.lead[data-v-bf2cbdac]{max-width:592px;letter-spacing:.15px;line-height:28px;font-size:20px}} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-cyrillic-ext.BBPuwvHQ.woff2) format("woff2"); + unicode-range: + U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, U+FE2E-FE2F; +} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-cyrillic.C5lxZ8CY.woff2) format("woff2"); + unicode-range: U+0301, U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-greek-ext.CqjqNYQ-.woff2) format("woff2"); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-greek.BBVDIX6e.woff2) format("woff2"); + unicode-range: + U+0370-0377, U+037A-037F, U+0384-038A, U+038C, U+038E-03A1, U+03A3-03FF; +} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-vietnamese.BjW4sHH5.woff2) format("woff2"); + unicode-range: + U+0102-0103, U+0110-0111, U+0128-0129, U+0168-0169, U+01A0-01A1, + U+01AF-01B0, U+0300-0301, U+0303-0304, U+0308-0309, U+0323, U+0329, + U+1EA0-1EF9, U+20AB; +} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-latin-ext.4ZJIpNVo.woff2) format("woff2"); + unicode-range: + U+0100-02AF, U+0304, U+0308, U+0329, U+1E00-1E9F, U+1EF2-1EFF, U+2020, + U+20A0-20AB, U+20AD-20C0, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Inter; + font-style: normal; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-roman-latin.Di8DUHzh.woff2) format("woff2"); + unicode-range: + U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, + U+0304, U+0308, U+0329, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, + U+2212, U+2215, U+FEFF, U+FFFD; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-cyrillic-ext.r48I6akx.woff2) + format("woff2"); + unicode-range: + U+0460-052F, U+1C80-1C88, U+20B4, U+2DE0-2DFF, U+A640-A69F, U+FE2E-FE2F; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-cyrillic.By2_1cv3.woff2) format("woff2"); + unicode-range: U+0301, U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-greek-ext.1u6EdAuj.woff2) format("woff2"); + unicode-range: U+1F00-1FFF; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-greek.DJ8dCoTZ.woff2) format("woff2"); + unicode-range: + U+0370-0377, U+037A-037F, U+0384-038A, U+038C, U+038E-03A1, U+03A3-03FF; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-vietnamese.BSbpV94h.woff2) format("woff2"); + unicode-range: + U+0102-0103, U+0110-0111, U+0128-0129, U+0168-0169, U+01A0-01A1, + U+01AF-01B0, U+0300-0301, U+0303-0304, U+0308-0309, U+0323, U+0329, + U+1EA0-1EF9, U+20AB; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-latin-ext.CN1xVJS-.woff2) format("woff2"); + unicode-range: + U+0100-02AF, U+0304, U+0308, U+0329, U+1E00-1E9F, U+1EF2-1EFF, U+2020, + U+20A0-20AB, U+20AD-20C0, U+2113, U+2C60-2C7F, U+A720-A7FF; +} +@font-face { + font-family: Inter; + font-style: italic; + font-weight: 100 900; + font-display: swap; + src: url(/docs/assets/inter-italic-latin.C2AdPX0b.woff2) format("woff2"); + unicode-range: + U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, + U+0304, U+0308, U+0329, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, + U+2212, U+2215, U+FEFF, U+FFFD; +} +@font-face { + font-family: Punctuation SC; + font-weight: 400; + src: + local("PingFang SC Regular"), local("Noto Sans CJK SC"), + local("Microsoft YaHei"); + unicode-range: + U+201C, U+201D, U+2018, U+2019, U+2E3A, U+2014, U+2013, U+2026, U+00B7, + U+007E, U+002F; +} +@font-face { + font-family: Punctuation SC; + font-weight: 500; + src: + local("PingFang SC Medium"), local("Noto Sans CJK SC"), + local("Microsoft YaHei"); + unicode-range: + U+201C, U+201D, U+2018, U+2019, U+2E3A, U+2014, U+2013, U+2026, U+00B7, + U+007E, U+002F; +} +@font-face { + font-family: Punctuation SC; + font-weight: 600; + src: + local("PingFang SC Semibold"), local("Noto Sans CJK SC Bold"), + local("Microsoft YaHei Bold"); + unicode-range: + U+201C, U+201D, U+2018, U+2019, U+2E3A, U+2014, U+2013, U+2026, U+00B7, + U+007E, U+002F; +} +@font-face { + font-family: Punctuation SC; + font-weight: 700; + src: + local("PingFang SC Semibold"), local("Noto Sans CJK SC Bold"), + local("Microsoft YaHei Bold"); + unicode-range: + U+201C, U+201D, U+2018, U+2019, U+2E3A, U+2014, U+2013, U+2026, U+00B7, + U+007E, U+002F; +} +:root { + --vp-c-white: #ffffff; + --vp-c-black: #000000; + --vp-c-neutral: var(--vp-c-black); + --vp-c-neutral-inverse: var(--vp-c-white); +} +.dark { + --vp-c-neutral: var(--vp-c-white); + --vp-c-neutral-inverse: var(--vp-c-black); +} +:root { + --vp-c-gray-1: #dddde3; + --vp-c-gray-2: #e4e4e9; + --vp-c-gray-3: #ebebef; + --vp-c-gray-soft: rgba(142, 150, 170, 0.14); + --vp-c-indigo-1: #3451b2; + --vp-c-indigo-2: #3a5ccc; + --vp-c-indigo-3: #5672cd; + --vp-c-indigo-soft: rgba(100, 108, 255, 0.14); + --vp-c-purple-1: #6f42c1; + --vp-c-purple-2: #7e4cc9; + --vp-c-purple-3: #8e5cd9; + --vp-c-purple-soft: rgba(159, 122, 234, 0.14); + --vp-c-green-1: #18794e; + --vp-c-green-2: #299764; + --vp-c-green-3: #30a46c; + --vp-c-green-soft: rgba(16, 185, 129, 0.14); + --vp-c-yellow-1: #915930; + --vp-c-yellow-2: #946300; + --vp-c-yellow-3: #9f6a00; + --vp-c-yellow-soft: rgba(234, 179, 8, 0.14); + --vp-c-red-1: #b8272c; + --vp-c-red-2: #d5393e; + --vp-c-red-3: #e0575b; + --vp-c-red-soft: rgba(244, 63, 94, 0.14); + --vp-c-sponsor: #db2777; +} +.dark { + --vp-c-gray-1: #515c67; + --vp-c-gray-2: #414853; + --vp-c-gray-3: #32363f; + --vp-c-gray-soft: rgba(101, 117, 133, 0.16); + --vp-c-indigo-1: #a8b1ff; + --vp-c-indigo-2: #5c73e7; + --vp-c-indigo-3: #3e63dd; + --vp-c-indigo-soft: rgba(100, 108, 255, 0.16); + --vp-c-purple-1: #c8abfa; + --vp-c-purple-2: #a879e6; + --vp-c-purple-3: #8e5cd9; + --vp-c-purple-soft: rgba(159, 122, 234, 0.16); + --vp-c-green-1: #3dd68c; + --vp-c-green-2: #30a46c; + --vp-c-green-3: #298459; + --vp-c-green-soft: rgba(16, 185, 129, 0.16); + --vp-c-yellow-1: #f9b44e; + --vp-c-yellow-2: #da8b17; + --vp-c-yellow-3: #a46a0a; + --vp-c-yellow-soft: rgba(234, 179, 8, 0.16); + --vp-c-red-1: #f66f81; + --vp-c-red-2: #f14158; + --vp-c-red-3: #b62a3c; + --vp-c-red-soft: rgba(244, 63, 94, 0.16); +} +:root { + --vp-c-bg: #ffffff; + --vp-c-bg-alt: #f6f6f7; + --vp-c-bg-elv: #ffffff; + --vp-c-bg-soft: #f6f6f7; +} +.dark { + --vp-c-bg: #1b1b1f; + --vp-c-bg-alt: #161618; + --vp-c-bg-elv: #202127; + --vp-c-bg-soft: #202127; +} +:root { + --vp-c-border: #c2c2c4; + --vp-c-divider: #e2e2e3; + --vp-c-gutter: #e2e2e3; +} +.dark { + --vp-c-border: #3c3f44; + --vp-c-divider: #2e2e32; + --vp-c-gutter: #000000; +} +:root { + --vp-c-text-1: #3c3c43; + --vp-c-text-2: #67676c; + --vp-c-text-3: #929295; +} +.dark { + --vp-c-text-1: #dfdfd6; + --vp-c-text-2: #98989f; + --vp-c-text-3: #6a6a71; +} +:root { + --vp-c-default-1: var(--vp-c-gray-1); + --vp-c-default-2: var(--vp-c-gray-2); + --vp-c-default-3: var(--vp-c-gray-3); + --vp-c-default-soft: var(--vp-c-gray-soft); + --vp-c-brand-1: var(--vp-c-indigo-1); + --vp-c-brand-2: var(--vp-c-indigo-2); + --vp-c-brand-3: var(--vp-c-indigo-3); + --vp-c-brand-soft: var(--vp-c-indigo-soft); + --vp-c-brand: var(--vp-c-brand-1); + --vp-c-tip-1: var(--vp-c-brand-1); + --vp-c-tip-2: var(--vp-c-brand-2); + --vp-c-tip-3: var(--vp-c-brand-3); + --vp-c-tip-soft: var(--vp-c-brand-soft); + --vp-c-note-1: var(--vp-c-brand-1); + --vp-c-note-2: var(--vp-c-brand-2); + --vp-c-note-3: var(--vp-c-brand-3); + --vp-c-note-soft: var(--vp-c-brand-soft); + --vp-c-success-1: var(--vp-c-green-1); + --vp-c-success-2: var(--vp-c-green-2); + --vp-c-success-3: var(--vp-c-green-3); + --vp-c-success-soft: var(--vp-c-green-soft); + --vp-c-important-1: var(--vp-c-purple-1); + --vp-c-important-2: var(--vp-c-purple-2); + --vp-c-important-3: var(--vp-c-purple-3); + --vp-c-important-soft: var(--vp-c-purple-soft); + --vp-c-warning-1: var(--vp-c-yellow-1); + --vp-c-warning-2: var(--vp-c-yellow-2); + --vp-c-warning-3: var(--vp-c-yellow-3); + --vp-c-warning-soft: var(--vp-c-yellow-soft); + --vp-c-danger-1: var(--vp-c-red-1); + --vp-c-danger-2: var(--vp-c-red-2); + --vp-c-danger-3: var(--vp-c-red-3); + --vp-c-danger-soft: var(--vp-c-red-soft); + --vp-c-caution-1: var(--vp-c-red-1); + --vp-c-caution-2: var(--vp-c-red-2); + --vp-c-caution-3: var(--vp-c-red-3); + --vp-c-caution-soft: var(--vp-c-red-soft); +} +:root { + --vp-font-family-base: + "Inter", ui-sans-serif, system-ui, sans-serif, "Apple Color Emoji", + "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + --vp-font-family-mono: + ui-monospace, "Menlo", "Monaco", "Consolas", "Liberation Mono", + "Courier New", monospace; + font-optical-sizing: auto; +} +:root:where(:lang(zh)) { + --vp-font-family-base: + "Punctuation SC", "Inter", ui-sans-serif, system-ui, sans-serif, + "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; +} +:root { + --vp-shadow-1: 0 1px 2px rgba(0, 0, 0, 0.04), 0 1px 2px rgba(0, 0, 0, 0.06); + --vp-shadow-2: 0 3px 12px rgba(0, 0, 0, 0.07), 0 1px 4px rgba(0, 0, 0, 0.07); + --vp-shadow-3: 0 12px 32px rgba(0, 0, 0, 0.1), 0 2px 6px rgba(0, 0, 0, 0.08); + --vp-shadow-4: 0 14px 44px rgba(0, 0, 0, 0.12), 0 3px 9px rgba(0, 0, 0, 0.12); + --vp-shadow-5: + 0 18px 56px rgba(0, 0, 0, 0.16), 0 4px 12px rgba(0, 0, 0, 0.16); +} +:root { + --vp-z-index-footer: 10; + --vp-z-index-local-nav: 20; + --vp-z-index-nav: 30; + --vp-z-index-layout-top: 40; + --vp-z-index-backdrop: 50; + --vp-z-index-sidebar: 60; +} +@media (min-width: 960px) { + :root { + --vp-z-index-sidebar: 25; + } +} +:root { + --vp-layout-max-width: 1440px; +} +:root { + --vp-header-anchor-symbol: "#"; +} +:root { + --vp-code-line-height: 1.7; + --vp-code-font-size: 0.875em; + --vp-code-color: var(--vp-c-brand-1); + --vp-code-link-color: var(--vp-c-brand-1); + --vp-code-link-hover-color: var(--vp-c-brand-2); + --vp-code-bg: var(--vp-c-default-soft); + --vp-code-block-color: var(--vp-c-text-2); + --vp-code-block-bg: var(--vp-c-bg-alt); + --vp-code-block-divider-color: var(--vp-c-gutter); + --vp-code-lang-color: var(--vp-c-text-3); + --vp-code-line-highlight-color: var(--vp-c-default-soft); + --vp-code-line-number-color: var(--vp-c-text-3); + --vp-code-line-diff-add-color: var(--vp-c-success-soft); + --vp-code-line-diff-add-symbol-color: var(--vp-c-success-1); + --vp-code-line-diff-remove-color: var(--vp-c-danger-soft); + --vp-code-line-diff-remove-symbol-color: var(--vp-c-danger-1); + --vp-code-line-warning-color: var(--vp-c-warning-soft); + --vp-code-line-error-color: var(--vp-c-danger-soft); + --vp-code-copy-code-border-color: var(--vp-c-divider); + --vp-code-copy-code-bg: var(--vp-c-bg-soft); + --vp-code-copy-code-hover-border-color: var(--vp-c-divider); + --vp-code-copy-code-hover-bg: var(--vp-c-bg); + --vp-code-copy-code-active-text: var(--vp-c-text-2); + --vp-code-copy-copied-text-content: "Copied"; + --vp-code-tab-divider: var(--vp-code-block-divider-color); + --vp-code-tab-text-color: var(--vp-c-text-2); + --vp-code-tab-bg: var(--vp-code-block-bg); + --vp-code-tab-hover-text-color: var(--vp-c-text-1); + --vp-code-tab-active-text-color: var(--vp-c-text-1); + --vp-code-tab-active-bar-color: var(--vp-c-brand-1); +} +:lang(es), +:lang(pt) { + --vp-code-copy-copied-text-content: "Copiado"; +} +:lang(fa) { + --vp-code-copy-copied-text-content: "کپی شد"; +} +:lang(ko) { + --vp-code-copy-copied-text-content: "복사됨"; +} +:lang(ru) { + --vp-code-copy-copied-text-content: "Скопировано"; +} +:lang(zh) { + --vp-code-copy-copied-text-content: "已复制"; +} +:root { + --vp-button-brand-border: transparent; + --vp-button-brand-text: var(--vp-c-white); + --vp-button-brand-bg: var(--vp-c-brand-3); + --vp-button-brand-hover-border: transparent; + --vp-button-brand-hover-text: var(--vp-c-white); + --vp-button-brand-hover-bg: var(--vp-c-brand-2); + --vp-button-brand-active-border: transparent; + --vp-button-brand-active-text: var(--vp-c-white); + --vp-button-brand-active-bg: var(--vp-c-brand-1); + --vp-button-alt-border: transparent; + --vp-button-alt-text: var(--vp-c-text-1); + --vp-button-alt-bg: var(--vp-c-default-3); + --vp-button-alt-hover-border: transparent; + --vp-button-alt-hover-text: var(--vp-c-text-1); + --vp-button-alt-hover-bg: var(--vp-c-default-2); + --vp-button-alt-active-border: transparent; + --vp-button-alt-active-text: var(--vp-c-text-1); + --vp-button-alt-active-bg: var(--vp-c-default-1); + --vp-button-sponsor-border: var(--vp-c-text-2); + --vp-button-sponsor-text: var(--vp-c-text-2); + --vp-button-sponsor-bg: transparent; + --vp-button-sponsor-hover-border: var(--vp-c-sponsor); + --vp-button-sponsor-hover-text: var(--vp-c-sponsor); + --vp-button-sponsor-hover-bg: transparent; + --vp-button-sponsor-active-border: var(--vp-c-sponsor); + --vp-button-sponsor-active-text: var(--vp-c-sponsor); + --vp-button-sponsor-active-bg: transparent; +} +:root { + --vp-custom-block-font-size: 14px; + --vp-custom-block-code-font-size: 13px; + --vp-custom-block-info-border: transparent; + --vp-custom-block-info-text: var(--vp-c-text-1); + --vp-custom-block-info-bg: var(--vp-c-default-soft); + --vp-custom-block-info-code-bg: var(--vp-c-default-soft); + --vp-custom-block-note-border: transparent; + --vp-custom-block-note-text: var(--vp-c-text-1); + --vp-custom-block-note-bg: var(--vp-c-default-soft); + --vp-custom-block-note-code-bg: var(--vp-c-default-soft); + --vp-custom-block-tip-border: transparent; + --vp-custom-block-tip-text: var(--vp-c-text-1); + --vp-custom-block-tip-bg: var(--vp-c-tip-soft); + --vp-custom-block-tip-code-bg: var(--vp-c-tip-soft); + --vp-custom-block-important-border: transparent; + --vp-custom-block-important-text: var(--vp-c-text-1); + --vp-custom-block-important-bg: var(--vp-c-important-soft); + --vp-custom-block-important-code-bg: var(--vp-c-important-soft); + --vp-custom-block-warning-border: transparent; + --vp-custom-block-warning-text: var(--vp-c-text-1); + --vp-custom-block-warning-bg: var(--vp-c-warning-soft); + --vp-custom-block-warning-code-bg: var(--vp-c-warning-soft); + --vp-custom-block-danger-border: transparent; + --vp-custom-block-danger-text: var(--vp-c-text-1); + --vp-custom-block-danger-bg: var(--vp-c-danger-soft); + --vp-custom-block-danger-code-bg: var(--vp-c-danger-soft); + --vp-custom-block-caution-border: transparent; + --vp-custom-block-caution-text: var(--vp-c-text-1); + --vp-custom-block-caution-bg: var(--vp-c-caution-soft); + --vp-custom-block-caution-code-bg: var(--vp-c-caution-soft); + --vp-custom-block-details-border: var(--vp-custom-block-info-border); + --vp-custom-block-details-text: var(--vp-custom-block-info-text); + --vp-custom-block-details-bg: var(--vp-custom-block-info-bg); + --vp-custom-block-details-code-bg: var(--vp-custom-block-info-code-bg); +} +:root { + --vp-input-border-color: var(--vp-c-border); + --vp-input-bg-color: var(--vp-c-bg-alt); + --vp-input-switch-bg-color: var(--vp-c-default-soft); +} +:root { + --vp-nav-height: 64px; + --vp-nav-bg-color: var(--vp-c-bg); + --vp-nav-screen-bg-color: var(--vp-c-bg); + --vp-nav-logo-height: 24px; +} +.hide-nav { + --vp-nav-height: 0px; +} +.hide-nav .VPSidebar { + --vp-nav-height: 22px; +} +:root { + --vp-local-nav-bg-color: var(--vp-c-bg); +} +:root { + --vp-sidebar-width: 272px; + --vp-sidebar-bg-color: var(--vp-c-bg-alt); +} +:root { + --vp-backdrop-bg-color: rgba(0, 0, 0, 0.6); +} +:root { + --vp-home-hero-name-color: var(--vp-c-brand-1); + --vp-home-hero-name-background: transparent; + --vp-home-hero-image-background-image: none; + --vp-home-hero-image-filter: none; +} +:root { + --vp-badge-info-border: transparent; + --vp-badge-info-text: var(--vp-c-text-2); + --vp-badge-info-bg: var(--vp-c-default-soft); + --vp-badge-tip-border: transparent; + --vp-badge-tip-text: var(--vp-c-tip-1); + --vp-badge-tip-bg: var(--vp-c-tip-soft); + --vp-badge-warning-border: transparent; + --vp-badge-warning-text: var(--vp-c-warning-1); + --vp-badge-warning-bg: var(--vp-c-warning-soft); + --vp-badge-danger-border: transparent; + --vp-badge-danger-text: var(--vp-c-danger-1); + --vp-badge-danger-bg: var(--vp-c-danger-soft); +} +:root { + --vp-carbon-ads-text-color: var(--vp-c-text-1); + --vp-carbon-ads-poweredby-color: var(--vp-c-text-2); + --vp-carbon-ads-bg-color: var(--vp-c-bg-soft); + --vp-carbon-ads-hover-text-color: var(--vp-c-brand-1); + --vp-carbon-ads-hover-poweredby-color: var(--vp-c-text-1); +} +:root { + --vp-local-search-bg: var(--vp-c-bg); + --vp-local-search-result-bg: var(--vp-c-bg); + --vp-local-search-result-border: var(--vp-c-divider); + --vp-local-search-result-selected-bg: var(--vp-c-bg); + --vp-local-search-result-selected-border: var(--vp-c-brand-1); + --vp-local-search-highlight-bg: var(--vp-c-brand-1); + --vp-local-search-highlight-text: var(--vp-c-neutral-inverse); +} +@media (prefers-reduced-motion: reduce) { + *, + :before, + :after { + animation-delay: -1ms !important; + animation-duration: 1ms !important; + animation-iteration-count: 1 !important; + background-attachment: initial !important; + scroll-behavior: auto !important; + transition-duration: 0s !important; + transition-delay: 0s !important; + } +} +*, +:before, +:after { + box-sizing: border-box; +} +html { + line-height: 1.4; + font-size: 16px; + -webkit-text-size-adjust: 100%; +} +html.dark { + color-scheme: dark; +} +body { + margin: 0; + width: 100%; + min-width: 320px; + min-height: 100vh; + line-height: 24px; + font-family: var(--vp-font-family-base); + font-size: 16px; + font-weight: 400; + color: var(--vp-c-text-1); + background-color: var(--vp-c-bg); + font-synthesis: style; + text-rendering: optimizeLegibility; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +main { + display: block; +} +h1, +h2, +h3, +h4, +h5, +h6 { + margin: 0; + line-height: 24px; + font-size: 16px; + font-weight: 400; +} +p { + margin: 0; +} +strong, +b { + font-weight: 600; +} +a, +area, +button, +[role="button"], +input, +label, +select, +summary, +textarea { + touch-action: manipulation; +} +a { + color: inherit; + text-decoration: inherit; +} +ol, +ul { + list-style: none; + margin: 0; + padding: 0; +} +blockquote { + margin: 0; +} +pre, +code, +kbd, +samp { + font-family: var(--vp-font-family-mono); +} +img, +svg, +video, +canvas, +audio, +iframe, +embed, +object { + display: block; +} +figure { + margin: 0; +} +img, +video { + max-width: 100%; + height: auto; +} +button, +input, +optgroup, +select, +textarea { + border: 0; + padding: 0; + line-height: inherit; + color: inherit; +} +button { + padding: 0; + font-family: inherit; + background-color: transparent; + background-image: none; +} +button:enabled, +[role="button"]:enabled { + cursor: pointer; +} +button:focus, +button:focus-visible { + outline: 1px dotted; + outline: 4px auto -webkit-focus-ring-color; +} +button:focus:not(:focus-visible) { + outline: none !important; +} +input:focus, +textarea:focus, +select:focus { + outline: none; +} +table { + border-collapse: collapse; +} +input { + background-color: transparent; +} +input:-ms-input-placeholder, +textarea:-ms-input-placeholder { + color: var(--vp-c-text-3); +} +input::-ms-input-placeholder, +textarea::-ms-input-placeholder { + color: var(--vp-c-text-3); +} +input::placeholder, +textarea::placeholder { + color: var(--vp-c-text-3); +} +input::-webkit-outer-spin-button, +input::-webkit-inner-spin-button { + -webkit-appearance: none; + margin: 0; +} +input[type="number"] { + -moz-appearance: textfield; +} +textarea { + resize: vertical; +} +select { + -webkit-appearance: none; +} +fieldset { + margin: 0; + padding: 0; +} +h1, +h2, +h3, +h4, +h5, +h6, +li, +p { + overflow-wrap: break-word; +} +vite-error-overlay { + z-index: 9999; +} +mjx-container { + overflow-x: auto; +} +mjx-container > svg { + display: inline-block; + margin: auto; +} +[class^="vpi-"], +[class*=" vpi-"], +.vp-icon { + width: 1em; + height: 1em; +} +[class^="vpi-"].bg, +[class*=" vpi-"].bg, +.vp-icon.bg { + background-size: 100% 100%; + background-color: transparent; +} +[class^="vpi-"]:not(.bg), +[class*=" vpi-"]:not(.bg), +.vp-icon:not(.bg) { + -webkit-mask: var(--icon) no-repeat; + mask: var(--icon) no-repeat; + -webkit-mask-size: 100% 100%; + mask-size: 100% 100%; + background-color: currentColor; + color: inherit; +} +.vpi-align-left { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M21 6H3M15 12H3M17 18H3'/%3E%3C/svg%3E"); +} +.vpi-arrow-right, +.vpi-arrow-down, +.vpi-arrow-left, +.vpi-arrow-up { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M5 12h14M12 5l7 7-7 7'/%3E%3C/svg%3E"); +} +.vpi-chevron-right, +.vpi-chevron-down, +.vpi-chevron-left, +.vpi-chevron-up { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='m9 18 6-6-6-6'/%3E%3C/svg%3E"); +} +.vpi-chevron-down, +.vpi-arrow-down { + transform: rotate(90deg); +} +.vpi-chevron-left, +.vpi-arrow-left { + transform: rotate(180deg); +} +.vpi-chevron-up, +.vpi-arrow-up { + transform: rotate(-90deg); +} +.vpi-square-pen { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M12 3H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2v-7'/%3E%3Cpath d='M18.375 2.625a2.121 2.121 0 1 1 3 3L12 15l-4 1 1-4Z'/%3E%3C/svg%3E"); +} +.vpi-plus { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M5 12h14M12 5v14'/%3E%3C/svg%3E"); +} +.vpi-sun { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Ccircle cx='12' cy='12' r='4'/%3E%3Cpath d='M12 2v2M12 20v2M4.93 4.93l1.41 1.41M17.66 17.66l1.41 1.41M2 12h2M20 12h2M6.34 17.66l-1.41 1.41M19.07 4.93l-1.41 1.41'/%3E%3C/svg%3E"); +} +.vpi-moon { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M12 3a6 6 0 0 0 9 9 9 9 0 1 1-9-9Z'/%3E%3C/svg%3E"); +} +.vpi-more-horizontal { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Ccircle cx='12' cy='12' r='1'/%3E%3Ccircle cx='19' cy='12' r='1'/%3E%3Ccircle cx='5' cy='12' r='1'/%3E%3C/svg%3E"); +} +.vpi-languages { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='m5 8 6 6M4 14l6-6 2-3M2 5h12M7 2h1M22 22l-5-10-5 10M14 18h6'/%3E%3C/svg%3E"); +} +.vpi-heart { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M19 14c1.49-1.46 3-3.21 3-5.5A5.5 5.5 0 0 0 16.5 3c-1.76 0-3 .5-4.5 2-1.5-1.5-2.74-2-4.5-2A5.5 5.5 0 0 0 2 8.5c0 2.3 1.5 4.05 3 5.5l7 7Z'/%3E%3C/svg%3E"); +} +.vpi-search { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Ccircle cx='11' cy='11' r='8'/%3E%3Cpath d='m21 21-4.3-4.3'/%3E%3C/svg%3E"); +} +.vpi-layout-list { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Crect width='7' height='7' x='3' y='3' rx='1'/%3E%3Crect width='7' height='7' x='3' y='14' rx='1'/%3E%3Cpath d='M14 4h7M14 9h7M14 15h7M14 20h7'/%3E%3C/svg%3E"); +} +.vpi-delete { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='M20 5H9l-7 7 7 7h11a2 2 0 0 0 2-2V7a2 2 0 0 0-2-2ZM18 9l-6 6M12 9l6 6'/%3E%3C/svg%3E"); +} +.vpi-corner-down-left { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Cpath d='m9 10-5 5 5 5'/%3E%3Cpath d='M20 4v7a4 4 0 0 1-4 4H4'/%3E%3C/svg%3E"); +} +:root { + --vp-icon-copy: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='rgba(128,128,128,1)' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Crect width='8' height='4' x='8' y='2' rx='1' ry='1'/%3E%3Cpath d='M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2'/%3E%3C/svg%3E"); + --vp-icon-copied: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='none' stroke='rgba(128,128,128,1)' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' viewBox='0 0 24 24'%3E%3Crect width='8' height='4' x='8' y='2' rx='1' ry='1'/%3E%3Cpath d='M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2'/%3E%3Cpath d='m9 14 2 2 4-4'/%3E%3C/svg%3E"); +} +.visually-hidden { + position: absolute; + width: 1px; + height: 1px; + white-space: nowrap; + clip: rect(0 0 0 0); + clip-path: inset(50%); + overflow: hidden; +} +.custom-block { + border: 1px solid transparent; + border-radius: 8px; + padding: 16px 16px 8px; + line-height: 24px; + font-size: var(--vp-custom-block-font-size); + color: var(--vp-c-text-2); +} +.custom-block.info { + border-color: var(--vp-custom-block-info-border); + color: var(--vp-custom-block-info-text); + background-color: var(--vp-custom-block-info-bg); +} +.custom-block.info a, +.custom-block.info code { + color: var(--vp-c-brand-1); +} +.custom-block.info a:hover, +.custom-block.info a:hover > code { + color: var(--vp-c-brand-2); +} +.custom-block.info code { + background-color: var(--vp-custom-block-info-code-bg); +} +.custom-block.note { + border-color: var(--vp-custom-block-note-border); + color: var(--vp-custom-block-note-text); + background-color: var(--vp-custom-block-note-bg); +} +.custom-block.note a, +.custom-block.note code { + color: var(--vp-c-brand-1); +} +.custom-block.note a:hover, +.custom-block.note a:hover > code { + color: var(--vp-c-brand-2); +} +.custom-block.note code { + background-color: var(--vp-custom-block-note-code-bg); +} +.custom-block.tip { + border-color: var(--vp-custom-block-tip-border); + color: var(--vp-custom-block-tip-text); + background-color: var(--vp-custom-block-tip-bg); +} +.custom-block.tip a, +.custom-block.tip code { + color: var(--vp-c-tip-1); +} +.custom-block.tip a:hover, +.custom-block.tip a:hover > code { + color: var(--vp-c-tip-2); +} +.custom-block.tip code { + background-color: var(--vp-custom-block-tip-code-bg); +} +.custom-block.important { + border-color: var(--vp-custom-block-important-border); + color: var(--vp-custom-block-important-text); + background-color: var(--vp-custom-block-important-bg); +} +.custom-block.important a, +.custom-block.important code { + color: var(--vp-c-important-1); +} +.custom-block.important a:hover, +.custom-block.important a:hover > code { + color: var(--vp-c-important-2); +} +.custom-block.important code { + background-color: var(--vp-custom-block-important-code-bg); +} +.custom-block.warning { + border-color: var(--vp-custom-block-warning-border); + color: var(--vp-custom-block-warning-text); + background-color: var(--vp-custom-block-warning-bg); +} +.custom-block.warning a, +.custom-block.warning code { + color: var(--vp-c-warning-1); +} +.custom-block.warning a:hover, +.custom-block.warning a:hover > code { + color: var(--vp-c-warning-2); +} +.custom-block.warning code { + background-color: var(--vp-custom-block-warning-code-bg); +} +.custom-block.danger { + border-color: var(--vp-custom-block-danger-border); + color: var(--vp-custom-block-danger-text); + background-color: var(--vp-custom-block-danger-bg); +} +.custom-block.danger a, +.custom-block.danger code { + color: var(--vp-c-danger-1); +} +.custom-block.danger a:hover, +.custom-block.danger a:hover > code { + color: var(--vp-c-danger-2); +} +.custom-block.danger code { + background-color: var(--vp-custom-block-danger-code-bg); +} +.custom-block.caution { + border-color: var(--vp-custom-block-caution-border); + color: var(--vp-custom-block-caution-text); + background-color: var(--vp-custom-block-caution-bg); +} +.custom-block.caution a, +.custom-block.caution code { + color: var(--vp-c-caution-1); +} +.custom-block.caution a:hover, +.custom-block.caution a:hover > code { + color: var(--vp-c-caution-2); +} +.custom-block.caution code { + background-color: var(--vp-custom-block-caution-code-bg); +} +.custom-block.details { + border-color: var(--vp-custom-block-details-border); + color: var(--vp-custom-block-details-text); + background-color: var(--vp-custom-block-details-bg); +} +.custom-block.details a { + color: var(--vp-c-brand-1); +} +.custom-block.details a:hover, +.custom-block.details a:hover > code { + color: var(--vp-c-brand-2); +} +.custom-block.details code { + background-color: var(--vp-custom-block-details-code-bg); +} +.custom-block-title { + font-weight: 600; +} +.custom-block p + p { + margin: 8px 0; +} +.custom-block.details summary { + margin: 0 0 8px; + font-weight: 700; + cursor: pointer; + -webkit-user-select: none; + user-select: none; +} +.custom-block.details summary + p { + margin: 8px 0; +} +.custom-block a { + color: inherit; + font-weight: 600; + text-decoration: underline; + text-underline-offset: 2px; + transition: opacity 0.25s; +} +.custom-block a:hover { + opacity: 0.75; +} +.custom-block code { + font-size: var(--vp-custom-block-code-font-size); +} +.custom-block.custom-block th, +.custom-block.custom-block blockquote > p { + font-size: var(--vp-custom-block-font-size); + color: inherit; +} +.dark .vp-code span { + color: var(--shiki-dark, inherit); +} +html:not(.dark) .vp-code span { + color: var(--shiki-light, inherit); +} +.vp-code-group { + margin-top: 16px; +} +.vp-code-group .tabs { + position: relative; + display: flex; + margin-right: -24px; + margin-left: -24px; + padding: 0 12px; + background-color: var(--vp-code-tab-bg); + overflow-x: auto; + overflow-y: hidden; + box-shadow: inset 0 -1px var(--vp-code-tab-divider); +} +@media (min-width: 640px) { + .vp-code-group .tabs { + margin-right: 0; + margin-left: 0; + border-radius: 8px 8px 0 0; + } +} +.vp-code-group .tabs input { + position: fixed; + opacity: 0; + pointer-events: none; +} +.vp-code-group .tabs label { + position: relative; + display: inline-block; + border-bottom: 1px solid transparent; + padding: 0 12px; + line-height: 48px; + font-size: 14px; + font-weight: 500; + color: var(--vp-code-tab-text-color); + white-space: nowrap; + cursor: pointer; + transition: color 0.25s; +} +.vp-code-group .tabs label:after { + position: absolute; + right: 8px; + bottom: -1px; + left: 8px; + z-index: 1; + height: 2px; + border-radius: 2px; + content: ""; + background-color: transparent; + transition: background-color 0.25s; +} +.vp-code-group label:hover { + color: var(--vp-code-tab-hover-text-color); +} +.vp-code-group input:checked + label { + color: var(--vp-code-tab-active-text-color); +} +.vp-code-group input:checked + label:after { + background-color: var(--vp-code-tab-active-bar-color); +} +.vp-code-group div[class*="language-"], +.vp-block { + display: none; + margin-top: 0 !important; + border-top-left-radius: 0 !important; + border-top-right-radius: 0 !important; +} +.vp-code-group div[class*="language-"].active, +.vp-block.active { + display: block; +} +.vp-block { + padding: 20px 24px; +} +.vp-doc h1, +.vp-doc h2, +.vp-doc h3, +.vp-doc h4, +.vp-doc h5, +.vp-doc h6 { + position: relative; + font-weight: 600; + outline: none; +} +.vp-doc h1 { + letter-spacing: -0.02em; + line-height: 40px; + font-size: 28px; +} +.vp-doc h2 { + margin: 48px 0 16px; + border-top: 1px solid var(--vp-c-divider); + padding-top: 24px; + letter-spacing: -0.02em; + line-height: 32px; + font-size: 24px; +} +.vp-doc h3 { + margin: 32px 0 0; + letter-spacing: -0.01em; + line-height: 28px; + font-size: 20px; +} +.vp-doc h4 { + margin: 24px 0 0; + letter-spacing: -0.01em; + line-height: 24px; + font-size: 18px; +} +.vp-doc .header-anchor { + position: absolute; + top: 0; + left: 0; + margin-left: -0.87em; + font-weight: 500; + -webkit-user-select: none; + user-select: none; + opacity: 0; + text-decoration: none; + transition: + color 0.25s, + opacity 0.25s; +} +.vp-doc .header-anchor:before { + content: var(--vp-header-anchor-symbol); +} +.vp-doc h1:hover .header-anchor, +.vp-doc h1 .header-anchor:focus, +.vp-doc h2:hover .header-anchor, +.vp-doc h2 .header-anchor:focus, +.vp-doc h3:hover .header-anchor, +.vp-doc h3 .header-anchor:focus, +.vp-doc h4:hover .header-anchor, +.vp-doc h4 .header-anchor:focus, +.vp-doc h5:hover .header-anchor, +.vp-doc h5 .header-anchor:focus, +.vp-doc h6:hover .header-anchor, +.vp-doc h6 .header-anchor:focus { + opacity: 1; +} +@media (min-width: 768px) { + .vp-doc h1 { + letter-spacing: -0.02em; + line-height: 40px; + font-size: 32px; + } +} +.vp-doc h2 .header-anchor { + top: 24px; +} +.vp-doc p, +.vp-doc summary { + margin: 16px 0; +} +.vp-doc p { + line-height: 28px; +} +.vp-doc blockquote { + margin: 16px 0; + border-left: 2px solid var(--vp-c-divider); + padding-left: 16px; + transition: border-color 0.5s; + color: var(--vp-c-text-2); +} +.vp-doc blockquote > p { + margin: 0; + font-size: 16px; + transition: color 0.5s; +} +.vp-doc a { + font-weight: 500; + color: var(--vp-c-brand-1); + text-decoration: underline; + text-underline-offset: 2px; + transition: + color 0.25s, + opacity 0.25s; +} +.vp-doc a:hover { + color: var(--vp-c-brand-2); +} +.vp-doc strong { + font-weight: 600; +} +.vp-doc ul, +.vp-doc ol { + padding-left: 1.25rem; + margin: 16px 0; +} +.vp-doc ul { + list-style: disc; +} +.vp-doc ol { + list-style: decimal; +} +.vp-doc li + li { + margin-top: 8px; +} +.vp-doc li > ol, +.vp-doc li > ul { + margin: 8px 0 0; +} +.vp-doc table { + display: block; + border-collapse: collapse; + margin: 20px 0; + overflow-x: auto; +} +.vp-doc tr { + background-color: var(--vp-c-bg); + border-top: 1px solid var(--vp-c-divider); + transition: background-color 0.5s; +} +.vp-doc tr:nth-child(2n) { + background-color: var(--vp-c-bg-soft); +} +.vp-doc th, +.vp-doc td { + border: 1px solid var(--vp-c-divider); + padding: 8px 16px; +} +.vp-doc th { + text-align: left; + font-size: 14px; + font-weight: 600; + color: var(--vp-c-text-2); + background-color: var(--vp-c-bg-soft); +} +.vp-doc td { + font-size: 14px; +} +.vp-doc hr { + margin: 16px 0; + border: none; + border-top: 1px solid var(--vp-c-divider); +} +.vp-doc .custom-block { + margin: 16px 0; +} +.vp-doc .custom-block p { + margin: 8px 0; + line-height: 24px; +} +.vp-doc .custom-block p:first-child { + margin: 0; +} +.vp-doc .custom-block div[class*="language-"] { + margin: 8px 0; + border-radius: 8px; +} +.vp-doc .custom-block div[class*="language-"] code { + font-weight: 400; + background-color: transparent; +} +.vp-doc .custom-block .vp-code-group .tabs { + margin: 0; + border-radius: 8px 8px 0 0; +} +.vp-doc :not(pre, h1, h2, h3, h4, h5, h6) > code { + font-size: var(--vp-code-font-size); + color: var(--vp-code-color); +} +.vp-doc :not(pre) > code { + border-radius: 4px; + padding: 3px 6px; + background-color: var(--vp-code-bg); + transition: + color 0.25s, + background-color 0.5s; +} +.vp-doc a > code { + color: var(--vp-code-link-color); +} +.vp-doc a:hover > code { + color: var(--vp-code-link-hover-color); +} +.vp-doc h1 > code, +.vp-doc h2 > code, +.vp-doc h3 > code, +.vp-doc h4 > code { + font-size: 0.9em; +} +.vp-doc div[class*="language-"], +.vp-block { + position: relative; + margin: 16px -24px; + background-color: var(--vp-code-block-bg); + overflow-x: auto; + transition: background-color 0.5s; +} +@media (min-width: 640px) { + .vp-doc div[class*="language-"], + .vp-block { + border-radius: 8px; + margin: 16px 0; + } +} +@media (max-width: 639px) { + .vp-doc li div[class*="language-"] { + border-radius: 8px 0 0 8px; + } +} +.vp-doc div[class*="language-"] + div[class*="language-"], +.vp-doc div[class$="-api"] + div[class*="language-"], +.vp-doc div[class*="language-"] + div[class$="-api"] > div[class*="language-"] { + margin-top: -8px; +} +.vp-doc [class*="language-"] pre, +.vp-doc [class*="language-"] code { + direction: ltr; + text-align: left; + white-space: pre; + word-spacing: normal; + word-break: normal; + word-wrap: normal; + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} +.vp-doc [class*="language-"] pre { + position: relative; + z-index: 1; + margin: 0; + padding: 20px 0; + background: transparent; + overflow-x: auto; +} +.vp-doc [class*="language-"] code { + display: block; + padding: 0 24px; + width: fit-content; + min-width: 100%; + line-height: var(--vp-code-line-height); + font-size: var(--vp-code-font-size); + color: var(--vp-code-block-color); + transition: color 0.5s; +} +.vp-doc [class*="language-"] code .highlighted { + background-color: var(--vp-code-line-highlight-color); + transition: background-color 0.5s; + margin: 0 -24px; + padding: 0 24px; + width: calc(100% + 48px); + display: inline-block; +} +.vp-doc [class*="language-"] code .highlighted.error { + background-color: var(--vp-code-line-error-color); +} +.vp-doc [class*="language-"] code .highlighted.warning { + background-color: var(--vp-code-line-warning-color); +} +.vp-doc [class*="language-"] code .diff { + transition: background-color 0.5s; + margin: 0 -24px; + padding: 0 24px; + width: calc(100% + 48px); + display: inline-block; +} +.vp-doc [class*="language-"] code .diff:before { + position: absolute; + left: 10px; +} +.vp-doc [class*="language-"] .has-focused-lines .line:not(.has-focus) { + filter: blur(0.095rem); + opacity: 0.4; + transition: + filter 0.35s, + opacity 0.35s; +} +.vp-doc [class*="language-"] .has-focused-lines .line:not(.has-focus) { + opacity: 0.7; + transition: + filter 0.35s, + opacity 0.35s; +} +.vp-doc [class*="language-"]:hover .has-focused-lines .line:not(.has-focus) { + filter: blur(0); + opacity: 1; +} +.vp-doc [class*="language-"] code .diff.remove { + background-color: var(--vp-code-line-diff-remove-color); + opacity: 0.7; +} +.vp-doc [class*="language-"] code .diff.remove:before { + content: "-"; + color: var(--vp-code-line-diff-remove-symbol-color); +} +.vp-doc [class*="language-"] code .diff.add { + background-color: var(--vp-code-line-diff-add-color); +} +.vp-doc [class*="language-"] code .diff.add:before { + content: "+"; + color: var(--vp-code-line-diff-add-symbol-color); +} +.vp-doc div[class*="language-"].line-numbers-mode { + padding-left: 32px; +} +.vp-doc .line-numbers-wrapper { + position: absolute; + top: 0; + bottom: 0; + left: 0; + z-index: 3; + border-right: 1px solid var(--vp-code-block-divider-color); + padding-top: 20px; + width: 32px; + text-align: center; + font-family: var(--vp-font-family-mono); + line-height: var(--vp-code-line-height); + font-size: var(--vp-code-font-size); + color: var(--vp-code-line-number-color); + transition: + border-color 0.5s, + color 0.5s; +} +.vp-doc [class*="language-"] > button.copy { + direction: ltr; + position: absolute; + top: 12px; + right: 12px; + z-index: 3; + border: 1px solid var(--vp-code-copy-code-border-color); + border-radius: 4px; + width: 40px; + height: 40px; + background-color: var(--vp-code-copy-code-bg); + opacity: 0; + cursor: pointer; + background-image: var(--vp-icon-copy); + background-position: 50%; + background-size: 20px; + background-repeat: no-repeat; + transition: + border-color 0.25s, + background-color 0.25s, + opacity 0.25s; +} +.vp-doc [class*="language-"]:hover > button.copy, +.vp-doc [class*="language-"] > button.copy:focus { + opacity: 1; +} +.vp-doc [class*="language-"] > button.copy:hover, +.vp-doc [class*="language-"] > button.copy.copied { + border-color: var(--vp-code-copy-code-hover-border-color); + background-color: var(--vp-code-copy-code-hover-bg); +} +.vp-doc [class*="language-"] > button.copy.copied, +.vp-doc [class*="language-"] > button.copy:hover.copied { + border-radius: 0 4px 4px 0; + background-color: var(--vp-code-copy-code-hover-bg); + background-image: var(--vp-icon-copied); +} +.vp-doc [class*="language-"] > button.copy.copied:before, +.vp-doc [class*="language-"] > button.copy:hover.copied:before { + position: relative; + top: -1px; + transform: translate(calc(-100% - 1px)); + display: flex; + justify-content: center; + align-items: center; + border: 1px solid var(--vp-code-copy-code-hover-border-color); + border-right: 0; + border-radius: 4px 0 0 4px; + padding: 0 10px; + width: fit-content; + height: 40px; + text-align: center; + font-size: 12px; + font-weight: 500; + color: var(--vp-code-copy-code-active-text); + background-color: var(--vp-code-copy-code-hover-bg); + white-space: nowrap; + content: var(--vp-code-copy-copied-text-content); +} +.vp-doc [class*="language-"] > span.lang { + position: absolute; + top: 2px; + right: 8px; + z-index: 2; + font-size: 12px; + font-weight: 500; + -webkit-user-select: none; + user-select: none; + color: var(--vp-code-lang-color); + transition: + color 0.4s, + opacity 0.4s; +} +.vp-doc [class*="language-"]:hover > button.copy + span.lang, +.vp-doc [class*="language-"] > button.copy:focus + span.lang { + opacity: 0; +} +.vp-doc .VPTeamMembers { + margin-top: 24px; +} +.vp-doc .VPTeamMembers.small.count-1 .container { + margin: 0 !important; + max-width: calc((100% - 24px) / 2) !important; +} +.vp-doc .VPTeamMembers.small.count-2 .container, +.vp-doc .VPTeamMembers.small.count-3 .container { + max-width: 100% !important; +} +.vp-doc .VPTeamMembers.medium.count-1 .container { + margin: 0 !important; + max-width: calc((100% - 24px) / 2) !important; +} +:is(.vp-external-link-icon,.vp-doc a[href*="://"],.vp-doc a[target=_blank]):not(:is(.no-icon,svg a,:has(img,svg))):after +{ + display: inline-block; + margin-top: -1px; + margin-left: 4px; + width: 11px; + height: 11px; + background: currentColor; + color: var(--vp-c-text-3); + flex-shrink: 0; + --icon: url("data:image/svg+xml, %3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' %3E%3Cpath d='M0 0h24v24H0V0z' fill='none' /%3E%3Cpath d='M9 5v2h6.59L4 18.59 5.41 20 17 8.41V15h2V5H9z' /%3E%3C/svg%3E"); + -webkit-mask-image: var(--icon); + mask-image: var(--icon); +} +.vp-external-link-icon:after { + content: ""; +} +.external-link-icon-enabled :is(.vp-doc a[href*="://"],.vp-doc a[target=_blank]):not(:is(.no-icon,svg a,:has(img,svg))):after +{ + content: ""; + color: currentColor; +} +.vp-sponsor { + border-radius: 16px; + overflow: hidden; +} +.vp-sponsor.aside { + border-radius: 12px; +} +.vp-sponsor-section + .vp-sponsor-section { + margin-top: 4px; +} +.vp-sponsor-tier { + margin: 0 0 4px !important; + text-align: center; + letter-spacing: 1px !important; + line-height: 24px; + width: 100%; + font-weight: 600; + color: var(--vp-c-text-2); + background-color: var(--vp-c-bg-soft); +} +.vp-sponsor.normal .vp-sponsor-tier { + padding: 13px 0 11px; + font-size: 14px; +} +.vp-sponsor.aside .vp-sponsor-tier { + padding: 9px 0 7px; + font-size: 12px; +} +.vp-sponsor-grid + .vp-sponsor-tier { + margin-top: 4px; +} +.vp-sponsor-grid { + display: flex; + flex-wrap: wrap; + gap: 4px; +} +.vp-sponsor-grid.xmini .vp-sponsor-grid-link { + height: 64px; +} +.vp-sponsor-grid.xmini .vp-sponsor-grid-image { + max-width: 64px; + max-height: 22px; +} +.vp-sponsor-grid.mini .vp-sponsor-grid-link { + height: 72px; +} +.vp-sponsor-grid.mini .vp-sponsor-grid-image { + max-width: 96px; + max-height: 24px; +} +.vp-sponsor-grid.small .vp-sponsor-grid-link { + height: 96px; +} +.vp-sponsor-grid.small .vp-sponsor-grid-image { + max-width: 96px; + max-height: 24px; +} +.vp-sponsor-grid.medium .vp-sponsor-grid-link { + height: 112px; +} +.vp-sponsor-grid.medium .vp-sponsor-grid-image { + max-width: 120px; + max-height: 36px; +} +.vp-sponsor-grid.big .vp-sponsor-grid-link { + height: 184px; +} +.vp-sponsor-grid.big .vp-sponsor-grid-image { + max-width: 192px; + max-height: 56px; +} +.vp-sponsor-grid[data-vp-grid="2"] .vp-sponsor-grid-item { + width: calc((100% - 4px) / 2); +} +.vp-sponsor-grid[data-vp-grid="3"] .vp-sponsor-grid-item { + width: calc((100% - 4px * 2) / 3); +} +.vp-sponsor-grid[data-vp-grid="4"] .vp-sponsor-grid-item { + width: calc((100% - 12px) / 4); +} +.vp-sponsor-grid[data-vp-grid="5"] .vp-sponsor-grid-item { + width: calc((100% - 16px) / 5); +} +.vp-sponsor-grid[data-vp-grid="6"] .vp-sponsor-grid-item { + width: calc((100% - 4px * 5) / 6); +} +.vp-sponsor-grid-item { + flex-shrink: 0; + width: 100%; + background-color: var(--vp-c-bg-soft); + transition: background-color 0.25s; +} +.vp-sponsor-grid-item:hover { + background-color: var(--vp-c-default-soft); +} +.vp-sponsor-grid-item:hover .vp-sponsor-grid-image { + filter: grayscale(0) invert(0); +} +.vp-sponsor-grid-item.empty:hover { + background-color: var(--vp-c-bg-soft); +} +.dark .vp-sponsor-grid-item:hover { + background-color: var(--vp-c-white); +} +.dark .vp-sponsor-grid-item.empty:hover { + background-color: var(--vp-c-bg-soft); +} +.vp-sponsor-grid-link { + display: flex; +} +.vp-sponsor-grid-box { + display: flex; + justify-content: center; + align-items: center; + width: 100%; +} +.vp-sponsor-grid-image { + max-width: 100%; + filter: grayscale(1); + transition: filter 0.25s; +} +.dark .vp-sponsor-grid-image { + filter: grayscale(1) invert(1); +} +.VPBadge { + display: inline-block; + margin-left: 2px; + border: 1px solid transparent; + border-radius: 12px; + padding: 0 10px; + line-height: 22px; + font-size: 12px; + font-weight: 500; + transform: translateY(-2px); +} +.VPBadge.small { + padding: 0 6px; + line-height: 18px; + font-size: 10px; + transform: translateY(-8px); +} +.VPDocFooter .VPBadge { + display: none; +} +.vp-doc h1 > .VPBadge { + margin-top: 4px; + vertical-align: top; +} +.vp-doc h2 > .VPBadge { + margin-top: 3px; + padding: 0 8px; + vertical-align: top; +} +.vp-doc h3 > .VPBadge { + vertical-align: middle; +} +.vp-doc h4 > .VPBadge, +.vp-doc h5 > .VPBadge, +.vp-doc h6 > .VPBadge { + vertical-align: middle; + line-height: 18px; +} +.VPBadge.info { + border-color: var(--vp-badge-info-border); + color: var(--vp-badge-info-text); + background-color: var(--vp-badge-info-bg); +} +.VPBadge.tip { + border-color: var(--vp-badge-tip-border); + color: var(--vp-badge-tip-text); + background-color: var(--vp-badge-tip-bg); +} +.VPBadge.warning { + border-color: var(--vp-badge-warning-border); + color: var(--vp-badge-warning-text); + background-color: var(--vp-badge-warning-bg); +} +.VPBadge.danger { + border-color: var(--vp-badge-danger-border); + color: var(--vp-badge-danger-text); + background-color: var(--vp-badge-danger-bg); +} +.VPBackdrop[data-v-c79a1216] { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: var(--vp-z-index-backdrop); + background: var(--vp-backdrop-bg-color); + transition: opacity 0.5s; +} +.VPBackdrop.fade-enter-from[data-v-c79a1216], +.VPBackdrop.fade-leave-to[data-v-c79a1216] { + opacity: 0; +} +.VPBackdrop.fade-leave-active[data-v-c79a1216] { + transition-duration: 0.25s; +} +@media (min-width: 1280px) { + .VPBackdrop[data-v-c79a1216] { + display: none; + } +} +.NotFound[data-v-d6be1790] { + padding: 64px 24px 96px; + text-align: center; +} +@media (min-width: 768px) { + .NotFound[data-v-d6be1790] { + padding: 96px 32px 168px; + } +} +.code[data-v-d6be1790] { + line-height: 64px; + font-size: 64px; + font-weight: 600; +} +.title[data-v-d6be1790] { + padding-top: 12px; + letter-spacing: 2px; + line-height: 20px; + font-size: 20px; + font-weight: 700; +} +.divider[data-v-d6be1790] { + margin: 24px auto 18px; + width: 64px; + height: 1px; + background-color: var(--vp-c-divider); +} +.quote[data-v-d6be1790] { + margin: 0 auto; + max-width: 256px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.action[data-v-d6be1790] { + padding-top: 20px; +} +.link[data-v-d6be1790] { + display: inline-block; + border: 1px solid var(--vp-c-brand-1); + border-radius: 16px; + padding: 3px 16px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-brand-1); + transition: + border-color 0.25s, + color 0.25s; +} +.link[data-v-d6be1790]:hover { + border-color: var(--vp-c-brand-2); + color: var(--vp-c-brand-2); +} +.root[data-v-b933a997] { + position: relative; + z-index: 1; +} +.nested[data-v-b933a997] { + padding-right: 16px; + padding-left: 16px; +} +.outline-link[data-v-b933a997] { + display: block; + line-height: 32px; + font-size: 14px; + font-weight: 400; + color: var(--vp-c-text-2); + white-space: nowrap; + overflow: hidden; + text-overflow: ellipsis; + transition: color 0.5s; +} +.outline-link[data-v-b933a997]:hover, +.outline-link.active[data-v-b933a997] { + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.outline-link.nested[data-v-b933a997] { + padding-left: 13px; +} +.VPDocAsideOutline[data-v-a5bbad30] { + display: none; +} +.VPDocAsideOutline.has-outline[data-v-a5bbad30] { + display: block; +} +.content[data-v-a5bbad30] { + position: relative; + border-left: 1px solid var(--vp-c-divider); + padding-left: 16px; + font-size: 13px; + font-weight: 500; +} +.outline-marker[data-v-a5bbad30] { + position: absolute; + top: 32px; + left: -1px; + z-index: 0; + opacity: 0; + width: 2px; + border-radius: 2px; + height: 18px; + background-color: var(--vp-c-brand-1); + transition: + top 0.25s cubic-bezier(0, 1, 0.5, 1), + background-color 0.5s, + opacity 0.25s; +} +.outline-title[data-v-a5bbad30] { + line-height: 32px; + font-size: 14px; + font-weight: 600; +} +.VPDocAside[data-v-3f215769] { + display: flex; + flex-direction: column; + flex-grow: 1; +} +.spacer[data-v-3f215769] { + flex-grow: 1; +} +.VPDocAside[data-v-3f215769] .spacer + .VPDocAsideSponsors, +.VPDocAside[data-v-3f215769] .spacer + .VPDocAsideCarbonAds { + margin-top: 24px; +} +.VPDocAside[data-v-3f215769] .VPDocAsideSponsors + .VPDocAsideCarbonAds { + margin-top: 16px; +} +.VPLastUpdated[data-v-e98dd255] { + line-height: 24px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-2); +} +@media (min-width: 640px) { + .VPLastUpdated[data-v-e98dd255] { + line-height: 32px; + font-size: 14px; + font-weight: 500; + } +} +.VPDocFooter[data-v-e257564d] { + margin-top: 64px; +} +.edit-info[data-v-e257564d] { + padding-bottom: 18px; +} +@media (min-width: 640px) { + .edit-info[data-v-e257564d] { + display: flex; + justify-content: space-between; + align-items: center; + padding-bottom: 14px; + } +} +.edit-link-button[data-v-e257564d] { + display: flex; + align-items: center; + border: 0; + line-height: 32px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-brand-1); + transition: color 0.25s; +} +.edit-link-button[data-v-e257564d]:hover { + color: var(--vp-c-brand-2); +} +.edit-link-icon[data-v-e257564d] { + margin-right: 8px; +} +.prev-next[data-v-e257564d] { + border-top: 1px solid var(--vp-c-divider); + padding-top: 24px; + display: grid; + grid-row-gap: 8px; +} +@media (min-width: 640px) { + .prev-next[data-v-e257564d] { + grid-template-columns: repeat(2, 1fr); + grid-column-gap: 16px; + } +} +.pager-link[data-v-e257564d] { + display: block; + border: 1px solid var(--vp-c-divider); + border-radius: 8px; + padding: 11px 16px 13px; + width: 100%; + height: 100%; + transition: border-color 0.25s; +} +.pager-link[data-v-e257564d]:hover { + border-color: var(--vp-c-brand-1); +} +.pager-link.next[data-v-e257564d] { + margin-left: auto; + text-align: right; +} +.desc[data-v-e257564d] { + display: block; + line-height: 20px; + font-size: 12px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.title[data-v-e257564d] { + display: block; + line-height: 20px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-brand-1); + transition: color 0.25s; +} +.VPDoc[data-v-39a288b8] { + padding: 32px 24px 96px; + width: 100%; +} +@media (min-width: 768px) { + .VPDoc[data-v-39a288b8] { + padding: 48px 32px 128px; + } +} +@media (min-width: 960px) { + .VPDoc[data-v-39a288b8] { + padding: 48px 32px 0; + } + .VPDoc:not(.has-sidebar) .container[data-v-39a288b8] { + display: flex; + justify-content: center; + max-width: 992px; + } + .VPDoc:not(.has-sidebar) .content[data-v-39a288b8] { + max-width: 752px; + } +} +@media (min-width: 1280px) { + .VPDoc .container[data-v-39a288b8] { + display: flex; + justify-content: center; + } + .VPDoc .aside[data-v-39a288b8] { + display: block; + } +} +@media (min-width: 1440px) { + .VPDoc:not(.has-sidebar) .content[data-v-39a288b8] { + max-width: 784px; + } + .VPDoc:not(.has-sidebar) .container[data-v-39a288b8] { + max-width: 1104px; + } +} +.container[data-v-39a288b8] { + margin: 0 auto; + width: 100%; +} +.aside[data-v-39a288b8] { + position: relative; + display: none; + order: 2; + flex-grow: 1; + padding-left: 32px; + width: 100%; + max-width: 256px; +} +.left-aside[data-v-39a288b8] { + order: 1; + padding-left: unset; + padding-right: 32px; +} +.aside-container[data-v-39a288b8] { + position: fixed; + top: 0; + padding-top: calc( + var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + + var(--vp-doc-top-height, 0px) + 48px + ); + width: 224px; + height: 100vh; + overflow-x: hidden; + overflow-y: auto; + scrollbar-width: none; +} +.aside-container[data-v-39a288b8]::-webkit-scrollbar { + display: none; +} +.aside-curtain[data-v-39a288b8] { + position: fixed; + bottom: 0; + z-index: 10; + width: 224px; + height: 32px; + background: linear-gradient(transparent, var(--vp-c-bg) 70%); +} +.aside-content[data-v-39a288b8] { + display: flex; + flex-direction: column; + min-height: calc( + 100vh - (var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 48px) + ); + padding-bottom: 32px; +} +.content[data-v-39a288b8] { + position: relative; + margin: 0 auto; + width: 100%; +} +@media (min-width: 960px) { + .content[data-v-39a288b8] { + padding: 0 32px 128px; + } +} +@media (min-width: 1280px) { + .content[data-v-39a288b8] { + order: 1; + margin: 0; + min-width: 640px; + } +} +.content-container[data-v-39a288b8] { + margin: 0 auto; +} +.VPDoc.has-aside .content-container[data-v-39a288b8] { + max-width: 688px; +} +.VPButton[data-v-fa7799d5] { + display: inline-block; + border: 1px solid transparent; + text-align: center; + font-weight: 600; + white-space: nowrap; + transition: + color 0.25s, + border-color 0.25s, + background-color 0.25s; +} +.VPButton[data-v-fa7799d5]:active { + transition: + color 0.1s, + border-color 0.1s, + background-color 0.1s; +} +.VPButton.medium[data-v-fa7799d5] { + border-radius: 20px; + padding: 0 20px; + line-height: 38px; + font-size: 14px; +} +.VPButton.big[data-v-fa7799d5] { + border-radius: 24px; + padding: 0 24px; + line-height: 46px; + font-size: 16px; +} +.VPButton.brand[data-v-fa7799d5] { + border-color: var(--vp-button-brand-border); + color: var(--vp-button-brand-text); + background-color: var(--vp-button-brand-bg); +} +.VPButton.brand[data-v-fa7799d5]:hover { + border-color: var(--vp-button-brand-hover-border); + color: var(--vp-button-brand-hover-text); + background-color: var(--vp-button-brand-hover-bg); +} +.VPButton.brand[data-v-fa7799d5]:active { + border-color: var(--vp-button-brand-active-border); + color: var(--vp-button-brand-active-text); + background-color: var(--vp-button-brand-active-bg); +} +.VPButton.alt[data-v-fa7799d5] { + border-color: var(--vp-button-alt-border); + color: var(--vp-button-alt-text); + background-color: var(--vp-button-alt-bg); +} +.VPButton.alt[data-v-fa7799d5]:hover { + border-color: var(--vp-button-alt-hover-border); + color: var(--vp-button-alt-hover-text); + background-color: var(--vp-button-alt-hover-bg); +} +.VPButton.alt[data-v-fa7799d5]:active { + border-color: var(--vp-button-alt-active-border); + color: var(--vp-button-alt-active-text); + background-color: var(--vp-button-alt-active-bg); +} +.VPButton.sponsor[data-v-fa7799d5] { + border-color: var(--vp-button-sponsor-border); + color: var(--vp-button-sponsor-text); + background-color: var(--vp-button-sponsor-bg); +} +.VPButton.sponsor[data-v-fa7799d5]:hover { + border-color: var(--vp-button-sponsor-hover-border); + color: var(--vp-button-sponsor-hover-text); + background-color: var(--vp-button-sponsor-hover-bg); +} +.VPButton.sponsor[data-v-fa7799d5]:active { + border-color: var(--vp-button-sponsor-active-border); + color: var(--vp-button-sponsor-active-text); + background-color: var(--vp-button-sponsor-active-bg); +} +html:not(.dark) .VPImage.dark[data-v-8426fc1a] { + display: none; +} +.dark .VPImage.light[data-v-8426fc1a] { + display: none; +} +.VPHero[data-v-4f9c455b] { + margin-top: calc( + (var(--vp-nav-height) + var(--vp-layout-top-height, 0px)) * -1 + ); + padding: calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 48px) + 24px 48px; +} +@media (min-width: 640px) { + .VPHero[data-v-4f9c455b] { + padding: calc( + var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 80px + ) + 48px 64px; + } +} +@media (min-width: 960px) { + .VPHero[data-v-4f9c455b] { + padding: calc( + var(--vp-nav-height) + var(--vp-layout-top-height, 0px) + 80px + ) + 64px 64px; + } +} +.container[data-v-4f9c455b] { + display: flex; + flex-direction: column; + margin: 0 auto; + max-width: 1152px; +} +@media (min-width: 960px) { + .container[data-v-4f9c455b] { + flex-direction: row; + } +} +.main[data-v-4f9c455b] { + position: relative; + z-index: 10; + order: 2; + flex-grow: 1; + flex-shrink: 0; +} +.VPHero.has-image .container[data-v-4f9c455b] { + text-align: center; +} +@media (min-width: 960px) { + .VPHero.has-image .container[data-v-4f9c455b] { + text-align: left; + } +} +@media (min-width: 960px) { + .main[data-v-4f9c455b] { + order: 1; + width: calc((100% / 3) * 2); + } + .VPHero.has-image .main[data-v-4f9c455b] { + max-width: 592px; + } +} +.heading[data-v-4f9c455b] { + display: flex; + flex-direction: column; +} +.name[data-v-4f9c455b], +.text[data-v-4f9c455b] { + width: fit-content; + max-width: 392px; + letter-spacing: -0.4px; + line-height: 40px; + font-size: 32px; + font-weight: 700; + white-space: pre-wrap; +} +.VPHero.has-image .name[data-v-4f9c455b], +.VPHero.has-image .text[data-v-4f9c455b] { + margin: 0 auto; +} +.name[data-v-4f9c455b] { + color: var(--vp-home-hero-name-color); +} +.clip[data-v-4f9c455b] { + background: var(--vp-home-hero-name-background); + -webkit-background-clip: text; + background-clip: text; + -webkit-text-fill-color: var(--vp-home-hero-name-color); +} +@media (min-width: 640px) { + .name[data-v-4f9c455b], + .text[data-v-4f9c455b] { + max-width: 576px; + line-height: 56px; + font-size: 48px; + } +} +@media (min-width: 960px) { + .name[data-v-4f9c455b], + .text[data-v-4f9c455b] { + line-height: 64px; + font-size: 56px; + } + .VPHero.has-image .name[data-v-4f9c455b], + .VPHero.has-image .text[data-v-4f9c455b] { + margin: 0; + } +} +.tagline[data-v-4f9c455b] { + padding-top: 8px; + max-width: 392px; + line-height: 28px; + font-size: 18px; + font-weight: 500; + white-space: pre-wrap; + color: var(--vp-c-text-2); +} +.VPHero.has-image .tagline[data-v-4f9c455b] { + margin: 0 auto; +} +@media (min-width: 640px) { + .tagline[data-v-4f9c455b] { + padding-top: 12px; + max-width: 576px; + line-height: 32px; + font-size: 20px; + } +} +@media (min-width: 960px) { + .tagline[data-v-4f9c455b] { + line-height: 36px; + font-size: 24px; + } + .VPHero.has-image .tagline[data-v-4f9c455b] { + margin: 0; + } +} +.actions[data-v-4f9c455b] { + display: flex; + flex-wrap: wrap; + margin: -6px; + padding-top: 24px; +} +.VPHero.has-image .actions[data-v-4f9c455b] { + justify-content: center; +} +@media (min-width: 640px) { + .actions[data-v-4f9c455b] { + padding-top: 32px; + } +} +@media (min-width: 960px) { + .VPHero.has-image .actions[data-v-4f9c455b] { + justify-content: flex-start; + } +} +.action[data-v-4f9c455b] { + flex-shrink: 0; + padding: 6px; +} +.image[data-v-4f9c455b] { + order: 1; + margin: -76px -24px -48px; +} +@media (min-width: 640px) { + .image[data-v-4f9c455b] { + margin: -108px -24px -48px; + } +} +@media (min-width: 960px) { + .image[data-v-4f9c455b] { + flex-grow: 1; + order: 2; + margin: 0; + min-height: 100%; + } +} +.image-container[data-v-4f9c455b] { + position: relative; + margin: 0 auto; + width: 320px; + height: 320px; +} +@media (min-width: 640px) { + .image-container[data-v-4f9c455b] { + width: 392px; + height: 392px; + } +} +@media (min-width: 960px) { + .image-container[data-v-4f9c455b] { + display: flex; + justify-content: center; + align-items: center; + width: 100%; + height: 100%; + transform: translate(-32px, -32px); + } +} +.image-bg[data-v-4f9c455b] { + position: absolute; + top: 50%; + left: 50%; + border-radius: 50%; + width: 192px; + height: 192px; + background-image: var(--vp-home-hero-image-background-image); + filter: var(--vp-home-hero-image-filter); + transform: translate(-50%, -50%); +} +@media (min-width: 640px) { + .image-bg[data-v-4f9c455b] { + width: 256px; + height: 256px; + } +} +@media (min-width: 960px) { + .image-bg[data-v-4f9c455b] { + width: 320px; + height: 320px; + } +} +[data-v-4f9c455b] .image-src { + position: absolute; + top: 50%; + left: 50%; + max-width: 192px; + max-height: 192px; + transform: translate(-50%, -50%); +} +@media (min-width: 640px) { + [data-v-4f9c455b] .image-src { + max-width: 256px; + max-height: 256px; + } +} +@media (min-width: 960px) { + [data-v-4f9c455b] .image-src { + max-width: 320px; + max-height: 320px; + } +} +.VPFeature[data-v-a3976bdc] { + display: block; + border: 1px solid var(--vp-c-bg-soft); + border-radius: 12px; + height: 100%; + background-color: var(--vp-c-bg-soft); + transition: + border-color 0.25s, + background-color 0.25s; +} +.VPFeature.link[data-v-a3976bdc]:hover { + border-color: var(--vp-c-brand-1); +} +.box[data-v-a3976bdc] { + display: flex; + flex-direction: column; + padding: 24px; + height: 100%; +} +.box[data-v-a3976bdc] > .VPImage { + margin-bottom: 20px; +} +.icon[data-v-a3976bdc] { + display: flex; + justify-content: center; + align-items: center; + margin-bottom: 20px; + border-radius: 6px; + background-color: var(--vp-c-default-soft); + width: 48px; + height: 48px; + font-size: 24px; + transition: background-color 0.25s; +} +.title[data-v-a3976bdc] { + line-height: 24px; + font-size: 16px; + font-weight: 600; +} +.details[data-v-a3976bdc] { + flex-grow: 1; + padding-top: 8px; + line-height: 24px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.link-text[data-v-a3976bdc] { + padding-top: 8px; +} +.link-text-value[data-v-a3976bdc] { + display: flex; + align-items: center; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-brand-1); +} +.link-text-icon[data-v-a3976bdc] { + margin-left: 6px; +} +.VPFeatures[data-v-a6181336] { + position: relative; + padding: 0 24px; +} +@media (min-width: 640px) { + .VPFeatures[data-v-a6181336] { + padding: 0 48px; + } +} +@media (min-width: 960px) { + .VPFeatures[data-v-a6181336] { + padding: 0 64px; + } +} +.container[data-v-a6181336] { + margin: 0 auto; + max-width: 1152px; +} +.items[data-v-a6181336] { + display: flex; + flex-wrap: wrap; + margin: -8px; +} +.item[data-v-a6181336] { + padding: 8px; + width: 100%; +} +@media (min-width: 640px) { + .item.grid-2[data-v-a6181336], + .item.grid-4[data-v-a6181336], + .item.grid-6[data-v-a6181336] { + width: 50%; + } +} +@media (min-width: 768px) { + .item.grid-2[data-v-a6181336], + .item.grid-4[data-v-a6181336] { + width: 50%; + } + .item.grid-3[data-v-a6181336], + .item.grid-6[data-v-a6181336] { + width: calc(100% / 3); + } +} +@media (min-width: 960px) { + .item.grid-4[data-v-a6181336] { + width: 25%; + } +} +.container[data-v-8e2d4988] { + margin: auto; + width: 100%; + max-width: 1280px; + padding: 0 24px; +} +@media (min-width: 640px) { + .container[data-v-8e2d4988] { + padding: 0 48px; + } +} +@media (min-width: 960px) { + .container[data-v-8e2d4988] { + width: 100%; + padding: 0 64px; + } +} +.vp-doc[data-v-8e2d4988] .VPHomeSponsors, +.vp-doc[data-v-8e2d4988] .VPTeamPage { + margin-left: var(--vp-offset, calc(50% - 50vw)); + margin-right: var(--vp-offset, calc(50% - 50vw)); +} +.vp-doc[data-v-8e2d4988] .VPHomeSponsors h2 { + border-top: none; + letter-spacing: normal; +} +.vp-doc[data-v-8e2d4988] .VPHomeSponsors a, +.vp-doc[data-v-8e2d4988] .VPTeamPage a { + text-decoration: none; +} +.VPHome[data-v-8b561e3d] { + margin-bottom: 96px; +} +@media (min-width: 768px) { + .VPHome[data-v-8b561e3d] { + margin-bottom: 128px; + } +} +.VPContent[data-v-1428d186] { + flex-grow: 1; + flex-shrink: 0; + margin: var(--vp-layout-top-height, 0px) auto 0; + width: 100%; +} +.VPContent.is-home[data-v-1428d186] { + width: 100%; + max-width: 100%; +} +.VPContent.has-sidebar[data-v-1428d186] { + margin: 0; +} +@media (min-width: 960px) { + .VPContent[data-v-1428d186] { + padding-top: var(--vp-nav-height); + } + .VPContent.has-sidebar[data-v-1428d186] { + margin: var(--vp-layout-top-height, 0px) 0 0; + padding-left: var(--vp-sidebar-width); + } +} +@media (min-width: 1440px) { + .VPContent.has-sidebar[data-v-1428d186] { + padding-right: calc((100vw - var(--vp-layout-max-width)) / 2); + padding-left: calc( + (100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width) + ); + } +} +.VPFooter[data-v-e315a0ad] { + position: relative; + z-index: var(--vp-z-index-footer); + border-top: 1px solid var(--vp-c-gutter); + padding: 32px 24px; + background-color: var(--vp-c-bg); +} +.VPFooter.has-sidebar[data-v-e315a0ad] { + display: none; +} +.VPFooter[data-v-e315a0ad] a { + text-decoration-line: underline; + text-underline-offset: 2px; + transition: color 0.25s; +} +.VPFooter[data-v-e315a0ad] a:hover { + color: var(--vp-c-text-1); +} +@media (min-width: 768px) { + .VPFooter[data-v-e315a0ad] { + padding: 32px; + } +} +.container[data-v-e315a0ad] { + margin: 0 auto; + max-width: var(--vp-layout-max-width); + text-align: center; +} +.message[data-v-e315a0ad], +.copyright[data-v-e315a0ad] { + line-height: 24px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.VPLocalNavOutlineDropdown[data-v-8a42e2b4] { + padding: 12px 20px 11px; +} +@media (min-width: 960px) { + .VPLocalNavOutlineDropdown[data-v-8a42e2b4] { + padding: 12px 36px 11px; + } +} +.VPLocalNavOutlineDropdown button[data-v-8a42e2b4] { + display: block; + font-size: 12px; + font-weight: 500; + line-height: 24px; + color: var(--vp-c-text-2); + transition: color 0.5s; + position: relative; +} +.VPLocalNavOutlineDropdown button[data-v-8a42e2b4]:hover { + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.VPLocalNavOutlineDropdown button.open[data-v-8a42e2b4] { + color: var(--vp-c-text-1); +} +.icon[data-v-8a42e2b4] { + display: inline-block; + vertical-align: middle; + margin-left: 2px; + font-size: 14px; + transform: rotate(0); + transition: transform 0.25s; +} +@media (min-width: 960px) { + .VPLocalNavOutlineDropdown button[data-v-8a42e2b4] { + font-size: 14px; + } + .icon[data-v-8a42e2b4] { + font-size: 16px; + } +} +.open > .icon[data-v-8a42e2b4] { + transform: rotate(90deg); +} +.items[data-v-8a42e2b4] { + position: absolute; + top: 40px; + right: 16px; + left: 16px; + display: grid; + gap: 1px; + border: 1px solid var(--vp-c-border); + border-radius: 8px; + background-color: var(--vp-c-gutter); + max-height: calc(var(--vp-vh, 100vh) - 86px); + overflow: hidden auto; + box-shadow: var(--vp-shadow-3); +} +@media (min-width: 960px) { + .items[data-v-8a42e2b4] { + right: auto; + left: calc(var(--vp-sidebar-width) + 32px); + width: 320px; + } +} +.header[data-v-8a42e2b4] { + background-color: var(--vp-c-bg-soft); +} +.top-link[data-v-8a42e2b4] { + display: block; + padding: 0 16px; + line-height: 48px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-brand-1); +} +.outline[data-v-8a42e2b4] { + padding: 8px 0; + background-color: var(--vp-c-bg-soft); +} +.flyout-enter-active[data-v-8a42e2b4] { + transition: all 0.2s ease-out; +} +.flyout-leave-active[data-v-8a42e2b4] { + transition: all 0.15s ease-in; +} +.flyout-enter-from[data-v-8a42e2b4], +.flyout-leave-to[data-v-8a42e2b4] { + opacity: 0; + transform: translateY(-16px); +} +.VPLocalNav[data-v-a6f0e41e] { + position: sticky; + top: 0; + left: 0; + z-index: var(--vp-z-index-local-nav); + border-bottom: 1px solid var(--vp-c-gutter); + padding-top: var(--vp-layout-top-height, 0px); + width: 100%; + background-color: var(--vp-local-nav-bg-color); +} +.VPLocalNav.fixed[data-v-a6f0e41e] { + position: fixed; +} +@media (min-width: 960px) { + .VPLocalNav[data-v-a6f0e41e] { + top: var(--vp-nav-height); + } + .VPLocalNav.has-sidebar[data-v-a6f0e41e] { + padding-left: var(--vp-sidebar-width); + } + .VPLocalNav.empty[data-v-a6f0e41e] { + display: none; + } +} +@media (min-width: 1280px) { + .VPLocalNav[data-v-a6f0e41e] { + display: none; + } +} +@media (min-width: 1440px) { + .VPLocalNav.has-sidebar[data-v-a6f0e41e] { + padding-left: calc( + (100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width) + ); + } +} +.container[data-v-a6f0e41e] { + display: flex; + justify-content: space-between; + align-items: center; +} +.menu[data-v-a6f0e41e] { + display: flex; + align-items: center; + padding: 12px 24px 11px; + line-height: 24px; + font-size: 12px; + font-weight: 500; + color: var(--vp-c-text-2); + transition: color 0.5s; +} +.menu[data-v-a6f0e41e]:hover { + color: var(--vp-c-text-1); + transition: color 0.25s; +} +@media (min-width: 768px) { + .menu[data-v-a6f0e41e] { + padding: 0 32px; + } +} +@media (min-width: 960px) { + .menu[data-v-a6f0e41e] { + display: none; + } +} +.menu-icon[data-v-a6f0e41e] { + margin-right: 8px; + font-size: 14px; +} +.VPOutlineDropdown[data-v-a6f0e41e] { + padding: 12px 24px 11px; +} +@media (min-width: 768px) { + .VPOutlineDropdown[data-v-a6f0e41e] { + padding: 12px 32px 11px; + } +} +.VPSwitch[data-v-1d5665e3] { + position: relative; + border-radius: 11px; + display: block; + width: 40px; + height: 22px; + flex-shrink: 0; + border: 1px solid var(--vp-input-border-color); + background-color: var(--vp-input-switch-bg-color); + transition: border-color 0.25s !important; +} +.VPSwitch[data-v-1d5665e3]:hover { + border-color: var(--vp-c-brand-1); +} +.check[data-v-1d5665e3] { + position: absolute; + top: 1px; + left: 1px; + width: 18px; + height: 18px; + border-radius: 50%; + background-color: var(--vp-c-neutral-inverse); + box-shadow: var(--vp-shadow-1); + transition: transform 0.25s !important; +} +.icon[data-v-1d5665e3] { + position: relative; + display: block; + width: 18px; + height: 18px; + border-radius: 50%; + overflow: hidden; +} +.icon[data-v-1d5665e3] [class^="vpi-"] { + position: absolute; + top: 3px; + left: 3px; + width: 12px; + height: 12px; + color: var(--vp-c-text-2); +} +.dark .icon[data-v-1d5665e3] [class^="vpi-"] { + color: var(--vp-c-text-1); + transition: opacity 0.25s !important; +} +.sun[data-v-5337faa4] { + opacity: 1; +} +.moon[data-v-5337faa4], +.dark .sun[data-v-5337faa4] { + opacity: 0; +} +.dark .moon[data-v-5337faa4] { + opacity: 1; +} +.dark .VPSwitchAppearance[data-v-5337faa4] .check { + transform: translate(18px); +} +.VPNavBarAppearance[data-v-6c893767] { + display: none; +} +@media (min-width: 1280px) { + .VPNavBarAppearance[data-v-6c893767] { + display: flex; + align-items: center; + } +} +.VPMenuGroup + .VPMenuLink[data-v-35975db6] { + margin: 12px -12px 0; + border-top: 1px solid var(--vp-c-divider); + padding: 12px 12px 0; +} +.link[data-v-35975db6] { + display: block; + border-radius: 6px; + padding: 0 12px; + line-height: 32px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-1); + white-space: nowrap; + transition: + background-color 0.25s, + color 0.25s; +} +.link[data-v-35975db6]:hover { + color: var(--vp-c-brand-1); + background-color: var(--vp-c-default-soft); +} +.link.active[data-v-35975db6] { + color: var(--vp-c-brand-1); +} +.VPMenuGroup[data-v-69e747b5] { + margin: 12px -12px 0; + border-top: 1px solid var(--vp-c-divider); + padding: 12px 12px 0; +} +.VPMenuGroup[data-v-69e747b5]:first-child { + margin-top: 0; + border-top: 0; + padding-top: 0; +} +.VPMenuGroup + .VPMenuGroup[data-v-69e747b5] { + margin-top: 12px; + border-top: 1px solid var(--vp-c-divider); +} +.title[data-v-69e747b5] { + padding: 0 12px; + line-height: 32px; + font-size: 14px; + font-weight: 600; + color: var(--vp-c-text-2); + white-space: nowrap; + transition: color 0.25s; +} +.VPMenu[data-v-b98bc113] { + border-radius: 12px; + padding: 12px; + min-width: 128px; + border: 1px solid var(--vp-c-divider); + background-color: var(--vp-c-bg-elv); + box-shadow: var(--vp-shadow-3); + transition: background-color 0.5s; + max-height: calc(100vh - var(--vp-nav-height)); + overflow-y: auto; +} +.VPMenu[data-v-b98bc113] .group { + margin: 0 -12px; + padding: 0 12px 12px; +} +.VPMenu[data-v-b98bc113] .group + .group { + border-top: 1px solid var(--vp-c-divider); + padding: 11px 12px 12px; +} +.VPMenu[data-v-b98bc113] .group:last-child { + padding-bottom: 0; +} +.VPMenu[data-v-b98bc113] .group + .item { + border-top: 1px solid var(--vp-c-divider); + padding: 11px 16px 0; +} +.VPMenu[data-v-b98bc113] .item { + padding: 0 16px; + white-space: nowrap; +} +.VPMenu[data-v-b98bc113] .label { + flex-grow: 1; + line-height: 28px; + font-size: 12px; + font-weight: 500; + color: var(--vp-c-text-2); + transition: color 0.5s; +} +.VPMenu[data-v-b98bc113] .action { + padding-left: 24px; +} +.VPFlyout[data-v-cf11d7a2] { + position: relative; +} +.VPFlyout[data-v-cf11d7a2]:hover { + color: var(--vp-c-brand-1); + transition: color 0.25s; +} +.VPFlyout:hover .text[data-v-cf11d7a2] { + color: var(--vp-c-text-2); +} +.VPFlyout:hover .icon[data-v-cf11d7a2] { + fill: var(--vp-c-text-2); +} +.VPFlyout.active .text[data-v-cf11d7a2] { + color: var(--vp-c-brand-1); +} +.VPFlyout.active:hover .text[data-v-cf11d7a2] { + color: var(--vp-c-brand-2); +} +.button[aria-expanded="false"] + .menu[data-v-cf11d7a2] { + opacity: 0; + visibility: hidden; + transform: translateY(0); +} +.VPFlyout:hover .menu[data-v-cf11d7a2], +.button[aria-expanded="true"] + .menu[data-v-cf11d7a2] { + opacity: 1; + visibility: visible; + transform: translateY(0); +} +.button[data-v-cf11d7a2] { + display: flex; + align-items: center; + padding: 0 12px; + height: var(--vp-nav-height); + color: var(--vp-c-text-1); + transition: color 0.5s; +} +.text[data-v-cf11d7a2] { + display: flex; + align-items: center; + line-height: var(--vp-nav-height); + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.option-icon[data-v-cf11d7a2] { + margin-right: 0; + font-size: 16px; +} +.text-icon[data-v-cf11d7a2] { + margin-left: 4px; + font-size: 14px; +} +.icon[data-v-cf11d7a2] { + font-size: 20px; + transition: fill 0.25s; +} +.menu[data-v-cf11d7a2] { + position: absolute; + top: calc(var(--vp-nav-height) / 2 + 20px); + right: 0; + opacity: 0; + visibility: hidden; + transition: + opacity 0.25s, + visibility 0.25s, + transform 0.25s; +} +.VPSocialLink[data-v-bd121fe5] { + display: flex; + justify-content: center; + align-items: center; + width: 36px; + height: 36px; + color: var(--vp-c-text-2); + transition: color 0.5s; +} +.VPSocialLink[data-v-bd121fe5]:hover { + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.VPSocialLink[data-v-bd121fe5] > svg, +.VPSocialLink[data-v-bd121fe5] > [class^="vpi-social-"] { + width: 20px; + height: 20px; + fill: currentColor; +} +.VPSocialLinks[data-v-7bc22406] { + display: flex; + justify-content: center; +} +.VPNavBarExtra[data-v-bb2aa2f0] { + display: none; + margin-right: -12px; +} +@media (min-width: 768px) { + .VPNavBarExtra[data-v-bb2aa2f0] { + display: block; + } +} +@media (min-width: 1280px) { + .VPNavBarExtra[data-v-bb2aa2f0] { + display: none; + } +} +.trans-title[data-v-bb2aa2f0] { + padding: 0 24px 0 12px; + line-height: 32px; + font-size: 14px; + font-weight: 700; + color: var(--vp-c-text-1); +} +.item.appearance[data-v-bb2aa2f0], +.item.social-links[data-v-bb2aa2f0] { + display: flex; + align-items: center; + padding: 0 12px; +} +.item.appearance[data-v-bb2aa2f0] { + min-width: 176px; +} +.appearance-action[data-v-bb2aa2f0] { + margin-right: -2px; +} +.social-links-list[data-v-bb2aa2f0] { + margin: -4px -8px; +} +.VPNavBarHamburger[data-v-e5dd9c1c] { + display: flex; + justify-content: center; + align-items: center; + width: 48px; + height: var(--vp-nav-height); +} +@media (min-width: 768px) { + .VPNavBarHamburger[data-v-e5dd9c1c] { + display: none; + } +} +.container[data-v-e5dd9c1c] { + position: relative; + width: 16px; + height: 14px; + overflow: hidden; +} +.VPNavBarHamburger:hover .top[data-v-e5dd9c1c] { + top: 0; + left: 0; + transform: translate(4px); +} +.VPNavBarHamburger:hover .middle[data-v-e5dd9c1c] { + top: 6px; + left: 0; + transform: translate(0); +} +.VPNavBarHamburger:hover .bottom[data-v-e5dd9c1c] { + top: 12px; + left: 0; + transform: translate(8px); +} +.VPNavBarHamburger.active .top[data-v-e5dd9c1c] { + top: 6px; + transform: translate(0) rotate(225deg); +} +.VPNavBarHamburger.active .middle[data-v-e5dd9c1c] { + top: 6px; + transform: translate(16px); +} +.VPNavBarHamburger.active .bottom[data-v-e5dd9c1c] { + top: 6px; + transform: translate(0) rotate(135deg); +} +.VPNavBarHamburger.active:hover .top[data-v-e5dd9c1c], +.VPNavBarHamburger.active:hover .middle[data-v-e5dd9c1c], +.VPNavBarHamburger.active:hover .bottom[data-v-e5dd9c1c] { + background-color: var(--vp-c-text-2); + transition: + top 0.25s, + background-color 0.25s, + transform 0.25s; +} +.top[data-v-e5dd9c1c], +.middle[data-v-e5dd9c1c], +.bottom[data-v-e5dd9c1c] { + position: absolute; + width: 16px; + height: 2px; + background-color: var(--vp-c-text-1); + transition: + top 0.25s, + background-color 0.5s, + transform 0.25s; +} +.top[data-v-e5dd9c1c] { + top: 0; + left: 0; + transform: translate(0); +} +.middle[data-v-e5dd9c1c] { + top: 6px; + left: 0; + transform: translate(8px); +} +.bottom[data-v-e5dd9c1c] { + top: 12px; + left: 0; + transform: translate(4px); +} +.VPNavBarMenuLink[data-v-e56f3d57] { + display: flex; + align-items: center; + padding: 0 12px; + line-height: var(--vp-nav-height); + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.VPNavBarMenuLink.active[data-v-e56f3d57], +.VPNavBarMenuLink[data-v-e56f3d57]:hover { + color: var(--vp-c-brand-1); +} +.VPNavBarMenu[data-v-dc692963] { + display: none; +} +@media (min-width: 768px) { + .VPNavBarMenu[data-v-dc692963] { + display: flex; + } +} /*! @docsearch/css 3.8.2 | MIT License | © Algolia, Inc. and contributors | https://docsearch.algolia.com */ +:root { + --docsearch-primary-color: #5468ff; + --docsearch-text-color: #1c1e21; + --docsearch-spacing: 12px; + --docsearch-icon-stroke-width: 1.4; + --docsearch-highlight-color: var(--docsearch-primary-color); + --docsearch-muted-color: #969faf; + --docsearch-container-background: rgba(101, 108, 133, 0.8); + --docsearch-logo-color: #5468ff; + --docsearch-modal-width: 560px; + --docsearch-modal-height: 600px; + --docsearch-modal-background: #f5f6f7; + --docsearch-modal-shadow: + inset 1px 1px 0 0 hsla(0, 0%, 100%, 0.5), 0 3px 8px 0 #555a64; + --docsearch-searchbox-height: 56px; + --docsearch-searchbox-background: #ebedf0; + --docsearch-searchbox-focus-background: #fff; + --docsearch-searchbox-shadow: inset 0 0 0 2px var(--docsearch-primary-color); + --docsearch-hit-height: 56px; + --docsearch-hit-color: #444950; + --docsearch-hit-active-color: #fff; + --docsearch-hit-background: #fff; + --docsearch-hit-shadow: 0 1px 3px 0 #d4d9e1; + --docsearch-key-gradient: linear-gradient(-225deg, #d5dbe4, #f8f8f8); + --docsearch-key-shadow: + inset 0 -2px 0 0 #cdcde6, inset 0 0 1px 1px #fff, + 0 1px 2px 1px rgba(30, 35, 90, 0.4); + --docsearch-key-pressed-shadow: + inset 0 -2px 0 0 #cdcde6, inset 0 0 1px 1px #fff, + 0 1px 1px 0 rgba(30, 35, 90, 0.4); + --docsearch-footer-height: 44px; + --docsearch-footer-background: #fff; + --docsearch-footer-shadow: + 0 -1px 0 0 #e0e3e8, 0 -3px 6px 0 rgba(69, 98, 155, 0.12); +} +html[data-theme="dark"] { + --docsearch-text-color: #f5f6f7; + --docsearch-container-background: rgba(9, 10, 17, 0.8); + --docsearch-modal-background: #15172a; + --docsearch-modal-shadow: inset 1px 1px 0 0 #2c2e40, 0 3px 8px 0 #000309; + --docsearch-searchbox-background: #090a11; + --docsearch-searchbox-focus-background: #000; + --docsearch-hit-color: #bec3c9; + --docsearch-hit-shadow: none; + --docsearch-hit-background: #090a11; + --docsearch-key-gradient: linear-gradient(-26.5deg, #565872, #31355b); + --docsearch-key-shadow: + inset 0 -2px 0 0 #282d55, inset 0 0 1px 1px #51577d, + 0 2px 2px 0 rgba(3, 4, 9, 0.3); + --docsearch-key-pressed-shadow: + inset 0 -2px 0 0 #282d55, inset 0 0 1px 1px #51577d, 0 1px 1px 0 #0304094d; + --docsearch-footer-background: #1e2136; + --docsearch-footer-shadow: + inset 0 1px 0 0 rgba(73, 76, 106, 0.5), 0 -4px 8px 0 rgba(0, 0, 0, 0.2); + --docsearch-logo-color: #fff; + --docsearch-muted-color: #7f8497; +} +.DocSearch-Button { + align-items: center; + background: var(--docsearch-searchbox-background); + border: 0; + border-radius: 40px; + color: var(--docsearch-muted-color); + cursor: pointer; + display: flex; + font-weight: 500; + height: 36px; + justify-content: space-between; + margin: 0 0 0 16px; + padding: 0 8px; + -webkit-user-select: none; + user-select: none; +} +.DocSearch-Button:active, +.DocSearch-Button:focus, +.DocSearch-Button:hover { + background: var(--docsearch-searchbox-focus-background); + box-shadow: var(--docsearch-searchbox-shadow); + color: var(--docsearch-text-color); + outline: none; +} +.DocSearch-Button-Container { + align-items: center; + display: flex; +} +.DocSearch-Search-Icon { + stroke-width: 1.6; +} +.DocSearch-Button .DocSearch-Search-Icon { + color: var(--docsearch-text-color); +} +.DocSearch-Button-Placeholder { + font-size: 1rem; + padding: 0 12px 0 6px; +} +.DocSearch-Button-Keys { + display: flex; + min-width: calc(40px + 0.8em); +} +.DocSearch-Button-Key { + align-items: center; + background: var(--docsearch-key-gradient); + border: 0; + border-radius: 3px; + box-shadow: var(--docsearch-key-shadow); + color: var(--docsearch-muted-color); + display: flex; + height: 18px; + justify-content: center; + margin-right: 0.4em; + padding: 0 0 2px; + position: relative; + top: -1px; + width: 20px; +} +.DocSearch-Button-Key--pressed { + box-shadow: var(--docsearch-key-pressed-shadow); + transform: translate3d(0, 1px, 0); +} +@media (max-width: 768px) { + .DocSearch-Button-Keys, + .DocSearch-Button-Placeholder { + display: none; + } +} +.DocSearch--active { + overflow: hidden !important; +} +.DocSearch-Container, +.DocSearch-Container * { + box-sizing: border-box; +} +.DocSearch-Container { + background-color: var(--docsearch-container-background); + height: 100vh; + left: 0; + position: fixed; + top: 0; + width: 100vw; + z-index: 200; +} +.DocSearch-Container a { + text-decoration: none; +} +.DocSearch-Link { + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + border: 0; + color: var(--docsearch-highlight-color); + cursor: pointer; + font: inherit; + margin: 0; + padding: 0; +} +.DocSearch-Modal { + background: var(--docsearch-modal-background); + border-radius: 6px; + box-shadow: var(--docsearch-modal-shadow); + flex-direction: column; + margin: 60px auto auto; + max-width: var(--docsearch-modal-width); + position: relative; +} +.DocSearch-SearchBar { + display: flex; + padding: var(--docsearch-spacing) var(--docsearch-spacing) 0; +} +.DocSearch-Form { + align-items: center; + background: var(--docsearch-searchbox-focus-background); + border-radius: 4px; + box-shadow: var(--docsearch-searchbox-shadow); + display: flex; + height: var(--docsearch-searchbox-height); + margin: 0; + padding: 0 var(--docsearch-spacing); + position: relative; + width: 100%; +} +.DocSearch-Input { + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: transparent; + border: 0; + color: var(--docsearch-text-color); + flex: 1; + font: inherit; + font-size: 1.2em; + height: 100%; + outline: none; + padding: 0 0 0 8px; + width: 80%; +} +.DocSearch-Input::placeholder { + color: var(--docsearch-muted-color); + opacity: 1; +} +.DocSearch-Input::-webkit-search-cancel-button, +.DocSearch-Input::-webkit-search-decoration, +.DocSearch-Input::-webkit-search-results-button, +.DocSearch-Input::-webkit-search-results-decoration { + display: none; +} +.DocSearch-LoadingIndicator, +.DocSearch-MagnifierLabel, +.DocSearch-Reset { + margin: 0; + padding: 0; +} +.DocSearch-MagnifierLabel, +.DocSearch-Reset { + align-items: center; + color: var(--docsearch-highlight-color); + display: flex; + justify-content: center; +} +.DocSearch-Container--Stalled .DocSearch-MagnifierLabel, +.DocSearch-LoadingIndicator { + display: none; +} +.DocSearch-Container--Stalled .DocSearch-LoadingIndicator { + align-items: center; + color: var(--docsearch-highlight-color); + display: flex; + justify-content: center; +} +@media screen and (prefers-reduced-motion: reduce) { + .DocSearch-Reset { + animation: none; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + border: 0; + border-radius: 50%; + color: var(--docsearch-icon-color); + cursor: pointer; + right: 0; + stroke-width: var(--docsearch-icon-stroke-width); + } +} +.DocSearch-Reset { + animation: fade-in 0.1s ease-in forwards; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + border: 0; + border-radius: 50%; + color: var(--docsearch-icon-color); + cursor: pointer; + padding: 2px; + right: 0; + stroke-width: var(--docsearch-icon-stroke-width); +} +.DocSearch-Reset[hidden] { + display: none; +} +.DocSearch-Reset:hover { + color: var(--docsearch-highlight-color); +} +.DocSearch-LoadingIndicator svg, +.DocSearch-MagnifierLabel svg { + height: 24px; + width: 24px; +} +.DocSearch-Cancel { + display: none; +} +.DocSearch-Dropdown { + max-height: calc( + var(--docsearch-modal-height) - var(--docsearch-searchbox-height) - + var(--docsearch-spacing) - var(--docsearch-footer-height) + ); + min-height: var(--docsearch-spacing); + overflow-y: auto; + overflow-y: overlay; + padding: 0 var(--docsearch-spacing); + scrollbar-color: var(--docsearch-muted-color) + var(--docsearch-modal-background); + scrollbar-width: thin; +} +.DocSearch-Dropdown::-webkit-scrollbar { + width: 12px; +} +.DocSearch-Dropdown::-webkit-scrollbar-track { + background: transparent; +} +.DocSearch-Dropdown::-webkit-scrollbar-thumb { + background-color: var(--docsearch-muted-color); + border: 3px solid var(--docsearch-modal-background); + border-radius: 20px; +} +.DocSearch-Dropdown ul { + list-style: none; + margin: 0; + padding: 0; +} +.DocSearch-Label { + font-size: 0.75em; + line-height: 1.6em; +} +.DocSearch-Help, +.DocSearch-Label { + color: var(--docsearch-muted-color); +} +.DocSearch-Help { + font-size: 0.9em; + margin: 0; + -webkit-user-select: none; + user-select: none; +} +.DocSearch-Title { + font-size: 1.2em; +} +.DocSearch-Logo a { + display: flex; +} +.DocSearch-Logo svg { + color: var(--docsearch-logo-color); + margin-left: 8px; +} +.DocSearch-Hits:last-of-type { + margin-bottom: 24px; +} +.DocSearch-Hits mark { + background: none; + color: var(--docsearch-highlight-color); +} +.DocSearch-HitsFooter { + color: var(--docsearch-muted-color); + display: flex; + font-size: 0.85em; + justify-content: center; + margin-bottom: var(--docsearch-spacing); + padding: var(--docsearch-spacing); +} +.DocSearch-HitsFooter a { + border-bottom: 1px solid; + color: inherit; +} +.DocSearch-Hit { + border-radius: 4px; + display: flex; + padding-bottom: 4px; + position: relative; +} +@media screen and (prefers-reduced-motion: reduce) { + .DocSearch-Hit--deleting { + transition: none; + } +} +.DocSearch-Hit--deleting { + opacity: 0; + transition: all 0.25s linear; +} +@media screen and (prefers-reduced-motion: reduce) { + .DocSearch-Hit--favoriting { + transition: none; + } +} +.DocSearch-Hit--favoriting { + transform: scale(0); + transform-origin: top center; + transition: all 0.25s linear; + transition-delay: 0.25s; +} +.DocSearch-Hit a { + background: var(--docsearch-hit-background); + border-radius: 4px; + box-shadow: var(--docsearch-hit-shadow); + display: block; + padding-left: var(--docsearch-spacing); + width: 100%; +} +.DocSearch-Hit-source { + background: var(--docsearch-modal-background); + color: var(--docsearch-highlight-color); + font-size: 0.85em; + font-weight: 600; + line-height: 32px; + margin: 0 -4px; + padding: 8px 4px 0; + position: sticky; + top: 0; + z-index: 10; +} +.DocSearch-Hit-Tree { + color: var(--docsearch-muted-color); + height: var(--docsearch-hit-height); + opacity: 0.5; + stroke-width: var(--docsearch-icon-stroke-width); + width: 24px; +} +.DocSearch-Hit[aria-selected="true"] a { + background-color: var(--docsearch-highlight-color); +} +.DocSearch-Hit[aria-selected="true"] mark { + text-decoration: underline; +} +.DocSearch-Hit-Container { + align-items: center; + color: var(--docsearch-hit-color); + display: flex; + flex-direction: row; + height: var(--docsearch-hit-height); + padding: 0 var(--docsearch-spacing) 0 0; +} +.DocSearch-Hit-icon { + height: 20px; + width: 20px; +} +.DocSearch-Hit-action, +.DocSearch-Hit-icon { + color: var(--docsearch-muted-color); + stroke-width: var(--docsearch-icon-stroke-width); +} +.DocSearch-Hit-action { + align-items: center; + display: flex; + height: 22px; + width: 22px; +} +.DocSearch-Hit-action svg { + display: block; + height: 18px; + width: 18px; +} +.DocSearch-Hit-action + .DocSearch-Hit-action { + margin-left: 6px; +} +.DocSearch-Hit-action-button { + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + border: 0; + border-radius: 50%; + color: inherit; + cursor: pointer; + padding: 2px; +} +svg.DocSearch-Hit-Select-Icon { + display: none; +} +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-Select-Icon { + display: block; +} +.DocSearch-Hit-action-button:focus, +.DocSearch-Hit-action-button:hover { + background: #0003; + transition: background-color 0.1s ease-in; +} +@media screen and (prefers-reduced-motion: reduce) { + .DocSearch-Hit-action-button:focus, + .DocSearch-Hit-action-button:hover { + transition: none; + } +} +.DocSearch-Hit-action-button:focus path, +.DocSearch-Hit-action-button:hover path { + fill: #fff; +} +.DocSearch-Hit-content-wrapper { + display: flex; + flex: 1 1 auto; + flex-direction: column; + font-weight: 500; + justify-content: center; + line-height: 1.2em; + margin: 0 8px; + overflow-x: hidden; + position: relative; + text-overflow: ellipsis; + white-space: nowrap; + width: 80%; +} +.DocSearch-Hit-title { + font-size: 0.9em; +} +.DocSearch-Hit-path { + color: var(--docsearch-muted-color); + font-size: 0.75em; +} +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-Tree, +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-action, +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-icon, +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-path, +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-text, +.DocSearch-Hit[aria-selected="true"] .DocSearch-Hit-title, +.DocSearch-Hit[aria-selected="true"] mark { + color: var(--docsearch-hit-active-color) !important; +} +@media screen and (prefers-reduced-motion: reduce) { + .DocSearch-Hit-action-button:focus, + .DocSearch-Hit-action-button:hover { + background: #0003; + transition: none; + } +} +.DocSearch-ErrorScreen, +.DocSearch-NoResults, +.DocSearch-StartScreen { + font-size: 0.9em; + margin: 0 auto; + padding: 36px 0; + text-align: center; + width: 80%; +} +.DocSearch-Screen-Icon { + color: var(--docsearch-muted-color); + padding-bottom: 12px; +} +.DocSearch-NoResults-Prefill-List { + display: inline-block; + padding-bottom: 24px; + text-align: left; +} +.DocSearch-NoResults-Prefill-List ul { + display: inline-block; + padding: 8px 0 0; +} +.DocSearch-NoResults-Prefill-List li { + list-style-position: inside; + list-style-type: "» "; +} +.DocSearch-Prefill { + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + border: 0; + border-radius: 1em; + color: var(--docsearch-highlight-color); + cursor: pointer; + display: inline-block; + font-size: 1em; + font-weight: 700; + padding: 0; +} +.DocSearch-Prefill:focus, +.DocSearch-Prefill:hover { + outline: none; + text-decoration: underline; +} +.DocSearch-Footer { + align-items: center; + background: var(--docsearch-footer-background); + border-radius: 0 0 8px 8px; + box-shadow: var(--docsearch-footer-shadow); + display: flex; + flex-direction: row-reverse; + flex-shrink: 0; + height: var(--docsearch-footer-height); + justify-content: space-between; + padding: 0 var(--docsearch-spacing); + position: relative; + -webkit-user-select: none; + user-select: none; + width: 100%; + z-index: 300; +} +.DocSearch-Commands { + color: var(--docsearch-muted-color); + display: flex; + list-style: none; + margin: 0; + padding: 0; +} +.DocSearch-Commands li { + align-items: center; + display: flex; +} +.DocSearch-Commands li:not(:last-of-type) { + margin-right: 0.8em; +} +.DocSearch-Commands-Key { + align-items: center; + background: var(--docsearch-key-gradient); + border: 0; + border-radius: 2px; + box-shadow: var(--docsearch-key-shadow); + color: var(--docsearch-muted-color); + display: flex; + height: 18px; + justify-content: center; + margin-right: 0.4em; + padding: 0 0 1px; + width: 20px; +} +.DocSearch-VisuallyHiddenForAccessibility { + clip: rect(0 0 0 0); + clip-path: inset(50%); + height: 1px; + overflow: hidden; + position: absolute; + white-space: nowrap; + width: 1px; +} +@media (max-width: 768px) { + :root { + --docsearch-spacing: 10px; + --docsearch-footer-height: 40px; + } + .DocSearch-Dropdown { + height: 100%; + } + .DocSearch-Container { + height: 100vh; + height: -webkit-fill-available; + height: calc(var(--docsearch-vh, 1vh) * 100); + position: absolute; + } + .DocSearch-Footer { + border-radius: 0; + bottom: 0; + position: absolute; + } + .DocSearch-Hit-content-wrapper { + display: flex; + position: relative; + width: 80%; + } + .DocSearch-Modal { + border-radius: 0; + box-shadow: none; + height: 100vh; + height: -webkit-fill-available; + height: calc(var(--docsearch-vh, 1vh) * 100); + margin: 0; + max-width: 100%; + width: 100%; + } + .DocSearch-Dropdown { + max-height: calc( + var(--docsearch-vh, 1vh) * 100 - var(--docsearch-searchbox-height) - + var(--docsearch-spacing) - var(--docsearch-footer-height) + ); + } + .DocSearch-Cancel { + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + border: 0; + color: var(--docsearch-highlight-color); + cursor: pointer; + display: inline-block; + flex: none; + font: inherit; + font-size: 1em; + font-weight: 500; + margin-left: var(--docsearch-spacing); + outline: none; + overflow: hidden; + padding: 0; + -webkit-user-select: none; + user-select: none; + white-space: nowrap; + } + .DocSearch-Commands, + .DocSearch-Hit-Tree { + display: none; + } +} +@keyframes fade-in { + 0% { + opacity: 0; + } + to { + opacity: 1; + } +} +[class*="DocSearch"] { + --docsearch-primary-color: var(--vp-c-brand-1); + --docsearch-highlight-color: var(--docsearch-primary-color); + --docsearch-text-color: var(--vp-c-text-1); + --docsearch-muted-color: var(--vp-c-text-2); + --docsearch-searchbox-shadow: none; + --docsearch-searchbox-background: transparent; + --docsearch-searchbox-focus-background: transparent; + --docsearch-key-gradient: transparent; + --docsearch-key-shadow: none; + --docsearch-modal-background: var(--vp-c-bg-soft); + --docsearch-footer-background: var(--vp-c-bg); +} +.dark [class*="DocSearch"] { + --docsearch-modal-shadow: none; + --docsearch-footer-shadow: none; + --docsearch-logo-color: var(--vp-c-text-2); + --docsearch-hit-background: var(--vp-c-default-soft); + --docsearch-hit-color: var(--vp-c-text-2); + --docsearch-hit-shadow: none; +} +.DocSearch-Button { + display: flex; + justify-content: center; + align-items: center; + margin: 0; + padding: 0; + width: 48px; + height: 55px; + background: transparent; + transition: border-color 0.25s; +} +.DocSearch-Button:hover { + background: transparent; +} +.DocSearch-Button:focus { + outline: 1px dotted; + outline: 5px auto -webkit-focus-ring-color; +} +.DocSearch-Button-Key--pressed { + transform: none; + box-shadow: none; +} +.DocSearch-Button:focus:not(:focus-visible) { + outline: none !important; +} +@media (min-width: 768px) { + .DocSearch-Button { + justify-content: flex-start; + border: 1px solid transparent; + border-radius: 8px; + padding: 0 10px 0 12px; + width: 100%; + height: 40px; + background-color: var(--vp-c-bg-alt); + } + .DocSearch-Button:hover { + border-color: var(--vp-c-brand-1); + background: var(--vp-c-bg-alt); + } +} +.DocSearch-Button .DocSearch-Button-Container { + display: flex; + align-items: center; +} +.DocSearch-Button .DocSearch-Search-Icon { + position: relative; + width: 16px; + height: 16px; + color: var(--vp-c-text-1); + fill: currentColor; + transition: color 0.5s; +} +.DocSearch-Button:hover .DocSearch-Search-Icon { + color: var(--vp-c-text-1); +} +@media (min-width: 768px) { + .DocSearch-Button .DocSearch-Search-Icon { + top: 1px; + margin-right: 8px; + width: 14px; + height: 14px; + color: var(--vp-c-text-2); + } +} +.DocSearch-Button .DocSearch-Button-Placeholder { + display: none; + margin-top: 2px; + padding: 0 16px 0 0; + font-size: 13px; + font-weight: 500; + color: var(--vp-c-text-2); + transition: color 0.5s; +} +.DocSearch-Button:hover .DocSearch-Button-Placeholder { + color: var(--vp-c-text-1); +} +@media (min-width: 768px) { + .DocSearch-Button .DocSearch-Button-Placeholder { + display: inline-block; + } +} +.DocSearch-Button .DocSearch-Button-Keys { + direction: ltr; + display: none; + min-width: auto; +} +@media (min-width: 768px) { + .DocSearch-Button .DocSearch-Button-Keys { + display: flex; + align-items: center; + } +} +.DocSearch-Button .DocSearch-Button-Key { + display: block; + margin: 2px 0 0; + border: 1px solid var(--vp-c-divider); + border-right: none; + border-radius: 4px 0 0 4px; + padding-left: 6px; + min-width: 0; + width: auto; + height: 22px; + line-height: 22px; + font-family: var(--vp-font-family-base); + font-size: 12px; + font-weight: 500; + transition: + color 0.5s, + border-color 0.5s; +} +.DocSearch-Button .DocSearch-Button-Key + .DocSearch-Button-Key { + border-right: 1px solid var(--vp-c-divider); + border-left: none; + border-radius: 0 4px 4px 0; + padding-left: 2px; + padding-right: 6px; +} +.DocSearch-Button .DocSearch-Button-Key:first-child { + font-size: 0 !important; +} +.DocSearch-Button .DocSearch-Button-Key:first-child:after { + content: "Ctrl"; + font-size: 12px; + letter-spacing: normal; + color: var(--docsearch-muted-color); +} +.mac .DocSearch-Button .DocSearch-Button-Key:first-child:after { + content: "⌘"; +} +.DocSearch-Button .DocSearch-Button-Key:first-child > * { + display: none; +} +.DocSearch-Search-Icon { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' stroke-width='1.6' viewBox='0 0 20 20'%3E%3Cpath fill='none' stroke='currentColor' stroke-linecap='round' stroke-linejoin='round' d='m14.386 14.386 4.088 4.088-4.088-4.088A7.533 7.533 0 1 1 3.733 3.733a7.533 7.533 0 0 1 10.653 10.653z'/%3E%3C/svg%3E"); +} +.VPNavBarSearch { + display: flex; + align-items: center; +} +@media (min-width: 768px) { + .VPNavBarSearch { + flex-grow: 1; + padding-left: 24px; + } +} +@media (min-width: 960px) { + .VPNavBarSearch { + padding-left: 32px; + } +} +.dark .DocSearch-Footer { + border-top: 1px solid var(--vp-c-divider); +} +.DocSearch-Form { + border: 1px solid var(--vp-c-brand-1); + background-color: var(--vp-c-white); +} +.dark .DocSearch-Form { + background-color: var(--vp-c-default-soft); +} +.DocSearch-Screen-Icon > svg { + margin: auto; +} +.VPNavBarSocialLinks[data-v-0394ad82] { + display: none; +} +@media (min-width: 1280px) { + .VPNavBarSocialLinks[data-v-0394ad82] { + display: flex; + align-items: center; + } +} +.title[data-v-1168a8e4] { + display: flex; + align-items: center; + border-bottom: 1px solid transparent; + width: 100%; + height: var(--vp-nav-height); + font-size: 16px; + font-weight: 600; + color: var(--vp-c-text-1); + transition: opacity 0.25s; +} +@media (min-width: 960px) { + .title[data-v-1168a8e4] { + flex-shrink: 0; + } + .VPNavBarTitle.has-sidebar .title[data-v-1168a8e4] { + border-bottom-color: var(--vp-c-divider); + } +} +[data-v-1168a8e4] .logo { + margin-right: 8px; + height: var(--vp-nav-logo-height); +} +.VPNavBarTranslations[data-v-88af2de4] { + display: none; +} +@media (min-width: 1280px) { + .VPNavBarTranslations[data-v-88af2de4] { + display: flex; + align-items: center; + } +} +.title[data-v-88af2de4] { + padding: 0 24px 0 12px; + line-height: 32px; + font-size: 14px; + font-weight: 700; + color: var(--vp-c-text-1); +} +.VPNavBar[data-v-6aa21345] { + position: relative; + height: var(--vp-nav-height); + pointer-events: none; + white-space: nowrap; + transition: background-color 0.25s; +} +.VPNavBar.screen-open[data-v-6aa21345] { + transition: none; + background-color: var(--vp-nav-bg-color); + border-bottom: 1px solid var(--vp-c-divider); +} +.VPNavBar[data-v-6aa21345]:not(.home) { + background-color: var(--vp-nav-bg-color); +} +@media (min-width: 960px) { + .VPNavBar[data-v-6aa21345]:not(.home) { + background-color: transparent; + } + .VPNavBar[data-v-6aa21345]:not(.has-sidebar):not(.home.top) { + background-color: var(--vp-nav-bg-color); + } +} +.wrapper[data-v-6aa21345] { + padding: 0 8px 0 24px; +} +@media (min-width: 768px) { + .wrapper[data-v-6aa21345] { + padding: 0 32px; + } +} +@media (min-width: 960px) { + .VPNavBar.has-sidebar .wrapper[data-v-6aa21345] { + padding: 0; + } +} +.container[data-v-6aa21345] { + display: flex; + justify-content: space-between; + margin: 0 auto; + max-width: calc(var(--vp-layout-max-width) - 64px); + height: var(--vp-nav-height); + pointer-events: none; +} +.container > .title[data-v-6aa21345], +.container > .content[data-v-6aa21345] { + pointer-events: none; +} +.container[data-v-6aa21345] * { + pointer-events: auto; +} +@media (min-width: 960px) { + .VPNavBar.has-sidebar .container[data-v-6aa21345] { + max-width: 100%; + } +} +.title[data-v-6aa21345] { + flex-shrink: 0; + height: calc(var(--vp-nav-height) - 1px); + transition: background-color 0.5s; +} +@media (min-width: 960px) { + .VPNavBar.has-sidebar .title[data-v-6aa21345] { + position: absolute; + top: 0; + left: 0; + z-index: 2; + padding: 0 32px; + width: var(--vp-sidebar-width); + height: var(--vp-nav-height); + background-color: transparent; + } +} +@media (min-width: 1440px) { + .VPNavBar.has-sidebar .title[data-v-6aa21345] { + padding-left: max( + 32px, + calc((100% - (var(--vp-layout-max-width) - 64px)) / 2) + ); + width: calc( + (100% - (var(--vp-layout-max-width) - 64px)) / 2 + + var(--vp-sidebar-width) - 32px + ); + } +} +.content[data-v-6aa21345] { + flex-grow: 1; +} +@media (min-width: 960px) { + .VPNavBar.has-sidebar .content[data-v-6aa21345] { + position: relative; + z-index: 1; + padding-right: 32px; + padding-left: var(--vp-sidebar-width); + } +} +@media (min-width: 1440px) { + .VPNavBar.has-sidebar .content[data-v-6aa21345] { + padding-right: calc((100vw - var(--vp-layout-max-width)) / 2 + 32px); + padding-left: calc( + (100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width) + ); + } +} +.content-body[data-v-6aa21345] { + display: flex; + justify-content: flex-end; + align-items: center; + height: var(--vp-nav-height); + transition: background-color 0.5s; +} +@media (min-width: 960px) { + .VPNavBar:not(.home.top) .content-body[data-v-6aa21345] { + position: relative; + background-color: var(--vp-nav-bg-color); + } + .VPNavBar:not(.has-sidebar):not(.home.top) .content-body[data-v-6aa21345] { + background-color: transparent; + } +} +@media (max-width: 767px) { + .content-body[data-v-6aa21345] { + column-gap: 0.5rem; + } +} +.menu + .translations[data-v-6aa21345]:before, +.menu + .appearance[data-v-6aa21345]:before, +.menu + .social-links[data-v-6aa21345]:before, +.translations + .appearance[data-v-6aa21345]:before, +.appearance + .social-links[data-v-6aa21345]:before { + margin-right: 8px; + margin-left: 8px; + width: 1px; + height: 24px; + background-color: var(--vp-c-divider); + content: ""; +} +.menu + .appearance[data-v-6aa21345]:before, +.translations + .appearance[data-v-6aa21345]:before { + margin-right: 16px; +} +.appearance + .social-links[data-v-6aa21345]:before { + margin-left: 16px; +} +.social-links[data-v-6aa21345] { + margin-right: -8px; +} +.divider[data-v-6aa21345] { + width: 100%; + height: 1px; +} +@media (min-width: 960px) { + .VPNavBar.has-sidebar .divider[data-v-6aa21345] { + padding-left: var(--vp-sidebar-width); + } +} +@media (min-width: 1440px) { + .VPNavBar.has-sidebar .divider[data-v-6aa21345] { + padding-left: calc( + (100vw - var(--vp-layout-max-width)) / 2 + var(--vp-sidebar-width) + ); + } +} +.divider-line[data-v-6aa21345] { + width: 100%; + height: 1px; + transition: background-color 0.5s; +} +.VPNavBar:not(.home) .divider-line[data-v-6aa21345] { + background-color: var(--vp-c-gutter); +} +@media (min-width: 960px) { + .VPNavBar:not(.home.top) .divider-line[data-v-6aa21345] { + background-color: var(--vp-c-gutter); + } + .VPNavBar:not(.has-sidebar):not(.home.top) .divider[data-v-6aa21345] { + background-color: var(--vp-c-gutter); + } +} +.VPNavScreenAppearance[data-v-b44890b2] { + display: flex; + justify-content: space-between; + align-items: center; + border-radius: 8px; + padding: 12px 14px 12px 16px; + background-color: var(--vp-c-bg-soft); +} +.text[data-v-b44890b2] { + line-height: 24px; + font-size: 12px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.VPNavScreenMenuLink[data-v-df37e6dd] { + display: block; + border-bottom: 1px solid var(--vp-c-divider); + padding: 12px 0 11px; + line-height: 24px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-1); + transition: + border-color 0.25s, + color 0.25s; +} +.VPNavScreenMenuLink[data-v-df37e6dd]:hover { + color: var(--vp-c-brand-1); +} +.VPNavScreenMenuGroupLink[data-v-3e9c20e4] { + display: block; + margin-left: 12px; + line-height: 32px; + font-size: 14px; + font-weight: 400; + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.VPNavScreenMenuGroupLink[data-v-3e9c20e4]:hover { + color: var(--vp-c-brand-1); +} +.VPNavScreenMenuGroupSection[data-v-8133b170] { + display: block; +} +.title[data-v-8133b170] { + line-height: 32px; + font-size: 13px; + font-weight: 700; + color: var(--vp-c-text-2); + transition: color 0.25s; +} +.VPNavScreenMenuGroup[data-v-b9ab8c58] { + border-bottom: 1px solid var(--vp-c-divider); + height: 48px; + overflow: hidden; + transition: border-color 0.5s; +} +.VPNavScreenMenuGroup .items[data-v-b9ab8c58] { + visibility: hidden; +} +.VPNavScreenMenuGroup.open .items[data-v-b9ab8c58] { + visibility: visible; +} +.VPNavScreenMenuGroup.open[data-v-b9ab8c58] { + padding-bottom: 10px; + height: auto; +} +.VPNavScreenMenuGroup.open .button[data-v-b9ab8c58] { + padding-bottom: 6px; + color: var(--vp-c-brand-1); +} +.VPNavScreenMenuGroup.open .button-icon[data-v-b9ab8c58] { + transform: rotate(45deg); +} +.button[data-v-b9ab8c58] { + display: flex; + justify-content: space-between; + align-items: center; + padding: 12px 4px 11px 0; + width: 100%; + line-height: 24px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-1); + transition: color 0.25s; +} +.button[data-v-b9ab8c58]:hover { + color: var(--vp-c-brand-1); +} +.button-icon[data-v-b9ab8c58] { + transition: transform 0.25s; +} +.group[data-v-b9ab8c58]:first-child { + padding-top: 0; +} +.group + .group[data-v-b9ab8c58], +.group + .item[data-v-b9ab8c58] { + padding-top: 4px; +} +.VPNavScreenTranslations[data-v-858fe1a4] { + height: 24px; + overflow: hidden; +} +.VPNavScreenTranslations.open[data-v-858fe1a4] { + height: auto; +} +.title[data-v-858fe1a4] { + display: flex; + align-items: center; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-text-1); +} +.icon[data-v-858fe1a4] { + font-size: 16px; +} +.icon.lang[data-v-858fe1a4] { + margin-right: 8px; +} +.icon.chevron[data-v-858fe1a4] { + margin-left: 4px; +} +.list[data-v-858fe1a4] { + padding: 4px 0 0 24px; +} +.link[data-v-858fe1a4] { + line-height: 32px; + font-size: 13px; + color: var(--vp-c-text-1); +} +.VPNavScreen[data-v-f2779853] { + position: fixed; + top: calc(var(--vp-nav-height) + var(--vp-layout-top-height, 0px)); + right: 0; + bottom: 0; + left: 0; + padding: 0 32px; + width: 100%; + background-color: var(--vp-nav-screen-bg-color); + overflow-y: auto; + transition: background-color 0.25s; + pointer-events: auto; +} +.VPNavScreen.fade-enter-active[data-v-f2779853], +.VPNavScreen.fade-leave-active[data-v-f2779853] { + transition: opacity 0.25s; +} +.VPNavScreen.fade-enter-active .container[data-v-f2779853], +.VPNavScreen.fade-leave-active .container[data-v-f2779853] { + transition: transform 0.25s ease; +} +.VPNavScreen.fade-enter-from[data-v-f2779853], +.VPNavScreen.fade-leave-to[data-v-f2779853] { + opacity: 0; +} +.VPNavScreen.fade-enter-from .container[data-v-f2779853], +.VPNavScreen.fade-leave-to .container[data-v-f2779853] { + transform: translateY(-8px); +} +@media (min-width: 768px) { + .VPNavScreen[data-v-f2779853] { + display: none; + } +} +.container[data-v-f2779853] { + margin: 0 auto; + padding: 24px 0 96px; + max-width: 288px; +} +.menu + .translations[data-v-f2779853], +.menu + .appearance[data-v-f2779853], +.translations + .appearance[data-v-f2779853] { + margin-top: 24px; +} +.menu + .social-links[data-v-f2779853] { + margin-top: 16px; +} +.appearance + .social-links[data-v-f2779853] { + margin-top: 16px; +} +.VPNav[data-v-ae24b3ad] { + position: relative; + top: var(--vp-layout-top-height, 0px); + left: 0; + z-index: var(--vp-z-index-nav); + width: 100%; + pointer-events: none; + transition: background-color 0.5s; +} +@media (min-width: 960px) { + .VPNav[data-v-ae24b3ad] { + position: fixed; + } +} +.VPSidebarItem.level-0[data-v-b3fd67f8] { + padding-bottom: 24px; +} +.VPSidebarItem.collapsed.level-0[data-v-b3fd67f8] { + padding-bottom: 10px; +} +.item[data-v-b3fd67f8] { + position: relative; + display: flex; + width: 100%; +} +.VPSidebarItem.collapsible > .item[data-v-b3fd67f8] { + cursor: pointer; +} +.indicator[data-v-b3fd67f8] { + position: absolute; + top: 6px; + bottom: 6px; + left: -17px; + width: 2px; + border-radius: 2px; + transition: background-color 0.25s; +} +.VPSidebarItem.level-2.is-active > .item > .indicator[data-v-b3fd67f8], +.VPSidebarItem.level-3.is-active > .item > .indicator[data-v-b3fd67f8], +.VPSidebarItem.level-4.is-active > .item > .indicator[data-v-b3fd67f8], +.VPSidebarItem.level-5.is-active > .item > .indicator[data-v-b3fd67f8] { + background-color: var(--vp-c-brand-1); +} +.link[data-v-b3fd67f8] { + display: flex; + align-items: center; + flex-grow: 1; +} +.text[data-v-b3fd67f8] { + flex-grow: 1; + padding: 4px 0; + line-height: 24px; + font-size: 14px; + transition: color 0.25s; +} +.VPSidebarItem.level-0 .text[data-v-b3fd67f8] { + font-weight: 700; + color: var(--vp-c-text-1); +} +.VPSidebarItem.level-1 .text[data-v-b3fd67f8], +.VPSidebarItem.level-2 .text[data-v-b3fd67f8], +.VPSidebarItem.level-3 .text[data-v-b3fd67f8], +.VPSidebarItem.level-4 .text[data-v-b3fd67f8], +.VPSidebarItem.level-5 .text[data-v-b3fd67f8] { + font-weight: 500; + color: var(--vp-c-text-2); +} +.VPSidebarItem.level-0.is-link > .item > .link:hover .text[data-v-b3fd67f8], +.VPSidebarItem.level-1.is-link > .item > .link:hover .text[data-v-b3fd67f8], +.VPSidebarItem.level-2.is-link > .item > .link:hover .text[data-v-b3fd67f8], +.VPSidebarItem.level-3.is-link > .item > .link:hover .text[data-v-b3fd67f8], +.VPSidebarItem.level-4.is-link > .item > .link:hover .text[data-v-b3fd67f8], +.VPSidebarItem.level-5.is-link > .item > .link:hover .text[data-v-b3fd67f8] { + color: var(--vp-c-brand-1); +} +.VPSidebarItem.level-0.has-active > .item > .text[data-v-b3fd67f8], +.VPSidebarItem.level-1.has-active > .item > .text[data-v-b3fd67f8], +.VPSidebarItem.level-2.has-active > .item > .text[data-v-b3fd67f8], +.VPSidebarItem.level-3.has-active > .item > .text[data-v-b3fd67f8], +.VPSidebarItem.level-4.has-active > .item > .text[data-v-b3fd67f8], +.VPSidebarItem.level-5.has-active > .item > .text[data-v-b3fd67f8], +.VPSidebarItem.level-0.has-active > .item > .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-1.has-active > .item > .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-2.has-active > .item > .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-3.has-active > .item > .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-4.has-active > .item > .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-5.has-active > .item > .link > .text[data-v-b3fd67f8] { + color: var(--vp-c-text-1); +} +.VPSidebarItem.level-0.is-active > .item .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-1.is-active > .item .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-2.is-active > .item .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-3.is-active > .item .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-4.is-active > .item .link > .text[data-v-b3fd67f8], +.VPSidebarItem.level-5.is-active > .item .link > .text[data-v-b3fd67f8] { + color: var(--vp-c-brand-1); +} +.caret[data-v-b3fd67f8] { + display: flex; + justify-content: center; + align-items: center; + margin-right: -7px; + width: 32px; + height: 32px; + color: var(--vp-c-text-3); + cursor: pointer; + transition: color 0.25s; + flex-shrink: 0; +} +.item:hover .caret[data-v-b3fd67f8] { + color: var(--vp-c-text-2); +} +.item:hover .caret[data-v-b3fd67f8]:hover { + color: var(--vp-c-text-1); +} +.caret-icon[data-v-b3fd67f8] { + font-size: 18px; + transform: rotate(90deg); + transition: transform 0.25s; +} +.VPSidebarItem.collapsed .caret-icon[data-v-b3fd67f8] { + transform: rotate(0); +} +.VPSidebarItem.level-1 .items[data-v-b3fd67f8], +.VPSidebarItem.level-2 .items[data-v-b3fd67f8], +.VPSidebarItem.level-3 .items[data-v-b3fd67f8], +.VPSidebarItem.level-4 .items[data-v-b3fd67f8], +.VPSidebarItem.level-5 .items[data-v-b3fd67f8] { + border-left: 1px solid var(--vp-c-divider); + padding-left: 16px; +} +.VPSidebarItem.collapsed .items[data-v-b3fd67f8] { + display: none; +} +.no-transition[data-v-c40bc020] .caret-icon { + transition: none; +} +.group + .group[data-v-c40bc020] { + border-top: 1px solid var(--vp-c-divider); + padding-top: 10px; +} +@media (min-width: 960px) { + .group[data-v-c40bc020] { + padding-top: 10px; + width: calc(var(--vp-sidebar-width) - 64px); + } +} +.VPSidebar[data-v-319d5ca6] { + position: fixed; + top: var(--vp-layout-top-height, 0px); + bottom: 0; + left: 0; + z-index: var(--vp-z-index-sidebar); + padding: 32px 32px 96px; + width: calc(100vw - 64px); + max-width: 320px; + background-color: var(--vp-sidebar-bg-color); + opacity: 0; + box-shadow: var(--vp-c-shadow-3); + overflow-x: hidden; + overflow-y: auto; + transform: translate(-100%); + transition: + opacity 0.5s, + transform 0.25s ease; + overscroll-behavior: contain; +} +.VPSidebar.open[data-v-319d5ca6] { + opacity: 1; + visibility: visible; + transform: translate(0); + transition: + opacity 0.25s, + transform 0.5s cubic-bezier(0.19, 1, 0.22, 1); +} +.dark .VPSidebar[data-v-319d5ca6] { + box-shadow: var(--vp-shadow-1); +} +@media (min-width: 960px) { + .VPSidebar[data-v-319d5ca6] { + padding-top: var(--vp-nav-height); + width: var(--vp-sidebar-width); + max-width: 100%; + background-color: var(--vp-sidebar-bg-color); + opacity: 1; + visibility: visible; + box-shadow: none; + transform: translate(0); + } +} +@media (min-width: 1440px) { + .VPSidebar[data-v-319d5ca6] { + padding-left: max( + 32px, + calc((100% - (var(--vp-layout-max-width) - 64px)) / 2) + ); + width: calc( + (100% - (var(--vp-layout-max-width) - 64px)) / 2 + + var(--vp-sidebar-width) - 32px + ); + } +} +@media (min-width: 960px) { + .curtain[data-v-319d5ca6] { + position: sticky; + top: -64px; + left: 0; + z-index: 1; + margin-top: calc(var(--vp-nav-height) * -1); + margin-right: -32px; + margin-left: -32px; + height: var(--vp-nav-height); + background-color: var(--vp-sidebar-bg-color); + } +} +.nav[data-v-319d5ca6] { + outline: 0; +} +.VPSkipLink[data-v-0b0ada53] { + top: 8px; + left: 8px; + padding: 8px 16px; + z-index: 999; + border-radius: 8px; + font-size: 12px; + font-weight: 700; + text-decoration: none; + color: var(--vp-c-brand-1); + box-shadow: var(--vp-shadow-3); + background-color: var(--vp-c-bg); +} +.VPSkipLink[data-v-0b0ada53]:focus { + height: auto; + width: auto; + clip: auto; + clip-path: none; +} +@media (min-width: 1280px) { + .VPSkipLink[data-v-0b0ada53] { + top: 14px; + left: 16px; + } +} +.Layout[data-v-5d98c3a5] { + display: flex; + flex-direction: column; + min-height: 100vh; +} +.VPHomeSponsors[data-v-3d121b4a] { + border-top: 1px solid var(--vp-c-gutter); + padding-top: 88px !important; +} +.VPHomeSponsors[data-v-3d121b4a] { + margin: 96px 0; +} +@media (min-width: 768px) { + .VPHomeSponsors[data-v-3d121b4a] { + margin: 128px 0; + } +} +.VPHomeSponsors[data-v-3d121b4a] { + padding: 0 24px; +} +@media (min-width: 768px) { + .VPHomeSponsors[data-v-3d121b4a] { + padding: 0 48px; + } +} +@media (min-width: 960px) { + .VPHomeSponsors[data-v-3d121b4a] { + padding: 0 64px; + } +} +.container[data-v-3d121b4a] { + margin: 0 auto; + max-width: 1152px; +} +.love[data-v-3d121b4a] { + margin: 0 auto; + width: fit-content; + font-size: 28px; + color: var(--vp-c-text-3); +} +.icon[data-v-3d121b4a] { + display: inline-block; +} +.message[data-v-3d121b4a] { + margin: 0 auto; + padding-top: 10px; + max-width: 320px; + text-align: center; + line-height: 24px; + font-size: 16px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.sponsors[data-v-3d121b4a] { + padding-top: 32px; +} +.action[data-v-3d121b4a] { + padding-top: 40px; + text-align: center; +} +.VPTeamMembersItem[data-v-f3fa364a] { + display: flex; + flex-direction: column; + gap: 2px; + border-radius: 12px; + width: 100%; + height: 100%; + overflow: hidden; +} +.VPTeamMembersItem.small .profile[data-v-f3fa364a] { + padding: 32px; +} +.VPTeamMembersItem.small .data[data-v-f3fa364a] { + padding-top: 20px; +} +.VPTeamMembersItem.small .avatar[data-v-f3fa364a] { + width: 64px; + height: 64px; +} +.VPTeamMembersItem.small .name[data-v-f3fa364a] { + line-height: 24px; + font-size: 16px; +} +.VPTeamMembersItem.small .affiliation[data-v-f3fa364a] { + padding-top: 4px; + line-height: 20px; + font-size: 14px; +} +.VPTeamMembersItem.small .desc[data-v-f3fa364a] { + padding-top: 12px; + line-height: 20px; + font-size: 14px; +} +.VPTeamMembersItem.small .links[data-v-f3fa364a] { + margin: 0 -16px -20px; + padding: 10px 0 0; +} +.VPTeamMembersItem.medium .profile[data-v-f3fa364a] { + padding: 48px 32px; +} +.VPTeamMembersItem.medium .data[data-v-f3fa364a] { + padding-top: 24px; + text-align: center; +} +.VPTeamMembersItem.medium .avatar[data-v-f3fa364a] { + width: 96px; + height: 96px; +} +.VPTeamMembersItem.medium .name[data-v-f3fa364a] { + letter-spacing: 0.15px; + line-height: 28px; + font-size: 20px; +} +.VPTeamMembersItem.medium .affiliation[data-v-f3fa364a] { + padding-top: 4px; + font-size: 16px; +} +.VPTeamMembersItem.medium .desc[data-v-f3fa364a] { + padding-top: 16px; + max-width: 288px; + font-size: 16px; +} +.VPTeamMembersItem.medium .links[data-v-f3fa364a] { + margin: 0 -16px -12px; + padding: 16px 12px 0; +} +.profile[data-v-f3fa364a] { + flex-grow: 1; + background-color: var(--vp-c-bg-soft); +} +.data[data-v-f3fa364a] { + text-align: center; +} +.avatar[data-v-f3fa364a] { + position: relative; + flex-shrink: 0; + margin: 0 auto; + border-radius: 50%; + box-shadow: var(--vp-shadow-3); +} +.avatar-img[data-v-f3fa364a] { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + border-radius: 50%; + object-fit: cover; +} +.name[data-v-f3fa364a] { + margin: 0; + font-weight: 600; +} +.affiliation[data-v-f3fa364a] { + margin: 0; + font-weight: 500; + color: var(--vp-c-text-2); +} +.org.link[data-v-f3fa364a] { + color: var(--vp-c-text-2); + transition: color 0.25s; +} +.org.link[data-v-f3fa364a]:hover { + color: var(--vp-c-brand-1); +} +.desc[data-v-f3fa364a] { + margin: 0 auto; +} +.desc[data-v-f3fa364a] a { + font-weight: 500; + color: var(--vp-c-brand-1); + text-decoration-style: dotted; + transition: color 0.25s; +} +.links[data-v-f3fa364a] { + display: flex; + justify-content: center; + height: 56px; +} +.sp-link[data-v-f3fa364a] { + display: flex; + justify-content: center; + align-items: center; + text-align: center; + padding: 16px; + font-size: 14px; + font-weight: 500; + color: var(--vp-c-sponsor); + background-color: var(--vp-c-bg-soft); + transition: + color 0.25s, + background-color 0.25s; +} +.sp .sp-link.link[data-v-f3fa364a]:hover, +.sp .sp-link.link[data-v-f3fa364a]:focus { + outline: none; + color: var(--vp-c-white); + background-color: var(--vp-c-sponsor); +} +.sp-icon[data-v-f3fa364a] { + margin-right: 8px; + font-size: 16px; +} +.VPTeamMembers.small .container[data-v-6cb0dbc4] { + grid-template-columns: repeat(auto-fit, minmax(224px, 1fr)); +} +.VPTeamMembers.small.count-1 .container[data-v-6cb0dbc4] { + max-width: 276px; +} +.VPTeamMembers.small.count-2 .container[data-v-6cb0dbc4] { + max-width: 576px; +} +.VPTeamMembers.small.count-3 .container[data-v-6cb0dbc4] { + max-width: 876px; +} +.VPTeamMembers.medium .container[data-v-6cb0dbc4] { + grid-template-columns: repeat(auto-fit, minmax(256px, 1fr)); +} +@media (min-width: 375px) { + .VPTeamMembers.medium .container[data-v-6cb0dbc4] { + grid-template-columns: repeat(auto-fit, minmax(288px, 1fr)); + } +} +.VPTeamMembers.medium.count-1 .container[data-v-6cb0dbc4] { + max-width: 368px; +} +.VPTeamMembers.medium.count-2 .container[data-v-6cb0dbc4] { + max-width: 760px; +} +.container[data-v-6cb0dbc4] { + display: grid; + gap: 24px; + margin: 0 auto; + max-width: 1152px; +} +.VPTeamPage[data-v-7c57f839] { + margin: 96px 0; +} +@media (min-width: 768px) { + .VPTeamPage[data-v-7c57f839] { + margin: 128px 0; + } +} +.VPHome .VPTeamPageTitle[data-v-7c57f839-s] { + border-top: 1px solid var(--vp-c-gutter); + padding-top: 88px !important; +} +.VPTeamPageSection + .VPTeamPageSection[data-v-7c57f839-s], +.VPTeamMembers + .VPTeamPageSection[data-v-7c57f839-s] { + margin-top: 64px; +} +.VPTeamMembers + .VPTeamMembers[data-v-7c57f839-s] { + margin-top: 24px; +} +@media (min-width: 768px) { + .VPTeamPageTitle + .VPTeamPageSection[data-v-7c57f839-s] { + margin-top: 16px; + } + .VPTeamPageSection + .VPTeamPageSection[data-v-7c57f839-s], + .VPTeamMembers + .VPTeamPageSection[data-v-7c57f839-s] { + margin-top: 96px; + } +} +.VPTeamMembers[data-v-7c57f839-s] { + padding: 0 24px; +} +@media (min-width: 768px) { + .VPTeamMembers[data-v-7c57f839-s] { + padding: 0 48px; + } +} +@media (min-width: 960px) { + .VPTeamMembers[data-v-7c57f839-s] { + padding: 0 64px; + } +} +.VPTeamPageSection[data-v-b1a88750] { + padding: 0 32px; +} +@media (min-width: 768px) { + .VPTeamPageSection[data-v-b1a88750] { + padding: 0 48px; + } +} +@media (min-width: 960px) { + .VPTeamPageSection[data-v-b1a88750] { + padding: 0 64px; + } +} +.title[data-v-b1a88750] { + position: relative; + margin: 0 auto; + max-width: 1152px; + text-align: center; + color: var(--vp-c-text-2); +} +.title-line[data-v-b1a88750] { + position: absolute; + top: 16px; + left: 0; + width: 100%; + height: 1px; + background-color: var(--vp-c-divider); +} +.title-text[data-v-b1a88750] { + position: relative; + display: inline-block; + padding: 0 24px; + letter-spacing: 0; + line-height: 32px; + font-size: 20px; + font-weight: 500; + background-color: var(--vp-c-bg); +} +.lead[data-v-b1a88750] { + margin: 0 auto; + max-width: 480px; + padding-top: 12px; + text-align: center; + line-height: 24px; + font-size: 16px; + font-weight: 500; + color: var(--vp-c-text-2); +} +.members[data-v-b1a88750] { + padding-top: 40px; +} +.VPTeamPageTitle[data-v-bf2cbdac] { + padding: 48px 32px; + text-align: center; +} +@media (min-width: 768px) { + .VPTeamPageTitle[data-v-bf2cbdac] { + padding: 64px 48px 48px; + } +} +@media (min-width: 960px) { + .VPTeamPageTitle[data-v-bf2cbdac] { + padding: 80px 64px 48px; + } +} +.title[data-v-bf2cbdac] { + letter-spacing: 0; + line-height: 44px; + font-size: 36px; + font-weight: 500; +} +@media (min-width: 768px) { + .title[data-v-bf2cbdac] { + letter-spacing: -0.5px; + line-height: 56px; + font-size: 48px; + } +} +.lead[data-v-bf2cbdac] { + margin: 0 auto; + max-width: 512px; + padding-top: 12px; + line-height: 24px; + font-size: 16px; + font-weight: 500; + color: var(--vp-c-text-2); +} +@media (min-width: 768px) { + .lead[data-v-bf2cbdac] { + max-width: 592px; + letter-spacing: 0.15px; + line-height: 28px; + font-size: 20px; + } +} diff --git a/public/docs/hashmap.json b/public/docs/hashmap.json index 441f0d2..b8ad43f 100644 --- a/public/docs/hashmap.json +++ b/public/docs/hashmap.json @@ -1 +1,5 @@ -{"api-examples.md":"B5cbNgMl","index.md":"ZzqtzDg7","markdown-examples.md":"OYFiuX35"} +{ + "api-examples.md": "B5cbNgMl", + "index.md": "ZzqtzDg7", + "markdown-examples.md": "OYFiuX35" +} diff --git a/public/docs/index.html b/public/docs/index.html index e41688b..bbc16b4 100644 --- a/public/docs/index.html +++ b/public/docs/index.html @@ -1,25 +1,397 @@ - + - - + + News Analzye Docs - - - - - + + + + + - - - - - - + + + + + + -
News Analzye Docs

Appearance

News Analzye DocsThe documentation for news analyze the project.

My great project tagline

Markdown Examples
API Examples

Feature A

Lorem ipsum dolor sit amet, consectetur adipiscing elit

Feature B

Lorem ipsum dolor sit amet, consectetur adipiscing elit

Feature C

Lorem ipsum dolor sit amet, consectetur adipiscing elit

- - +
+
+ +
+
+
+
+
+
+ News Analzye Docs +
+
+
+
+ +
+ +
+ + +
+ +
+ +
+ +
+
+ +
+
+

Appearance

+
+ +
+
+
+
+ +
+ +
+
+
+ +
+
+
+
+
+
+
+
+ +
+ +
+
+ +
+
+
+ +

+ News Analzye DocsThe documentation for news analyze the project. +

+

+ My great project tagline +

+ +
+ +
+ Markdown Examples +
+
+ API Examples +
+ +
+ +
+ +
+
+ +
+
+
+ +
+
+ +
+ +

Feature A

+

+ Lorem ipsum dolor sit amet, consectetur adipiscing + elit +

+ +
+ +
+
+
+
+ +
+ +

Feature B

+

+ Lorem ipsum dolor sit amet, consectetur adipiscing + elit +

+ +
+ +
+
+
+
+ +
+ +

Feature C

+

+ Lorem ipsum dolor sit amet, consectetur adipiscing + elit +

+ +
+ +
+
+ +
+
+
+ +
+ +
+ +
+
+
+ +
+
+ - \ No newline at end of file + diff --git a/public/docs/markdown-examples.html b/public/docs/markdown-examples.html index 0a36309..a070e64 100644 --- a/public/docs/markdown-examples.html +++ b/public/docs/markdown-examples.html @@ -1,24 +1,459 @@ - + - - + + Markdown Extension Examples | News Analzye Docs - - - - - + + + + + - - - - - - + + + + + + -
News Analzye Docs

Appearance

Markdown Extension Examples ​

This page demonstrates some of the built-in markdown extensions provided by VitePress.

Syntax Highlighting ​

VitePress provides Syntax Highlighting powered by Shiki, with additional features like line-highlighting:

Input

md
```js{4}
+    

+      

+        
+        

+          

+            

+              

+                

+                  

+                    News Analzye Docs
+                  

+                

+                

+                  

+                    
+                    

+                      
+                    

+                    
+                    
+                    

+                      
+                    

+                    
+                    

+                      
+                      

+                        

+                          
+                          

+                            

+                              
Appearance

+                              

+                                
+                              

+                            

+                          

+                          

+                            
+                          

+                          
+                        

+                      

+                    

+                    
+                  

+                

+              

+            

+            

+              

+            

+          

+          
+        

+        

+          

+            
+            

+              
+            

+          

+        

+        
+        

+          

+            
+            

+              

+                

+                

+                  

+                    

+                      
+                      
+                      
+                      

+                      
+                    

+                  

+                

+              

+              

+                

+                  
+                  

+                    

+                      

+                        

+                          Markdown Extension Examples
+                          ​
+                        

+                        

+                          This page demonstrates some of the built-in markdown
+                          extensions provided by VitePress.
+                        

+                        

+                          Syntax Highlighting
+                          ​
+                        

+                        

+                          VitePress provides Syntax Highlighting powered by
+                          Shiki, with additional features like line-highlighting:
+                        

+                        
Input

+                        

+                          md
+                          
```js{4}
 export default {
   data () {
     return {
@@ -26,13 +461,40 @@
     }
   }
 }
-```
Output
js
export default {
+```

+                        

+                        
Output

+                        

+                          js
+                          
export default {
   data () {
     return {
       msg: 'Highlighted!'
     }
   }
-}
Custom Containers ​
Input
md
::: info
+}

+                        

+                        

+                          Custom Containers
+                          ​
+                        

+                        
Input

+                        

+                          md
+                          
::: info
 This is an info box.
 :::
 
@@ -50,8 +512,95 @@
 
 ::: details
 This is a details block.
-:::
Output
INFO
This is an info box.
TIP
This is a tip.
WARNING
This is a warning.
DANGER
This is a dangerous warning.
Details
This is a details block.
More ​
Check out the documentation for the full list of markdown extensions.

-    
-    
+:::
+
+

Output

+
+

INFO

+

This is an info box.

+
+
+

TIP

+

This is a tip.

+
+
+

WARNING

+

This is a warning.

+
+
+

DANGER

+

This is a dangerous warning.

+
+
+ Details +

This is a details block.

+
+

+ More + ​ +

+

+ Check out the documentation for the + full list of markdown extensions. +

+
+
+
+ + +
+
+
+ +
+
+ +
+
+ - \ No newline at end of file + diff --git a/public/docs/vp-icons.css b/public/docs/vp-icons.css index ddc5bd8..e8489f0 100644 --- a/public/docs/vp-icons.css +++ b/public/docs/vp-icons.css @@ -1 +1,3 @@ -.vpi-social-github{--icon:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' width='24' height='24'%3E%3Cpath fill='black' d='M12 .297c-6.63 0-12 5.373-12 12c0 5.303 3.438 9.8 8.205 11.385c.6.113.82-.258.82-.577c0-.285-.01-1.04-.015-2.04c-3.338.724-4.042-1.61-4.042-1.61C4.422 18.07 3.633 17.7 3.633 17.7c-1.087-.744.084-.729.084-.729c1.205.084 1.838 1.236 1.838 1.236c1.07 1.835 2.809 1.305 3.495.998c.108-.776.417-1.305.76-1.605c-2.665-.3-5.466-1.332-5.466-5.93c0-1.31.465-2.38 1.235-3.22c-.135-.303-.54-1.523.105-3.176c0 0 1.005-.322 3.3 1.23c.96-.267 1.98-.399 3-.405c1.02.006 2.04.138 3 .405c2.28-1.552 3.285-1.23 3.285-1.23c.645 1.653.24 2.873.12 3.176c.765.84 1.23 1.91 1.23 3.22c0 4.61-2.805 5.625-5.475 5.92c.42.36.81 1.096.81 2.22c0 1.606-.015 2.896-.015 3.286c0 .315.21.69.825.57C20.565 22.092 24 17.592 24 12.297c0-6.627-5.373-12-12-12'/%3E%3C/svg%3E")} \ No newline at end of file +.vpi-social-github { + --icon: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' width='24' height='24'%3E%3Cpath fill='black' d='M12 .297c-6.63 0-12 5.373-12 12c0 5.303 3.438 9.8 8.205 11.385c.6.113.82-.258.82-.577c0-.285-.01-1.04-.015-2.04c-3.338.724-4.042-1.61-4.042-1.61C4.422 18.07 3.633 17.7 3.633 17.7c-1.087-.744.084-.729.084-.729c1.205.084 1.838 1.236 1.838 1.236c1.07 1.835 2.809 1.305 3.495.998c.108-.776.417-1.305.76-1.605c-2.665-.3-5.466-1.332-5.466-5.93c0-1.31.465-2.38 1.235-3.22c-.135-.303-.54-1.523.105-3.176c0 0 1.005-.322 3.3 1.23c.96-.267 1.98-.399 3-.405c1.02.006 2.04.138 3 .405c2.28-1.552 3.285-1.23 3.285-1.23c.645 1.653.24 2.873.12 3.176c.765.84 1.23 1.91 1.23 3.22c0 4.61-2.805 5.625-5.475 5.92c.42.36.81 1.096.81 2.22c0 1.606-.015 2.896-.015 3.286c0 .315.21.69.825.57C20.565 22.092 24 17.592 24 12.297c0-6.627-5.373-12-12-12'/%3E%3C/svg%3E"); +}